<!DOCTYPE html>
<!-- saved from url=(0130)https://selbsttest.ktn.gv.at/validierung?id=VGI5VkplbSs5MFFLZ0lpTXh2UFVrMkVBWDlZczJaOTZ3ZTN0Y2wrTkRIMjk1YVE5Ui8zeXpMcm1leHp0bUhsTA -->
<html lang="en">
<head>
<meta http-equiv="Content-Type" content="text/html; charset=UTF-8">
<meta name="viewport" content="width=device-width, initial-scale=1.0">
<title>Befund Validierung - CovidBefundValidierung</title>
<link rel="shortcut icon" href="https://selbsttest.ktn.gv.at/validierung/favicon.ico">
<style>
/*!
* Bootstrap v4.3.1 (https://getbootstrap.com/)
* Copyright 2011-2019 The Bootstrap Authors
* Copyright 2011-2019 Twitter, Inc.
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
*/
:root {
--blue: #007bff;
--indigo: #6610f2;
--purple: #6f42c1;
--pink: #e83e8c;
--red: #dc3545;
--orange: #fd7e14;
--yellow: #ffc107;
--green: #28a745;
--teal: #20c997;
--cyan: #17a2b8;
--white: #fff;
--gray: #6c757d;
--gray-dark: #343a40;
--primary: #007bff;
--secondary: #6c757d;
--success: #28a745;
--info: #17a2b8;
--warning: #ffc107;
--danger: #dc3545;
--light: #f8f9fa;
--dark: #343a40;
--breakpoint-xs: 0;
--breakpoint-sm: 576px;
--breakpoint-md: 768px;
--breakpoint-lg: 992px;
--breakpoint-xl: 1200px;
--font-family-sans-serif: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
--font-family-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace
}
*,
::after,
::before {
box-sizing: border-box
}
html {
font-family: sans-serif;
line-height: 1.15;
-webkit-text-size-adjust: 100%;
-webkit-tap-highlight-color: transparent
}
article,
aside,
figcaption,
figure,
footer,
header,
hgroup,
main,
nav,
section {
display: block
}
body {
margin: 0;
font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
font-size: 1rem;
font-weight: 400;
line-height: 1.5;
color: #212529;
text-align: left;
background-color: #fff
}
[tabindex="-1"]:focus {
outline: 0 !important
}
hr {
box-sizing: content-box;
height: 0;
overflow: visible
}
h1,
h2,
h3,
h4,
h5,
h6 {
margin-top: 0;
margin-bottom: .5rem
}
p {
margin-top: 0;
margin-bottom: 1rem
}
abbr[data-original-title],
abbr[title] {
text-decoration: underline;
-webkit-text-decoration: underline dotted;
text-decoration: underline dotted;
cursor: help;
border-bottom: 0;
-webkit-text-decoration-skip-ink: none;
text-decoration-skip-ink: none
}
address {
margin-bottom: 1rem;
font-style: normal;
line-height: inherit
}
dl,
ol,
ul {
margin-top: 0;
margin-bottom: 1rem
}
ol ol,
ol ul,
ul ol,
ul ul {
margin-bottom: 0
}
dt {
font-weight: 700
}
dd {
margin-bottom: .5rem;
margin-left: 0
}
blockquote {
margin: 0 0 1rem
}
b,
strong {
font-weight: bolder
}
small {
font-size: 80%
}
sub,
sup {
position: relative;
font-size: 75%;
line-height: 0;
vertical-align: baseline
}
sub {
bottom: -.25em
}
sup {
top: -.5em
}
a {
color: #007bff;
text-decoration: none;
background-color: transparent
}
a:hover {
color: #0056b3;
text-decoration: underline
}
a:not([href]):not([tabindex]) {
color: inherit;
text-decoration: none
}
a:not([href]):not([tabindex]):focus,
a:not([href]):not([tabindex]):hover {
color: inherit;
text-decoration: none
}
a:not([href]):not([tabindex]):focus {
outline: 0
}
code,
kbd,
pre,
samp {
font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
font-size: 1em
}
pre {
margin-top: 0;
margin-bottom: 1rem;
overflow: auto
}
figure {
margin: 0 0 1rem
}
img {
vertical-align: middle;
border-style: none
}
svg {
overflow: hidden;
vertical-align: middle
}
table {
border-collapse: collapse
}
caption {
padding-top: .75rem;
padding-bottom: .75rem;
color: #6c757d;
text-align: left;
caption-side: bottom
}
th {
text-align: inherit
}
label {
display: inline-block;
margin-bottom: .5rem
}
button {
border-radius: 0
}
button:focus {
outline: 1px dotted;
outline: 5px auto -webkit-focus-ring-color
}
button,
input,
optgroup,
select,
textarea {
margin: 0;
font-family: inherit;
font-size: inherit;
line-height: inherit
}
button,
input {
overflow: visible
}
button,
select {
text-transform: none
}
select {
word-wrap: normal
}
[type=button],
[type=reset],
[type=submit],
button {
-webkit-appearance: button
}
[type=button]:not(:disabled),
[type=reset]:not(:disabled),
[type=submit]:not(:disabled),
button:not(:disabled) {
cursor: pointer
}
[type=button]::-moz-focus-inner,
[type=reset]::-moz-focus-inner,
[type=submit]::-moz-focus-inner,
button::-moz-focus-inner {
padding: 0;
border-style: none
}
input[type=checkbox],
input[type=radio] {
box-sizing: border-box;
padding: 0
}
input[type=date],
input[type=datetime-local],
input[type=month],
input[type=time] {
-webkit-appearance: listbox
}
textarea {
overflow: auto;
resize: vertical
}
fieldset {
min-width: 0;
padding: 0;
margin: 0;
border: 0
}
legend {
display: block;
width: 100%;
max-width: 100%;
padding: 0;
margin-bottom: .5rem;
font-size: 1.5rem;
line-height: inherit;
color: inherit;
white-space: normal
}
progress {
vertical-align: baseline
}
[type=number]::-webkit-inner-spin-button,
[type=number]::-webkit-outer-spin-button {
height: auto
}
[type=search] {
outline-offset: -2px;
-webkit-appearance: none
}
[type=search]::-webkit-search-decoration {
-webkit-appearance: none
}
::-webkit-file-upload-button {
font: inherit;
-webkit-appearance: button
}
output {
display: inline-block
}
summary {
display: list-item;
cursor: pointer
}
template {
display: none
}
[hidden] {
display: none !important
}
.h1,
.h2,
.h3,
.h4,
.h5,
.h6,
h1,
h2,
h3,
h4,
h5,
h6 {
margin-bottom: .5rem;
font-weight: 500;
line-height: 1.2
}
.h1,
h1 {
font-size: 2.5rem
}
.h2,
h2 {
font-size: 2rem
}
.h3,
h3 {
font-size: 1.75rem
}
.h4,
h4 {
font-size: 1.5rem
}
.h5,
h5 {
font-size: 1.25rem
}
.h6,
h6 {
font-size: 1rem
}
.lead {
font-size: 1.25rem;
font-weight: 300
}
.display-1 {
font-size: 6rem;
font-weight: 300;
line-height: 1.2
}
.display-2 {
font-size: 5.5rem;
font-weight: 300;
line-height: 1.2
}
.display-3 {
font-size: 4.5rem;
font-weight: 300;
line-height: 1.2
}
.display-4 {
font-size: 3.5rem;
font-weight: 300;
line-height: 1.2
}
hr {
margin-top: 1rem;
margin-bottom: 1rem;
border: 0;
border-top: 1px solid rgba(0, 0, 0, .1)
}
.small,
small {
font-size: 80%;
font-weight: 400
}
.mark,
mark {
padding: .2em;
background-color: #fcf8e3
}
.list-unstyled {
padding-left: 0;
list-style: none
}
.list-inline {
padding-left: 0;
list-style: none
}
.list-inline-item {
display: inline-block
}
.list-inline-item:not(:last-child) {
margin-right: .5rem
}
.initialism {
font-size: 90%;
text-transform: uppercase
}
.blockquote {
margin-bottom: 1rem;
font-size: 1.25rem
}
.blockquote-footer {
display: block;
font-size: 80%;
color: #6c757d
}
.blockquote-footer::before {
content: "\2014\00A0"
}
.img-fluid {
max-width: 100%;
height: auto
}
.img-thumbnail {
padding: .25rem;
background-color: #fff;
border: 1px solid #dee2e6;
border-radius: .25rem;
max-width: 100%;
height: auto
}
.figure {
display: inline-block
}
.figure-img {
margin-bottom: .5rem;
line-height: 1
}
.figure-caption {
font-size: 90%;
color: #6c757d
}
code {
font-size: 87.5%;
color: #e83e8c;
word-break: break-word
}
a>code {
color: inherit
}
kbd {
padding: .2rem .4rem;
font-size: 87.5%;
color: #fff;
background-color: #212529;
border-radius: .2rem
}
kbd kbd {
padding: 0;
font-size: 100%;
font-weight: 700
}
pre {
display: block;
font-size: 87.5%;
color: #212529
}
pre code {
font-size: inherit;
color: inherit;
word-break: normal
}
.pre-scrollable {
max-height: 340px;
overflow-y: scroll
}
.container {
width: 100%;
padding-right: 15px;
padding-left: 15px;
margin-right: auto;
margin-left: auto
}
@media (min-width:576px) {
.container {
max-width: 540px
}
}
@media (min-width:768px) {
.container {
max-width: 720px
}
}
@media (min-width:992px) {
.container {
max-width: 960px
}
}
@media (min-width:1200px) {
.container {
max-width: 1140px
}
}
.container-fluid {
width: 100%;
padding-right: 15px;
padding-left: 15px;
margin-right: auto;
margin-left: auto
}
.row {
display: -ms-flexbox;
display: flex;
-ms-flex-wrap: wrap;
flex-wrap: wrap;
margin-right: -15px;
margin-left: -15px
}
.no-gutters {
margin-right: 0;
margin-left: 0
}
.no-gutters>.col,
.no-gutters>[class*=col-] {
padding-right: 0;
padding-left: 0
}
.col,
.col-1,
.col-10,
.col-11,
.col-12,
.col-2,
.col-3,
.col-4,
.col-5,
.col-6,
.col-7,
.col-8,
.col-9,
.col-auto,
.col-lg,
.col-lg-1,
.col-lg-10,
.col-lg-11,
.col-lg-12,
.col-lg-2,
.col-lg-3,
.col-lg-4,
.col-lg-5,
.col-lg-6,
.col-lg-7,
.col-lg-8,
.col-lg-9,
.col-lg-auto,
.col-md,
.col-md-1,
.col-md-10,
.col-md-11,
.col-md-12,
.col-md-2,
.col-md-3,
.col-md-4,
.col-md-5,
.col-md-6,
.col-md-7,
.col-md-8,
.col-md-9,
.col-md-auto,
.col-sm,
.col-sm-1,
.col-sm-10,
.col-sm-11,
.col-sm-12,
.col-sm-2,
.col-sm-3,
.col-sm-4,
.col-sm-5,
.col-sm-6,
.col-sm-7,
.col-sm-8,
.col-sm-9,
.col-sm-auto,
.col-xl,
.col-xl-1,
.col-xl-10,
.col-xl-11,
.col-xl-12,
.col-xl-2,
.col-xl-3,
.col-xl-4,
.col-xl-5,
.col-xl-6,
.col-xl-7,
.col-xl-8,
.col-xl-9,
.col-xl-auto {
position: relative;
width: 100%;
padding-right: 15px;
padding-left: 15px
}
.col {
-ms-flex-preferred-size: 0;
flex-basis: 0;
-ms-flex-positive: 1;
flex-grow: 1;
max-width: 100%
}
.col-auto {
-ms-flex: 0 0 auto;
flex: 0 0 auto;
width: auto;
max-width: 100%
}
.col-1 {
-ms-flex: 0 0 8.333333%;
flex: 0 0 8.333333%;
max-width: 8.333333%
}
.col-2 {
-ms-flex: 0 0 16.666667%;
flex: 0 0 16.666667%;
max-width: 16.666667%
}
.col-3 {
-ms-flex: 0 0 25%;
flex: 0 0 25%;
max-width: 25%
}
.col-4 {
-ms-flex: 0 0 33.333333%;
flex: 0 0 33.333333%;
max-width: 33.333333%
}
.col-5 {
-ms-flex: 0 0 41.666667%;
flex: 0 0 41.666667%;
max-width: 41.666667%
}
.col-6 {
-ms-flex: 0 0 50%;
flex: 0 0 50%;
max-width: 50%
}
.col-7 {
-ms-flex: 0 0 58.333333%;
flex: 0 0 58.333333%;
max-width: 58.333333%
}
.col-8 {
-ms-flex: 0 0 66.666667%;
flex: 0 0 66.666667%;
max-width: 66.666667%
}
.col-9 {
-ms-flex: 0 0 75%;
flex: 0 0 75%;
max-width: 75%
}
.col-10 {
-ms-flex: 0 0 83.333333%;
flex: 0 0 83.333333%;
max-width: 83.333333%
}
.col-11 {
-ms-flex: 0 0 91.666667%;
flex: 0 0 91.666667%;
max-width: 91.666667%
}
.col-12 {
-ms-flex: 0 0 100%;
flex: 0 0 100%;
max-width: 100%
}
.order-first {
-ms-flex-order: -1;
order: -1
}
.order-last {
-ms-flex-order: 13;
order: 13
}
.order-0 {
-ms-flex-order: 0;
order: 0
}
.order-1 {
-ms-flex-order: 1;
order: 1
}
.order-2 {
-ms-flex-order: 2;
order: 2
}
.order-3 {
-ms-flex-order: 3;
order: 3
}
.order-4 {
-ms-flex-order: 4;
order: 4
}
.order-5 {
-ms-flex-order: 5;
order: 5
}
.order-6 {
-ms-flex-order: 6;
order: 6
}
.order-7 {
-ms-flex-order: 7;
order: 7
}
.order-8 {
-ms-flex-order: 8;
order: 8
}
.order-9 {
-ms-flex-order: 9;
order: 9
}
.order-10 {
-ms-flex-order: 10;
order: 10
}
.order-11 {
-ms-flex-order: 11;
order: 11
}
.order-12 {
-ms-flex-order: 12;
order: 12
}
.offset-1 {
margin-left: 8.333333%
}
.offset-2 {
margin-left: 16.666667%
}
.offset-3 {
margin-left: 25%
}
.offset-4 {
margin-left: 33.333333%
}
.offset-5 {
margin-left: 41.666667%
}
.offset-6 {
margin-left: 50%
}
.offset-7 {
margin-left: 58.333333%
}
.offset-8 {
margin-left: 66.666667%
}
.offset-9 {
margin-left: 75%
}
.offset-10 {
margin-left: 83.333333%
}
.offset-11 {
margin-left: 91.666667%
}
@media (min-width:576px) {
.col-sm {
-ms-flex-preferred-size: 0;
flex-basis: 0;
-ms-flex-positive: 1;
flex-grow: 1;
max-width: 100%
}
.col-sm-auto {
-ms-flex: 0 0 auto;
flex: 0 0 auto;
width: auto;
max-width: 100%
}
.col-sm-1 {
-ms-flex: 0 0 8.333333%;
flex: 0 0 8.333333%;
max-width: 8.333333%
}
.col-sm-2 {
-ms-flex: 0 0 16.666667%;
flex: 0 0 16.666667%;
max-width: 16.666667%
}
.col-sm-3 {
-ms-flex: 0 0 25%;
flex: 0 0 25%;
max-width: 25%
}
.col-sm-4 {
-ms-flex: 0 0 33.333333%;
flex: 0 0 33.333333%;
max-width: 33.333333%
}
.col-sm-5 {
-ms-flex: 0 0 41.666667%;
flex: 0 0 41.666667%;
max-width: 41.666667%
}
.col-sm-6 {
-ms-flex: 0 0 50%;
flex: 0 0 50%;
max-width: 50%
}
.col-sm-7 {
-ms-flex: 0 0 58.333333%;
flex: 0 0 58.333333%;
max-width: 58.333333%
}
.col-sm-8 {
-ms-flex: 0 0 66.666667%;
flex: 0 0 66.666667%;
max-width: 66.666667%
}
.col-sm-9 {
-ms-flex: 0 0 75%;
flex: 0 0 75%;
max-width: 75%
}
.col-sm-10 {
-ms-flex: 0 0 83.333333%;
flex: 0 0 83.333333%;
max-width: 83.333333%
}
.col-sm-11 {
-ms-flex: 0 0 91.666667%;
flex: 0 0 91.666667%;
max-width: 91.666667%
}
.col-sm-12 {
-ms-flex: 0 0 100%;
flex: 0 0 100%;
max-width: 100%
}
.order-sm-first {
-ms-flex-order: -1;
order: -1
}
.order-sm-last {
-ms-flex-order: 13;
order: 13
}
.order-sm-0 {
-ms-flex-order: 0;
order: 0
}
.order-sm-1 {
-ms-flex-order: 1;
order: 1
}
.order-sm-2 {
-ms-flex-order: 2;
order: 2
}
.order-sm-3 {
-ms-flex-order: 3;
order: 3
}
.order-sm-4 {
-ms-flex-order: 4;
order: 4
}
.order-sm-5 {
-ms-flex-order: 5;
order: 5
}
.order-sm-6 {
-ms-flex-order: 6;
order: 6
}
.order-sm-7 {
-ms-flex-order: 7;
order: 7
}
.order-sm-8 {
-ms-flex-order: 8;
order: 8
}
.order-sm-9 {
-ms-flex-order: 9;
order: 9
}
.order-sm-10 {
-ms-flex-order: 10;
order: 10
}
.order-sm-11 {
-ms-flex-order: 11;
order: 11
}
.order-sm-12 {
-ms-flex-order: 12;
order: 12
}
.offset-sm-0 {
margin-left: 0
}
.offset-sm-1 {
margin-left: 8.333333%
}
.offset-sm-2 {
margin-left: 16.666667%
}
.offset-sm-3 {
margin-left: 25%
}
.offset-sm-4 {
margin-left: 33.333333%
}
.offset-sm-5 {
margin-left: 41.666667%
}
.offset-sm-6 {
margin-left: 50%
}
.offset-sm-7 {
margin-left: 58.333333%
}
.offset-sm-8 {
margin-left: 66.666667%
}
.offset-sm-9 {
margin-left: 75%
}
.offset-sm-10 {
margin-left: 83.333333%
}
.offset-sm-11 {
margin-left: 91.666667%
}
}
@media (min-width:768px) {
.col-md {
-ms-flex-preferred-size: 0;
flex-basis: 0;
-ms-flex-positive: 1;
flex-grow: 1;
max-width: 100%
}
.col-md-auto {
-ms-flex: 0 0 auto;
flex: 0 0 auto;
width: auto;
max-width: 100%
}
.col-md-1 {
-ms-flex: 0 0 8.333333%;
flex: 0 0 8.333333%;
max-width: 8.333333%
}
.col-md-2 {
-ms-flex: 0 0 16.666667%;
flex: 0 0 16.666667%;
max-width: 16.666667%
}
.col-md-3 {
-ms-flex: 0 0 25%;
flex: 0 0 25%;
max-width: 25%
}
.col-md-4 {
-ms-flex: 0 0 33.333333%;
flex: 0 0 33.333333%;
max-width: 33.333333%
}
.col-md-5 {
-ms-flex: 0 0 41.666667%;
flex: 0 0 41.666667%;
max-width: 41.666667%
}
.col-md-6 {
-ms-flex: 0 0 50%;
flex: 0 0 50%;
max-width: 50%
}
.col-md-7 {
-ms-flex: 0 0 58.333333%;
flex: 0 0 58.333333%;
max-width: 58.333333%
}
.col-md-8 {
-ms-flex: 0 0 66.666667%;
flex: 0 0 66.666667%;
max-width: 66.666667%
}
.col-md-9 {
-ms-flex: 0 0 75%;
flex: 0 0 75%;
max-width: 75%
}
.col-md-10 {
-ms-flex: 0 0 83.333333%;
flex: 0 0 83.333333%;
max-width: 83.333333%
}
.col-md-11 {
-ms-flex: 0 0 91.666667%;
flex: 0 0 91.666667%;
max-width: 91.666667%
}
.col-md-12 {
-ms-flex: 0 0 100%;
flex: 0 0 100%;
max-width: 100%
}
.order-md-first {
-ms-flex-order: -1;
order: -1
}
.order-md-last {
-ms-flex-order: 13;
order: 13
}
.order-md-0 {
-ms-flex-order: 0;
order: 0
}
.order-md-1 {
-ms-flex-order: 1;
order: 1
}
.order-md-2 {
-ms-flex-order: 2;
order: 2
}
.order-md-3 {
-ms-flex-order: 3;
order: 3
}
.order-md-4 {
-ms-flex-order: 4;
order: 4
}
.order-md-5 {
-ms-flex-order: 5;
order: 5
}
.order-md-6 {
-ms-flex-order: 6;
order: 6
}
.order-md-7 {
-ms-flex-order: 7;
order: 7
}
.order-md-8 {
-ms-flex-order: 8;
order: 8
}
.order-md-9 {
-ms-flex-order: 9;
order: 9
}
.order-md-10 {
-ms-flex-order: 10;
order: 10
}
.order-md-11 {
-ms-flex-order: 11;
order: 11
}
.order-md-12 {
-ms-flex-order: 12;
order: 12
}
.offset-md-0 {
margin-left: 0
}
.offset-md-1 {
margin-left: 8.333333%
}
.offset-md-2 {
margin-left: 16.666667%
}
.offset-md-3 {
margin-left: 25%
}
.offset-md-4 {
margin-left: 33.333333%
}
.offset-md-5 {
margin-left: 41.666667%
}
.offset-md-6 {
margin-left: 50%
}
.offset-md-7 {
margin-left: 58.333333%
}
.offset-md-8 {
margin-left: 66.666667%
}
.offset-md-9 {
margin-left: 75%
}
.offset-md-10 {
margin-left: 83.333333%
}
.offset-md-11 {
margin-left: 91.666667%
}
}
@media (min-width:992px) {
.col-lg {
-ms-flex-preferred-size: 0;
flex-basis: 0;
-ms-flex-positive: 1;
flex-grow: 1;
max-width: 100%
}
.col-lg-auto {
-ms-flex: 0 0 auto;
flex: 0 0 auto;
width: auto;
max-width: 100%
}
.col-lg-1 {
-ms-flex: 0 0 8.333333%;
flex: 0 0 8.333333%;
max-width: 8.333333%
}
.col-lg-2 {
-ms-flex: 0 0 16.666667%;
flex: 0 0 16.666667%;
max-width: 16.666667%
}
.col-lg-3 {
-ms-flex: 0 0 25%;
flex: 0 0 25%;
max-width: 25%
}
.col-lg-4 {
-ms-flex: 0 0 33.333333%;
flex: 0 0 33.333333%;
max-width: 33.333333%
}
.col-lg-5 {
-ms-flex: 0 0 41.666667%;
flex: 0 0 41.666667%;
max-width: 41.666667%
}
.col-lg-6 {
-ms-flex: 0 0 50%;
flex: 0 0 50%;
max-width: 50%
}
.col-lg-7 {
-ms-flex: 0 0 58.333333%;
flex: 0 0 58.333333%;
max-width: 58.333333%
}
.col-lg-8 {
-ms-flex: 0 0 66.666667%;
flex: 0 0 66.666667%;
max-width: 66.666667%
}
.col-lg-9 {
-ms-flex: 0 0 75%;
flex: 0 0 75%;
max-width: 75%
}
.col-lg-10 {
-ms-flex: 0 0 83.333333%;
flex: 0 0 83.333333%;
max-width: 83.333333%
}
.col-lg-11 {
-ms-flex: 0 0 91.666667%;
flex: 0 0 91.666667%;
max-width: 91.666667%
}
.col-lg-12 {
-ms-flex: 0 0 100%;
flex: 0 0 100%;
max-width: 100%
}
.order-lg-first {
-ms-flex-order: -1;
order: -1
}
.order-lg-last {
-ms-flex-order: 13;
order: 13
}
.order-lg-0 {
-ms-flex-order: 0;
order: 0
}
.order-lg-1 {
-ms-flex-order: 1;
order: 1
}
.order-lg-2 {
-ms-flex-order: 2;
order: 2
}
.order-lg-3 {
-ms-flex-order: 3;
order: 3
}
.order-lg-4 {
-ms-flex-order: 4;
order: 4
}
.order-lg-5 {
-ms-flex-order: 5;
order: 5
}
.order-lg-6 {
-ms-flex-order: 6;
order: 6
}
.order-lg-7 {
-ms-flex-order: 7;
order: 7
}
.order-lg-8 {
-ms-flex-order: 8;
order: 8
}
.order-lg-9 {
-ms-flex-order: 9;
order: 9
}
.order-lg-10 {
-ms-flex-order: 10;
order: 10
}
.order-lg-11 {
-ms-flex-order: 11;
order: 11
}
.order-lg-12 {
-ms-flex-order: 12;
order: 12
}
.offset-lg-0 {
margin-left: 0
}
.offset-lg-1 {
margin-left: 8.333333%
}
.offset-lg-2 {
margin-left: 16.666667%
}
.offset-lg-3 {
margin-left: 25%
}
.offset-lg-4 {
margin-left: 33.333333%
}
.offset-lg-5 {
margin-left: 41.666667%
}
.offset-lg-6 {
margin-left: 50%
}
.offset-lg-7 {
margin-left: 58.333333%
}
.offset-lg-8 {
margin-left: 66.666667%
}
.offset-lg-9 {
margin-left: 75%
}
.offset-lg-10 {
margin-left: 83.333333%
}
.offset-lg-11 {
margin-left: 91.666667%
}
}
@media (min-width:1200px) {
.col-xl {
-ms-flex-preferred-size: 0;
flex-basis: 0;
-ms-flex-positive: 1;
flex-grow: 1;
max-width: 100%
}
.col-xl-auto {
-ms-flex: 0 0 auto;
flex: 0 0 auto;
width: auto;
max-width: 100%
}
.col-xl-1 {
-ms-flex: 0 0 8.333333%;
flex: 0 0 8.333333%;
max-width: 8.333333%
}
.col-xl-2 {
-ms-flex: 0 0 16.666667%;
flex: 0 0 16.666667%;
max-width: 16.666667%
}
.col-xl-3 {
-ms-flex: 0 0 25%;
flex: 0 0 25%;
max-width: 25%
}
.col-xl-4 {
-ms-flex: 0 0 33.333333%;
flex: 0 0 33.333333%;
max-width: 33.333333%
}
.col-xl-5 {
-ms-flex: 0 0 41.666667%;
flex: 0 0 41.666667%;
max-width: 41.666667%
}
.col-xl-6 {
-ms-flex: 0 0 50%;
flex: 0 0 50%;
max-width: 50%
}
.col-xl-7 {
-ms-flex: 0 0 58.333333%;
flex: 0 0 58.333333%;
max-width: 58.333333%
}
.col-xl-8 {
-ms-flex: 0 0 66.666667%;
flex: 0 0 66.666667%;
max-width: 66.666667%
}
.col-xl-9 {
-ms-flex: 0 0 75%;
flex: 0 0 75%;
max-width: 75%
}
.col-xl-10 {
-ms-flex: 0 0 83.333333%;
flex: 0 0 83.333333%;
max-width: 83.333333%
}
.col-xl-11 {
-ms-flex: 0 0 91.666667%;
flex: 0 0 91.666667%;
max-width: 91.666667%
}
.col-xl-12 {
-ms-flex: 0 0 100%;
flex: 0 0 100%;
max-width: 100%
}
.order-xl-first {
-ms-flex-order: -1;
order: -1
}
.order-xl-last {
-ms-flex-order: 13;
order: 13
}
.order-xl-0 {
-ms-flex-order: 0;
order: 0
}
.order-xl-1 {
-ms-flex-order: 1;
order: 1
}
.order-xl-2 {
-ms-flex-order: 2;
order: 2
}
.order-xl-3 {
-ms-flex-order: 3;
order: 3
}
.order-xl-4 {
-ms-flex-order: 4;
order: 4
}
.order-xl-5 {
-ms-flex-order: 5;
order: 5
}
.order-xl-6 {
-ms-flex-order: 6;
order: 6
}
.order-xl-7 {
-ms-flex-order: 7;
order: 7
}
.order-xl-8 {
-ms-flex-order: 8;
order: 8
}
.order-xl-9 {
-ms-flex-order: 9;
order: 9
}
.order-xl-10 {
-ms-flex-order: 10;
order: 10
}
.order-xl-11 {
-ms-flex-order: 11;
order: 11
}
.order-xl-12 {
-ms-flex-order: 12;
order: 12
}
.offset-xl-0 {
margin-left: 0
}
.offset-xl-1 {
margin-left: 8.333333%
}
.offset-xl-2 {
margin-left: 16.666667%
}
.offset-xl-3 {
margin-left: 25%
}
.offset-xl-4 {
margin-left: 33.333333%
}
.offset-xl-5 {
margin-left: 41.666667%
}
.offset-xl-6 {
margin-left: 50%
}
.offset-xl-7 {
margin-left: 58.333333%
}
.offset-xl-8 {
margin-left: 66.666667%
}
.offset-xl-9 {
margin-left: 75%
}
.offset-xl-10 {
margin-left: 83.333333%
}
.offset-xl-11 {
margin-left: 91.666667%
}
}
.table {
width: 100%;
margin-bottom: 1rem;
color: #212529
}
.table td,
.table th {
padding: .75rem;
vertical-align: top;
border-top: 1px solid #dee2e6
}
.table thead th {
vertical-align: bottom;
border-bottom: 2px solid #dee2e6
}
.table tbody+tbody {
border-top: 2px solid #dee2e6
}
.table-sm td,
.table-sm th {
padding: .3rem
}
.table-bordered {
border: 1px solid #dee2e6
}
.table-bordered td,
.table-bordered th {
border: 1px solid #dee2e6
}
.table-bordered thead td,
.table-bordered thead th {
border-bottom-width: 2px
}
.table-borderless tbody+tbody,
.table-borderless td,
.table-borderless th,
.table-borderless thead th {
border: 0
}
.table-striped tbody tr:nth-of-type(odd) {
background-color: rgba(0, 0, 0, .05)
}
.table-hover tbody tr:hover {
color: #212529;
background-color: rgba(0, 0, 0, .075)
}
.table-primary,
.table-primary>td,
.table-primary>th {
background-color: #b8daff
}
.table-primary tbody+tbody,
.table-primary td,
.table-primary th,
.table-primary thead th {
border-color: #7abaff
}
.table-hover .table-primary:hover {
background-color: #9fcdff
}
.table-hover .table-primary:hover>td,
.table-hover .table-primary:hover>th {
background-color: #9fcdff
}
.table-secondary,
.table-secondary>td,
.table-secondary>th {
background-color: #d6d8db
}
.table-secondary tbody+tbody,
.table-secondary td,
.table-secondary th,
.table-secondary thead th {
border-color: #b3b7bb
}
.table-hover .table-secondary:hover {
background-color: #c8cbcf
}
.table-hover .table-secondary:hover>td,
.table-hover .table-secondary:hover>th {
background-color: #c8cbcf
}
.table-success,
.table-success>td,
.table-success>th {
background-color: #c3e6cb
}
.table-success tbody+tbody,
.table-success td,
.table-success th,
.table-success thead th {
border-color: #8fd19e
}
.table-hover .table-success:hover {
background-color: #b1dfbb
}
.table-hover .table-success:hover>td,
.table-hover .table-success:hover>th {
background-color: #b1dfbb
}
.table-info,
.table-info>td,
.table-info>th {
background-color: #bee5eb
}
.table-info tbody+tbody,
.table-info td,
.table-info th,
.table-info thead th {
border-color: #86cfda
}
.table-hover .table-info:hover {
background-color: #abdde5
}
.table-hover .table-info:hover>td,
.table-hover .table-info:hover>th {
background-color: #abdde5
}
.table-warning,
.table-warning>td,
.table-warning>th {
background-color: #ffeeba
}
.table-warning tbody+tbody,
.table-warning td,
.table-warning th,
.table-warning thead th {
border-color: #ffdf7e
}
.table-hover .table-warning:hover {
background-color: #ffe8a1
}
.table-hover .table-warning:hover>td,
.table-hover .table-warning:hover>th {
background-color: #ffe8a1
}
.table-danger,
.table-danger>td,
.table-danger>th {
background-color: #f5c6cb
}
.table-danger tbody+tbody,
.table-danger td,
.table-danger th,
.table-danger thead th {
border-color: #ed969e
}
.table-hover .table-danger:hover {
background-color: #f1b0b7
}
.table-hover .table-danger:hover>td,
.table-hover .table-danger:hover>th {
background-color: #f1b0b7
}
.table-light,
.table-light>td,
.table-light>th {
background-color: #fdfdfe
}
.table-light tbody+tbody,
.table-light td,
.table-light th,
.table-light thead th {
border-color: #fbfcfc
}
.table-hover .table-light:hover {
background-color: #ececf6
}
.table-hover .table-light:hover>td,
.table-hover .table-light:hover>th {
background-color: #ececf6
}
.table-dark,
.table-dark>td,
.table-dark>th {
background-color: #c6c8ca
}
.table-dark tbody+tbody,
.table-dark td,
.table-dark th,
.table-dark thead th {
border-color: #95999c
}
.table-hover .table-dark:hover {
background-color: #b9bbbe
}
.table-hover .table-dark:hover>td,
.table-hover .table-dark:hover>th {
background-color: #b9bbbe
}
.table-active,
.table-active>td,
.table-active>th {
background-color: rgba(0, 0, 0, .075)
}
.table-hover .table-active:hover {
background-color: rgba(0, 0, 0, .075)
}
.table-hover .table-active:hover>td,
.table-hover .table-active:hover>th {
background-color: rgba(0, 0, 0, .075)
}
.table .thead-dark th {
color: #fff;
background-color: #343a40;
border-color: #454d55
}
.table .thead-light th {
color: #495057;
background-color: #e9ecef;
border-color: #dee2e6
}
.table-dark {
color: #fff;
background-color: #343a40
}
.table-dark td,
.table-dark th,
.table-dark thead th {
border-color: #454d55
}
.table-dark.table-bordered {
border: 0
}
.table-dark.table-striped tbody tr:nth-of-type(odd) {
background-color: rgba(255, 255, 255, .05)
}
.table-dark.table-hover tbody tr:hover {
color: #fff;
background-color: rgba(255, 255, 255, .075)
}
@media (max-width:575.98px) {
.table-responsive-sm {
display: block;
width: 100%;
overflow-x: auto;
-webkit-overflow-scrolling: touch
}
.table-responsive-sm>.table-bordered {
border: 0
}
}
@media (max-width:767.98px) {
.table-responsive-md {
display: block;
width: 100%;
overflow-x: auto;
-webkit-overflow-scrolling: touch
}
.table-responsive-md>.table-bordered {
border: 0
}
}
@media (max-width:991.98px) {
.table-responsive-lg {
display: block;
width: 100%;
overflow-x: auto;
-webkit-overflow-scrolling: touch
}
.table-responsive-lg>.table-bordered {
border: 0
}
}
@media (max-width:1199.98px) {
.table-responsive-xl {
display: block;
width: 100%;
overflow-x: auto;
-webkit-overflow-scrolling: touch
}
.table-responsive-xl>.table-bordered {
border: 0
}
}
.table-responsive {
display: block;
width: 100%;
overflow-x: auto;
-webkit-overflow-scrolling: touch
}
.table-responsive>.table-bordered {
border: 0
}
.form-control {
display: block;
width: 100%;
height: calc(1.5em + .75rem + 2px);
padding: .375rem .75rem;
font-size: 1rem;
font-weight: 400;
line-height: 1.5;
color: #495057;
background-color: #fff;
background-clip: padding-box;
border: 1px solid #ced4da;
border-radius: .25rem;
transition: border-color .15s ease-in-out, box-shadow .15s ease-in-out
}
@media (prefers-reduced-motion:reduce) {
.form-control {
transition: none
}
}
.form-control::-ms-expand {
background-color: transparent;
border: 0
}
.form-control:focus {
color: #495057;
background-color: #fff;
border-color: #80bdff;
outline: 0;
box-shadow: 0 0 0 .2rem rgba(0, 123, 255, .25)
}
.form-control::-webkit-input-placeholder {
color: #6c757d;
opacity: 1
}
.form-control::-moz-placeholder {
color: #6c757d;
opacity: 1
}
.form-control:-ms-input-placeholder {
color: #6c757d;
opacity: 1
}
.form-control::-ms-input-placeholder {
color: #6c757d;
opacity: 1
}
.form-control::placeholder {
color: #6c757d;
opacity: 1
}
.form-control:disabled,
.form-control[readonly] {
background-color: #e9ecef;
opacity: 1
}
select.form-control:focus::-ms-value {
color: #495057;
background-color: #fff
}
.form-control-file,
.form-control-range {
display: block;
width: 100%
}
.col-form-label {
padding-top: calc(.375rem + 1px);
padding-bottom: calc(.375rem + 1px);
margin-bottom: 0;
font-size: inherit;
line-height: 1.5
}
.col-form-label-lg {
padding-top: calc(.5rem + 1px);
padding-bottom: calc(.5rem + 1px);
font-size: 1.25rem;
line-height: 1.5
}
.col-form-label-sm {
padding-top: calc(.25rem + 1px);
padding-bottom: calc(.25rem + 1px);
font-size: .875rem;
line-height: 1.5
}
.form-control-plaintext {
display: block;
width: 100%;
padding-top: .375rem;
padding-bottom: .375rem;
margin-bottom: 0;
line-height: 1.5;
color: #212529;
background-color: transparent;
border: solid transparent;
border-width: 1px 0
}
.form-control-plaintext.form-control-lg,
.form-control-plaintext.form-control-sm {
padding-right: 0;
padding-left: 0
}
.form-control-sm {
height: calc(1.5em + .5rem + 2px);
padding: .25rem .5rem;
font-size: .875rem;
line-height: 1.5;
border-radius: .2rem
}
.form-control-lg {
height: calc(1.5em + 1rem + 2px);
padding: .5rem 1rem;
font-size: 1.25rem;
line-height: 1.5;
border-radius: .3rem
}
select.form-control[multiple],
select.form-control[size] {
height: auto
}
textarea.form-control {
height: auto
}
.form-group {
margin-bottom: 1rem
}
.form-text {
display: block;
margin-top: .25rem
}
.form-row {
display: -ms-flexbox;
display: flex;
-ms-flex-wrap: wrap;
flex-wrap: wrap;
margin-right: -5px;
margin-left: -5px
}
.form-row>.col,
.form-row>[class*=col-] {
padding-right: 5px;
padding-left: 5px
}
.form-check {
position: relative;
display: block;
padding-left: 1.25rem
}
.form-check-input {
position: absolute;
margin-top: .3rem;
margin-left: -1.25rem
}
.form-check-input:disabled~.form-check-label {
color: #6c757d
}
.form-check-label {
margin-bottom: 0
}
.form-check-inline {
display: -ms-inline-flexbox;
display: inline-flex;
-ms-flex-align: center;
align-items: center;
padding-left: 0;
margin-right: .75rem
}
.form-check-inline .form-check-input {
position: static;
margin-top: 0;
margin-right: .3125rem;
margin-left: 0
}
.valid-feedback {
display: none;
width: 100%;
margin-top: .25rem;
font-size: 80%;
color: #28a745
}
.valid-tooltip {
position: absolute;
top: 100%;
z-index: 5;
display: none;
max-width: 100%;
padding: .25rem .5rem;
margin-top: .1rem;
font-size: .875rem;
line-height: 1.5;
color: #fff;
background-color: rgba(40, 167, 69, .9);
border-radius: .25rem
}
.form-control.is-valid,
.was-validated .form-control:valid {
border-color: #28a745;
padding-right: calc(1.5em + .75rem);
background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");
background-repeat: no-repeat;
background-position: center right calc(.375em + .1875rem);
background-size: calc(.75em + .375rem) calc(.75em + .375rem)
}
.form-control.is-valid:focus,
.was-validated .form-control:valid:focus {
border-color: #28a745;
box-shadow: 0 0 0 .2rem rgba(40, 167, 69, .25)
}
.form-control.is-valid~.valid-feedback,
.form-control.is-valid~.valid-tooltip,
.was-validated .form-control:valid~.valid-feedback,
.was-validated .form-control:valid~.valid-tooltip {
display: block
}
.was-validated textarea.form-control:valid,
textarea.form-control.is-valid {
padding-right: calc(1.5em + .75rem);
background-position: top calc(.375em + .1875rem) right calc(.375em + .1875rem)
}
.custom-select.is-valid,
.was-validated .custom-select:valid {
border-color: #28a745;
padding-right: calc((1em + .75rem) * 3 / 4 + 1.75rem);
background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right .75rem center/8px 10px, url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e") #fff no-repeat center right 1.75rem/calc(.75em + .375rem) calc(.75em + .375rem)
}
.custom-select.is-valid:focus,
.was-validated .custom-select:valid:focus {
border-color: #28a745;
box-shadow: 0 0 0 .2rem rgba(40, 167, 69, .25)
}
.custom-select.is-valid~.valid-feedback,
.custom-select.is-valid~.valid-tooltip,
.was-validated .custom-select:valid~.valid-feedback,
.was-validated .custom-select:valid~.valid-tooltip {
display: block
}
.form-control-file.is-valid~.valid-feedback,
.form-control-file.is-valid~.valid-tooltip,
.was-validated .form-control-file:valid~.valid-feedback,
.was-validated .form-control-file:valid~.valid-tooltip {
display: block
}
.form-check-input.is-valid~.form-check-label,
.was-validated .form-check-input:valid~.form-check-label {
color: #28a745
}
.form-check-input.is-valid~.valid-feedback,
.form-check-input.is-valid~.valid-tooltip,
.was-validated .form-check-input:valid~.valid-feedback,
.was-validated .form-check-input:valid~.valid-tooltip {
display: block
}
.custom-control-input.is-valid~.custom-control-label,
.was-validated .custom-control-input:valid~.custom-control-label {
color: #28a745
}
.custom-control-input.is-valid~.custom-control-label::before,
.was-validated .custom-control-input:valid~.custom-control-label::before {
border-color: #28a745
}
.custom-control-input.is-valid~.valid-feedback,
.custom-control-input.is-valid~.valid-tooltip,
.was-validated .custom-control-input:valid~.valid-feedback,
.was-validated .custom-control-input:valid~.valid-tooltip {
display: block
}
.custom-control-input.is-valid:checked~.custom-control-label::before,
.was-validated .custom-control-input:valid:checked~.custom-control-label::before {
border-color: #34ce57;
background-color: #34ce57
}
.custom-control-input.is-valid:focus~.custom-control-label::before,
.was-validated .custom-control-input:valid:focus~.custom-control-label::before {
box-shadow: 0 0 0 .2rem rgba(40, 167, 69, .25)
}
.custom-control-input.is-valid:focus:not(:checked)~.custom-control-label::before,
.was-validated .custom-control-input:valid:focus:not(:checked)~.custom-control-label::before {
border-color: #28a745
}
.custom-file-input.is-valid~.custom-file-label,
.was-validated .custom-file-input:valid~.custom-file-label {
border-color: #28a745
}
.custom-file-input.is-valid~.valid-feedback,
.custom-file-input.is-valid~.valid-tooltip,
.was-validated .custom-file-input:valid~.valid-feedback,
.was-validated .custom-file-input:valid~.valid-tooltip {
display: block
}
.custom-file-input.is-valid:focus~.custom-file-label,
.was-validated .custom-file-input:valid:focus~.custom-file-label {
border-color: #28a745;
box-shadow: 0 0 0 .2rem rgba(40, 167, 69, .25)
}
.invalid-feedback {
display: none;
width: 100%;
margin-top: .25rem;
font-size: 80%;
color: #dc3545
}
.invalid-tooltip {
position: absolute;
top: 100%;
z-index: 5;
display: none;
max-width: 100%;
padding: .25rem .5rem;
margin-top: .1rem;
font-size: .875rem;
line-height: 1.5;
color: #fff;
background-color: rgba(220, 53, 69, .9);
border-radius: .25rem
}
.form-control.is-invalid,
.was-validated .form-control:invalid {
border-color: #dc3545;
padding-right: calc(1.5em + .75rem);
background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23dc3545' viewBox='-2 -2 7 7'%3e%3cpath stroke='%23dc3545' d='M0 0l3 3m0-3L0 3'/%3e%3ccircle r='.5'/%3e%3ccircle cx='3' r='.5'/%3e%3ccircle cy='3' r='.5'/%3e%3ccircle cx='3' cy='3' r='.5'/%3e%3c/svg%3E");
background-repeat: no-repeat;
background-position: center right calc(.375em + .1875rem);
background-size: calc(.75em + .375rem) calc(.75em + .375rem)
}
.form-control.is-invalid:focus,
.was-validated .form-control:invalid:focus {
border-color: #dc3545;
box-shadow: 0 0 0 .2rem rgba(220, 53, 69, .25)
}
.form-control.is-invalid~.invalid-feedback,
.form-control.is-invalid~.invalid-tooltip,
.was-validated .form-control:invalid~.invalid-feedback,
.was-validated .form-control:invalid~.invalid-tooltip {
display: block
}
.was-validated textarea.form-control:invalid,
textarea.form-control.is-invalid {
padding-right: calc(1.5em + .75rem);
background-position: top calc(.375em + .1875rem) right calc(.375em + .1875rem)
}
.custom-select.is-invalid,
.was-validated .custom-select:invalid {
border-color: #dc3545;
padding-right: calc((1em + .75rem) * 3 / 4 + 1.75rem);
background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right .75rem center/8px 10px, url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23dc3545' viewBox='-2 -2 7 7'%3e%3cpath stroke='%23dc3545' d='M0 0l3 3m0-3L0 3'/%3e%3ccircle r='.5'/%3e%3ccircle cx='3' r='.5'/%3e%3ccircle cy='3' r='.5'/%3e%3ccircle cx='3' cy='3' r='.5'/%3e%3c/svg%3E") #fff no-repeat center right 1.75rem/calc(.75em + .375rem) calc(.75em + .375rem)
}
.custom-select.is-invalid:focus,
.was-validated .custom-select:invalid:focus {
border-color: #dc3545;
box-shadow: 0 0 0 .2rem rgba(220, 53, 69, .25)
}
.custom-select.is-invalid~.invalid-feedback,
.custom-select.is-invalid~.invalid-tooltip,
.was-validated .custom-select:invalid~.invalid-feedback,
.was-validated .custom-select:invalid~.invalid-tooltip {
display: block
}
.form-control-file.is-invalid~.invalid-feedback,
.form-control-file.is-invalid~.invalid-tooltip,
.was-validated .form-control-file:invalid~.invalid-feedback,
.was-validated .form-control-file:invalid~.invalid-tooltip {
display: block
}
.form-check-input.is-invalid~.form-check-label,
.was-validated .form-check-input:invalid~.form-check-label {
color: #dc3545
}
.form-check-input.is-invalid~.invalid-feedback,
.form-check-input.is-invalid~.invalid-tooltip,
.was-validated .form-check-input:invalid~.invalid-feedback,
.was-validated .form-check-input:invalid~.invalid-tooltip {
display: block
}
.custom-control-input.is-invalid~.custom-control-label,
.was-validated .custom-control-input:invalid~.custom-control-label {
color: #dc3545
}
.custom-control-input.is-invalid~.custom-control-label::before,
.was-validated .custom-control-input:invalid~.custom-control-label::before {
border-color: #dc3545
}
.custom-control-input.is-invalid~.invalid-feedback,
.custom-control-input.is-invalid~.invalid-tooltip,
.was-validated .custom-control-input:invalid~.invalid-feedback,
.was-validated .custom-control-input:invalid~.invalid-tooltip {
display: block
}
.custom-control-input.is-invalid:checked~.custom-control-label::before,
.was-validated .custom-control-input:invalid:checked~.custom-control-label::before {
border-color: #e4606d;
background-color: #e4606d
}
.custom-control-input.is-invalid:focus~.custom-control-label::before,
.was-validated .custom-control-input:invalid:focus~.custom-control-label::before {
box-shadow: 0 0 0 .2rem rgba(220, 53, 69, .25)
}
.custom-control-input.is-invalid:focus:not(:checked)~.custom-control-label::before,
.was-validated .custom-control-input:invalid:focus:not(:checked)~.custom-control-label::before {
border-color: #dc3545
}
.custom-file-input.is-invalid~.custom-file-label,
.was-validated .custom-file-input:invalid~.custom-file-label {
border-color: #dc3545
}
.custom-file-input.is-invalid~.invalid-feedback,
.custom-file-input.is-invalid~.invalid-tooltip,
.was-validated .custom-file-input:invalid~.invalid-feedback,
.was-validated .custom-file-input:invalid~.invalid-tooltip {
display: block
}
.custom-file-input.is-invalid:focus~.custom-file-label,
.was-validated .custom-file-input:invalid:focus~.custom-file-label {
border-color: #dc3545;
box-shadow: 0 0 0 .2rem rgba(220, 53, 69, .25)
}
.form-inline {
display: -ms-flexbox;
display: flex;
-ms-flex-flow: row wrap;
flex-flow: row wrap;
-ms-flex-align: center;
align-items: center
}
.form-inline .form-check {
width: 100%
}
@media (min-width:576px) {
.form-inline label {
display: -ms-flexbox;
display: flex;
-ms-flex-align: center;
align-items: center;
-ms-flex-pack: center;
justify-content: center;
margin-bottom: 0
}
.form-inline .form-group {
display: -ms-flexbox;
display: flex;
-ms-flex: 0 0 auto;
flex: 0 0 auto;
-ms-flex-flow: row wrap;
flex-flow: row wrap;
-ms-flex-align: center;
align-items: center;
margin-bottom: 0
}
.form-inline .form-control {
display: inline-block;
width: auto;
vertical-align: middle
}
.form-inline .form-control-plaintext {
display: inline-block
}
.form-inline .custom-select,
.form-inline .input-group {
width: auto
}
.form-inline .form-check {
display: -ms-flexbox;
display: flex;
-ms-flex-align: center;
align-items: center;
-ms-flex-pack: center;
justify-content: center;
width: auto;
padding-left: 0
}
.form-inline .form-check-input {
position: relative;
-ms-flex-negative: 0;
flex-shrink: 0;
margin-top: 0;
margin-right: .25rem;
margin-left: 0
}
.form-inline .custom-control {
-ms-flex-align: center;
align-items: center;
-ms-flex-pack: center;
justify-content: center
}
.form-inline .custom-control-label {
margin-bottom: 0
}
}
.btn {
display: inline-block;
font-weight: 400;
color: #212529;
text-align: center;
vertical-align: middle;
-webkit-user-select: none;
-moz-user-select: none;
-ms-user-select: none;
user-select: none;
background-color: transparent;
border: 1px solid transparent;
padding: .375rem .75rem;
font-size: 1rem;
line-height: 1.5;
border-radius: .25rem;
transition: color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out
}
@media (prefers-reduced-motion:reduce) {
.btn {
transition: none
}
}
.btn:hover {
color: #212529;
text-decoration: none
}
.btn.focus,
.btn:focus {
outline: 0;
box-shadow: 0 0 0 .2rem rgba(0, 123, 255, .25)
}
.btn.disabled,
.btn:disabled {
opacity: .65
}
a.btn.disabled,
fieldset:disabled a.btn {
pointer-events: none
}
.btn-primary {
color: #fff;
background-color: #007bff;
border-color: #007bff
}
.btn-primary:hover {
color: #fff;
background-color: #0069d9;
border-color: #0062cc
}
.btn-primary.focus,
.btn-primary:focus {
box-shadow: 0 0 0 .2rem rgba(38, 143, 255, .5)
}
.btn-primary.disabled,
.btn-primary:disabled {
color: #fff;
background-color: #007bff;
border-color: #007bff
}
.btn-primary:not(:disabled):not(.disabled).active,
.btn-primary:not(:disabled):not(.disabled):active,
.show>.btn-primary.dropdown-toggle {
color: #fff;
background-color: #0062cc;
border-color: #005cbf
}
.btn-primary:not(:disabled):not(.disabled).active:focus,
.btn-primary:not(:disabled):not(.disabled):active:focus,
.show>.btn-primary.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(38, 143, 255, .5)
}
.btn-secondary {
color: #fff;
background-color: #6c757d;
border-color: #6c757d
}
.btn-secondary:hover {
color: #fff;
background-color: #5a6268;
border-color: #545b62
}
.btn-secondary.focus,
.btn-secondary:focus {
box-shadow: 0 0 0 .2rem rgba(130, 138, 145, .5)
}
.btn-secondary.disabled,
.btn-secondary:disabled {
color: #fff;
background-color: #6c757d;
border-color: #6c757d
}
.btn-secondary:not(:disabled):not(.disabled).active,
.btn-secondary:not(:disabled):not(.disabled):active,
.show>.btn-secondary.dropdown-toggle {
color: #fff;
background-color: #545b62;
border-color: #4e555b
}
.btn-secondary:not(:disabled):not(.disabled).active:focus,
.btn-secondary:not(:disabled):not(.disabled):active:focus,
.show>.btn-secondary.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(130, 138, 145, .5)
}
.btn-success {
color: #fff;
background-color: #28a745;
border-color: #28a745
}
.btn-success:hover {
color: #fff;
background-color: #218838;
border-color: #1e7e34
}
.btn-success.focus,
.btn-success:focus {
box-shadow: 0 0 0 .2rem rgba(72, 180, 97, .5)
}
.btn-success.disabled,
.btn-success:disabled {
color: #fff;
background-color: #28a745;
border-color: #28a745
}
.btn-success:not(:disabled):not(.disabled).active,
.btn-success:not(:disabled):not(.disabled):active,
.show>.btn-success.dropdown-toggle {
color: #fff;
background-color: #1e7e34;
border-color: #1c7430
}
.btn-success:not(:disabled):not(.disabled).active:focus,
.btn-success:not(:disabled):not(.disabled):active:focus,
.show>.btn-success.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(72, 180, 97, .5)
}
.btn-info {
color: #fff;
background-color: #17a2b8;
border-color: #17a2b8
}
.btn-info:hover {
color: #fff;
background-color: #138496;
border-color: #117a8b
}
.btn-info.focus,
.btn-info:focus {
box-shadow: 0 0 0 .2rem rgba(58, 176, 195, .5)
}
.btn-info.disabled,
.btn-info:disabled {
color: #fff;
background-color: #17a2b8;
border-color: #17a2b8
}
.btn-info:not(:disabled):not(.disabled).active,
.btn-info:not(:disabled):not(.disabled):active,
.show>.btn-info.dropdown-toggle {
color: #fff;
background-color: #117a8b;
border-color: #10707f
}
.btn-info:not(:disabled):not(.disabled).active:focus,
.btn-info:not(:disabled):not(.disabled):active:focus,
.show>.btn-info.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(58, 176, 195, .5)
}
.btn-warning {
color: #212529;
background-color: #ffc107;
border-color: #ffc107
}
.btn-warning:hover {
color: #212529;
background-color: #e0a800;
border-color: #d39e00
}
.btn-warning.focus,
.btn-warning:focus {
box-shadow: 0 0 0 .2rem rgba(222, 170, 12, .5)
}
.btn-warning.disabled,
.btn-warning:disabled {
color: #212529;
background-color: #ffc107;
border-color: #ffc107
}
.btn-warning:not(:disabled):not(.disabled).active,
.btn-warning:not(:disabled):not(.disabled):active,
.show>.btn-warning.dropdown-toggle {
color: #212529;
background-color: #d39e00;
border-color: #c69500
}
.btn-warning:not(:disabled):not(.disabled).active:focus,
.btn-warning:not(:disabled):not(.disabled):active:focus,
.show>.btn-warning.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(222, 170, 12, .5)
}
.btn-danger {
color: #fff;
background-color: #dc3545;
border-color: #dc3545
}
.btn-danger:hover {
color: #fff;
background-color: #c82333;
border-color: #bd2130
}
.btn-danger.focus,
.btn-danger:focus {
box-shadow: 0 0 0 .2rem rgba(225, 83, 97, .5)
}
.btn-danger.disabled,
.btn-danger:disabled {
color: #fff;
background-color: #dc3545;
border-color: #dc3545
}
.btn-danger:not(:disabled):not(.disabled).active,
.btn-danger:not(:disabled):not(.disabled):active,
.show>.btn-danger.dropdown-toggle {
color: #fff;
background-color: #bd2130;
border-color: #b21f2d
}
.btn-danger:not(:disabled):not(.disabled).active:focus,
.btn-danger:not(:disabled):not(.disabled):active:focus,
.show>.btn-danger.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(225, 83, 97, .5)
}
.btn-light {
color: #212529;
background-color: #f8f9fa;
border-color: #f8f9fa
}
.btn-light:hover {
color: #212529;
background-color: #e2e6ea;
border-color: #dae0e5
}
.btn-light.focus,
.btn-light:focus {
box-shadow: 0 0 0 .2rem rgba(216, 217, 219, .5)
}
.btn-light.disabled,
.btn-light:disabled {
color: #212529;
background-color: #f8f9fa;
border-color: #f8f9fa
}
.btn-light:not(:disabled):not(.disabled).active,
.btn-light:not(:disabled):not(.disabled):active,
.show>.btn-light.dropdown-toggle {
color: #212529;
background-color: #dae0e5;
border-color: #d3d9df
}
.btn-light:not(:disabled):not(.disabled).active:focus,
.btn-light:not(:disabled):not(.disabled):active:focus,
.show>.btn-light.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(216, 217, 219, .5)
}
.btn-dark {
color: #fff;
background-color: #343a40;
border-color: #343a40
}
.btn-dark:hover {
color: #fff;
background-color: #23272b;
border-color: #1d2124
}
.btn-dark.focus,
.btn-dark:focus {
box-shadow: 0 0 0 .2rem rgba(82, 88, 93, .5)
}
.btn-dark.disabled,
.btn-dark:disabled {
color: #fff;
background-color: #343a40;
border-color: #343a40
}
.btn-dark:not(:disabled):not(.disabled).active,
.btn-dark:not(:disabled):not(.disabled):active,
.show>.btn-dark.dropdown-toggle {
color: #fff;
background-color: #1d2124;
border-color: #171a1d
}
.btn-dark:not(:disabled):not(.disabled).active:focus,
.btn-dark:not(:disabled):not(.disabled):active:focus,
.show>.btn-dark.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(82, 88, 93, .5)
}
.btn-outline-primary {
color: #007bff;
border-color: #007bff
}
.btn-outline-primary:hover {
color: #fff;
background-color: #007bff;
border-color: #007bff
}
.btn-outline-primary.focus,
.btn-outline-primary:focus {
box-shadow: 0 0 0 .2rem rgba(0, 123, 255, .5)
}
.btn-outline-primary.disabled,
.btn-outline-primary:disabled {
color: #007bff;
background-color: transparent
}
.btn-outline-primary:not(:disabled):not(.disabled).active,
.btn-outline-primary:not(:disabled):not(.disabled):active,
.show>.btn-outline-primary.dropdown-toggle {
color: #fff;
background-color: #007bff;
border-color: #007bff
}
.btn-outline-primary:not(:disabled):not(.disabled).active:focus,
.btn-outline-primary:not(:disabled):not(.disabled):active:focus,
.show>.btn-outline-primary.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(0, 123, 255, .5)
}
.btn-outline-secondary {
color: #6c757d;
border-color: #6c757d
}
.btn-outline-secondary:hover {
color: #fff;
background-color: #6c757d;
border-color: #6c757d
}
.btn-outline-secondary.focus,
.btn-outline-secondary:focus {
box-shadow: 0 0 0 .2rem rgba(108, 117, 125, .5)
}
.btn-outline-secondary.disabled,
.btn-outline-secondary:disabled {
color: #6c757d;
background-color: transparent
}
.btn-outline-secondary:not(:disabled):not(.disabled).active,
.btn-outline-secondary:not(:disabled):not(.disabled):active,
.show>.btn-outline-secondary.dropdown-toggle {
color: #fff;
background-color: #6c757d;
border-color: #6c757d
}
.btn-outline-secondary:not(:disabled):not(.disabled).active:focus,
.btn-outline-secondary:not(:disabled):not(.disabled):active:focus,
.show>.btn-outline-secondary.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(108, 117, 125, .5)
}
.btn-outline-success {
color: #28a745;
border-color: #28a745
}
.btn-outline-success:hover {
color: #fff;
background-color: #28a745;
border-color: #28a745
}
.btn-outline-success.focus,
.btn-outline-success:focus {
box-shadow: 0 0 0 .2rem rgba(40, 167, 69, .5)
}
.btn-outline-success.disabled,
.btn-outline-success:disabled {
color: #28a745;
background-color: transparent
}
.btn-outline-success:not(:disabled):not(.disabled).active,
.btn-outline-success:not(:disabled):not(.disabled):active,
.show>.btn-outline-success.dropdown-toggle {
color: #fff;
background-color: #28a745;
border-color: #28a745
}
.btn-outline-success:not(:disabled):not(.disabled).active:focus,
.btn-outline-success:not(:disabled):not(.disabled):active:focus,
.show>.btn-outline-success.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(40, 167, 69, .5)
}
.btn-outline-info {
color: #17a2b8;
border-color: #17a2b8
}
.btn-outline-info:hover {
color: #fff;
background-color: #17a2b8;
border-color: #17a2b8
}
.btn-outline-info.focus,
.btn-outline-info:focus {
box-shadow: 0 0 0 .2rem rgba(23, 162, 184, .5)
}
.btn-outline-info.disabled,
.btn-outline-info:disabled {
color: #17a2b8;
background-color: transparent
}
.btn-outline-info:not(:disabled):not(.disabled).active,
.btn-outline-info:not(:disabled):not(.disabled):active,
.show>.btn-outline-info.dropdown-toggle {
color: #fff;
background-color: #17a2b8;
border-color: #17a2b8
}
.btn-outline-info:not(:disabled):not(.disabled).active:focus,
.btn-outline-info:not(:disabled):not(.disabled):active:focus,
.show>.btn-outline-info.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(23, 162, 184, .5)
}
.btn-outline-warning {
color: #ffc107;
border-color: #ffc107
}
.btn-outline-warning:hover {
color: #212529;
background-color: #ffc107;
border-color: #ffc107
}
.btn-outline-warning.focus,
.btn-outline-warning:focus {
box-shadow: 0 0 0 .2rem rgba(255, 193, 7, .5)
}
.btn-outline-warning.disabled,
.btn-outline-warning:disabled {
color: #ffc107;
background-color: transparent
}
.btn-outline-warning:not(:disabled):not(.disabled).active,
.btn-outline-warning:not(:disabled):not(.disabled):active,
.show>.btn-outline-warning.dropdown-toggle {
color: #212529;
background-color: #ffc107;
border-color: #ffc107
}
.btn-outline-warning:not(:disabled):not(.disabled).active:focus,
.btn-outline-warning:not(:disabled):not(.disabled):active:focus,
.show>.btn-outline-warning.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(255, 193, 7, .5)
}
.btn-outline-danger {
color: #dc3545;
border-color: #dc3545
}
.btn-outline-danger:hover {
color: #fff;
background-color: #dc3545;
border-color: #dc3545
}
.btn-outline-danger.focus,
.btn-outline-danger:focus {
box-shadow: 0 0 0 .2rem rgba(220, 53, 69, .5)
}
.btn-outline-danger.disabled,
.btn-outline-danger:disabled {
color: #dc3545;
background-color: transparent
}
.btn-outline-danger:not(:disabled):not(.disabled).active,
.btn-outline-danger:not(:disabled):not(.disabled):active,
.show>.btn-outline-danger.dropdown-toggle {
color: #fff;
background-color: #dc3545;
border-color: #dc3545
}
.btn-outline-danger:not(:disabled):not(.disabled).active:focus,
.btn-outline-danger:not(:disabled):not(.disabled):active:focus,
.show>.btn-outline-danger.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(220, 53, 69, .5)
}
.btn-outline-light {
color: #f8f9fa;
border-color: #f8f9fa
}
.btn-outline-light:hover {
color: #212529;
background-color: #f8f9fa;
border-color: #f8f9fa
}
.btn-outline-light.focus,
.btn-outline-light:focus {
box-shadow: 0 0 0 .2rem rgba(248, 249, 250, .5)
}
.btn-outline-light.disabled,
.btn-outline-light:disabled {
color: #f8f9fa;
background-color: transparent
}
.btn-outline-light:not(:disabled):not(.disabled).active,
.btn-outline-light:not(:disabled):not(.disabled):active,
.show>.btn-outline-light.dropdown-toggle {
color: #212529;
background-color: #f8f9fa;
border-color: #f8f9fa
}
.btn-outline-light:not(:disabled):not(.disabled).active:focus,
.btn-outline-light:not(:disabled):not(.disabled):active:focus,
.show>.btn-outline-light.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(248, 249, 250, .5)
}
.btn-outline-dark {
color: #343a40;
border-color: #343a40
}
.btn-outline-dark:hover {
color: #fff;
background-color: #343a40;
border-color: #343a40
}
.btn-outline-dark.focus,
.btn-outline-dark:focus {
box-shadow: 0 0 0 .2rem rgba(52, 58, 64, .5)
}
.btn-outline-dark.disabled,
.btn-outline-dark:disabled {
color: #343a40;
background-color: transparent
}
.btn-outline-dark:not(:disabled):not(.disabled).active,
.btn-outline-dark:not(:disabled):not(.disabled):active,
.show>.btn-outline-dark.dropdown-toggle {
color: #fff;
background-color: #343a40;
border-color: #343a40
}
.btn-outline-dark:not(:disabled):not(.disabled).active:focus,
.btn-outline-dark:not(:disabled):not(.disabled):active:focus,
.show>.btn-outline-dark.dropdown-toggle:focus {
box-shadow: 0 0 0 .2rem rgba(52, 58, 64, .5)
}
.btn-link {
font-weight: 400;
color: #007bff;
text-decoration: none
}
.btn-link:hover {
color: #0056b3;
text-decoration: underline
}
.btn-link.focus,
.btn-link:focus {
text-decoration: underline;
box-shadow: none
}
.btn-link.disabled,
.btn-link:disabled {
color: #6c757d;
pointer-events: none
}
.btn-group-lg>.btn,
.btn-lg {
padding: .5rem 1rem;
font-size: 1.25rem;
line-height: 1.5;
border-radius: .3rem
}
.btn-group-sm>.btn,
.btn-sm {
padding: .25rem .5rem;
font-size: .875rem;
line-height: 1.5;
border-radius: .2rem
}
.btn-block {
display: block;
width: 100%
}
.btn-block+.btn-block {
margin-top: .5rem
}
input[type=button].btn-block,
input[type=reset].btn-block,
input[type=submit].btn-block {
width: 100%
}
.fade {
transition: opacity .15s linear
}
@media (prefers-reduced-motion:reduce) {
.fade {
transition: none
}
}
.fade:not(.show) {
opacity: 0
}
.collapse:not(.show) {
display: none
}
.collapsing {
position: relative;
height: 0;
overflow: hidden;
transition: height .35s ease
}
@media (prefers-reduced-motion:reduce) {
.collapsing {
transition: none
}
}
.dropdown,
.dropleft,
.dropright,
.dropup {
position: relative
}
.dropdown-toggle {
white-space: nowrap
}
.dropdown-toggle::after {
display: inline-block;
margin-left: .255em;
vertical-align: .255em;
content: "";
border-top: .3em solid;
border-right: .3em solid transparent;
border-bottom: 0;
border-left: .3em solid transparent
}
.dropdown-toggle:empty::after {
margin-left: 0
}
.dropdown-menu {
position: absolute;
top: 100%;
left: 0;
z-index: 1000;
display: none;
float: left;
min-width: 10rem;
padding: .5rem 0;
margin: .125rem 0 0;
font-size: 1rem;
color: #212529;
text-align: left;
list-style: none;
background-color: #fff;
background-clip: padding-box;
border: 1px solid rgba(0, 0, 0, .15);
border-radius: .25rem
}
.dropdown-menu-left {
right: auto;
left: 0
}
.dropdown-menu-right {
right: 0;
left: auto
}
@media (min-width:576px) {
.dropdown-menu-sm-left {
right: auto;
left: 0
}
.dropdown-menu-sm-right {
right: 0;
left: auto
}
}
@media (min-width:768px) {
.dropdown-menu-md-left {
right: auto;
left: 0
}
.dropdown-menu-md-right {
right: 0;
left: auto
}
}
@media (min-width:992px) {
.dropdown-menu-lg-left {
right: auto;
left: 0
}
.dropdown-menu-lg-right {
right: 0;
left: auto
}
}
@media (min-width:1200px) {
.dropdown-menu-xl-left {
right: auto;
left: 0
}
.dropdown-menu-xl-right {
right: 0;
left: auto
}
}
.dropup .dropdown-menu {
top: auto;
bottom: 100%;
margin-top: 0;
margin-bottom: .125rem
}
.dropup .dropdown-toggle::after {
display: inline-block;
margin-left: .255em;
vertical-align: .255em;
content: "";
border-top: 0;
border-right: .3em solid transparent;
border-bottom: .3em solid;
border-left: .3em solid transparent
}
.dropup .dropdown-toggle:empty::after {
margin-left: 0
}
.dropright .dropdown-menu {
top: 0;
right: auto;
left: 100%;
margin-top: 0;
margin-left: .125rem
}
.dropright .dropdown-toggle::after {
display: inline-block;
margin-left: .255em;
vertical-align: .255em;
content: "";
border-top: .3em solid transparent;
border-right: 0;
border-bottom: .3em solid transparent;
border-left: .3em solid
}
.dropright .dropdown-toggle:empty::after {
margin-left: 0
}
.dropright .dropdown-toggle::after {
vertical-align: 0
}
.dropleft .dropdown-menu {
top: 0;
right: 100%;
left: auto;
margin-top: 0;
margin-right: .125rem
}
.dropleft .dropdown-toggle::after {
display: inline-block;
margin-left: .255em;
vertical-align: .255em;
content: ""
}
.dropleft .dropdown-toggle::after {
display: none
}
.dropleft .dropdown-toggle::before {
display: inline-block;
margin-right: .255em;
vertical-align: .255em;
content: "";
border-top: .3em solid transparent;
border-right: .3em solid;
border-bottom: .3em solid transparent
}
.dropleft .dropdown-toggle:empty::after {
margin-left: 0
}
.dropleft .dropdown-toggle::before {
vertical-align: 0
}
.dropdown-menu[x-placement^=bottom],
.dropdown-menu[x-placement^=left],
.dropdown-menu[x-placement^=right],
.dropdown-menu[x-placement^=top] {
right: auto;
bottom: auto
}
.dropdown-divider {
height: 0;
margin: .5rem 0;
overflow: hidden;
border-top: 1px solid #e9ecef
}
.dropdown-item {
display: block;
width: 100%;
padding: .25rem 1.5rem;
clear: both;
font-weight: 400;
color: #212529;
text-align: inherit;
white-space: nowrap;
background-color: transparent;
border: 0
}
.dropdown-item:focus,
.dropdown-item:hover {
color: #16181b;
text-decoration: none;
background-color: #f8f9fa
}
.dropdown-item.active,
.dropdown-item:active {
color: #fff;
text-decoration: none;
background-color: #007bff
}
.dropdown-item.disabled,
.dropdown-item:disabled {
color: #6c757d;
pointer-events: none;
background-color: transparent
}
.dropdown-menu.show {
display: block
}
.dropdown-header {
display: block;
padding: .5rem 1.5rem;
margin-bottom: 0;
font-size: .875rem;
color: #6c757d;
white-space: nowrap
}
.dropdown-item-text {
display: block;
padding: .25rem 1.5rem;
color: #212529
}
.btn-group,
.btn-group-vertical {
position: relative;
display: -ms-inline-flexbox;
display: inline-flex;
vertical-align: middle
}
.btn-group-vertical>.btn,
.btn-group>.btn {
position: relative;
-ms-flex: 1 1 auto;
flex: 1 1 auto
}
.btn-group-vertical>.btn:hover,
.btn-group>.btn:hover {
z-index: 1
}
.btn-group-vertical>.btn.active,
.btn-group-vertical>.btn:active,
.btn-group-vertical>.btn:focus,
.btn-group>.btn.active,
.btn-group>.btn:active,
.btn-group>.btn:focus {
z-index: 1
}
.btn-toolbar {
display: -ms-flexbox;
display: flex;
-ms-flex-wrap: wrap;
flex-wrap: wrap;
-ms-flex-pack: start;
justify-content: flex-start
}
.btn-toolbar .input-group {
width: auto
}
.btn-group>.btn-group:not(:first-child),
.btn-group>.btn:not(:first-child) {
margin-left: -1px
}
.btn-group>.btn-group:not(:last-child)>.btn,
.btn-group>.btn:not(:last-child):not(.dropdown-toggle) {
border-top-right-radius: 0;
border-bottom-right-radius: 0
}
.btn-group>.btn-group:not(:first-child)>.btn,
.btn-group>.btn:not(:first-child) {
border-top-left-radius: 0;
border-bottom-left-radius: 0
}
.dropdown-toggle-split {
padding-right: .5625rem;
padding-left: .5625rem
}
.dropdown-toggle-split::after,
.dropright .dropdown-toggle-split::after,
.dropup .dropdown-toggle-split::after {
margin-left: 0
}
.dropleft .dropdown-toggle-split::before {
margin-right: 0
}
.btn-group-sm>.btn+.dropdown-toggle-split,
.btn-sm+.dropdown-toggle-split {
padding-right: .375rem;
padding-left: .375rem
}
.btn-group-lg>.btn+.dropdown-toggle-split,
.btn-lg+.dropdown-toggle-split {
padding-right: .75rem;
padding-left: .75rem
}
.btn-group-vertical {
-ms-flex-direction: column;
flex-direction: column;
-ms-flex-align: start;
align-items: flex-start;
-ms-flex-pack: center;
justify-content: center
}
.btn-group-vertical>.btn,
.btn-group-vertical>.btn-group {
width: 100%
}
.btn-group-vertical>.btn-group:not(:first-child),
.btn-group-vertical>.btn:not(:first-child) {
margin-top: -1px
}
.btn-group-vertical>.btn-group:not(:last-child)>.btn,
.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle) {
border-bottom-right-radius: 0;
border-bottom-left-radius: 0
}
.btn-group-vertical>.btn-group:not(:first-child)>.btn,
.btn-group-vertical>.btn:not(:first-child) {
border-top-left-radius: 0;
border-top-right-radius: 0
}
.btn-group-toggle>.btn,
.btn-group-toggle>.btn-group>.btn {
margin-bottom: 0
}
.btn-group-toggle>.btn input[type=checkbox],
.btn-group-toggle>.btn input[type=radio],
.btn-group-toggle>.btn-group>.btn input[type=checkbox],
.btn-group-toggle>.btn-group>.btn input[type=radio] {
position: absolute;
clip: rect(0, 0, 0, 0);
pointer-events: none
}
.input-group {
position: relative;
display: -ms-flexbox;
display: flex;
-ms-flex-wrap: wrap;
flex-wrap: wrap;
-ms-flex-align: stretch;
align-items: stretch;
width: 100%
}
.input-group>.custom-file,
.input-group>.custom-select,
.input-group>.form-control,
.input-group>.form-control-plaintext {
position: relative;
-ms-flex: 1 1 auto;
flex: 1 1 auto;
width: 1%;
margin-bottom: 0
}
.input-group>.custom-file+.custom-file,
.input-group>.custom-file+.custom-select,
.input-group>.custom-file+.form-control,
.input-group>.custom-select+.custom-file,
.input-group>.custom-select+.custom-select,
.input-group>.custom-select+.form-control,
.input-group>.form-control+.custom-file,
.input-group>.form-control+.custom-select,
.input-group>.form-control+.form-control,
.input-group>.form-control-plaintext+.custom-file,
.input-group>.form-control-plaintext+.custom-select,
.input-group>.form-control-plaintext+.form-control {
margin-left: -1px
}
.input-group>.custom-file .custom-file-input:focus~.custom-file-label,
.input-group>.custom-select:focus,
.input-group>.form-control:focus {
z-index: 3
}
.input-group>.custom-file .custom-file-input:focus {
z-index: 4
}
.input-group>.custom-select:not(:last-child),
.input-group>.form-control:not(:last-child) {
border-top-right-radius: 0;
border-bottom-right-radius: 0
}
.input-group>.custom-select:not(:first-child),
.input-group>.form-control:not(:first-child) {
border-top-left-radius: 0;
border-bottom-left-radius: 0
}
.input-group>.custom-file {
display: -ms-flexbox;
display: flex;
-ms-flex-align: center;
align-items: center
}
.input-group>.custom-file:not(:last-child) .custom-file-label,
.input-group>.custom-file:not(:last-child) .custom-file-label::after {
border-top-right-radius: 0;
border-bottom-right-radius: 0
}
.input-group>.custom-file:not(:first-child) .custom-file-label {
border-top-left-radius: 0;
border-bottom-left-radius: 0
}
.input-group-append,
.input-group-prepend {
display: -ms-flexbox;
display: flex
}
.input-group-append .btn,
.input-group-prepend .btn {
position: relative;
z-index: 2
}
.input-group-append .btn:focus,
.input-group-prepend .btn:focus {
z-index: 3
}
.input-group-append .btn+.btn,
.input-group-append .btn+.input-group-text,
.input-group-append .input-group-text+.btn,
.input-group-append .input-group-text+.input-group-text,
.input-group-prepend .btn+.btn,
.input-group-prepend .btn+.input-group-text,
.input-group-prepend .input-group-text+.btn,
.input-group-prepend .input-group-text+.input-group-text {
margin-left: -1px
}
.input-group-prepend {
margin-right: -1px
}
.input-group-append {
margin-left: -1px
}
.input-group-text {
display: -ms-flexbox;
display: flex;
-ms-flex-align: center;
align-items: center;
padding: .375rem .75rem;
margin-bottom: 0;
font-size: 1rem;
font-weight: 400;
line-height: 1.5;
color: #495057;
text-align: center;
white-space: nowrap;
background-color: #e9ecef;
border: 1px solid #ced4da;
border-radius: .25rem
}
.input-group-text input[type=checkbox],
.input-group-text input[type=radio] {
margin-top: 0
}
.input-group-lg>.custom-select,
.input-group-lg>.form-control:not(textarea) {
height: calc(1.5em + 1rem + 2px)
}
.input-group-lg>.custom-select,
.input-group-lg>.form-control,
.input-group-lg>.input-group-append>.btn,
.input-group-lg>.input-group-append>.input-group-text,
.input-group-lg>.input-group-prepend>.btn,
.input-group-lg>.input-group-prepend>.input-group-text {
padding: .5rem 1rem;
font-size: 1.25rem;
line-height: 1.5;
border-radius: .3rem
}
.input-group-sm>.custom-select,
.input-group-sm>.form-control:not(textarea) {
height: calc(1.5em + .5rem + 2px)
}
.input-group-sm>.custom-select,
.input-group-sm>.form-control,
.input-group-sm>.input-group-append>.btn,
.input-group-sm>.input-group-append>.input-group-text,
.input-group-sm>.input-group-prepend>.btn,
.input-group-sm>.input-group-prepend>.input-group-text {
padding: .25rem .5rem;
font-size: .875rem;
line-height: 1.5;
border-radius: .2rem
}
.input-group-lg>.custom-select,
.input-group-sm>.custom-select {
padding-right: 1.75rem
}
.input-group>.input-group-append:last-child>.btn:not(:last-child):not(.dropdown-toggle),
.input-group>.input-group-append:last-child>.input-group-text:not(:last-child),
.input-group>.input-group-append:not(:last-child)>.btn,
.input-group>.input-group-append:not(:last-child)>.input-group-text,
.input-group>.input-group-prepend>.btn,
.input-group>.input-group-prepend>.input-group-text {
border-top-right-radius: 0;
border-bottom-right-radius: 0
}
.input-group>.input-group-append>.btn,
.input-group>.input-group-append>.input-group-text,
.input-group>.input-group-prepend:first-child>.btn:not(:first-child),
.input-group>.input-group-prepend:first-child>.input-group-text:not(:first-child),
.input-group>.input-group-prepend:not(:first-child)>.btn,
.input-group>.input-group-prepend:not(:first-child)>.input-group-text {
border-top-left-radius: 0;
border-bottom-left-radius: 0
}
.custom-control {
position: relative;
display: block;
min-height: 1.5rem;
padding-left: 1.5rem
}
.custom-control-inline {
display: -ms-inline-flexbox;
display: inline-flex;
margin-right: 1rem
}
.custom-control-input {
position: absolute;
z-index: -1;
opacity: 0
}
.custom-control-input:checked~.custom-control-label::before {
color: #fff;
border-color: #007bff;
background-color: #007bff
}
.custom-control-input:focus~.custom-control-label::before {
box-shadow: 0 0 0 .2rem rgba(0, 123, 255, .25)
}
.custom-control-input:focus:not(:checked)~.custom-control-label::before {
border-color: #80bdff
}
.custom-control-input:not(:disabled):active~.custom-control-label::before {
color: #fff;
background-color: #b3d7ff;
border-color: #b3d7ff
}
.custom-control-input:disabled~.custom-control-label {
color: #6c757d
}
.custom-control-input:disabled~.custom-control-label::before {
background-color: #e9ecef
}
.custom-control-label {
position: relative;
margin-bottom: 0;
vertical-align: top
}
.custom-control-label::before {
position: absolute;
top: .25rem;
left: -1.5rem;
display: block;
width: 1rem;
height: 1rem;
pointer-events: none;
content: "";
background-color: #fff;
border: #adb5bd solid 1px
}
.custom-control-label::after {
position: absolute;
top: .25rem;
left: -1.5rem;
display: block;
width: 1rem;
height: 1rem;
content: "";
background: no-repeat 50%/50% 50%
}
.custom-checkbox .custom-control-label::before {
border-radius: .25rem
}
.custom-checkbox .custom-control-input:checked~.custom-control-label::after {
background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3e%3c/svg%3e")
}
.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::before {
border-color: #007bff;
background-color: #007bff
}
.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::after {
background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3e%3cpath stroke='%23fff' d='M0 2h4'/%3e%3c/svg%3e")
}
.custom-checkbox .custom-control-input:disabled:checked~.custom-control-label::before {
background-color: rgba(0, 123, 255, .5)
}
.custom-checkbox .custom-control-input:disabled:indeterminate~.custom-control-label::before {
background-color: rgba(0, 123, 255, .5)
}
.custom-radio .custom-control-label::before {
border-radius: 50%
}
.custom-radio .custom-control-input:checked~.custom-control-label::after {
background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")
}
.custom-radio .custom-control-input:disabled:checked~.custom-control-label::before {
background-color: rgba(0, 123, 255, .5)
}
.custom-switch {
padding-left: 2.25rem
}
.custom-switch .custom-control-label::before {
left: -2.25rem;
width: 1.75rem;
pointer-events: all;
border-radius: .5rem
}
.custom-switch .custom-control-label::after {
top: calc(.25rem + 2px);
left: calc(-2.25rem + 2px);
width: calc(1rem - 4px);
height: calc(1rem - 4px);
background-color: #adb5bd;
border-radius: .5rem;
transition: background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out, -webkit-transform .15s ease-in-out;
transition: transform .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out;
transition: transform .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out, -webkit-transform .15s ease-in-out
}
@media (prefers-reduced-motion:reduce) {
.custom-switch .custom-control-label::after {
transition: none
}
}
.custom-switch .custom-control-input:checked~.custom-control-label::after {
background-color: #fff;
-webkit-transform: translateX(.75rem);
transform: translateX(.75rem)
}
.custom-switch .custom-control-input:disabled:checked~.custom-control-label::before {
background-color: rgba(0, 123, 255, .5)
}
.custom-select {
display: inline-block;
width: 100%;
height: calc(1.5em + .75rem + 2px);
padding: .375rem 1.75rem .375rem .75rem;
font-size: 1rem;
font-weight: 400;
line-height: 1.5;
color: #495057;
vertical-align: middle;
background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right .75rem center/8px 10px;
background-color: #fff;
border: 1px solid #ced4da;
border-radius: .25rem;
-webkit-appearance: none;
-moz-appearance: none;
appearance: none
}
.custom-select:focus {
border-color: #80bdff;
outline: 0;
box-shadow: 0 0 0 .2rem rgba(0, 123, 255, .25)
}
.custom-select:focus::-ms-value {
color: #495057;
background-color: #fff
}
.custom-select[multiple],
.custom-select[size]:not([size="1"]) {
height: auto;
padding-right: .75rem;
background-image: none
}
.custom-select:disabled {
color: #6c757d;
background-color: #e9ecef
}
.custom-select::-ms-expand {
display: none
}
.custom-select-sm {
height: calc(1.5em + .5rem + 2px);
padding-top: .25rem;
padding-bottom: .25rem;
padding-left: .5rem;
font-size: .875rem
}
.custom-select-lg {
height: calc(1.5em + 1rem + 2px);
padding-top: .5rem;
padding-bottom: .5rem;
padding-left: 1rem;
font-size: 1.25rem
}
.custom-file {
position: relative;
display: inline-block;
width: 100%;
height: calc(1.5em + .75rem + 2px);
margin-bottom: 0
}
.custom-file-input {
position: relative;
z-index: 2;
width: 100%;
height: calc(1.5em + .75rem + 2px);
margin: 0;
opacity: 0
}
.custom-file-input:focus~.custom-file-label {
border-color: #80bdff;
box-shadow: 0 0 0 .2rem rgba(0, 123, 255, .25)
}
.custom-file-input:disabled~.custom-file-label {
background-color: #e9ecef
}
.custom-file-input:lang(en)~.custom-file-label::after {
content: "Browse"
}
.custom-file-input~.custom-file-label[data-browse]::after {
content: attr(data-browse)
}
.custom-file-label {
position: absolute;
top: 0;
right: 0;
left: 0;
z-index: 1;
height: calc(1.5em + .75rem + 2px);
padding: .375rem .75rem;
font-weight: 400;
line-height: 1.5;
color: #495057;
background-color: #fff;
border: 1px solid #ced4da;
border-radius: .25rem
}
.custom-file-label::after {
position: absolute;
top: 0;
right: 0;
bottom: 0;
z-index: 3;
display: block;
height: calc(1.5em + .75rem);
padding: .375rem .75rem;
line-height: 1.5;
color: #495057;
content: "Browse";
background-color: #e9ecef;
border-left: inherit;
border-radius: 0 .25rem .25rem 0
}
.custom-range {
width: 100%;
height: calc(1rem + .4rem);
padding: 0;
background-color: transparent;
-webkit-appearance: none;
-moz-appearance: none;
appearance: none
}
.custom-range:focus {
outline: 0
}
.custom-range:focus::-webkit-slider-thumb {
box-shadow: 0 0 0 1px #fff, 0 0 0 .2rem rgba(0, 123, 255, .25)
}
.custom-range:focus::-moz-range-thumb {
box-shadow: 0 0 0 1px #fff, 0 0 0 .2rem rgba(0, 123, 255, .25)
}
.custom-range:focus::-ms-thumb {
box-shadow: 0 0 0 1px #fff, 0 0 0 .2rem rgba(0, 123, 255, .25)
}
.custom-range::-moz-focus-outer {
border: 0
}
.custom-range::-webkit-slider-thumb {
width: 1rem;
height: 1rem;
margin-top: -.25rem;
background-color: #007bff;
border: 0;
border-radius: 1rem;
transition: background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out;
-webkit-appearance: none;
appearance: none
}
@media (prefers-reduced-motion:reduce) {
.custom-range::-webkit-slider-thumb {
transition: none
}
}
.custom-range::-webkit-slider-thumb:active {
background-color: #b3d7ff
}
.custom-range::-webkit-slider-runnable-track {
width: 100%;
height: .5rem;
color: transparent;
cursor: pointer;
background-color: #dee2e6;
border-color: transparent;
border-radius: 1rem
}
.custom-range::-moz-range-thumb {
width: 1rem;
height: 1rem;
background-color: #007bff;
border: 0;
border-radius: 1rem;
transition: background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out;
-moz-appearance: none;
appearance: none
}
@media (prefers-reduced-motion:reduce) {
.custom-range::-moz-range-thumb {
transition: none
}
}
.custom-range::-moz-range-thumb:active {
background-color: #b3d7ff
}
.custom-range::-moz-range-track {
width: 100%;
height: .5rem;
color: transparent;
cursor: pointer;
background-color: #dee2e6;
border-color: transparent;
border-radius: 1rem
}
.custom-range::-ms-thumb {
width: 1rem;
height: 1rem;
margin-top: 0;
margin-right: .2rem;
margin-left: .2rem;
background-color: #007bff;
border: 0;
border-radius: 1rem;
transition: background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out;
appearance: none
}
@media (prefers-reduced-motion:reduce) {
.custom-range::-ms-thumb {
transition: none
}
}
.custom-range::-ms-thumb:active {
background-color: #b3d7ff
}
.custom-range::-ms-track {
width: 100%;
height: .5rem;
color: transparent;
cursor: pointer;
background-color: transparent;
border-color: transparent;
border-width: .5rem
}
.custom-range::-ms-fill-lower {
background-color: #dee2e6;
border-radius: 1rem
}
.custom-range::-ms-fill-upper {
margin-right: 15px;
background-color: #dee2e6;
border-radius: 1rem
}
.custom-range:disabled::-webkit-slider-thumb {
background-color: #adb5bd
}
.custom-range:disabled::-webkit-slider-runnable-track {
cursor: default
}
.custom-range:disabled::-moz-range-thumb {
background-color: #adb5bd
}
.custom-range:disabled::-moz-range-track {
cursor: default
}
.custom-range:disabled::-ms-thumb {
background-color: #adb5bd
}
.custom-control-label::before,
.custom-file-label,
.custom-select {
transition: background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out
}
@media (prefers-reduced-motion:reduce) {
.custom-control-label::before,
.custom-file-label,
.custom-select {
transition: none
}
}
.nav {
display: -ms-flexbox;
display: flex;
-ms-flex-wrap: wrap;
flex-wrap: wrap;
padding-left: 0;
margin-bottom: 0;
list-style: none
}
.nav-link {
display: block;
padding: .5rem 1rem
}
.nav-link:focus,
.nav-link:hover {
text-decoration: none
}
.nav-link.disabled {
color: #6c757d;
pointer-events: none;
cursor: default
}
.nav-tabs {
border-bottom: 1px solid #dee2e6
}
.nav-tabs .nav-item {
margin-bottom: -1px
}
.nav-tabs .nav-link {
border: 1px solid transparent;
border-top-left-radius: .25rem;
border-top-right-radius: .25rem
}
.nav-tabs .nav-link:focus,
.nav-tabs .nav-link:hover {
border-color: #e9ecef #e9ecef #dee2e6
}
.nav-tabs .nav-link.disabled {
color: #6c757d;
background-color: transparent;
border-color: transparent
}
.nav-tabs .nav-item.show .nav-link,
.nav-tabs .nav-link.active {
color: #495057;
background-color: #fff;
border-color: #dee2e6 #dee2e6 #fff
}
.nav-tabs .dropdown-menu {
margin-top: -1px;
border-top-left-radius: 0;
border-top-right-radius: 0
}
.nav-pills .nav-link {
border-radius: .25rem
}
.nav-pills .nav-link.active,
.nav-pills .show>.nav-link {
color: #fff;
background-color: #007bff
}
.nav-fill .nav-item {
-ms-flex: 1 1 auto;
flex: 1 1 auto;
text-align: center
}
.nav-justified .nav-item {
-ms-flex-preferred-size: 0;
flex-basis: 0;
-ms-flex-positive: 1;
flex-grow: 1;
text-align: center
}
.tab-content>.tab-pane {
display: none
}
.tab-content>.active {
display: block
}
.navbar {
position: relative;
display: -ms-flexbox;
display: flex;
-ms-flex-wrap: wrap;
flex-wrap: wrap;
-ms-flex-align: center;
align-items: center;
-ms-flex-pack: justify;
justify-content: space-between;
padding: .5rem 1rem
}
.navbar>.container,
.navbar>.container-fluid {
display: -ms-flexbox;
display: flex;
-ms-flex-wrap: wrap;
flex-wrap: wrap;
-ms-flex-align: center;
align-items: center;
-ms-flex-pack: justify;
justify-content: space-between
}
.navbar-brand {
display: inline-block;
padding-top: .3125rem;
padding-bottom: .3125rem;
margin-right: 1rem;
font-size: 1.25rem;
line-height: inherit;
white-space: nowrap
}
.navbar-brand:focus,
.navbar-brand:hover {
text-decoration: none
}
.navbar-nav {
display: -ms-flexbox;
display: flex;
-ms-flex-direction: column;
flex-direction: column;
padding-left: 0;
margin-bottom: 0;
list-style: none
}
.navbar-nav .nav-link {
padding-right: 0;
padding-left: 0
}
.navbar-nav .dropdown-menu {
position: static;
float: none
}
.navbar-text {
display: inline-block;
padding-top: .5rem;
padding-bottom: .5rem
}
.navbar-collapse {
-ms-flex-preferred-size: 100%;
flex-basis: 100%;
-ms-flex-positive: 1;
flex-grow: 1;
-ms-flex-align: center;
align-items: center
}
.navbar-toggler {
padding: .25rem .75rem;
font-size: 1.25rem;
line-height: 1;
background-color: transparent;
border: 1px solid transparent;
border-radius: .25rem
}
.navbar-toggler:focus,
.navbar-toggler:hover {
text-decoration: none
}
.navbar-toggler-icon {
display: inline-block;
width: 1.5em;
height: 1.5em;
vertical-align: middle;
content: "";
background: no-repeat center center;
background-size: 100% 100%
}
@media (max-width:575.98px) {
.navbar-expand-sm>.container,
.navbar-expand-sm>.container-fluid {
padding-right: 0;
padding-left: 0
}
}
@media (min-width:576px) {
.navbar-expand-sm {
-ms-flex-flow: row nowrap;
flex-flow: row nowrap;
-ms-flex-pack: start;
justify-content: flex-start
}
.navbar-expand-sm .navbar-nav {
-ms-flex-direction: row;
flex-direction: row
}
.navbar-expand-sm .navbar-nav .dropdown-menu {
position: absolute
}
.navbar-expand-sm .navbar-nav .nav-link {
padding-right: .5rem;
padding-left: .5rem
}
.navbar-expand-sm>.container,
.navbar-expand-sm>.container-fluid {
-ms-flex-wrap: nowrap;
flex-wrap: nowrap
}
.navbar-expand-sm .navbar-collapse {
display: -ms-flexbox !important;
display: flex !important;
-ms-flex-preferred-size: auto;
flex-basis: auto
}
.navbar-expand-sm .navbar-toggler {
display: none
}
}
@media (max-width:767.98px) {
.navbar-expand-md>.container,
.navbar-expand-md>.container-fluid {
padding-right: 0;
padding-left: 0
}
}
@media (min-width:768px) {
.navbar-expand-md {
-ms-flex-flow: row nowrap;
flex-flow: row nowrap;
-ms-flex-pack: start;
justify-content: flex-start
}
.navbar-expand-md .navbar-nav {
-ms-flex-direction: row;
flex-direction: row
}
.navbar-expand-md .navbar-nav .dropdown-menu {
position: absolute
}
.navbar-expand-md .navbar-nav .nav-link {
padding-right: .5rem;
padding-left: .5rem
}
.navbar-expand-md>.container,
.navbar-expand-md>.container-fluid {
-ms-flex-wrap: nowrap;
flex-wrap: nowrap
}
.navbar-expand-md .navbar-collapse {
display: -ms-flexbox !important;
display: flex !important;
-ms-flex-preferred-size: auto;
flex-basis: auto
}
.navbar-expand-md .navbar-toggler {
display: none
}
}
@media (max-width:991.98px) {
.navbar-expand-lg>.container,
.navbar-expand-lg>.container-fluid {
padding-right: 0;
padding-left: 0
}
}
@media (min-width:992px) {
.navbar-expand-lg {
-ms-flex-flow: row nowrap;
flex-flow: row nowrap;
-ms-flex-pack: start;
justify-content: flex-start
}
.navbar-expand-lg .navbar-nav {
-ms-flex-direction: row;
flex-direction: row
}
.navbar-expand-lg .navbar-nav .dropdown-menu {
position: absolute
}
.navbar-expand-lg .navbar-nav .nav-link {
padding-right: .5rem;
padding-left: .5rem
}
.navbar-expand-lg>.container,
.navbar-expand-lg>.container-fluid {
-ms-flex-wrap: nowrap;
flex-wrap: nowrap
}
.navbar-expand-lg .navbar-collapse {
display: -ms-flexbox !important;
display: flex !important;
-ms-flex-preferred-size: auto;
flex-basis: auto
}
.navbar-expand-lg .navbar-toggler {
display: none
}
}
@media (max-width:1199.98px) {
.navbar-expand-xl>.container,
.navbar-expand-xl>.container-fluid {
padding-right: 0;
padding-left: 0
}
}
@media (min-width:1200px) {
.navbar-expand-xl {
-ms-flex-flow: row nowrap;
flex-flow: row nowrap;
-ms-flex-pack: start;
justify-content: flex-start
}
.navbar-expand-xl .navbar-nav {
-ms-flex-direction: row;
flex-direction: row
}
.navbar-expand-xl .navbar-nav .dropdown-menu {
position: absolute
}
.navbar-expand-xl .navbar-nav .nav-link {
padding-right: .5rem;
padding-left: .5rem
}
.navbar-expand-xl>.container,
.navbar-expand-xl>.container-fluid {
-ms-flex-wrap: nowrap;
flex-wrap: nowrap
}
.navbar-expand-xl .navbar-collapse {
display: -ms-flexbox !important;
display: flex !important;
-ms-flex-preferred-size: auto;
flex-basis: auto
}
.navbar-expand-xl .navbar-toggler {
display: none
}
}
.navbar-expand {
-ms-flex-flow: row nowrap;
flex-flow: row nowrap;
-ms-flex-pack: start;
justify-content: flex-start
}
.navbar-expand>.container,
.navbar-expand>.container-fluid {
padding-right: 0;
padding-left: 0
}
.navbar-expand .navbar-nav {
-ms-flex-direction: row;
flex-direction: row
}
.navbar-expand .navbar-nav .dropdown-menu {
position: absolute
}
.navbar-expand .navbar-nav .nav-link {
padding-right: .5rem;
padding-left: .5rem
}
.navbar-expand>.container,
.navbar-expand>.container-fluid {
-ms-flex-wrap: nowrap;
flex-wrap: nowrap
}
.navbar-expand .navbar-collapse {
display: -ms-flexbox !important;
display: flex !important;
-ms-flex-preferred-size: auto;
flex-basis: auto
}
.navbar-expand .navbar-toggler {
display: none
}
.navbar-light .navbar-brand {
color: rgba(0, 0, 0, .9)
}
.navbar-light .navbar-brand:focus,
.navbar-light .navbar-brand:hover {
color: rgba(0, 0, 0, .9)
}
.navbar-light .navbar-nav .nav-link {
color: rgba(0, 0, 0, .5)
}
.navbar-light .navbar-nav .nav-link:focus,
.navbar-light .navbar-nav .nav-link:hover {
color: rgba(0, 0, 0, .7)
}
.navbar-light .navbar-nav .nav-link.disabled {
color: rgba(0, 0, 0, .3)
}
.navbar-light .navbar-nav .active>.nav-link,
.navbar-light .navbar-nav .nav-link.active,
.navbar-light .navbar-nav .nav-link.show,
.navbar-light .navbar-nav .show>.nav-link {
color: rgba(0, 0, 0, .9)
}
.navbar-light .navbar-toggler {
color: rgba(0, 0, 0, .5);
border-color: rgba(0, 0, 0, .1)
}
.navbar-light .navbar-toggler-icon {
background-image: url("data:image/svg+xml,%3csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3e%3cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")
}
.navbar-light .navbar-text {
color: rgba(0, 0, 0, .5)
}
.navbar-light .navbar-text a {
color: rgba(0, 0, 0, .9)
}
.navbar-light .navbar-text a:focus,
.navbar-light .navbar-text a:hover {
color: rgba(0, 0, 0, .9)
}
.navbar-dark .navbar-brand {
color: #fff
}
.navbar-dark .navbar-brand:focus,
.navbar-dark .navbar-brand:hover {
color: #fff
}
.navbar-dark .navbar-nav .nav-link {
color: rgba(255, 255, 255, .5)
}
.navbar-dark .navbar-nav .nav-link:focus,
.navbar-dark .navbar-nav .nav-link:hover {
color: rgba(255, 255, 255, .75)
}
.navbar-dark .navbar-nav .nav-link.disabled {
color: rgba(255, 255, 255, .25)
}
.navbar-dark .navbar-nav .active>.nav-link,
.navbar-dark .navbar-nav .nav-link.active,
.navbar-dark .navbar-nav .nav-link.show,
.navbar-dark .navbar-nav .show>.nav-link {
color: #fff
}
.navbar-dark .navbar-toggler {
color: rgba(255, 255, 255, .5);
border-color: rgba(255, 255, 255, .1)
}
.navbar-dark .navbar-toggler-icon {
background-image: url("data:image/svg+xml,%3csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3e%3cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")
}
.navbar-dark .navbar-text {
color: rgba(255, 255, 255, .5)
}
.navbar-dark .navbar-text a {
color: #fff
}
.navbar-dark .navbar-text a:focus,
.navbar-dark .navbar-text a:hover {
color: #fff
}
.card {
position: relative;
display: -ms-flexbox;
display: flex;
-ms-flex-direction: column;
flex-direction: column;
min-width: 0;
word-wrap: break-word;
background-color: #fff;
background-clip: border-box;
border: 1px solid rgba(0, 0, 0, .125);
border-radius: .25rem
}
.card>hr {
margin-right: 0;
margin-left: 0
}
.card>.list-group:first-child .list-group-item:first-child {
border-top-left-radius: .25rem;
border-top-right-radius: .25rem
}
.card>.list-group:last-child .list-group-item:last-child {
border-bottom-right-radius: .25rem;
border-bottom-left-radius: .25rem
}
.card-body {
-ms-flex: 1 1 auto;
flex: 1 1 auto;
padding: 1.25rem
}
.card-title {
margin-bottom: .75rem
}
.card-subtitle {
margin-top: -.375rem;
margin-bottom: 0
}
.card-text:last-child {
margin-bottom: 0
}
.card-link:hover {
text-decoration: none
}
.card-link+.card-link {
margin-left: 1.25rem
}
.card-header {
padding: .75rem 1.25rem;
margin-bottom: 0;
background-color: rgba(0, 0, 0, .03);
border-bottom: 1px solid rgba(0, 0, 0, .125)
}
.card-header:first-child {
border-radius: calc(.25rem - 1px) calc(.25rem - 1px) 0 0
}
.card-header+.list-group .list-group-item:first-child {
border-top: 0
}
.card-footer {
padding: .75rem 1.25rem;
background-color: rgba(0, 0, 0, .03);
border-top: 1px solid rgba(0, 0, 0, .125)
}
.card-footer:last-child {
border-radius: 0 0 calc(.25rem - 1px) calc(.25rem - 1px)
}
.card-header-tabs {
margin-right: -.625rem;
margin-bottom: -.75rem;
margin-left: -.625rem;
border-bottom: 0
}
.card-header-pills {
margin-right: -.625rem;
margin-left: -.625rem
}
.card-img-overlay {
position: absolute;
top: 0;
right: 0;
bottom: 0;
left: 0;
padding: 1.25rem
}
.card-img {
width: 100%;
border-radius: calc(.25rem - 1px)
}
.card-img-top {
width: 100%;
border-top-left-radius: calc(.25rem - 1px);
border-top-right-radius: calc(.25rem - 1px)
}
.card-img-bottom {
width: 100%;
border-bottom-right-radius: calc(.25rem - 1px);
border-bottom-left-radius: calc(.25rem - 1px)
}
.card-deck {
display: -ms-flexbox;
display: flex;
-ms-flex-direction: column;
flex-direction: column
}
.card-deck .card {
margin-bottom: 15px
}
@media (min-width:576px) {
.card-deck {
-ms-flex-flow: row wrap;
flex-flow: row wrap;
margin-right: -15px;
margin-left: -15px
}
.card-deck .card {
display: -ms-flexbox;
display: flex;
-ms-flex: 1 0 0%;
flex: 1 0 0%;
-ms-flex-direction: column;
flex-direction: column;
margin-right: 15px;
margin-bottom: 0;
margin-left: 15px
}
}
.card-group {
display: -ms-flexbox;
display: flex;
-ms-flex-direction: column;
flex-direction: column
}
.card-group>.card {
margin-bottom: 15px
}
@media (min-width:576px) {
.card-group {
-ms-flex-flow: row wrap;
flex-flow: row wrap
}
.card-group>.card {
-ms-flex: 1 0 0%;
flex: 1 0 0%;
margin-bottom: 0
}
.card-group>.card+.card {
margin-left: 0;
border-left: 0
}
.card-group>.card:not(:last-child) {
border-top-right-radius: 0;
border-bottom-right-radius: 0
}
.card-group>.card:not(:last-child) .card-header,
.card-group>.card:not(:last-child) .card-img-top {
border-top-right-radius: 0
}
.card-group>.card:not(:last-child) .card-footer,
.card-group>.card:not(:last-child) .card-img-bottom {
border-bottom-right-radius: 0
}
.card-group>.card:not(:first-child) {
border-top-left-radius: 0;
border-bottom-left-radius: 0
}
.card-group>.card:not(:first-child) .card-header,
.card-group>.card:not(:first-child) .card-img-top {
border-top-left-radius: 0
}
.card-group>.card:not(:first-child) .card-footer,
.card-group>.card:not(:first-child) .card-img-bottom {
border-bottom-left-radius: 0
}
}
.card-columns .card {
margin-bottom: .75rem
}
@media (min-width:576px) {
.card-columns {
-webkit-column-count: 3;
-moz-column-count: 3;
column-count: 3;
-webkit-column-gap: 1.25rem;
-moz-column-gap: 1.25rem;
column-gap: 1.25rem;
orphans: 1;
widows: 1
}
.card-columns .card {
display: inline-block;
width: 100%
}
}
.accordion>.card {
overflow: hidden
}
.accordion>.card:not(:first-of-type) .card-header:first-child {
border-radius: 0
}
.accordion>.card:not(:first-of-type):not(:last-of-type) {
border-bottom: 0;
border-radius: 0
}
.accordion>.card:first-of-type {
border-bottom: 0;
border-bottom-right-radius: 0;
border-bottom-left-radius: 0
}
.accordion>.card:last-of-type {
border-top-left-radius: 0;
border-top-right-radius: 0
}
.accordion>.card .card-header {
margin-bottom: -1px
}
.breadcrumb {
display: -ms-flexbox;
display: flex;
-ms-flex-wrap: wrap;
flex-wrap: wrap;
padding: .75rem 1rem;
margin-bottom: 1rem;
list-style: none;
background-color: #e9ecef;
border-radius: .25rem
}
.breadcrumb-item+.breadcrumb-item {
padding-left: .5rem
}
.breadcrumb-item+.breadcrumb-item::before {
display: inline-block;
padding-right: .5rem;
color: #6c757d;
content: "/"
}
.breadcrumb-item+.breadcrumb-item:hover::before {
text-decoration: underline
}
.breadcrumb-item+.breadcrumb-item:hover::before {
text-decoration: none
}
.breadcrumb-item.active {
color: #6c757d
}
.pagination {
display: -ms-flexbox;
display: flex;
padding-left: 0;
list-style: none;
border-radius: .25rem
}
.page-link {
position: relative;
display: block;
padding: .5rem .75rem;
margin-left: -1px;
line-height: 1.25;
color: #007bff;
background-color: #fff;
border: 1px solid #dee2e6
}
.page-link:hover {
z-index: 2;
color: #0056b3;
text-decoration: none;
background-color: #e9ecef;
border-color: #dee2e6
}
.page-link:focus {
z-index: 2;
outline: 0;
box-shadow: 0 0 0 .2rem rgba(0, 123, 255, .25)
}
.page-item:first-child .page-link {
margin-left: 0;
border-top-left-radius: .25rem;
border-bottom-left-radius: .25rem
}
.page-item:last-child .page-link {
border-top-right-radius: .25rem;
border-bottom-right-radius: .25rem
}
.page-item.active .page-link {
z-index: 1;
color: #fff;
background-color: #007bff;
border-color: #007bff
}
.page-item.disabled .page-link {
color: #6c757d;
pointer-events: none;
cursor: auto;
background-color: #fff;
border-color: #dee2e6
}
.pagination-lg .page-link {
padding: .75rem 1.5rem;
font-size: 1.25rem;
line-height: 1.5
}
.pagination-lg .page-item:first-child .page-link {
border-top-left-radius: .3rem;
border-bottom-left-radius: .3rem
}
.pagination-lg .page-item:last-child .page-link {
border-top-right-radius: .3rem;
border-bottom-right-radius: .3rem
}
.pagination-sm .page-link {
padding: .25rem .5rem;
font-size: .875rem;
line-height: 1.5
}
.pagination-sm .page-item:first-child .page-link {
border-top-left-radius: .2rem;
border-bottom-left-radius: .2rem
}
.pagination-sm .page-item:last-child .page-link {
border-top-right-radius: .2rem;
border-bottom-right-radius: .2rem
}
.badge {
display: inline-block;
padding: .25em .4em;
font-size: 75%;
font-weight: 700;
line-height: 1;
text-align: center;
white-space: nowrap;
vertical-align: baseline;
border-radius: .25rem;
transition: color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out
}
@media (prefers-reduced-motion:reduce) {
.badge {
transition: none
}
}
a.badge:focus,
a.badge:hover {
text-decoration: none
}
.badge:empty {
display: none
}
.btn .badge {
position: relative;
top: -1px
}
.badge-pill {
padding-right: .6em;
padding-left: .6em;
border-radius: 10rem
}
.badge-primary {
color: #fff;
background-color: #007bff
}
a.badge-primary:focus,
a.badge-primary:hover {
color: #fff;
background-color: #0062cc
}
a.badge-primary.focus,
a.badge-primary:focus {
outline: 0;
box-shadow: 0 0 0 .2rem rgba(0, 123, 255, .5)
}
.badge-secondary {
color: #fff;
background-color: #6c757d
}
a.badge-secondary:focus,
a.badge-secondary:hover {
color: #fff;
background-color: #545b62
}
a.badge-secondary.focus,
a.badge-secondary:focus {
outline: 0;
box-shadow: 0 0 0 .2rem rgba(108, 117, 125, .5)
}
.badge-success {
color: #fff;
background-color: #28a745
}
a.badge-success:focus,
a.badge-success:hover {
color: #fff;
background-color: #1e7e34
}
a.badge-success.focus,
a.badge-success:focus {
outline: 0;
box-shadow: 0 0 0 .2rem rgba(40, 167, 69, .5)
}
.badge-info {
color: #fff;
background-color: #17a2b8
}
a.badge-info:focus,
a.badge-info:hover {
color: #fff;
background-color: #117a8b
}
a.badge-info.focus,
a.badge-info:focus {
outline: 0;
box-shadow: 0 0 0 .2rem rgba(23, 162, 184, .5)
}
.badge-warning {
color: #212529;
background-color: #ffc107
}
a.badge-warning:focus,
a.badge-warning:hover {
color: #212529;
background-color: #d39e00
}
a.badge-warning.focus,
a.badge-warning:focus {
outline: 0;
box-shadow: 0 0 0 .2rem rgba(255, 193, 7, .5)
}
.badge-danger {
color: #fff;
background-color: #dc3545
}
a.badge-danger:focus,
a.badge-danger:hover {
color: #fff;
background-color: #bd2130
}
a.badge-danger.focus,
a.badge-danger:focus {
outline: 0;
box-shadow: 0 0 0 .2rem rgba(220, 53, 69, .5)
}
.badge-light {
color: #212529;
background-color: #f8f9fa
}
a.badge-light:focus,
a.badge-light:hover {
color: #212529;
background-color: #dae0e5
}
a.badge-light.focus,
a.badge-light:focus {
outline: 0;
box-shadow: 0 0 0 .2rem rgba(248, 249, 250, .5)
}
.badge-dark {
color: #fff;
background-color: #343a40
}
a.badge-dark:focus,
a.badge-dark:hover {
color: #fff;
background-color: #1d2124
}
a.badge-dark.focus,
a.badge-dark:focus {
outline: 0;
box-shadow: 0 0 0 .2rem rgba(52, 58, 64, .5)
}
.jumbotron {
padding: 2rem 1rem;
margin-bottom: 2rem;
background-color: #e9ecef;
border-radius: .3rem
}
@media (min-width:576px) {
.jumbotron {
padding: 4rem 2rem
}
}
.jumbotron-fluid {
padding-right: 0;
padding-left: 0;
border-radius: 0
}
.alert {
position: relative;
padding: .75rem 1.25rem;
margin-bottom: 1rem;
border: 1px solid transparent;
border-radius: .25rem
}
.alert-heading {
color: inherit
}
.alert-link {
font-weight: 700
}
.alert-dismissible {
padding-right: 4rem
}
.alert-dismissible .close {
position: absolute;
top: 0;
right: 0;
padding: .75rem 1.25rem;
color: inherit
}
.alert-primary {
color: #004085;
background-color: #cce5ff;
border-color: #b8daff
}
.alert-primary hr {
border-top-color: #9fcdff
}
.alert-primary .alert-link {
color: #002752
}
.alert-secondary {
color: #383d41;
background-color: #e2e3e5;
border-color: #d6d8db
}
.alert-secondary hr {
border-top-color: #c8cbcf
}
.alert-secondary .alert-link {
color: #202326
}
.alert-success {
color: #155724;
background-color: #d4edda;
border-color: #c3e6cb
}
.alert-success hr {
border-top-color: #b1dfbb
}
.alert-success .alert-link {
color: #0b2e13
}
.alert-info {
color: #0c5460;
background-color: #d1ecf1;
border-color: #bee5eb
}
.alert-info hr {
border-top-color: #abdde5
}
.alert-info .alert-link {
color: #062c33
}
.alert-warning {
color: #856404;
background-color: #fff3cd;
border-color: #ffeeba
}
.alert-warning hr {
border-top-color: #ffe8a1
}
.alert-warning .alert-link {
color: #533f03
}
.alert-danger {
color: #721c24;
background-color: #f8d7da;
border-color: #f5c6cb
}
.alert-danger hr {
border-top-color: #f1b0b7
}
.alert-danger .alert-link {
color: #491217
}
.alert-light {
color: #818182;
background-color: #fefefe;
border-color: #fdfdfe
}
.alert-light hr {
border-top-color: #ececf6
}
.alert-light .alert-link {
color: #686868
}
.alert-dark {
color: #1b1e21;
background-color: #d6d8d9;
border-color: #c6c8ca
}
.alert-dark hr {
border-top-color: #b9bbbe
}
.alert-dark .alert-link {
color: #040505
}
@-webkit-keyframes progress-bar-stripes {
from {
background-position: 1rem 0
}
to {
background-position: 0 0
}
}
@keyframes progress-bar-stripes {
from {
background-position: 1rem 0
}
to {
background-position: 0 0
}
}
.progress {
display: -ms-flexbox;
display: flex;
height: 1rem;
overflow: hidden;
font-size: .75rem;
background-color: #e9ecef;
border-radius: .25rem
}
.progress-bar {
display: -ms-flexbox;
display: flex;
-ms-flex-direction: column;
flex-direction: column;
-ms-flex-pack: center;
justify-content: center;
color: #fff;
text-align: center;
white-space: nowrap;
background-color: #007bff;
transition: width .6s ease
}
@media (prefers-reduced-motion:reduce) {
.progress-bar {
transition: none
}
}
.progress-bar-striped {
background-image: linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
background-size: 1rem 1rem
}
.progress-bar-animated {
-webkit-animation: progress-bar-stripes 1s linear infinite;
animation: progress-bar-stripes 1s linear infinite
}
@media (prefers-reduced-motion:reduce) {
.progress-bar-animated {
-webkit-animation: none;
animation: none
}
}
.media {
display: -ms-flexbox;
display: flex;
-ms-flex-align: start;
align-items: flex-start
}
.media-body {
-ms-flex: 1;
flex: 1
}
.list-group {
display: -ms-flexbox;
display: flex;
-ms-flex-direction: column;
flex-direction: column;
padding-left: 0;
margin-bottom: 0
}
.list-group-item-action {
width: 100%;
color: #495057;
text-align: inherit
}
.list-group-item-action:focus,
.list-group-item-action:hover {
z-index: 1;
color: #495057;
text-decoration: none;
background-color: #f8f9fa
}
.list-group-item-action:active {
color: #212529;
background-color: #e9ecef
}
.list-group-item {
position: relative;
display: block;
padding: .75rem 1.25rem;
margin-bottom: -1px;
background-color: #fff;
border: 1px solid rgba(0, 0, 0, .125)
}
.list-group-item:first-child {
border-top-left-radius: .25rem;
border-top-right-radius: .25rem
}
.list-group-item:last-child {
margin-bottom: 0;
border-bottom-right-radius: .25rem;
border-bottom-left-radius: .25rem
}
.list-group-item.disabled,
.list-group-item:disabled {
color: #6c757d;
pointer-events: none;
background-color: #fff
}
.list-group-item.active {
z-index: 2;
color: #fff;
background-color: #007bff;
border-color: #007bff
}
.list-group-horizontal {
-ms-flex-direction: row;
flex-direction: row
}
.list-group-horizontal .list-group-item {
margin-right: -1px;
margin-bottom: 0
}
.list-group-horizontal .list-group-item:first-child {
border-top-left-radius: .25rem;
border-bottom-left-radius: .25rem;
border-top-right-radius: 0
}
.list-group-horizontal .list-group-item:last-child {
margin-right: 0;
border-top-right-radius: .25rem;
border-bottom-right-radius: .25rem;
border-bottom-left-radius: 0
}
@media (min-width:576px) {
.list-group-horizontal-sm {
-ms-flex-direction: row;
flex-direction: row
}
.list-group-horizontal-sm .list-group-item {
margin-right: -1px;
margin-bottom: 0
}
.list-group-horizontal-sm .list-group-item:first-child {
border-top-left-radius: .25rem;
border-bottom-left-radius: .25rem;
border-top-right-radius: 0
}
.list-group-horizontal-sm .list-group-item:last-child {
margin-right: 0;
border-top-right-radius: .25rem;
border-bottom-right-radius: .25rem;
border-bottom-left-radius: 0
}
}
@media (min-width:768px) {
.list-group-horizontal-md {
-ms-flex-direction: row;
flex-direction: row
}
.list-group-horizontal-md .list-group-item {
margin-right: -1px;
margin-bottom: 0
}
.list-group-horizontal-md .list-group-item:first-child {
border-top-left-radius: .25rem;
border-bottom-left-radius: .25rem;
border-top-right-radius: 0
}
.list-group-horizontal-md .list-group-item:last-child {
margin-right: 0;
border-top-right-radius: .25rem;
border-bottom-right-radius: .25rem;
border-bottom-left-radius: 0
}
}
@media (min-width:992px) {
.list-group-horizontal-lg {
-ms-flex-direction: row;
flex-direction: row
}
.list-group-horizontal-lg .list-group-item {
margin-right: -1px;
margin-bottom: 0
}
.list-group-horizontal-lg .list-group-item:first-child {
border-top-left-radius: .25rem;
border-bottom-left-radius: .25rem;
border-top-right-radius: 0
}
.list-group-horizontal-lg .list-group-item:last-child {
margin-right: 0;
border-top-right-radius: .25rem;
border-bottom-right-radius: .25rem;
border-bottom-left-radius: 0
}
}
@media (min-width:1200px) {
.list-group-horizontal-xl {
-ms-flex-direction: row;
flex-direction: row
}
.list-group-horizontal-xl .list-group-item {
margin-right: -1px;
margin-bottom: 0
}
.list-group-horizontal-xl .list-group-item:first-child {
border-top-left-radius: .25rem;
border-bottom-left-radius: .25rem;
border-top-right-radius: 0
}
.list-group-horizontal-xl .list-group-item:last-child {
margin-right: 0;
border-top-right-radius: .25rem;
border-bottom-right-radius: .25rem;
border-bottom-left-radius: 0
}
}
.list-group-flush .list-group-item {
border-right: 0;
border-left: 0;
border-radius: 0
}
.list-group-flush .list-group-item:last-child {
margin-bottom: -1px
}
.list-group-flush:first-child .list-group-item:first-child {
border-top: 0
}
.list-group-flush:last-child .list-group-item:last-child {
margin-bottom: 0;
border-bottom: 0
}
.list-group-item-primary {
color: #004085;
background-color: #b8daff
}
.list-group-item-primary.list-group-item-action:focus,
.list-group-item-primary.list-group-item-action:hover {
color: #004085;
background-color: #9fcdff
}
.list-group-item-primary.list-group-item-action.active {
color: #fff;
background-color: #004085;
border-color: #004085
}
.list-group-item-secondary {
color: #383d41;
background-color: #d6d8db
}
.list-group-item-secondary.list-group-item-action:focus,
.list-group-item-secondary.list-group-item-action:hover {
color: #383d41;
background-color: #c8cbcf
}
.list-group-item-secondary.list-group-item-action.active {
color: #fff;
background-color: #383d41;
border-color: #383d41
}
.list-group-item-success {
color: #155724;
background-color: #c3e6cb
}
.list-group-item-success.list-group-item-action:focus,
.list-group-item-success.list-group-item-action:hover {
color: #155724;
background-color: #b1dfbb
}
.list-group-item-success.list-group-item-action.active {
color: #fff;
background-color: #155724;
border-color: #155724
}
.list-group-item-info {
color: #0c5460;
background-color: #bee5eb
}
.list-group-item-info.list-group-item-action:focus,
.list-group-item-info.list-group-item-action:hover {
color: #0c5460;
background-color: #abdde5
}
.list-group-item-info.list-group-item-action.active {
color: #fff;
background-color: #0c5460;
border-color: #0c5460
}
.list-group-item-warning {
color: #856404;
background-color: #ffeeba
}
.list-group-item-warning.list-group-item-action:focus,
.list-group-item-warning.list-group-item-action:hover {
color: #856404;
background-color: #ffe8a1
}
.list-group-item-warning.list-group-item-action.active {
color: #fff;
background-color: #856404;
border-color: #856404
}
.list-group-item-danger {
color: #721c24;
background-color: #f5c6cb
}
.list-group-item-danger.list-group-item-action:focus,
.list-group-item-danger.list-group-item-action:hover {
color: #721c24;
background-color: #f1b0b7
}
.list-group-item-danger.list-group-item-action.active {
color: #fff;
background-color: #721c24;
border-color: #721c24
}
.list-group-item-light {
color: #818182;
background-color: #fdfdfe
}
.list-group-item-light.list-group-item-action:focus,
.list-group-item-light.list-group-item-action:hover {
color: #818182;
background-color: #ececf6
}
.list-group-item-light.list-group-item-action.active {
color: #fff;
background-color: #818182;
border-color: #818182
}
.list-group-item-dark {
color: #1b1e21;
background-color: #c6c8ca
}
.list-group-item-dark.list-group-item-action:focus,
.list-group-item-dark.list-group-item-action:hover {
color: #1b1e21;
background-color: #b9bbbe
}
.list-group-item-dark.list-group-item-action.active {
color: #fff;
background-color: #1b1e21;
border-color: #1b1e21
}
.close {
float: right;
font-size: 1.5rem;
font-weight: 700;
line-height: 1;
color: #000;
text-shadow: 0 1px 0 #fff;
opacity: .5
}
.close:hover {
color: #000;
text-decoration: none
}
.close:not(:disabled):not(.disabled):focus,
.close:not(:disabled):not(.disabled):hover {
opacity: .75
}
button.close {
padding: 0;
background-color: transparent;
border: 0;
-webkit-appearance: none;
-moz-appearance: none;
appearance: none
}
a.close.disabled {
pointer-events: none
}
.toast {
max-width: 350px;
overflow: hidden;
font-size: .875rem;
background-color: rgba(255, 255, 255, .85);
background-clip: padding-box;
border: 1px solid rgba(0, 0, 0, .1);
box-shadow: 0 .25rem .75rem rgba(0, 0, 0, .1);
-webkit-backdrop-filter: blur(10px);
backdrop-filter: blur(10px);
opacity: 0;
border-radius: .25rem
}
.toast:not(:last-child) {
margin-bottom: .75rem
}
.toast.showing {
opacity: 1
}
.toast.show {
display: block;
opacity: 1
}
.toast.hide {
display: none
}
.toast-header {
display: -ms-flexbox;
display: flex;
-ms-flex-align: center;
align-items: center;
padding: .25rem .75rem;
color: #6c757d;
background-color: rgba(255, 255, 255, .85);
background-clip: padding-box;
border-bottom: 1px solid rgba(0, 0, 0, .05)
}
.toast-body {
padding: .75rem
}
.modal-open {
overflow: hidden
}
.modal-open .modal {
overflow-x: hidden;
overflow-y: auto
}
.modal {
position: fixed;
top: 0;
left: 0;
z-index: 1050;
display: none;
width: 100%;
height: 100%;
overflow: hidden;
outline: 0
}
.modal-dialog {
position: relative;
width: auto;
margin: .5rem;
pointer-events: none
}
.modal.fade .modal-dialog {
transition: -webkit-transform .3s ease-out;
transition: transform .3s ease-out;
transition: transform .3s ease-out, -webkit-transform .3s ease-out;
-webkit-transform: translate(0, -50px);
transform: translate(0, -50px)
}
@media (prefers-reduced-motion:reduce) {
.modal.fade .modal-dialog {
transition: none
}
}
.modal.show .modal-dialog {
-webkit-transform: none;
transform: none
}
.modal-dialog-scrollable {
display: -ms-flexbox;
display: flex;
max-height: calc(100% - 1rem)
}
.modal-dialog-scrollable .modal-content {
max-height: calc(100vh - 1rem);
overflow: hidden
}
.modal-dialog-scrollable .modal-footer,
.modal-dialog-scrollable .modal-header {
-ms-flex-negative: 0;
flex-shrink: 0
}
.modal-dialog-scrollable .modal-body {
overflow-y: auto
}
.modal-dialog-centered {
display: -ms-flexbox;
display: flex;
-ms-flex-align: center;
align-items: center;
min-height: calc(100% - 1rem)
}
.modal-dialog-centered::before {
display: block;
height: calc(100vh - 1rem);
content: ""
}
.modal-dialog-centered.modal-dialog-scrollable {
-ms-flex-direction: column;
flex-direction: column;
-ms-flex-pack: center;
justify-content: center;
height: 100%
}
.modal-dialog-centered.modal-dialog-scrollable .modal-content {
max-height: none
}
.modal-dialog-centered.modal-dialog-scrollable::before {
content: none
}
.modal-content {
position: relative;
display: -ms-flexbox;
display: flex;
-ms-flex-direction: column;
flex-direction: column;
width: 100%;
pointer-events: auto;
background-color: #fff;
background-clip: padding-box;
border: 1px solid rgba(0, 0, 0, .2);
border-radius: .3rem;
outline: 0
}
.modal-backdrop {
position: fixed;
top: 0;
left: 0;
z-index: 1040;
width: 100vw;
height: 100vh;
background-color: #000
}
.modal-backdrop.fade {
opacity: 0
}
.modal-backdrop.show {
opacity: .5
}
.modal-header {
display: -ms-flexbox;
display: flex;
-ms-flex-align: start;
align-items: flex-start;
-ms-flex-pack: justify;
justify-content: space-between;
padding: 1rem 1rem;
border-bottom: 1px solid #dee2e6;
border-top-left-radius: .3rem;
border-top-right-radius: .3rem
}
.modal-header .close {
padding: 1rem 1rem;
margin: -1rem -1rem -1rem auto
}
.modal-title {
margin-bottom: 0;
line-height: 1.5
}
.modal-body {
position: relative;
-ms-flex: 1 1 auto;
flex: 1 1 auto;
padding: 1rem
}
.modal-footer {
display: -ms-flexbox;
display: flex;
-ms-flex-align: center;
align-items: center;
-ms-flex-pack: end;
justify-content: flex-end;
padding: 1rem;
border-top: 1px solid #dee2e6;
border-bottom-right-radius: .3rem;
border-bottom-left-radius: .3rem
}
.modal-footer>:not(:first-child) {
margin-left: .25rem
}
.modal-footer>:not(:last-child) {
margin-right: .25rem
}
.modal-scrollbar-measure {
position: absolute;
top: -9999px;
width: 50px;
height: 50px;
overflow: scroll
}
@media (min-width:576px) {
.modal-dialog {
max-width: 500px;
margin: 1.75rem auto
}
.modal-dialog-scrollable {
max-height: calc(100% - 3.5rem)
}
.modal-dialog-scrollable .modal-content {
max-height: calc(100vh - 3.5rem)
}
.modal-dialog-centered {
min-height: calc(100% - 3.5rem)
}
.modal-dialog-centered::before {
height: calc(100vh - 3.5rem)
}
.modal-sm {
max-width: 300px
}
}
@media (min-width:992px) {
.modal-lg,
.modal-xl {
max-width: 800px
}
}
@media (min-width:1200px) {
.modal-xl {
max-width: 1140px
}
}
.tooltip {
position: absolute;
z-index: 1070;
display: block;
margin: 0;
font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
font-style: normal;
font-weight: 400;
line-height: 1.5;
text-align: left;
text-align: start;
text-decoration: none;
text-shadow: none;
text-transform: none;
letter-spacing: normal;
word-break: normal;
word-spacing: normal;
white-space: normal;
line-break: auto;
font-size: .875rem;
word-wrap: break-word;
opacity: 0
}
.tooltip.show {
opacity: .9
}
.tooltip .arrow {
position: absolute;
display: block;
width: .8rem;
height: .4rem
}
.tooltip .arrow::before {
position: absolute;
content: "";
border-color: transparent;
border-style: solid
}
.bs-tooltip-auto[x-placement^=top],
.bs-tooltip-top {
padding: .4rem 0
}
.bs-tooltip-auto[x-placement^=top] .arrow,
.bs-tooltip-top .arrow {
bottom: 0
}
.bs-tooltip-auto[x-placement^=top] .arrow::before,
.bs-tooltip-top .arrow::before {
top: 0;
border-width: .4rem .4rem 0;
border-top-color: #000
}
.bs-tooltip-auto[x-placement^=right],
.bs-tooltip-right {
padding: 0 .4rem
}
.bs-tooltip-auto[x-placement^=right] .arrow,
.bs-tooltip-right .arrow {
left: 0;
width: .4rem;
height: .8rem
}
.bs-tooltip-auto[x-placement^=right] .arrow::before,
.bs-tooltip-right .arrow::before {
right: 0;
border-width: .4rem .4rem .4rem 0;
border-right-color: #000
}
.bs-tooltip-auto[x-placement^=bottom],
.bs-tooltip-bottom {
padding: .4rem 0
}
.bs-tooltip-auto[x-placement^=bottom] .arrow,
.bs-tooltip-bottom .arrow {
top: 0
}
.bs-tooltip-auto[x-placement^=bottom] .arrow::before,
.bs-tooltip-bottom .arrow::before {
bottom: 0;
border-width: 0 .4rem .4rem;
border-bottom-color: #000
}
.bs-tooltip-auto[x-placement^=left],
.bs-tooltip-left {
padding: 0 .4rem
}
.bs-tooltip-auto[x-placement^=left] .arrow,
.bs-tooltip-left .arrow {
right: 0;
width: .4rem;
height: .8rem
}
.bs-tooltip-auto[x-placement^=left] .arrow::before,
.bs-tooltip-left .arrow::before {
left: 0;
border-width: .4rem 0 .4rem .4rem;
border-left-color: #000
}
.tooltip-inner {
max-width: 200px;
padding: .25rem .5rem;
color: #fff;
text-align: center;
background-color: #000;
border-radius: .25rem
}
.popover {
position: absolute;
top: 0;
left: 0;
z-index: 1060;
display: block;
max-width: 276px;
font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
font-style: normal;
font-weight: 400;
line-height: 1.5;
text-align: left;
text-align: start;
text-decoration: none;
text-shadow: none;
text-transform: none;
letter-spacing: normal;
word-break: normal;
word-spacing: normal;
white-space: normal;
line-break: auto;
font-size: .875rem;
word-wrap: break-word;
background-color: #fff;
background-clip: padding-box;
border: 1px solid rgba(0, 0, 0, .2);
border-radius: .3rem
}
.popover .arrow {
position: absolute;
display: block;
width: 1rem;
height: .5rem;
margin: 0 .3rem
}
.popover .arrow::after,
.popover .arrow::before {
position: absolute;
display: block;
content: "";
border-color: transparent;
border-style: solid
}
.bs-popover-auto[x-placement^=top],
.bs-popover-top {
margin-bottom: .5rem
}
.bs-popover-auto[x-placement^=top]>.arrow,
.bs-popover-top>.arrow {
bottom: calc((.5rem + 1px) * -1)
}
.bs-popover-auto[x-placement^=top]>.arrow::before,
.bs-popover-top>.arrow::before {
bottom: 0;
border-width: .5rem .5rem 0;
border-top-color: rgba(0, 0, 0, .25)
}
.bs-popover-auto[x-placement^=top]>.arrow::after,
.bs-popover-top>.arrow::after {
bottom: 1px;
border-width: .5rem .5rem 0;
border-top-color: #fff
}
.bs-popover-auto[x-placement^=right],
.bs-popover-right {
margin-left: .5rem
}
.bs-popover-auto[x-placement^=right]>.arrow,
.bs-popover-right>.arrow {
left: calc((.5rem + 1px) * -1);
width: .5rem;
height: 1rem;
margin: .3rem 0
}
.bs-popover-auto[x-placement^=right]>.arrow::before,
.bs-popover-right>.arrow::before {
left: 0;
border-width: .5rem .5rem .5rem 0;
border-right-color: rgba(0, 0, 0, .25)
}
.bs-popover-auto[x-placement^=right]>.arrow::after,
.bs-popover-right>.arrow::after {
left: 1px;
border-width: .5rem .5rem .5rem 0;
border-right-color: #fff
}
.bs-popover-auto[x-placement^=bottom],
.bs-popover-bottom {
margin-top: .5rem
}
.bs-popover-auto[x-placement^=bottom]>.arrow,
.bs-popover-bottom>.arrow {
top: calc((.5rem + 1px) * -1)
}
.bs-popover-auto[x-placement^=bottom]>.arrow::before,
.bs-popover-bottom>.arrow::before {
top: 0;
border-width: 0 .5rem .5rem .5rem;
border-bottom-color: rgba(0, 0, 0, .25)
}
.bs-popover-auto[x-placement^=bottom]>.arrow::after,
.bs-popover-bottom>.arrow::after {
top: 1px;
border-width: 0 .5rem .5rem .5rem;
border-bottom-color: #fff
}
.bs-popover-auto[x-placement^=bottom] .popover-header::before,
.bs-popover-bottom .popover-header::before {
position: absolute;
top: 0;
left: 50%;
display: block;
width: 1rem;
margin-left: -.5rem;
content: "";
border-bottom: 1px solid #f7f7f7
}
.bs-popover-auto[x-placement^=left],
.bs-popover-left {
margin-right: .5rem
}
.bs-popover-auto[x-placement^=left]>.arrow,
.bs-popover-left>.arrow {
right: calc((.5rem + 1px) * -1);
width: .5rem;
height: 1rem;
margin: .3rem 0
}
.bs-popover-auto[x-placement^=left]>.arrow::before,
.bs-popover-left>.arrow::before {
right: 0;
border-width: .5rem 0 .5rem .5rem;
border-left-color: rgba(0, 0, 0, .25)
}
.bs-popover-auto[x-placement^=left]>.arrow::after,
.bs-popover-left>.arrow::after {
right: 1px;
border-width: .5rem 0 .5rem .5rem;
border-left-color: #fff
}
.popover-header {
padding: .5rem .75rem;
margin-bottom: 0;
font-size: 1rem;
background-color: #f7f7f7;
border-bottom: 1px solid #ebebeb;
border-top-left-radius: calc(.3rem - 1px);
border-top-right-radius: calc(.3rem - 1px)
}
.popover-header:empty {
display: none
}
.popover-body {
padding: .5rem .75rem;
color: #212529
}
.carousel {
position: relative
}
.carousel.pointer-event {
-ms-touch-action: pan-y;
touch-action: pan-y
}
.carousel-inner {
position: relative;
width: 100%;
overflow: hidden
}
.carousel-inner::after {
display: block;
clear: both;
content: ""
}
.carousel-item {
position: relative;
display: none;
float: left;
width: 100%;
margin-right: -100%;
-webkit-backface-visibility: hidden;
backface-visibility: hidden;
transition: -webkit-transform .6s ease-in-out;
transition: transform .6s ease-in-out;
transition: transform .6s ease-in-out, -webkit-transform .6s ease-in-out
}
@media (prefers-reduced-motion:reduce) {
.carousel-item {
transition: none
}
}
.carousel-item-next,
.carousel-item-prev,
.carousel-item.active {
display: block
}
.active.carousel-item-right,
.carousel-item-next:not(.carousel-item-left) {
-webkit-transform: translateX(100%);
transform: translateX(100%)
}
.active.carousel-item-left,
.carousel-item-prev:not(.carousel-item-right) {
-webkit-transform: translateX(-100%);
transform: translateX(-100%)
}
.carousel-fade .carousel-item {
opacity: 0;
transition-property: opacity;
-webkit-transform: none;
transform: none
}
.carousel-fade .carousel-item-next.carousel-item-left,
.carousel-fade .carousel-item-prev.carousel-item-right,
.carousel-fade .carousel-item.active {
z-index: 1;
opacity: 1
}
.carousel-fade .active.carousel-item-left,
.carousel-fade .active.carousel-item-right {
z-index: 0;
opacity: 0;
transition: 0s .6s opacity
}
@media (prefers-reduced-motion:reduce) {
.carousel-fade .active.carousel-item-left,
.carousel-fade .active.carousel-item-right {
transition: none
}
}
.carousel-control-next,
.carousel-control-prev {
position: absolute;
top: 0;
bottom: 0;
z-index: 1;
display: -ms-flexbox;
display: flex;
-ms-flex-align: center;
align-items: center;
-ms-flex-pack: center;
justify-content: center;
width: 15%;
color: #fff;
text-align: center;
opacity: .5;
transition: opacity .15s ease
}
@media (prefers-reduced-motion:reduce) {
.carousel-control-next,
.carousel-control-prev {
transition: none
}
}
.carousel-control-next:focus,
.carousel-control-next:hover,
.carousel-control-prev:focus,
.carousel-control-prev:hover {
color: #fff;
text-decoration: none;
outline: 0;
opacity: .9
}
.carousel-control-prev {
left: 0
}
.carousel-control-next {
right: 0
}
.carousel-control-next-icon,
.carousel-control-prev-icon {
display: inline-block;
width: 20px;
height: 20px;
background: no-repeat 50%/100% 100%
}
.carousel-control-prev-icon {
background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3e%3cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3e%3c/svg%3e")
}
.carousel-control-next-icon {
background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3e%3cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3e%3c/svg%3e")
}
.carousel-indicators {
position: absolute;
right: 0;
bottom: 0;
left: 0;
z-index: 15;
display: -ms-flexbox;
display: flex;
-ms-flex-pack: center;
justify-content: center;
padding-left: 0;
margin-right: 15%;
margin-left: 15%;
list-style: none
}
.carousel-indicators li {
box-sizing: content-box;
-ms-flex: 0 1 auto;
flex: 0 1 auto;
width: 30px;
height: 3px;
margin-right: 3px;
margin-left: 3px;
text-indent: -999px;
cursor: pointer;
background-color: #fff;
background-clip: padding-box;
border-top: 10px solid transparent;
border-bottom: 10px solid transparent;
opacity: .5;
transition: opacity .6s ease
}
@media (prefers-reduced-motion:reduce) {
.carousel-indicators li {
transition: none
}
}
.carousel-indicators .active {
opacity: 1
}
.carousel-caption {
position: absolute;
right: 15%;
bottom: 20px;
left: 15%;
z-index: 10;
padding-top: 20px;
padding-bottom: 20px;
color: #fff;
text-align: center
}
@-webkit-keyframes spinner-border {
to {
-webkit-transform: rotate(360deg);
transform: rotate(360deg)
}
}
@keyframes spinner-border {
to {
-webkit-transform: rotate(360deg);
transform: rotate(360deg)
}
}
.spinner-border {
display: inline-block;
width: 2rem;
height: 2rem;
vertical-align: text-bottom;
border: .25em solid currentColor;
border-right-color: transparent;
border-radius: 50%;
-webkit-animation: spinner-border .75s linear infinite;
animation: spinner-border .75s linear infinite
}
.spinner-border-sm {
width: 1rem;
height: 1rem;
border-width: .2em
}
@-webkit-keyframes spinner-grow {
0% {
-webkit-transform: scale(0);
transform: scale(0)
}
50% {
opacity: 1
}
}
@keyframes spinner-grow {
0% {
-webkit-transform: scale(0);
transform: scale(0)
}
50% {
opacity: 1
}
}
.spinner-grow {
display: inline-block;
width: 2rem;
height: 2rem;
vertical-align: text-bottom;
background-color: currentColor;
border-radius: 50%;
opacity: 0;
-webkit-animation: spinner-grow .75s linear infinite;
animation: spinner-grow .75s linear infinite
}
.spinner-grow-sm {
width: 1rem;
height: 1rem
}
.align-baseline {
vertical-align: baseline !important
}
.align-top {
vertical-align: top !important
}
.align-middle {
vertical-align: middle !important
}
.align-bottom {
vertical-align: bottom !important
}
.align-text-bottom {
vertical-align: text-bottom !important
}
.align-text-top {
vertical-align: text-top !important
}
.bg-primary {
background-color: #007bff !important
}
a.bg-primary:focus,
a.bg-primary:hover,
button.bg-primary:focus,
button.bg-primary:hover {
background-color: #0062cc !important
}
.bg-secondary {
background-color: #6c757d !important
}
a.bg-secondary:focus,
a.bg-secondary:hover,
button.bg-secondary:focus,
button.bg-secondary:hover {
background-color: #545b62 !important
}
.bg-success {
background-color: #28a745 !important
}
a.bg-success:focus,
a.bg-success:hover,
button.bg-success:focus,
button.bg-success:hover {
background-color: #1e7e34 !important
}
.bg-info {
background-color: #17a2b8 !important
}
a.bg-info:focus,
a.bg-info:hover,
button.bg-info:focus,
button.bg-info:hover {
background-color: #117a8b !important
}
.bg-warning {
background-color: #ffc107 !important
}
a.bg-warning:focus,
a.bg-warning:hover,
button.bg-warning:focus,
button.bg-warning:hover {
background-color: #d39e00 !important
}
.bg-danger {
background-color: #dc3545 !important
}
a.bg-danger:focus,
a.bg-danger:hover,
button.bg-danger:focus,
button.bg-danger:hover {
background-color: #bd2130 !important
}
.bg-light {
background-color: #f8f9fa !important
}
a.bg-light:focus,
a.bg-light:hover,
button.bg-light:focus,
button.bg-light:hover {
background-color: #dae0e5 !important
}
.bg-dark {
background-color: #343a40 !important
}
a.bg-dark:focus,
a.bg-dark:hover,
button.bg-dark:focus,
button.bg-dark:hover {
background-color: #1d2124 !important
}
.bg-white {
background-color: #fff !important
}
.bg-transparent {
background-color: transparent !important
}
.border {
border: 1px solid #dee2e6 !important
}
.border-top {
border-top: 1px solid #dee2e6 !important
}
.border-right {
border-right: 1px solid #dee2e6 !important
}
.border-bottom {
border-bottom: 1px solid #dee2e6 !important
}
.border-left {
border-left: 1px solid #dee2e6 !important
}
.border-0 {
border: 0 !important
}
.border-top-0 {
border-top: 0 !important
}
.border-right-0 {
border-right: 0 !important
}
.border-bottom-0 {
border-bottom: 0 !important
}
.border-left-0 {
border-left: 0 !important
}
.border-primary {
border-color: #007bff !important
}
.border-secondary {
border-color: #6c757d !important
}
.border-success {
border-color: #28a745 !important
}
.border-info {
border-color: #17a2b8 !important
}
.border-warning {
border-color: #ffc107 !important
}
.border-danger {
border-color: #dc3545 !important
}
.border-light {
border-color: #f8f9fa !important
}
.border-dark {
border-color: #343a40 !important
}
.border-white {
border-color: #fff !important
}
.rounded-sm {
border-radius: .2rem !important
}
.rounded {
border-radius: .25rem !important
}
.rounded-top {
border-top-left-radius: .25rem !important;
border-top-right-radius: .25rem !important
}
.rounded-right {
border-top-right-radius: .25rem !important;
border-bottom-right-radius: .25rem !important
}
.rounded-bottom {
border-bottom-right-radius: .25rem !important;
border-bottom-left-radius: .25rem !important
}
.rounded-left {
border-top-left-radius: .25rem !important;
border-bottom-left-radius: .25rem !important
}
.rounded-lg {
border-radius: .3rem !important
}
.rounded-circle {
border-radius: 50% !important
}
.rounded-pill {
border-radius: 50rem !important
}
.rounded-0 {
border-radius: 0 !important
}
.clearfix::after {
display: block;
clear: both;
content: ""
}
.d-none {
display: none !important
}
.d-inline {
display: inline !important
}
.d-inline-block {
display: inline-block !important
}
.d-block {
display: block !important
}
.d-table {
display: table !important
}
.d-table-row {
display: table-row !important
}
.d-table-cell {
display: table-cell !important
}
.d-flex {
display: -ms-flexbox !important;
display: flex !important
}
.d-inline-flex {
display: -ms-inline-flexbox !important;
display: inline-flex !important
}
@media (min-width:576px) {
.d-sm-none {
display: none !important
}
.d-sm-inline {
display: inline !important
}
.d-sm-inline-block {
display: inline-block !important
}
.d-sm-block {
display: block !important
}
.d-sm-table {
display: table !important
}
.d-sm-table-row {
display: table-row !important
}
.d-sm-table-cell {
display: table-cell !important
}
.d-sm-flex {
display: -ms-flexbox !important;
display: flex !important
}
.d-sm-inline-flex {
display: -ms-inline-flexbox !important;
display: inline-flex !important
}
}
@media (min-width:768px) {
.d-md-none {
display: none !important
}
.d-md-inline {
display: inline !important
}
.d-md-inline-block {
display: inline-block !important
}
.d-md-block {
display: block !important
}
.d-md-table {
display: table !important
}
.d-md-table-row {
display: table-row !important
}
.d-md-table-cell {
display: table-cell !important
}
.d-md-flex {
display: -ms-flexbox !important;
display: flex !important
}
.d-md-inline-flex {
display: -ms-inline-flexbox !important;
display: inline-flex !important
}
}
@media (min-width:992px) {
.d-lg-none {
display: none !important
}
.d-lg-inline {
display: inline !important
}
.d-lg-inline-block {
display: inline-block !important
}
.d-lg-block {
display: block !important
}
.d-lg-table {
display: table !important
}
.d-lg-table-row {
display: table-row !important
}
.d-lg-table-cell {
display: table-cell !important
}
.d-lg-flex {
display: -ms-flexbox !important;
display: flex !important
}
.d-lg-inline-flex {
display: -ms-inline-flexbox !important;
display: inline-flex !important
}
}
@media (min-width:1200px) {
.d-xl-none {
display: none !important
}
.d-xl-inline {
display: inline !important
}
.d-xl-inline-block {
display: inline-block !important
}
.d-xl-block {
display: block !important
}
.d-xl-table {
display: table !important
}
.d-xl-table-row {
display: table-row !important
}
.d-xl-table-cell {
display: table-cell !important
}
.d-xl-flex {
display: -ms-flexbox !important;
display: flex !important
}
.d-xl-inline-flex {
display: -ms-inline-flexbox !important;
display: inline-flex !important
}
}
@media print {
.d-print-none {
display: none !important
}
.d-print-inline {
display: inline !important
}
.d-print-inline-block {
display: inline-block !important
}
.d-print-block {
display: block !important
}
.d-print-table {
display: table !important
}
.d-print-table-row {
display: table-row !important
}
.d-print-table-cell {
display: table-cell !important
}
.d-print-flex {
display: -ms-flexbox !important;
display: flex !important
}
.d-print-inline-flex {
display: -ms-inline-flexbox !important;
display: inline-flex !important
}
}
.embed-responsive {
position: relative;
display: block;
width: 100%;
padding: 0;
overflow: hidden
}
.embed-responsive::before {
display: block;
content: ""
}
.embed-responsive .embed-responsive-item,
.embed-responsive embed,
.embed-responsive iframe,
.embed-responsive object,
.embed-responsive video {
position: absolute;
top: 0;
bottom: 0;
left: 0;
width: 100%;
height: 100%;
border: 0
}
.embed-responsive-21by9::before {
padding-top: 42.857143%
}
.embed-responsive-16by9::before {
padding-top: 56.25%
}
.embed-responsive-4by3::before {
padding-top: 75%
}
.embed-responsive-1by1::before {
padding-top: 100%
}
.flex-row {
-ms-flex-direction: row !important;
flex-direction: row !important
}
.flex-column {
-ms-flex-direction: column !important;
flex-direction: column !important
}
.flex-row-reverse {
-ms-flex-direction: row-reverse !important;
flex-direction: row-reverse !important
}
.flex-column-reverse {
-ms-flex-direction: column-reverse !important;
flex-direction: column-reverse !important
}
.flex-wrap {
-ms-flex-wrap: wrap !important;
flex-wrap: wrap !important
}
.flex-nowrap {
-ms-flex-wrap: nowrap !important;
flex-wrap: nowrap !important
}
.flex-wrap-reverse {
-ms-flex-wrap: wrap-reverse !important;
flex-wrap: wrap-reverse !important
}
.flex-fill {
-ms-flex: 1 1 auto !important;
flex: 1 1 auto !important
}
.flex-grow-0 {
-ms-flex-positive: 0 !important;
flex-grow: 0 !important
}
.flex-grow-1 {
-ms-flex-positive: 1 !important;
flex-grow: 1 !important
}
.flex-shrink-0 {
-ms-flex-negative: 0 !important;
flex-shrink: 0 !important
}
.flex-shrink-1 {
-ms-flex-negative: 1 !important;
flex-shrink: 1 !important
}
.justify-content-start {
-ms-flex-pack: start !important;
justify-content: flex-start !important
}
.justify-content-end {
-ms-flex-pack: end !important;
justify-content: flex-end !important
}
.justify-content-center {
-ms-flex-pack: center !important;
justify-content: center !important
}
.justify-content-between {
-ms-flex-pack: justify !important;
justify-content: space-between !important
}
.justify-content-around {
-ms-flex-pack: distribute !important;
justify-content: space-around !important
}
.align-items-start {
-ms-flex-align: start !important;
align-items: flex-start !important
}
.align-items-end {
-ms-flex-align: end !important;
align-items: flex-end !important
}
.align-items-center {
-ms-flex-align: center !important;
align-items: center !important
}
.align-items-baseline {
-ms-flex-align: baseline !important;
align-items: baseline !important
}
.align-items-stretch {
-ms-flex-align: stretch !important;
align-items: stretch !important
}
.align-content-start {
-ms-flex-line-pack: start !important;
align-content: flex-start !important
}
.align-content-end {
-ms-flex-line-pack: end !important;
align-content: flex-end !important
}
.align-content-center {
-ms-flex-line-pack: center !important;
align-content: center !important
}
.align-content-between {
-ms-flex-line-pack: justify !important;
align-content: space-between !important
}
.align-content-around {
-ms-flex-line-pack: distribute !important;
align-content: space-around !important
}
.align-content-stretch {
-ms-flex-line-pack: stretch !important;
align-content: stretch !important
}
.align-self-auto {
-ms-flex-item-align: auto !important;
align-self: auto !important
}
.align-self-start {
-ms-flex-item-align: start !important;
align-self: flex-start !important
}
.align-self-end {
-ms-flex-item-align: end !important;
align-self: flex-end !important
}
.align-self-center {
-ms-flex-item-align: center !important;
align-self: center !important
}
.align-self-baseline {
-ms-flex-item-align: baseline !important;
align-self: baseline !important
}
.align-self-stretch {
-ms-flex-item-align: stretch !important;
align-self: stretch !important
}
@media (min-width:576px) {
.flex-sm-row {
-ms-flex-direction: row !important;
flex-direction: row !important
}
.flex-sm-column {
-ms-flex-direction: column !important;
flex-direction: column !important
}
.flex-sm-row-reverse {
-ms-flex-direction: row-reverse !important;
flex-direction: row-reverse !important
}
.flex-sm-column-reverse {
-ms-flex-direction: column-reverse !important;
flex-direction: column-reverse !important
}
.flex-sm-wrap {
-ms-flex-wrap: wrap !important;
flex-wrap: wrap !important
}
.flex-sm-nowrap {
-ms-flex-wrap: nowrap !important;
flex-wrap: nowrap !important
}
.flex-sm-wrap-reverse {
-ms-flex-wrap: wrap-reverse !important;
flex-wrap: wrap-reverse !important
}
.flex-sm-fill {
-ms-flex: 1 1 auto !important;
flex: 1 1 auto !important
}
.flex-sm-grow-0 {
-ms-flex-positive: 0 !important;
flex-grow: 0 !important
}
.flex-sm-grow-1 {
-ms-flex-positive: 1 !important;
flex-grow: 1 !important
}
.flex-sm-shrink-0 {
-ms-flex-negative: 0 !important;
flex-shrink: 0 !important
}
.flex-sm-shrink-1 {
-ms-flex-negative: 1 !important;
flex-shrink: 1 !important
}
.justify-content-sm-start {
-ms-flex-pack: start !important;
justify-content: flex-start !important
}
.justify-content-sm-end {
-ms-flex-pack: end !important;
justify-content: flex-end !important
}
.justify-content-sm-center {
-ms-flex-pack: center !important;
justify-content: center !important
}
.justify-content-sm-between {
-ms-flex-pack: justify !important;
justify-content: space-between !important
}
.justify-content-sm-around {
-ms-flex-pack: distribute !important;
justify-content: space-around !important
}
.align-items-sm-start {
-ms-flex-align: start !important;
align-items: flex-start !important
}
.align-items-sm-end {
-ms-flex-align: end !important;
align-items: flex-end !important
}
.align-items-sm-center {
-ms-flex-align: center !important;
align-items: center !important
}
.align-items-sm-baseline {
-ms-flex-align: baseline !important;
align-items: baseline !important
}
.align-items-sm-stretch {
-ms-flex-align: stretch !important;
align-items: stretch !important
}
.align-content-sm-start {
-ms-flex-line-pack: start !important;
align-content: flex-start !important
}
.align-content-sm-end {
-ms-flex-line-pack: end !important;
align-content: flex-end !important
}
.align-content-sm-center {
-ms-flex-line-pack: center !important;
align-content: center !important
}
.align-content-sm-between {
-ms-flex-line-pack: justify !important;
align-content: space-between !important
}
.align-content-sm-around {
-ms-flex-line-pack: distribute !important;
align-content: space-around !important
}
.align-content-sm-stretch {
-ms-flex-line-pack: stretch !important;
align-content: stretch !important
}
.align-self-sm-auto {
-ms-flex-item-align: auto !important;
align-self: auto !important
}
.align-self-sm-start {
-ms-flex-item-align: start !important;
align-self: flex-start !important
}
.align-self-sm-end {
-ms-flex-item-align: end !important;
align-self: flex-end !important
}
.align-self-sm-center {
-ms-flex-item-align: center !important;
align-self: center !important
}
.align-self-sm-baseline {
-ms-flex-item-align: baseline !important;
align-self: baseline !important
}
.align-self-sm-stretch {
-ms-flex-item-align: stretch !important;
align-self: stretch !important
}
}
@media (min-width:768px) {
.flex-md-row {
-ms-flex-direction: row !important;
flex-direction: row !important
}
.flex-md-column {
-ms-flex-direction: column !important;
flex-direction: column !important
}
.flex-md-row-reverse {
-ms-flex-direction: row-reverse !important;
flex-direction: row-reverse !important
}
.flex-md-column-reverse {
-ms-flex-direction: column-reverse !important;
flex-direction: column-reverse !important
}
.flex-md-wrap {
-ms-flex-wrap: wrap !important;
flex-wrap: wrap !important
}
.flex-md-nowrap {
-ms-flex-wrap: nowrap !important;
flex-wrap: nowrap !important
}
.flex-md-wrap-reverse {
-ms-flex-wrap: wrap-reverse !important;
flex-wrap: wrap-reverse !important
}
.flex-md-fill {
-ms-flex: 1 1 auto !important;
flex: 1 1 auto !important
}
.flex-md-grow-0 {
-ms-flex-positive: 0 !important;
flex-grow: 0 !important
}
.flex-md-grow-1 {
-ms-flex-positive: 1 !important;
flex-grow: 1 !important
}
.flex-md-shrink-0 {
-ms-flex-negative: 0 !important;
flex-shrink: 0 !important
}
.flex-md-shrink-1 {
-ms-flex-negative: 1 !important;
flex-shrink: 1 !important
}
.justify-content-md-start {
-ms-flex-pack: start !important;
justify-content: flex-start !important
}
.justify-content-md-end {
-ms-flex-pack: end !important;
justify-content: flex-end !important
}
.justify-content-md-center {
-ms-flex-pack: center !important;
justify-content: center !important
}
.justify-content-md-between {
-ms-flex-pack: justify !important;
justify-content: space-between !important
}
.justify-content-md-around {
-ms-flex-pack: distribute !important;
justify-content: space-around !important
}
.align-items-md-start {
-ms-flex-align: start !important;
align-items: flex-start !important
}
.align-items-md-end {
-ms-flex-align: end !important;
align-items: flex-end !important
}
.align-items-md-center {
-ms-flex-align: center !important;
align-items: center !important
}
.align-items-md-baseline {
-ms-flex-align: baseline !important;
align-items: baseline !important
}
.align-items-md-stretch {
-ms-flex-align: stretch !important;
align-items: stretch !important
}
.align-content-md-start {
-ms-flex-line-pack: start !important;
align-content: flex-start !important
}
.align-content-md-end {
-ms-flex-line-pack: end !important;
align-content: flex-end !important
}
.align-content-md-center {
-ms-flex-line-pack: center !important;
align-content: center !important
}
.align-content-md-between {
-ms-flex-line-pack: justify !important;
align-content: space-between !important
}
.align-content-md-around {
-ms-flex-line-pack: distribute !important;
align-content: space-around !important
}
.align-content-md-stretch {
-ms-flex-line-pack: stretch !important;
align-content: stretch !important
}
.align-self-md-auto {
-ms-flex-item-align: auto !important;
align-self: auto !important
}
.align-self-md-start {
-ms-flex-item-align: start !important;
align-self: flex-start !important
}
.align-self-md-end {
-ms-flex-item-align: end !important;
align-self: flex-end !important
}
.align-self-md-center {
-ms-flex-item-align: center !important;
align-self: center !important
}
.align-self-md-baseline {
-ms-flex-item-align: baseline !important;
align-self: baseline !important
}
.align-self-md-stretch {
-ms-flex-item-align: stretch !important;
align-self: stretch !important
}
}
@media (min-width:992px) {
.flex-lg-row {
-ms-flex-direction: row !important;
flex-direction: row !important
}
.flex-lg-column {
-ms-flex-direction: column !important;
flex-direction: column !important
}
.flex-lg-row-reverse {
-ms-flex-direction: row-reverse !important;
flex-direction: row-reverse !important
}
.flex-lg-column-reverse {
-ms-flex-direction: column-reverse !important;
flex-direction: column-reverse !important
}
.flex-lg-wrap {
-ms-flex-wrap: wrap !important;
flex-wrap: wrap !important
}
.flex-lg-nowrap {
-ms-flex-wrap: nowrap !important;
flex-wrap: nowrap !important
}
.flex-lg-wrap-reverse {
-ms-flex-wrap: wrap-reverse !important;
flex-wrap: wrap-reverse !important
}
.flex-lg-fill {
-ms-flex: 1 1 auto !important;
flex: 1 1 auto !important
}
.flex-lg-grow-0 {
-ms-flex-positive: 0 !important;
flex-grow: 0 !important
}
.flex-lg-grow-1 {
-ms-flex-positive: 1 !important;
flex-grow: 1 !important
}
.flex-lg-shrink-0 {
-ms-flex-negative: 0 !important;
flex-shrink: 0 !important
}
.flex-lg-shrink-1 {
-ms-flex-negative: 1 !important;
flex-shrink: 1 !important
}
.justify-content-lg-start {
-ms-flex-pack: start !important;
justify-content: flex-start !important
}
.justify-content-lg-end {
-ms-flex-pack: end !important;
justify-content: flex-end !important
}
.justify-content-lg-center {
-ms-flex-pack: center !important;
justify-content: center !important
}
.justify-content-lg-between {
-ms-flex-pack: justify !important;
justify-content: space-between !important
}
.justify-content-lg-around {
-ms-flex-pack: distribute !important;
justify-content: space-around !important
}
.align-items-lg-start {
-ms-flex-align: start !important;
align-items: flex-start !important
}
.align-items-lg-end {
-ms-flex-align: end !important;
align-items: flex-end !important
}
.align-items-lg-center {
-ms-flex-align: center !important;
align-items: center !important
}
.align-items-lg-baseline {
-ms-flex-align: baseline !important;
align-items: baseline !important
}
.align-items-lg-stretch {
-ms-flex-align: stretch !important;
align-items: stretch !important
}
.align-content-lg-start {
-ms-flex-line-pack: start !important;
align-content: flex-start !important
}
.align-content-lg-end {
-ms-flex-line-pack: end !important;
align-content: flex-end !important
}
.align-content-lg-center {
-ms-flex-line-pack: center !important;
align-content: center !important
}
.align-content-lg-between {
-ms-flex-line-pack: justify !important;
align-content: space-between !important
}
.align-content-lg-around {
-ms-flex-line-pack: distribute !important;
align-content: space-around !important
}
.align-content-lg-stretch {
-ms-flex-line-pack: stretch !important;
align-content: stretch !important
}
.align-self-lg-auto {
-ms-flex-item-align: auto !important;
align-self: auto !important
}
.align-self-lg-start {
-ms-flex-item-align: start !important;
align-self: flex-start !important
}
.align-self-lg-end {
-ms-flex-item-align: end !important;
align-self: flex-end !important
}
.align-self-lg-center {
-ms-flex-item-align: center !important;
align-self: center !important
}
.align-self-lg-baseline {
-ms-flex-item-align: baseline !important;
align-self: baseline !important
}
.align-self-lg-stretch {
-ms-flex-item-align: stretch !important;
align-self: stretch !important
}
}
@media (min-width:1200px) {
.flex-xl-row {
-ms-flex-direction: row !important;
flex-direction: row !important
}
.flex-xl-column {
-ms-flex-direction: column !important;
flex-direction: column !important
}
.flex-xl-row-reverse {
-ms-flex-direction: row-reverse !important;
flex-direction: row-reverse !important
}
.flex-xl-column-reverse {
-ms-flex-direction: column-reverse !important;
flex-direction: column-reverse !important
}
.flex-xl-wrap {
-ms-flex-wrap: wrap !important;
flex-wrap: wrap !important
}
.flex-xl-nowrap {
-ms-flex-wrap: nowrap !important;
flex-wrap: nowrap !important
}
.flex-xl-wrap-reverse {
-ms-flex-wrap: wrap-reverse !important;
flex-wrap: wrap-reverse !important
}
.flex-xl-fill {
-ms-flex: 1 1 auto !important;
flex: 1 1 auto !important
}
.flex-xl-grow-0 {
-ms-flex-positive: 0 !important;
flex-grow: 0 !important
}
.flex-xl-grow-1 {
-ms-flex-positive: 1 !important;
flex-grow: 1 !important
}
.flex-xl-shrink-0 {
-ms-flex-negative: 0 !important;
flex-shrink: 0 !important
}
.flex-xl-shrink-1 {
-ms-flex-negative: 1 !important;
flex-shrink: 1 !important
}
.justify-content-xl-start {
-ms-flex-pack: start !important;
justify-content: flex-start !important
}
.justify-content-xl-end {
-ms-flex-pack: end !important;
justify-content: flex-end !important
}
.justify-content-xl-center {
-ms-flex-pack: center !important;
justify-content: center !important
}
.justify-content-xl-between {
-ms-flex-pack: justify !important;
justify-content: space-between !important
}
.justify-content-xl-around {
-ms-flex-pack: distribute !important;
justify-content: space-around !important
}
.align-items-xl-start {
-ms-flex-align: start !important;
align-items: flex-start !important
}
.align-items-xl-end {
-ms-flex-align: end !important;
align-items: flex-end !important
}
.align-items-xl-center {
-ms-flex-align: center !important;
align-items: center !important
}
.align-items-xl-baseline {
-ms-flex-align: baseline !important;
align-items: baseline !important
}
.align-items-xl-stretch {
-ms-flex-align: stretch !important;
align-items: stretch !important
}
.align-content-xl-start {
-ms-flex-line-pack: start !important;
align-content: flex-start !important
}
.align-content-xl-end {
-ms-flex-line-pack: end !important;
align-content: flex-end !important
}
.align-content-xl-center {
-ms-flex-line-pack: center !important;
align-content: center !important
}
.align-content-xl-between {
-ms-flex-line-pack: justify !important;
align-content: space-between !important
}
.align-content-xl-around {
-ms-flex-line-pack: distribute !important;
align-content: space-around !important
}
.align-content-xl-stretch {
-ms-flex-line-pack: stretch !important;
align-content: stretch !important
}
.align-self-xl-auto {
-ms-flex-item-align: auto !important;
align-self: auto !important
}
.align-self-xl-start {
-ms-flex-item-align: start !important;
align-self: flex-start !important
}
.align-self-xl-end {
-ms-flex-item-align: end !important;
align-self: flex-end !important
}
.align-self-xl-center {
-ms-flex-item-align: center !important;
align-self: center !important
}
.align-self-xl-baseline {
-ms-flex-item-align: baseline !important;
align-self: baseline !important
}
.align-self-xl-stretch {
-ms-flex-item-align: stretch !important;
align-self: stretch !important
}
}
.float-left {
float: left !important
}
.float-right {
float: right !important
}
.float-none {
float: none !important
}
@media (min-width:576px) {
.float-sm-left {
float: left !important
}
.float-sm-right {
float: right !important
}
.float-sm-none {
float: none !important
}
}
@media (min-width:768px) {
.float-md-left {
float: left !important
}
.float-md-right {
float: right !important
}
.float-md-none {
float: none !important
}
}
@media (min-width:992px) {
.float-lg-left {
float: left !important
}
.float-lg-right {
float: right !important
}
.float-lg-none {
float: none !important
}
}
@media (min-width:1200px) {
.float-xl-left {
float: left !important
}
.float-xl-right {
float: right !important
}
.float-xl-none {
float: none !important
}
}
.overflow-auto {
overflow: auto !important
}
.overflow-hidden {
overflow: hidden !important
}
.position-static {
position: static !important
}
.position-relative {
position: relative !important
}
.position-absolute {
position: absolute !important
}
.position-fixed {
position: fixed !important
}
.position-sticky {
position: -webkit-sticky !important;
position: sticky !important
}
.fixed-top {
position: fixed;
top: 0;
right: 0;
left: 0;
z-index: 1030
}
.fixed-bottom {
position: fixed;
right: 0;
bottom: 0;
left: 0;
z-index: 1030
}
@supports ((position:-webkit-sticky) or (position:sticky)) {
.sticky-top {
position: -webkit-sticky;
position: sticky;
top: 0;
z-index: 1020
}
}
.sr-only {
position: absolute;
width: 1px;
height: 1px;
padding: 0;
overflow: hidden;
clip: rect(0, 0, 0, 0);
white-space: nowrap;
border: 0
}
.sr-only-focusable:active,
.sr-only-focusable:focus {
position: static;
width: auto;
height: auto;
overflow: visible;
clip: auto;
white-space: normal
}
.shadow-sm {
box-shadow: 0 .125rem .25rem rgba(0, 0, 0, .075) !important
}
.shadow {
box-shadow: 0 .5rem 1rem rgba(0, 0, 0, .15) !important
}
.shadow-lg {
box-shadow: 0 1rem 3rem rgba(0, 0, 0, .175) !important
}
.shadow-none {
box-shadow: none !important
}
.w-25 {
width: 25% !important
}
.w-50 {
width: 50% !important
}
.w-75 {
width: 75% !important
}
.w-100 {
width: 100% !important
}
.w-auto {
width: auto !important
}
.h-25 {
height: 25% !important
}
.h-50 {
height: 50% !important
}
.h-75 {
height: 75% !important
}
.h-100 {
height: 100% !important
}
.h-auto {
height: auto !important
}
.mw-100 {
max-width: 100% !important
}
.mh-100 {
max-height: 100% !important
}
.min-vw-100 {
min-width: 100vw !important
}
.min-vh-100 {
min-height: 100vh !important
}
.vw-100 {
width: 100vw !important
}
.vh-100 {
height: 100vh !important
}
.stretched-link::after {
position: absolute;
top: 0;
right: 0;
bottom: 0;
left: 0;
z-index: 1;
pointer-events: auto;
content: "";
background-color: rgba(0, 0, 0, 0)
}
.m-0 {
margin: 0 !important
}
.mt-0,
.my-0 {
margin-top: 0 !important
}
.mr-0,
.mx-0 {
margin-right: 0 !important
}
.mb-0,
.my-0 {
margin-bottom: 0 !important
}
.ml-0,
.mx-0 {
margin-left: 0 !important
}
.m-1 {
margin: .25rem !important
}
.mt-1,
.my-1 {
margin-top: .25rem !important
}
.mr-1,
.mx-1 {
margin-right: .25rem !important
}
.mb-1,
.my-1 {
margin-bottom: .25rem !important
}
.ml-1,
.mx-1 {
margin-left: .25rem !important
}
.m-2 {
margin: .5rem !important
}
.mt-2,
.my-2 {
margin-top: .5rem !important
}
.mr-2,
.mx-2 {
margin-right: .5rem !important
}
.mb-2,
.my-2 {
margin-bottom: .5rem !important
}
.ml-2,
.mx-2 {
margin-left: .5rem !important
}
.m-3 {
margin: 1rem !important
}
.mt-3,
.my-3 {
margin-top: 1rem !important
}
.mr-3,
.mx-3 {
margin-right: 1rem !important
}
.mb-3,
.my-3 {
margin-bottom: 1rem !important
}
.ml-3,
.mx-3 {
margin-left: 1rem !important
}
.m-4 {
margin: 1.5rem !important
}
.mt-4,
.my-4 {
margin-top: 1.5rem !important
}
.mr-4,
.mx-4 {
margin-right: 1.5rem !important
}
.mb-4,
.my-4 {
margin-bottom: 1.5rem !important
}
.ml-4,
.mx-4 {
margin-left: 1.5rem !important
}
.m-5 {
margin: 3rem !important
}
.mt-5,
.my-5 {
margin-top: 3rem !important
}
.mr-5,
.mx-5 {
margin-right: 3rem !important
}
.mb-5,
.my-5 {
margin-bottom: 3rem !important
}
.ml-5,
.mx-5 {
margin-left: 3rem !important
}
.p-0 {
padding: 0 !important
}
.pt-0,
.py-0 {
padding-top: 0 !important
}
.pr-0,
.px-0 {
padding-right: 0 !important
}
.pb-0,
.py-0 {
padding-bottom: 0 !important
}
.pl-0,
.px-0 {
padding-left: 0 !important
}
.p-1 {
padding: .25rem !important
}
.pt-1,
.py-1 {
padding-top: .25rem !important
}
.pr-1,
.px-1 {
padding-right: .25rem !important
}
.pb-1,
.py-1 {
padding-bottom: .25rem !important
}
.pl-1,
.px-1 {
padding-left: .25rem !important
}
.p-2 {
padding: .5rem !important
}
.pt-2,
.py-2 {
padding-top: .5rem !important
}
.pr-2,
.px-2 {
padding-right: .5rem !important
}
.pb-2,
.py-2 {
padding-bottom: .5rem !important
}
.pl-2,
.px-2 {
padding-left: .5rem !important
}
.p-3 {
padding: 1rem !important
}
.pt-3,
.py-3 {
padding-top: 1rem !important
}
.pr-3,
.px-3 {
padding-right: 1rem !important
}
.pb-3,
.py-3 {
padding-bottom: 1rem !important
}
.pl-3,
.px-3 {
padding-left: 1rem !important
}
.p-4 {
padding: 1.5rem !important
}
.pt-4,
.py-4 {
padding-top: 1.5rem !important
}
.pr-4,
.px-4 {
padding-right: 1.5rem !important
}
.pb-4,
.py-4 {
padding-bottom: 1.5rem !important
}
.pl-4,
.px-4 {
padding-left: 1.5rem !important
}
.p-5 {
padding: 3rem !important
}
.pt-5,
.py-5 {
padding-top: 3rem !important
}
.pr-5,
.px-5 {
padding-right: 3rem !important
}
.pb-5,
.py-5 {
padding-bottom: 3rem !important
}
.pl-5,
.px-5 {
padding-left: 3rem !important
}
.m-n1 {
margin: -.25rem !important
}
.mt-n1,
.my-n1 {
margin-top: -.25rem !important
}
.mr-n1,
.mx-n1 {
margin-right: -.25rem !important
}
.mb-n1,
.my-n1 {
margin-bottom: -.25rem !important
}
.ml-n1,
.mx-n1 {
margin-left: -.25rem !important
}
.m-n2 {
margin: -.5rem !important
}
.mt-n2,
.my-n2 {
margin-top: -.5rem !important
}
.mr-n2,
.mx-n2 {
margin-right: -.5rem !important
}
.mb-n2,
.my-n2 {
margin-bottom: -.5rem !important
}
.ml-n2,
.mx-n2 {
margin-left: -.5rem !important
}
.m-n3 {
margin: -1rem !important
}
.mt-n3,
.my-n3 {
margin-top: -1rem !important
}
.mr-n3,
.mx-n3 {
margin-right: -1rem !important
}
.mb-n3,
.my-n3 {
margin-bottom: -1rem !important
}
.ml-n3,
.mx-n3 {
margin-left: -1rem !important
}
.m-n4 {
margin: -1.5rem !important
}
.mt-n4,
.my-n4 {
margin-top: -1.5rem !important
}
.mr-n4,
.mx-n4 {
margin-right: -1.5rem !important
}
.mb-n4,
.my-n4 {
margin-bottom: -1.5rem !important
}
.ml-n4,
.mx-n4 {
margin-left: -1.5rem !important
}
.m-n5 {
margin: -3rem !important
}
.mt-n5,
.my-n5 {
margin-top: -3rem !important
}
.mr-n5,
.mx-n5 {
margin-right: -3rem !important
}
.mb-n5,
.my-n5 {
margin-bottom: -3rem !important
}
.ml-n5,
.mx-n5 {
margin-left: -3rem !important
}
.m-auto {
margin: auto !important
}
.mt-auto,
.my-auto {
margin-top: auto !important
}
.mr-auto,
.mx-auto {
margin-right: auto !important
}
.mb-auto,
.my-auto {
margin-bottom: auto !important
}
.ml-auto,
.mx-auto {
margin-left: auto !important
}
@media (min-width:576px) {
.m-sm-0 {
margin: 0 !important
}
.mt-sm-0,
.my-sm-0 {
margin-top: 0 !important
}
.mr-sm-0,
.mx-sm-0 {
margin-right: 0 !important
}
.mb-sm-0,
.my-sm-0 {
margin-bottom: 0 !important
}
.ml-sm-0,
.mx-sm-0 {
margin-left: 0 !important
}
.m-sm-1 {
margin: .25rem !important
}
.mt-sm-1,
.my-sm-1 {
margin-top: .25rem !important
}
.mr-sm-1,
.mx-sm-1 {
margin-right: .25rem !important
}
.mb-sm-1,
.my-sm-1 {
margin-bottom: .25rem !important
}
.ml-sm-1,
.mx-sm-1 {
margin-left: .25rem !important
}
.m-sm-2 {
margin: .5rem !important
}
.mt-sm-2,
.my-sm-2 {
margin-top: .5rem !important
}
.mr-sm-2,
.mx-sm-2 {
margin-right: .5rem !important
}
.mb-sm-2,
.my-sm-2 {
margin-bottom: .5rem !important
}
.ml-sm-2,
.mx-sm-2 {
margin-left: .5rem !important
}
.m-sm-3 {
margin: 1rem !important
}
.mt-sm-3,
.my-sm-3 {
margin-top: 1rem !important
}
.mr-sm-3,
.mx-sm-3 {
margin-right: 1rem !important
}
.mb-sm-3,
.my-sm-3 {
margin-bottom: 1rem !important
}
.ml-sm-3,
.mx-sm-3 {
margin-left: 1rem !important
}
.m-sm-4 {
margin: 1.5rem !important
}
.mt-sm-4,
.my-sm-4 {
margin-top: 1.5rem !important
}
.mr-sm-4,
.mx-sm-4 {
margin-right: 1.5rem !important
}
.mb-sm-4,
.my-sm-4 {
margin-bottom: 1.5rem !important
}
.ml-sm-4,
.mx-sm-4 {
margin-left: 1.5rem !important
}
.m-sm-5 {
margin: 3rem !important
}
.mt-sm-5,
.my-sm-5 {
margin-top: 3rem !important
}
.mr-sm-5,
.mx-sm-5 {
margin-right: 3rem !important
}
.mb-sm-5,
.my-sm-5 {
margin-bottom: 3rem !important
}
.ml-sm-5,
.mx-sm-5 {
margin-left: 3rem !important
}
.p-sm-0 {
padding: 0 !important
}
.pt-sm-0,
.py-sm-0 {
padding-top: 0 !important
}
.pr-sm-0,
.px-sm-0 {
padding-right: 0 !important
}
.pb-sm-0,
.py-sm-0 {
padding-bottom: 0 !important
}
.pl-sm-0,
.px-sm-0 {
padding-left: 0 !important
}
.p-sm-1 {
padding: .25rem !important
}
.pt-sm-1,
.py-sm-1 {
padding-top: .25rem !important
}
.pr-sm-1,
.px-sm-1 {
padding-right: .25rem !important
}
.pb-sm-1,
.py-sm-1 {
padding-bottom: .25rem !important
}
.pl-sm-1,
.px-sm-1 {
padding-left: .25rem !important
}
.p-sm-2 {
padding: .5rem !important
}
.pt-sm-2,
.py-sm-2 {
padding-top: .5rem !important
}
.pr-sm-2,
.px-sm-2 {
padding-right: .5rem !important
}
.pb-sm-2,
.py-sm-2 {
padding-bottom: .5rem !important
}
.pl-sm-2,
.px-sm-2 {
padding-left: .5rem !important
}
.p-sm-3 {
padding: 1rem !important
}
.pt-sm-3,
.py-sm-3 {
padding-top: 1rem !important
}
.pr-sm-3,
.px-sm-3 {
padding-right: 1rem !important
}
.pb-sm-3,
.py-sm-3 {
padding-bottom: 1rem !important
}
.pl-sm-3,
.px-sm-3 {
padding-left: 1rem !important
}
.p-sm-4 {
padding: 1.5rem !important
}
.pt-sm-4,
.py-sm-4 {
padding-top: 1.5rem !important
}
.pr-sm-4,
.px-sm-4 {
padding-right: 1.5rem !important
}
.pb-sm-4,
.py-sm-4 {
padding-bottom: 1.5rem !important
}
.pl-sm-4,
.px-sm-4 {
padding-left: 1.5rem !important
}
.p-sm-5 {
padding: 3rem !important
}
.pt-sm-5,
.py-sm-5 {
padding-top: 3rem !important
}
.pr-sm-5,
.px-sm-5 {
padding-right: 3rem !important
}
.pb-sm-5,
.py-sm-5 {
padding-bottom: 3rem !important
}
.pl-sm-5,
.px-sm-5 {
padding-left: 3rem !important
}
.m-sm-n1 {
margin: -.25rem !important
}
.mt-sm-n1,
.my-sm-n1 {
margin-top: -.25rem !important
}
.mr-sm-n1,
.mx-sm-n1 {
margin-right: -.25rem !important
}
.mb-sm-n1,
.my-sm-n1 {
margin-bottom: -.25rem !important
}
.ml-sm-n1,
.mx-sm-n1 {
margin-left: -.25rem !important
}
.m-sm-n2 {
margin: -.5rem !important
}
.mt-sm-n2,
.my-sm-n2 {
margin-top: -.5rem !important
}
.mr-sm-n2,
.mx-sm-n2 {
margin-right: -.5rem !important
}
.mb-sm-n2,
.my-sm-n2 {
margin-bottom: -.5rem !important
}
.ml-sm-n2,
.mx-sm-n2 {
margin-left: -.5rem !important
}
.m-sm-n3 {
margin: -1rem !important
}
.mt-sm-n3,
.my-sm-n3 {
margin-top: -1rem !important
}
.mr-sm-n3,
.mx-sm-n3 {
margin-right: -1rem !important
}
.mb-sm-n3,
.my-sm-n3 {
margin-bottom: -1rem !important
}
.ml-sm-n3,
.mx-sm-n3 {
margin-left: -1rem !important
}
.m-sm-n4 {
margin: -1.5rem !important
}
.mt-sm-n4,
.my-sm-n4 {
margin-top: -1.5rem !important
}
.mr-sm-n4,
.mx-sm-n4 {
margin-right: -1.5rem !important
}
.mb-sm-n4,
.my-sm-n4 {
margin-bottom: -1.5rem !important
}
.ml-sm-n4,
.mx-sm-n4 {
margin-left: -1.5rem !important
}
.m-sm-n5 {
margin: -3rem !important
}
.mt-sm-n5,
.my-sm-n5 {
margin-top: -3rem !important
}
.mr-sm-n5,
.mx-sm-n5 {
margin-right: -3rem !important
}
.mb-sm-n5,
.my-sm-n5 {
margin-bottom: -3rem !important
}
.ml-sm-n5,
.mx-sm-n5 {
margin-left: -3rem !important
}
.m-sm-auto {
margin: auto !important
}
.mt-sm-auto,
.my-sm-auto {
margin-top: auto !important
}
.mr-sm-auto,
.mx-sm-auto {
margin-right: auto !important
}
.mb-sm-auto,
.my-sm-auto {
margin-bottom: auto !important
}
.ml-sm-auto,
.mx-sm-auto {
margin-left: auto !important
}
}
@media (min-width:768px) {
.m-md-0 {
margin: 0 !important
}
.mt-md-0,
.my-md-0 {
margin-top: 0 !important
}
.mr-md-0,
.mx-md-0 {
margin-right: 0 !important
}
.mb-md-0,
.my-md-0 {
margin-bottom: 0 !important
}
.ml-md-0,
.mx-md-0 {
margin-left: 0 !important
}
.m-md-1 {
margin: .25rem !important
}
.mt-md-1,
.my-md-1 {
margin-top: .25rem !important
}
.mr-md-1,
.mx-md-1 {
margin-right: .25rem !important
}
.mb-md-1,
.my-md-1 {
margin-bottom: .25rem !important
}
.ml-md-1,
.mx-md-1 {
margin-left: .25rem !important
}
.m-md-2 {
margin: .5rem !important
}
.mt-md-2,
.my-md-2 {
margin-top: .5rem !important
}
.mr-md-2,
.mx-md-2 {
margin-right: .5rem !important
}
.mb-md-2,
.my-md-2 {
margin-bottom: .5rem !important
}
.ml-md-2,
.mx-md-2 {
margin-left: .5rem !important
}
.m-md-3 {
margin: 1rem !important
}
.mt-md-3,
.my-md-3 {
margin-top: 1rem !important
}
.mr-md-3,
.mx-md-3 {
margin-right: 1rem !important
}
.mb-md-3,
.my-md-3 {
margin-bottom: 1rem !important
}
.ml-md-3,
.mx-md-3 {
margin-left: 1rem !important
}
.m-md-4 {
margin: 1.5rem !important
}
.mt-md-4,
.my-md-4 {
margin-top: 1.5rem !important
}
.mr-md-4,
.mx-md-4 {
margin-right: 1.5rem !important
}
.mb-md-4,
.my-md-4 {
margin-bottom: 1.5rem !important
}
.ml-md-4,
.mx-md-4 {
margin-left: 1.5rem !important
}
.m-md-5 {
margin: 3rem !important
}
.mt-md-5,
.my-md-5 {
margin-top: 3rem !important
}
.mr-md-5,
.mx-md-5 {
margin-right: 3rem !important
}
.mb-md-5,
.my-md-5 {
margin-bottom: 3rem !important
}
.ml-md-5,
.mx-md-5 {
margin-left: 3rem !important
}
.p-md-0 {
padding: 0 !important
}
.pt-md-0,
.py-md-0 {
padding-top: 0 !important
}
.pr-md-0,
.px-md-0 {
padding-right: 0 !important
}
.pb-md-0,
.py-md-0 {
padding-bottom: 0 !important
}
.pl-md-0,
.px-md-0 {
padding-left: 0 !important
}
.p-md-1 {
padding: .25rem !important
}
.pt-md-1,
.py-md-1 {
padding-top: .25rem !important
}
.pr-md-1,
.px-md-1 {
padding-right: .25rem !important
}
.pb-md-1,
.py-md-1 {
padding-bottom: .25rem !important
}
.pl-md-1,
.px-md-1 {
padding-left: .25rem !important
}
.p-md-2 {
padding: .5rem !important
}
.pt-md-2,
.py-md-2 {
padding-top: .5rem !important
}
.pr-md-2,
.px-md-2 {
padding-right: .5rem !important
}
.pb-md-2,
.py-md-2 {
padding-bottom: .5rem !important
}
.pl-md-2,
.px-md-2 {
padding-left: .5rem !important
}
.p-md-3 {
padding: 1rem !important
}
.pt-md-3,
.py-md-3 {
padding-top: 1rem !important
}
.pr-md-3,
.px-md-3 {
padding-right: 1rem !important
}
.pb-md-3,
.py-md-3 {
padding-bottom: 1rem !important
}
.pl-md-3,
.px-md-3 {
padding-left: 1rem !important
}
.p-md-4 {
padding: 1.5rem !important
}
.pt-md-4,
.py-md-4 {
padding-top: 1.5rem !important
}
.pr-md-4,
.px-md-4 {
padding-right: 1.5rem !important
}
.pb-md-4,
.py-md-4 {
padding-bottom: 1.5rem !important
}
.pl-md-4,
.px-md-4 {
padding-left: 1.5rem !important
}
.p-md-5 {
padding: 3rem !important
}
.pt-md-5,
.py-md-5 {
padding-top: 3rem !important
}
.pr-md-5,
.px-md-5 {
padding-right: 3rem !important
}
.pb-md-5,
.py-md-5 {
padding-bottom: 3rem !important
}
.pl-md-5,
.px-md-5 {
padding-left: 3rem !important
}
.m-md-n1 {
margin: -.25rem !important
}
.mt-md-n1,
.my-md-n1 {
margin-top: -.25rem !important
}
.mr-md-n1,
.mx-md-n1 {
margin-right: -.25rem !important
}
.mb-md-n1,
.my-md-n1 {
margin-bottom: -.25rem !important
}
.ml-md-n1,
.mx-md-n1 {
margin-left: -.25rem !important
}
.m-md-n2 {
margin: -.5rem !important
}
.mt-md-n2,
.my-md-n2 {
margin-top: -.5rem !important
}
.mr-md-n2,
.mx-md-n2 {
margin-right: -.5rem !important
}
.mb-md-n2,
.my-md-n2 {
margin-bottom: -.5rem !important
}
.ml-md-n2,
.mx-md-n2 {
margin-left: -.5rem !important
}
.m-md-n3 {
margin: -1rem !important
}
.mt-md-n3,
.my-md-n3 {
margin-top: -1rem !important
}
.mr-md-n3,
.mx-md-n3 {
margin-right: -1rem !important
}
.mb-md-n3,
.my-md-n3 {
margin-bottom: -1rem !important
}
.ml-md-n3,
.mx-md-n3 {
margin-left: -1rem !important
}
.m-md-n4 {
margin: -1.5rem !important
}
.mt-md-n4,
.my-md-n4 {
margin-top: -1.5rem !important
}
.mr-md-n4,
.mx-md-n4 {
margin-right: -1.5rem !important
}
.mb-md-n4,
.my-md-n4 {
margin-bottom: -1.5rem !important
}
.ml-md-n4,
.mx-md-n4 {
margin-left: -1.5rem !important
}
.m-md-n5 {
margin: -3rem !important
}
.mt-md-n5,
.my-md-n5 {
margin-top: -3rem !important
}
.mr-md-n5,
.mx-md-n5 {
margin-right: -3rem !important
}
.mb-md-n5,
.my-md-n5 {
margin-bottom: -3rem !important
}
.ml-md-n5,
.mx-md-n5 {
margin-left: -3rem !important
}
.m-md-auto {
margin: auto !important
}
.mt-md-auto,
.my-md-auto {
margin-top: auto !important
}
.mr-md-auto,
.mx-md-auto {
margin-right: auto !important
}
.mb-md-auto,
.my-md-auto {
margin-bottom: auto !important
}
.ml-md-auto,
.mx-md-auto {
margin-left: auto !important
}
}
@media (min-width:992px) {
.m-lg-0 {
margin: 0 !important
}
.mt-lg-0,
.my-lg-0 {
margin-top: 0 !important
}
.mr-lg-0,
.mx-lg-0 {
margin-right: 0 !important
}
.mb-lg-0,
.my-lg-0 {
margin-bottom: 0 !important
}
.ml-lg-0,
.mx-lg-0 {
margin-left: 0 !important
}
.m-lg-1 {
margin: .25rem !important
}
.mt-lg-1,
.my-lg-1 {
margin-top: .25rem !important
}
.mr-lg-1,
.mx-lg-1 {
margin-right: .25rem !important
}
.mb-lg-1,
.my-lg-1 {
margin-bottom: .25rem !important
}
.ml-lg-1,
.mx-lg-1 {
margin-left: .25rem !important
}
.m-lg-2 {
margin: .5rem !important
}
.mt-lg-2,
.my-lg-2 {
margin-top: .5rem !important
}
.mr-lg-2,
.mx-lg-2 {
margin-right: .5rem !important
}
.mb-lg-2,
.my-lg-2 {
margin-bottom: .5rem !important
}
.ml-lg-2,
.mx-lg-2 {
margin-left: .5rem !important
}
.m-lg-3 {
margin: 1rem !important
}
.mt-lg-3,
.my-lg-3 {
margin-top: 1rem !important
}
.mr-lg-3,
.mx-lg-3 {
margin-right: 1rem !important
}
.mb-lg-3,
.my-lg-3 {
margin-bottom: 1rem !important
}
.ml-lg-3,
.mx-lg-3 {
margin-left: 1rem !important
}
.m-lg-4 {
margin: 1.5rem !important
}
.mt-lg-4,
.my-lg-4 {
margin-top: 1.5rem !important
}
.mr-lg-4,
.mx-lg-4 {
margin-right: 1.5rem !important
}
.mb-lg-4,
.my-lg-4 {
margin-bottom: 1.5rem !important
}
.ml-lg-4,
.mx-lg-4 {
margin-left: 1.5rem !important
}
.m-lg-5 {
margin: 3rem !important
}
.mt-lg-5,
.my-lg-5 {
margin-top: 3rem !important
}
.mr-lg-5,
.mx-lg-5 {
margin-right: 3rem !important
}
.mb-lg-5,
.my-lg-5 {
margin-bottom: 3rem !important
}
.ml-lg-5,
.mx-lg-5 {
margin-left: 3rem !important
}
.p-lg-0 {
padding: 0 !important
}
.pt-lg-0,
.py-lg-0 {
padding-top: 0 !important
}
.pr-lg-0,
.px-lg-0 {
padding-right: 0 !important
}
.pb-lg-0,
.py-lg-0 {
padding-bottom: 0 !important
}
.pl-lg-0,
.px-lg-0 {
padding-left: 0 !important
}
.p-lg-1 {
padding: .25rem !important
}
.pt-lg-1,
.py-lg-1 {
padding-top: .25rem !important
}
.pr-lg-1,
.px-lg-1 {
padding-right: .25rem !important
}
.pb-lg-1,
.py-lg-1 {
padding-bottom: .25rem !important
}
.pl-lg-1,
.px-lg-1 {
padding-left: .25rem !important
}
.p-lg-2 {
padding: .5rem !important
}
.pt-lg-2,
.py-lg-2 {
padding-top: .5rem !important
}
.pr-lg-2,
.px-lg-2 {
padding-right: .5rem !important
}
.pb-lg-2,
.py-lg-2 {
padding-bottom: .5rem !important
}
.pl-lg-2,
.px-lg-2 {
padding-left: .5rem !important
}
.p-lg-3 {
padding: 1rem !important
}
.pt-lg-3,
.py-lg-3 {
padding-top: 1rem !important
}
.pr-lg-3,
.px-lg-3 {
padding-right: 1rem !important
}
.pb-lg-3,
.py-lg-3 {
padding-bottom: 1rem !important
}
.pl-lg-3,
.px-lg-3 {
padding-left: 1rem !important
}
.p-lg-4 {
padding: 1.5rem !important
}
.pt-lg-4,
.py-lg-4 {
padding-top: 1.5rem !important
}
.pr-lg-4,
.px-lg-4 {
padding-right: 1.5rem !important
}
.pb-lg-4,
.py-lg-4 {
padding-bottom: 1.5rem !important
}
.pl-lg-4,
.px-lg-4 {
padding-left: 1.5rem !important
}
.p-lg-5 {
padding: 3rem !important
}
.pt-lg-5,
.py-lg-5 {
padding-top: 3rem !important
}
.pr-lg-5,
.px-lg-5 {
padding-right: 3rem !important
}
.pb-lg-5,
.py-lg-5 {
padding-bottom: 3rem !important
}
.pl-lg-5,
.px-lg-5 {
padding-left: 3rem !important
}
.m-lg-n1 {
margin: -.25rem !important
}
.mt-lg-n1,
.my-lg-n1 {
margin-top: -.25rem !important
}
.mr-lg-n1,
.mx-lg-n1 {
margin-right: -.25rem !important
}
.mb-lg-n1,
.my-lg-n1 {
margin-bottom: -.25rem !important
}
.ml-lg-n1,
.mx-lg-n1 {
margin-left: -.25rem !important
}
.m-lg-n2 {
margin: -.5rem !important
}
.mt-lg-n2,
.my-lg-n2 {
margin-top: -.5rem !important
}
.mr-lg-n2,
.mx-lg-n2 {
margin-right: -.5rem !important
}
.mb-lg-n2,
.my-lg-n2 {
margin-bottom: -.5rem !important
}
.ml-lg-n2,
.mx-lg-n2 {
margin-left: -.5rem !important
}
.m-lg-n3 {
margin: -1rem !important
}
.mt-lg-n3,
.my-lg-n3 {
margin-top: -1rem !important
}
.mr-lg-n3,
.mx-lg-n3 {
margin-right: -1rem !important
}
.mb-lg-n3,
.my-lg-n3 {
margin-bottom: -1rem !important
}
.ml-lg-n3,
.mx-lg-n3 {
margin-left: -1rem !important
}
.m-lg-n4 {
margin: -1.5rem !important
}
.mt-lg-n4,
.my-lg-n4 {
margin-top: -1.5rem !important
}
.mr-lg-n4,
.mx-lg-n4 {
margin-right: -1.5rem !important
}
.mb-lg-n4,
.my-lg-n4 {
margin-bottom: -1.5rem !important
}
.ml-lg-n4,
.mx-lg-n4 {
margin-left: -1.5rem !important
}
.m-lg-n5 {
margin: -3rem !important
}
.mt-lg-n5,
.my-lg-n5 {
margin-top: -3rem !important
}
.mr-lg-n5,
.mx-lg-n5 {
margin-right: -3rem !important
}
.mb-lg-n5,
.my-lg-n5 {
margin-bottom: -3rem !important
}
.ml-lg-n5,
.mx-lg-n5 {
margin-left: -3rem !important
}
.m-lg-auto {
margin: auto !important
}
.mt-lg-auto,
.my-lg-auto {
margin-top: auto !important
}
.mr-lg-auto,
.mx-lg-auto {
margin-right: auto !important
}
.mb-lg-auto,
.my-lg-auto {
margin-bottom: auto !important
}
.ml-lg-auto,
.mx-lg-auto {
margin-left: auto !important
}
}
@media (min-width:1200px) {
.m-xl-0 {
margin: 0 !important
}
.mt-xl-0,
.my-xl-0 {
margin-top: 0 !important
}
.mr-xl-0,
.mx-xl-0 {
margin-right: 0 !important
}
.mb-xl-0,
.my-xl-0 {
margin-bottom: 0 !important
}
.ml-xl-0,
.mx-xl-0 {
margin-left: 0 !important
}
.m-xl-1 {
margin: .25rem !important
}
.mt-xl-1,
.my-xl-1 {
margin-top: .25rem !important
}
.mr-xl-1,
.mx-xl-1 {
margin-right: .25rem !important
}
.mb-xl-1,
.my-xl-1 {
margin-bottom: .25rem !important
}
.ml-xl-1,
.mx-xl-1 {
margin-left: .25rem !important
}
.m-xl-2 {
margin: .5rem !important
}
.mt-xl-2,
.my-xl-2 {
margin-top: .5rem !important
}
.mr-xl-2,
.mx-xl-2 {
margin-right: .5rem !important
}
.mb-xl-2,
.my-xl-2 {
margin-bottom: .5rem !important
}
.ml-xl-2,
.mx-xl-2 {
margin-left: .5rem !important
}
.m-xl-3 {
margin: 1rem !important
}
.mt-xl-3,
.my-xl-3 {
margin-top: 1rem !important
}
.mr-xl-3,
.mx-xl-3 {
margin-right: 1rem !important
}
.mb-xl-3,
.my-xl-3 {
margin-bottom: 1rem !important
}
.ml-xl-3,
.mx-xl-3 {
margin-left: 1rem !important
}
.m-xl-4 {
margin: 1.5rem !important
}
.mt-xl-4,
.my-xl-4 {
margin-top: 1.5rem !important
}
.mr-xl-4,
.mx-xl-4 {
margin-right: 1.5rem !important
}
.mb-xl-4,
.my-xl-4 {
margin-bottom: 1.5rem !important
}
.ml-xl-4,
.mx-xl-4 {
margin-left: 1.5rem !important
}
.m-xl-5 {
margin: 3rem !important
}
.mt-xl-5,
.my-xl-5 {
margin-top: 3rem !important
}
.mr-xl-5,
.mx-xl-5 {
margin-right: 3rem !important
}
.mb-xl-5,
.my-xl-5 {
margin-bottom: 3rem !important
}
.ml-xl-5,
.mx-xl-5 {
margin-left: 3rem !important
}
.p-xl-0 {
padding: 0 !important
}
.pt-xl-0,
.py-xl-0 {
padding-top: 0 !important
}
.pr-xl-0,
.px-xl-0 {
padding-right: 0 !important
}
.pb-xl-0,
.py-xl-0 {
padding-bottom: 0 !important
}
.pl-xl-0,
.px-xl-0 {
padding-left: 0 !important
}
.p-xl-1 {
padding: .25rem !important
}
.pt-xl-1,
.py-xl-1 {
padding-top: .25rem !important
}
.pr-xl-1,
.px-xl-1 {
padding-right: .25rem !important
}
.pb-xl-1,
.py-xl-1 {
padding-bottom: .25rem !important
}
.pl-xl-1,
.px-xl-1 {
padding-left: .25rem !important
}
.p-xl-2 {
padding: .5rem !important
}
.pt-xl-2,
.py-xl-2 {
padding-top: .5rem !important
}
.pr-xl-2,
.px-xl-2 {
padding-right: .5rem !important
}
.pb-xl-2,
.py-xl-2 {
padding-bottom: .5rem !important
}
.pl-xl-2,
.px-xl-2 {
padding-left: .5rem !important
}
.p-xl-3 {
padding: 1rem !important
}
.pt-xl-3,
.py-xl-3 {
padding-top: 1rem !important
}
.pr-xl-3,
.px-xl-3 {
padding-right: 1rem !important
}
.pb-xl-3,
.py-xl-3 {
padding-bottom: 1rem !important
}
.pl-xl-3,
.px-xl-3 {
padding-left: 1rem !important
}
.p-xl-4 {
padding: 1.5rem !important
}
.pt-xl-4,
.py-xl-4 {
padding-top: 1.5rem !important
}
.pr-xl-4,
.px-xl-4 {
padding-right: 1.5rem !important
}
.pb-xl-4,
.py-xl-4 {
padding-bottom: 1.5rem !important
}
.pl-xl-4,
.px-xl-4 {
padding-left: 1.5rem !important
}
.p-xl-5 {
padding: 3rem !important
}
.pt-xl-5,
.py-xl-5 {
padding-top: 3rem !important
}
.pr-xl-5,
.px-xl-5 {
padding-right: 3rem !important
}
.pb-xl-5,
.py-xl-5 {
padding-bottom: 3rem !important
}
.pl-xl-5,
.px-xl-5 {
padding-left: 3rem !important
}
.m-xl-n1 {
margin: -.25rem !important
}
.mt-xl-n1,
.my-xl-n1 {
margin-top: -.25rem !important
}
.mr-xl-n1,
.mx-xl-n1 {
margin-right: -.25rem !important
}
.mb-xl-n1,
.my-xl-n1 {
margin-bottom: -.25rem !important
}
.ml-xl-n1,
.mx-xl-n1 {
margin-left: -.25rem !important
}
.m-xl-n2 {
margin: -.5rem !important
}
.mt-xl-n2,
.my-xl-n2 {
margin-top: -.5rem !important
}
.mr-xl-n2,
.mx-xl-n2 {
margin-right: -.5rem !important
}
.mb-xl-n2,
.my-xl-n2 {
margin-bottom: -.5rem !important
}
.ml-xl-n2,
.mx-xl-n2 {
margin-left: -.5rem !important
}
.m-xl-n3 {
margin: -1rem !important
}
.mt-xl-n3,
.my-xl-n3 {
margin-top: -1rem !important
}
.mr-xl-n3,
.mx-xl-n3 {
margin-right: -1rem !important
}
.mb-xl-n3,
.my-xl-n3 {
margin-bottom: -1rem !important
}
.ml-xl-n3,
.mx-xl-n3 {
margin-left: -1rem !important
}
.m-xl-n4 {
margin: -1.5rem !important
}
.mt-xl-n4,
.my-xl-n4 {
margin-top: -1.5rem !important
}
.mr-xl-n4,
.mx-xl-n4 {
margin-right: -1.5rem !important
}
.mb-xl-n4,
.my-xl-n4 {
margin-bottom: -1.5rem !important
}
.ml-xl-n4,
.mx-xl-n4 {
margin-left: -1.5rem !important
}
.m-xl-n5 {
margin: -3rem !important
}
.mt-xl-n5,
.my-xl-n5 {
margin-top: -3rem !important
}
.mr-xl-n5,
.mx-xl-n5 {
margin-right: -3rem !important
}
.mb-xl-n5,
.my-xl-n5 {
margin-bottom: -3rem !important
}
.ml-xl-n5,
.mx-xl-n5 {
margin-left: -3rem !important
}
.m-xl-auto {
margin: auto !important
}
.mt-xl-auto,
.my-xl-auto {
margin-top: auto !important
}
.mr-xl-auto,
.mx-xl-auto {
margin-right: auto !important
}
.mb-xl-auto,
.my-xl-auto {
margin-bottom: auto !important
}
.ml-xl-auto,
.mx-xl-auto {
margin-left: auto !important
}
}
.text-monospace {
font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace !important
}
.text-justify {
text-align: justify !important
}
.text-wrap {
white-space: normal !important
}
.text-nowrap {
white-space: nowrap !important
}
.text-truncate {
overflow: hidden;
text-overflow: ellipsis;
white-space: nowrap
}
.text-left {
text-align: left !important
}
.text-right {
text-align: right !important
}
.text-center {
text-align: center !important
}
@media (min-width:576px) {
.text-sm-left {
text-align: left !important
}
.text-sm-right {
text-align: right !important
}
.text-sm-center {
text-align: center !important
}
}
@media (min-width:768px) {
.text-md-left {
text-align: left !important
}
.text-md-right {
text-align: right !important
}
.text-md-center {
text-align: center !important
}
}
@media (min-width:992px) {
.text-lg-left {
text-align: left !important
}
.text-lg-right {
text-align: right !important
}
.text-lg-center {
text-align: center !important
}
}
@media (min-width:1200px) {
.text-xl-left {
text-align: left !important
}
.text-xl-right {
text-align: right !important
}
.text-xl-center {
text-align: center !important
}
}
.text-lowercase {
text-transform: lowercase !important
}
.text-uppercase {
text-transform: uppercase !important
}
.text-capitalize {
text-transform: capitalize !important
}
.font-weight-light {
font-weight: 300 !important
}
.font-weight-lighter {
font-weight: lighter !important
}
.font-weight-normal {
font-weight: 400 !important
}
.font-weight-bold {
font-weight: 700 !important
}
.font-weight-bolder {
font-weight: bolder !important
}
.font-italic {
font-style: italic !important
}
.text-white {
color: #fff !important
}
.text-primary {
color: #007bff !important
}
a.text-primary:focus,
a.text-primary:hover {
color: #0056b3 !important
}
.text-secondary {
color: #6c757d !important
}
a.text-secondary:focus,
a.text-secondary:hover {
color: #494f54 !important
}
.text-success {
color: #28a745 !important
}
a.text-success:focus,
a.text-success:hover {
color: #19692c !important
}
.text-info {
color: #17a2b8 !important
}
a.text-info:focus,
a.text-info:hover {
color: #0f6674 !important
}
.text-warning {
color: #ffc107 !important
}
a.text-warning:focus,
a.text-warning:hover {
color: #ba8b00 !important
}
.text-danger {
color: #dc3545 !important
}
a.text-danger:focus,
a.text-danger:hover {
color: #a71d2a !important
}
.text-light {
color: #f8f9fa !important
}
a.text-light:focus,
a.text-light:hover {
color: #cbd3da !important
}
.text-dark {
color: #343a40 !important
}
a.text-dark:focus,
a.text-dark:hover {
color: #121416 !important
}
.text-body {
color: #212529 !important
}
.text-muted {
color: #6c757d !important
}
.text-black-50 {
color: rgba(0, 0, 0, .5) !important
}
.text-white-50 {
color: rgba(255, 255, 255, .5) !important
}
.text-hide {
font: 0/0 a;
color: transparent;
text-shadow: none;
background-color: transparent;
border: 0
}
.text-decoration-none {
text-decoration: none !important
}
.text-break {
word-break: break-word !important;
overflow-wrap: break-word !important
}
.text-reset {
color: inherit !important
}
.visible {
visibility: visible !important
}
.invisible {
visibility: hidden !important
}
@media print {
*,
::after,
::before {
text-shadow: none !important;
box-shadow: none !important
}
a:not(.btn) {
text-decoration: underline
}
abbr[title]::after {
content: " ("attr(title) ")"
}
pre {
white-space: pre-wrap !important
}
blockquote,
pre {
border: 1px solid #adb5bd;
page-break-inside: avoid
}
thead {
display: table-header-group
}
img,
tr {
page-break-inside: avoid
}
h2,
h3,
p {
orphans: 3;
widows: 3
}
h2,
h3 {
page-break-after: avoid
}
@page {
size: a3
}
body {
min-width: 992px !important
}
.container {
min-width: 992px !important
}
.navbar {
display: none
}
.badge {
border: 1px solid #000
}
.table {
border-collapse: collapse !important
}
.table td,
.table th {
background-color: #fff !important
}
.table-bordered td,
.table-bordered th {
border: 1px solid #dee2e6 !important
}
.table-dark {
color: inherit
}
.table-dark tbody+tbody,
.table-dark td,
.table-dark th,
.table-dark thead th {
border-color: #dee2e6
}
.table .thead-dark th {
color: inherit;
border-color: #dee2e6
}
}
/*# sourceMappingURL=bootstrap.min.css.map */
</style>
<style>
/* Please see documentation at https://docs.microsoft.com/aspnet/core/client-side/bundling-and-minification
for details on configuring this project to bundle and minify static web assets. */
a.navbar-brand {
white-space: normal;
text-align: center;
word-break: break-all;
}
/* Provide sufficient contrast against white background */
a {
color: #0366d6;
}
.btn-primary {
color: #fff;
background-color: #1b6ec2;
border-color: #1861ac;
}
.nav-pills .nav-link.active,
.nav-pills .show>.nav-link {
color: #fff;
background-color: #1b6ec2;
border-color: #1861ac;
}
/* Sticky footer styles
-------------------------------------------------- */
html {
font-size: 14px;
}
@media (min-width: 768px) {
html {
font-size: 16px;
}
}
.border-top {
border-top: 1px solid #e5e5e5;
}
.border-bottom {
border-bottom: 1px solid #e5e5e5;
}
.box-shadow {
box-shadow: 0 .25rem .75rem rgba(0, 0, 0, .05);
}
button.accept-policy {
font-size: 1rem;
line-height: inherit;
}
/* Sticky footer styles
-------------------------------------------------- */
html {
position: relative;
min-height: 100%;
}
body {
/* Margin bottom by footer height */
margin-bottom: 60px;
}
.footer {
position: absolute;
bottom: 0;
width: 100%;
white-space: nowrap;
line-height: 60px;
/* Vertically center the text there */
}
span.bg-secondary {
color: white !important;
font-size: 100%;
}
.logo {
/*width: 6em;*/
margin-right: 1em;
}
.width-100 {
width: 100%;
}
</style>
</head>
<body>
<header>
<nav class="navbar navbar-expand-sm navbar-toggleable-sm navbar-light bg-white border-bottom box-shadow mb-3">
<div class="container">
<a class="navbar-brand" href="https://selbsttest.ktn.gv.at/validierung/">
<div class="navbar-brand-logo">
<img alt="logo" class="logo"
src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAS8AAAAjCAMAAADytXwlAAABEVBMVEX///8aGhj/3QDiAA9lZWTf4OCio6Nzc3OpqqpTU1L39/fy8vIfHx0yMjHu7u4oKCfp6enX2NhZWVkrKyr//O709PT/+Ne8vL2CgoI/Pz45OTiWlpb8/PyPj497e3qwsLGioqIlJCPNzs7m5ub84NPCw8Ozs7RsbGy3t7giIiD5xrLqUTfT1NTyi2s2NjXjDhLj4+Pb3NxKSknpTDP5+fnh4eHExcWenp6GhoUvLi3mMSF4eHddXVxGRUVBQUBoaGdXV1fx8fGtrq+mp6eam5vr6+vIyMl+fn6+v79wcHBgYF9QUE+Sk5OKions7OyAgID70b/5xK/959zZ2dk8Ozr97eb/+NbnNiP/4CDmMSD/3ABMQI5dAAAGoklEQVRo3u3aeZPSMBgG8PdRymoJlENUELGAcigiIKcccgjsLrLe5/f/IEKgTVK5ZKozOj5/dLahZV5+JE1alv5Ebl+T8/UWLfP2uZon7+kXcqcQC1IW1QD9i/n8XQHjXu+uO/KQfiFJIE2XQIP+xYj+JbweO7ie/ZJXCyhSbrX5F+O+V/l+U6f6/XGC/sUc6fVXxGumt7ZnTa8m7+e9ptz5H5l3iGdqejcZZxsZd70q5g1d7I3M5kTsZbzekdy70qbXyui8bs8LpqPq/HJ75XXEnC5bNVNp4zNJyFyeIFI2vQS0aEsqAN7IDT2gKhX/EmHi6UCKkbvjptcNsKG90wRyUgH3AUxJ2RdJzTYTZxiI+eSqe8ttEc6crToElIR4ZwIgeZ8DBNwnEbk6fBySyE0AY7F7Bg/x3EXbw3PZnfsBXAzd83oAv/1h0wxziUuvAkiSyD0ULjeF3GwD4Shv9QAw5apvLrd1zzpV+5TxqisCA49IZv2FAV2pe+700nvoRnDH4eW/2uYVttoSgewA6Oq/w8vXhyGPrAYiZygFZC+/bo/VHHDD9ipNFC+REeL2iOZeFVLDvZA/wiuNVD2HnOI1L6G1w0s4z4BXv8PrDMiSlDcIaylkFS+fKCOGm4m1V7ePu7KXohGPKl6hn736XfT0w14dhJfVsozsdXcEVjngRYmbiPsOex1er6per4CF0v/juEEDvNzhRQukgmuvRR4onu5VDRloHvTylWDS0A+v7NWpVZE75EVZoHiM19snjrzf4zVluKwpszUKmeXLkckOrztg2tprtqy8e7pXjO6hHTzkNUKhsnr3uex1tjq+cchrqTw+6HUwqtewh7a6VOHXimAK3h1eaSC09kquqs6e7pXwfUTykNdL3tPzYEXFi3Ko1g54Jap447bXBaCuU8oG8ryI7m6vD5YX5dDTT/bSKQuW3u8VNDAiokAcLdVLM2Ae8KIBci57NYHXpGSMeICvh1hxu1feHo9JUfWJXrWb8Oz3GqPk45PQ8nDFixZoBw54heFx16sB5zdQq67nvGhfQKped2Fcbbz4a5HMMV6VbV68s+b3es3RsXp1WvHiXe4Pe01K6E/U9qJ1HW2JT6x4RePoJiwv7po8xqsRtBKQvSiJnm+PV4htmBI9dFQvPhP8Sa8o5YB5Qm1/jZLP+kKnwss+qnwBZMn24sMzfYRXykhtklO8yhG82uO1QL9mLXtKPsWLD+Y/6UVewHn50qtWQ62PC9srlbzLkwynAI8uvPiq8PKwlxSP5MUdjMxOr2gfrUmQZ8owEl7WV3rnz3nF8gWMO2DncnMDuBPkmbTgD1heUmL3fSS8RNUHvM7r2iZB1WsYQ2en1zlgWOHSihddIOb7Y16GgRkF+mjXSSSpFJi3vIx7zWazA5xlizqR6kVv0Peder3nAxrFXV4dyClUHF71FMz964kL97yAwWqCKiAsLmFXBuS8VK9fA1GP7BX049WJ64lVEpfoJrZ7RUtohaw0UmgKL6uyUnDPerWHhYte8cxmsL2S7rhSDbvABVhGmR+LBbze4kVNGOXTvajIkN/ulQU0eXQNnF7DGFq7vTIG8sd4PXzqyKdtXoUp/0MPA1NRUlhZWnsVL3olDpW9fDHcPdmLf85YrbHN6yUGCVmvEFK9+Oxcme3yegWmufh8YlNuvYR4xr4ejEnkElXVKxFG7EryEh6Fyux0rys/muktXpUCRiQSiGBhe4kqPLv6V93PuV1//nVuP4gcwygrsxNLK15UN5BTvMRN8cXpXmSiNAbIubgx+b2DyAz9qNMrDUS2e4WqQIPc9BJ14B5fcs2RczwPaale1ASyW7w+pBA5ZX4Uq744AwGtgJUob1WntwbwSHiJGV143dycHdQenaXEhdllr2h13ZFCHEPKGWK66pXool1WvKxSsd9rGhDRhZeQAAhgkU2MZSFpZzn65p5oLjsG27bXG2BzegrLxEfkplfbJ7puAbEJUcu+5RCfM829xLGaYQ1eDzrSVNQG5opXSfUyIiKm8LKSA0CMMazDn8ndZ/6J42aNRYKrdQ3rkIi3wDbrnpZ9Pmv3Xt4IkoteWSbb3EghV9P7bOb8aYZXdk8+9kZh081fspla9UD2YjHJ65wxSGmuj+hJXpU2Y6SJLLkow7dKPZqm8xcUirq1e6VZKQ9rLv++7dPK8txR1iq1mqZFSU1QK68mJuXYuqYl1q9N1Koz6tuTSFRTMnQewQ002pX//w9wfP57uRT3vUT+e+31evvthZIvf4fXD49q3JFC4gsHAAAAAElFTkSuQmCCAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA"><span
class="nav-title">COVID-Befund Validierung</span>
</div>
</a>
</div>
</nav>
</header>
<div class="container">
<main role="main" class="pb-3">
<div class="text-center">
<div class="alert alert-success" role="alert">
<h1>Prüfung: Gültig!</h1>
</div>
<div class="row">
<h6 class="col-12">Vorname:</h6>
<p class="col-12">C.</p>
<h6 class="col-12">Nachname:</h6>
<p class="col-12">S.</p>
<h6 class="col-12">Geburtsjahr:</h6>
<p class="col-12">1989</p>
<h6 class="col-12">Getestet am:</h6>
<p class="col-12" id="testedOn"></p>
<p class="col-12">
<span class="badge bg-secondary">vor 0 Tagen</span>
</p>
<h6 class="col-12">Eintrittstest gültig bis:</h6>
<p class="col-12" id="validUntil"></p>
<p class="col-12">
<span class="badge bg-secondary">noch 22 Stunden</span>
</p>
</div>
</div>
</main>
</div>
<footer class="border-top footer text-muted">
<div class="container">
© 2021 - Amt der Kärntner Landesregierung - <a
href="https://selbsttest.ktn.gv.at/validierung/Impressum">Impressum</a>
</div>
</footer>
<script type="text/javascript">
/*! jQuery v3.5.1 | (c) JS Foundation and other contributors | jquery.org/license */
!function (e, t) { "use strict"; "object" == typeof module && "object" == typeof module.exports ? module.exports = e.document ? t(e, !0) : function (e) { if (!e.document) throw new Error("jQuery requires a window with a document"); return t(e) } : t(e) }("undefined" != typeof window ? window : this, function (C, e) { "use strict"; var t = [], r = Object.getPrototypeOf, s = t.slice, g = t.flat ? function (e) { return t.flat.call(e) } : function (e) { return t.concat.apply([], e) }, u = t.push, i = t.indexOf, n = {}, o = n.toString, v = n.hasOwnProperty, a = v.toString, l = a.call(Object), y = {}, m = function (e) { return "function" == typeof e && "number" != typeof e.nodeType }, x = function (e) { return null != e && e === e.window }, E = C.document, c = { type: !0, src: !0, nonce: !0, noModule: !0 }; function b(e, t, n) { var r, i, o = (n = n || E).createElement("script"); if (o.text = e, t) for (r in c) (i = t[r] || t.getAttribute && t.getAttribute(r)) && o.setAttribute(r, i); n.head.appendChild(o).parentNode.removeChild(o) } function w(e) { return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[o.call(e)] || "object" : typeof e } var f = "3.5.1", S = function (e, t) { return new S.fn.init(e, t) }; function p(e) { var t = !!e && "length" in e && e.length, n = w(e); return !m(e) && !x(e) && ("array" === n || 0 === t || "number" == typeof t && 0 < t && t - 1 in e) } S.fn = S.prototype = { jquery: f, constructor: S, length: 0, toArray: function () { return s.call(this) }, get: function (e) { return null == e ? s.call(this) : e < 0 ? this[e + this.length] : this[e] }, pushStack: function (e) { var t = S.merge(this.constructor(), e); return t.prevObject = this, t }, each: function (e) { return S.each(this, e) }, map: function (n) { return this.pushStack(S.map(this, function (e, t) { return n.call(e, t, e) })) }, slice: function () { return this.pushStack(s.apply(this, arguments)) }, first: function () { return this.eq(0) }, last: function () { return this.eq(-1) }, even: function () { return this.pushStack(S.grep(this, function (e, t) { return (t + 1) % 2 })) }, odd: function () { return this.pushStack(S.grep(this, function (e, t) { return t % 2 })) }, eq: function (e) { var t = this.length, n = +e + (e < 0 ? t : 0); return this.pushStack(0 <= n && n < t ? [this[n]] : []) }, end: function () { return this.prevObject || this.constructor() }, push: u, sort: t.sort, splice: t.splice }, S.extend = S.fn.extend = function () { var e, t, n, r, i, o, a = arguments[0] || {}, s = 1, u = arguments.length, l = !1; for ("boolean" == typeof a && (l = a, a = arguments[s] || {}, s++), "object" == typeof a || m(a) || (a = {}), s === u && (a = this, s--); s < u; s++)if (null != (e = arguments[s])) for (t in e) r = e[t], "__proto__" !== t && a !== r && (l && r && (S.isPlainObject(r) || (i = Array.isArray(r))) ? (n = a[t], o = i && !Array.isArray(n) ? [] : i || S.isPlainObject(n) ? n : {}, i = !1, a[t] = S.extend(l, o, r)) : void 0 !== r && (a[t] = r)); return a }, S.extend({ expando: "jQuery" + (f + Math.random()).replace(/\D/g, ""), isReady: !0, error: function (e) { throw new Error(e) }, noop: function () { }, isPlainObject: function (e) { var t, n; return !(!e || "[object Object]" !== o.call(e)) && (!(t = r(e)) || "function" == typeof (n = v.call(t, "constructor") && t.constructor) && a.call(n) === l) }, isEmptyObject: function (e) { var t; for (t in e) return !1; return !0 }, globalEval: function (e, t, n) { b(e, { nonce: t && t.nonce }, n) }, each: function (e, t) { var n, r = 0; if (p(e)) { for (n = e.length; r < n; r++)if (!1 === t.call(e[r], r, e[r])) break } else for (r in e) if (!1 === t.call(e[r], r, e[r])) break; return e }, makeArray: function (e, t) { var n = t || []; return null != e && (p(Object(e)) ? S.merge(n, "string" == typeof e ? [e] : e) : u.call(n, e)), n }, inArray: function (e, t, n) { return null == t ? -1 : i.call(t, e, n) }, merge: function (e, t) { for (var n = +t.length, r = 0, i = e.length; r < n; r++)e[i++] = t[r]; return e.length = i, e }, grep: function (e, t, n) { for (var r = [], i = 0, o = e.length, a = !n; i < o; i++)!t(e[i], i) !== a && r.push(e[i]); return r }, map: function (e, t, n) { var r, i, o = 0, a = []; if (p(e)) for (r = e.length; o < r; o++)null != (i = t(e[o], o, n)) && a.push(i); else for (o in e) null != (i = t(e[o], o, n)) && a.push(i); return g(a) }, guid: 1, support: y }), "function" == typeof Symbol && (S.fn[Symbol.iterator] = t[Symbol.iterator]), S.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "), function (e, t) { n["[object " + t + "]"] = t.toLowerCase() }); var d = function (n) { var e, d, b, o, i, h, f, g, w, u, l, T, C, a, E, v, s, c, y, S = "sizzle" + 1 * new Date, p = n.document, k = 0, r = 0, m = ue(), x = ue(), A = ue(), N = ue(), D = function (e, t) { return e === t && (l = !0), 0 }, j = {}.hasOwnProperty, t = [], q = t.pop, L = t.push, H = t.push, O = t.slice, P = function (e, t) { for (var n = 0, r = e.length; n < r; n++)if (e[n] === t) return n; return -1 }, R = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped", M = "[\\x20\\t\\r\\n\\f]", I = "(?:\\\\[\\da-fA-F]{1,6}" + M + "?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+", W = "\\[" + M + "*(" + I + ")(?:" + M + "*([*^$|!~]?=)" + M + "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + I + "))|)" + M + "*\\]", F = ":(" + I + ")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|" + W + ")*)|.*)\\)|)", B = new RegExp(M + "+", "g"), $ = new RegExp("^" + M + "+|((?:^|[^\\\\])(?:\\\\.)*)" + M + "+$", "g"), _ = new RegExp("^" + M + "*," + M + "*"), z = new RegExp("^" + M + "*([>+~]|" + M + ")" + M + "*"), U = new RegExp(M + "|>"), X = new RegExp(F), V = new RegExp("^" + I + "$"), G = { ID: new RegExp("^#(" + I + ")"), CLASS: new RegExp("^\\.(" + I + ")"), TAG: new RegExp("^(" + I + "|[*])"), ATTR: new RegExp("^" + W), PSEUDO: new RegExp("^" + F), CHILD: new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + M + "*(even|odd|(([+-]|)(\\d*)n|)" + M + "*(?:([+-]|)" + M + "*(\\d+)|))" + M + "*\\)|)", "i"), bool: new RegExp("^(?:" + R + ")$", "i"), needsContext: new RegExp("^" + M + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + M + "*((?:-\\d)?\\d*)" + M + "*\\)|)(?=[^-]|$)", "i") }, Y = /HTML$/i, Q = /^(?:input|select|textarea|button)$/i, J = /^h\d$/i, K = /^[^{]+\{\s*\[native \w/, Z = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, ee = /[+~]/, te = new RegExp("\\\\[\\da-fA-F]{1,6}" + M + "?|\\\\([^\\r\\n\\f])", "g"), ne = function (e, t) { var n = "0x" + e.slice(1) - 65536; return t || (n < 0 ? String.fromCharCode(n + 65536) : String.fromCharCode(n >> 10 | 55296, 1023 & n | 56320)) }, re = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g, ie = function (e, t) { return t ? "\0" === e ? "\ufffd" : e.slice(0, -1) + "\\" + e.charCodeAt(e.length - 1).toString(16) + " " : "\\" + e }, oe = function () { T() }, ae = be(function (e) { return !0 === e.disabled && "fieldset" === e.nodeName.toLowerCase() }, { dir: "parentNode", next: "legend" }); try { H.apply(t = O.call(p.childNodes), p.childNodes), t[p.childNodes.length].nodeType } catch (e) { H = { apply: t.length ? function (e, t) { L.apply(e, O.call(t)) } : function (e, t) { var n = e.length, r = 0; while (e[n++] = t[r++]); e.length = n - 1 } } } function se(t, e, n, r) { var i, o, a, s, u, l, c, f = e && e.ownerDocument, p = e ? e.nodeType : 9; if (n = n || [], "string" != typeof t || !t || 1 !== p && 9 !== p && 11 !== p) return n; if (!r && (T(e), e = e || C, E)) { if (11 !== p && (u = Z.exec(t))) if (i = u[1]) { if (9 === p) { if (!(a = e.getElementById(i))) return n; if (a.id === i) return n.push(a), n } else if (f && (a = f.getElementById(i)) && y(e, a) && a.id === i) return n.push(a), n } else { if (u[2]) return H.apply(n, e.getElementsByTagName(t)), n; if ((i = u[3]) && d.getElementsByClassName && e.getElementsByClassName) return H.apply(n, e.getElementsByClassName(i)), n } if (d.qsa && !N[t + " "] && (!v || !v.test(t)) && (1 !== p || "object" !== e.nodeName.toLowerCase())) { if (c = t, f = e, 1 === p && (U.test(t) || z.test(t))) { (f = ee.test(t) && ye(e.parentNode) || e) === e && d.scope || ((s = e.getAttribute("id")) ? s = s.replace(re, ie) : e.setAttribute("id", s = S)), o = (l = h(t)).length; while (o--) l[o] = (s ? "#" + s : ":scope") + " " + xe(l[o]); c = l.join(",") } try { return H.apply(n, f.querySelectorAll(c)), n } catch (e) { N(t, !0) } finally { s === S && e.removeAttribute("id") } } } return g(t.replace($, "$1"), e, n, r) } function ue() { var r = []; return function e(t, n) { return r.push(t + " ") > b.cacheLength && delete e[r.shift()], e[t + " "] = n } } function le(e) { return e[S] = !0, e } function ce(e) { var t = C.createElement("fieldset"); try { return !!e(t) } catch (e) { return !1 } finally { t.parentNode && t.parentNode.removeChild(t), t = null } } function fe(e, t) { var n = e.split("|"), r = n.length; while (r--) b.attrHandle[n[r]] = t } function pe(e, t) { var n = t && e, r = n && 1 === e.nodeType && 1 === t.nodeType && e.sourceIndex - t.sourceIndex; if (r) return r; if (n) while (n = n.nextSibling) if (n === t) return -1; return e ? 1 : -1 } function de(t) { return function (e) { return "input" === e.nodeName.toLowerCase() && e.type === t } } function he(n) { return function (e) { var t = e.nodeName.toLowerCase(); return ("input" === t || "button" === t) && e.type === n } } function ge(t) { return function (e) { return "form" in e ? e.parentNode && !1 === e.disabled ? "label" in e ? "label" in e.parentNode ? e.parentNode.disabled === t : e.disabled === t : e.isDisabled === t || e.isDisabled !== !t && ae(e) === t : e.disabled === t : "label" in e && e.disabled === t } } function ve(a) { return le(function (o) { return o = +o, le(function (e, t) { var n, r = a([], e.length, o), i = r.length; while (i--) e[n = r[i]] && (e[n] = !(t[n] = e[n])) }) }) } function ye(e) { return e && "undefined" != typeof e.getElementsByTagName && e } for (e in d = se.support = {}, i = se.isXML = function (e) { var t = e.namespaceURI, n = (e.ownerDocument || e).documentElement; return !Y.test(t || n && n.nodeName || "HTML") }, T = se.setDocument = function (e) { var t, n, r = e ? e.ownerDocument || e : p; return r != C && 9 === r.nodeType && r.documentElement && (a = (C = r).documentElement, E = !i(C), p != C && (n = C.defaultView) && n.top !== n && (n.addEventListener ? n.addEventListener("unload", oe, !1) : n.attachEvent && n.attachEvent("onunload", oe)), d.scope = ce(function (e) { return a.appendChild(e).appendChild(C.createElement("div")), "undefined" != typeof e.querySelectorAll && !e.querySelectorAll(":scope fieldset div").length }), d.attributes = ce(function (e) { return e.className = "i", !e.getAttribute("className") }), d.getElementsByTagName = ce(function (e) { return e.appendChild(C.createComment("")), !e.getElementsByTagName("*").length }), d.getElementsByClassName = K.test(C.getElementsByClassName), d.getById = ce(function (e) { return a.appendChild(e).id = S, !C.getElementsByName || !C.getElementsByName(S).length }), d.getById ? (b.filter.ID = function (e) { var t = e.replace(te, ne); return function (e) { return e.getAttribute("id") === t } }, b.find.ID = function (e, t) { if ("undefined" != typeof t.getElementById && E) { var n = t.getElementById(e); return n ? [n] : [] } }) : (b.filter.ID = function (e) { var n = e.replace(te, ne); return function (e) { var t = "undefined" != typeof e.getAttributeNode && e.getAttributeNode("id"); return t && t.value === n } }, b.find.ID = function (e, t) { if ("undefined" != typeof t.getElementById && E) { var n, r, i, o = t.getElementById(e); if (o) { if ((n = o.getAttributeNode("id")) && n.value === e) return [o]; i = t.getElementsByName(e), r = 0; while (o = i[r++]) if ((n = o.getAttributeNode("id")) && n.value === e) return [o] } return [] } }), b.find.TAG = d.getElementsByTagName ? function (e, t) { return "undefined" != typeof t.getElementsByTagName ? t.getElementsByTagName(e) : d.qsa ? t.querySelectorAll(e) : void 0 } : function (e, t) { var n, r = [], i = 0, o = t.getElementsByTagName(e); if ("*" === e) { while (n = o[i++]) 1 === n.nodeType && r.push(n); return r } return o }, b.find.CLASS = d.getElementsByClassName && function (e, t) { if ("undefined" != typeof t.getElementsByClassName && E) return t.getElementsByClassName(e) }, s = [], v = [], (d.qsa = K.test(C.querySelectorAll)) && (ce(function (e) { var t; a.appendChild(e).innerHTML = "<a id='" + S + "'></a><select id='" + S + "-\r\\' msallowcapture=''><option selected=''></option></select>", e.querySelectorAll("[msallowcapture^='']").length && v.push("[*^$]=" + M + "*(?:''|\"\")"), e.querySelectorAll("[selected]").length || v.push("\\[" + M + "*(?:value|" + R + ")"), e.querySelectorAll("[id~=" + S + "-]").length || v.push("~="), (t = C.createElement("input")).setAttribute("name", ""), e.appendChild(t), e.querySelectorAll("[name='']").length || v.push("\\[" + M + "*name" + M + "*=" + M + "*(?:''|\"\")"), e.querySelectorAll(":checked").length || v.push(":checked"), e.querySelectorAll("a#" + S + "+*").length || v.push(".#.+[+~]"), e.querySelectorAll("\\\f"), v.push("[\\r\\n\\f]") }), ce(function (e) { e.innerHTML = "<a href='' disabled='disabled'></a><select disabled='disabled'><option/></select>"; var t = C.createElement("input"); t.setAttribute("type", "hidden"), e.appendChild(t).setAttribute("name", "D"), e.querySelectorAll("[name=d]").length && v.push("name" + M + "*[*^$|!~]?="), 2 !== e.querySelectorAll(":enabled").length && v.push(":enabled", ":disabled"), a.appendChild(e).disabled = !0, 2 !== e.querySelectorAll(":disabled").length && v.push(":enabled", ":disabled"), e.querySelectorAll("*,:x"), v.push(",.*:") })), (d.matchesSelector = K.test(c = a.matches || a.webkitMatchesSelector || a.mozMatchesSelector || a.oMatchesSelector || a.msMatchesSelector)) && ce(function (e) { d.disconnectedMatch = c.call(e, "*"), c.call(e, "[s!='']:x"), s.push("!=", F) }), v = v.length && new RegExp(v.join("|")), s = s.length && new RegExp(s.join("|")), t = K.test(a.compareDocumentPosition), y = t || K.test(a.contains) ? function (e, t) { var n = 9 === e.nodeType ? e.documentElement : e, r = t && t.parentNode; return e === r || !(!r || 1 !== r.nodeType || !(n.contains ? n.contains(r) : e.compareDocumentPosition && 16 & e.compareDocumentPosition(r))) } : function (e, t) { if (t) while (t = t.parentNode) if (t === e) return !0; return !1 }, D = t ? function (e, t) { if (e === t) return l = !0, 0; var n = !e.compareDocumentPosition - !t.compareDocumentPosition; return n || (1 & (n = (e.ownerDocument || e) == (t.ownerDocument || t) ? e.compareDocumentPosition(t) : 1) || !d.sortDetached && t.compareDocumentPosition(e) === n ? e == C || e.ownerDocument == p && y(p, e) ? -1 : t == C || t.ownerDocument == p && y(p, t) ? 1 : u ? P(u, e) - P(u, t) : 0 : 4 & n ? -1 : 1) } : function (e, t) { if (e === t) return l = !0, 0; var n, r = 0, i = e.parentNode, o = t.parentNode, a = [e], s = [t]; if (!i || !o) return e == C ? -1 : t == C ? 1 : i ? -1 : o ? 1 : u ? P(u, e) - P(u, t) : 0; if (i === o) return pe(e, t); n = e; while (n = n.parentNode) a.unshift(n); n = t; while (n = n.parentNode) s.unshift(n); while (a[r] === s[r]) r++; return r ? pe(a[r], s[r]) : a[r] == p ? -1 : s[r] == p ? 1 : 0 }), C }, se.matches = function (e, t) { return se(e, null, null, t) }, se.matchesSelector = function (e, t) { if (T(e), d.matchesSelector && E && !N[t + " "] && (!s || !s.test(t)) && (!v || !v.test(t))) try { var n = c.call(e, t); if (n || d.disconnectedMatch || e.document && 11 !== e.document.nodeType) return n } catch (e) { N(t, !0) } return 0 < se(t, C, null, [e]).length }, se.contains = function (e, t) { return (e.ownerDocument || e) != C && T(e), y(e, t) }, se.attr = function (e, t) { (e.ownerDocument || e) != C && T(e); var n = b.attrHandle[t.toLowerCase()], r = n && j.call(b.attrHandle, t.toLowerCase()) ? n(e, t, !E) : void 0; return void 0 !== r ? r : d.attributes || !E ? e.getAttribute(t) : (r = e.getAttributeNode(t)) && r.specified ? r.value : null }, se.escape = function (e) { return (e + "").replace(re, ie) }, se.error = function (e) { throw new Error("Syntax error, unrecognized expression: " + e) }, se.uniqueSort = function (e) { var t, n = [], r = 0, i = 0; if (l = !d.detectDuplicates, u = !d.sortStable && e.slice(0), e.sort(D), l) { while (t = e[i++]) t === e[i] && (r = n.push(i)); while (r--) e.splice(n[r], 1) } return u = null, e }, o = se.getText = function (e) { var t, n = "", r = 0, i = e.nodeType; if (i) { if (1 === i || 9 === i || 11 === i) { if ("string" == typeof e.textContent) return e.textContent; for (e = e.firstChild; e; e = e.nextSibling)n += o(e) } else if (3 === i || 4 === i) return e.nodeValue } else while (t = e[r++]) n += o(t); return n }, (b = se.selectors = { cacheLength: 50, createPseudo: le, match: G, attrHandle: {}, find: {}, relative: { ">": { dir: "parentNode", first: !0 }, " ": { dir: "parentNode" }, "+": { dir: "previousSibling", first: !0 }, "~": { dir: "previousSibling" } }, preFilter: { ATTR: function (e) { return e[1] = e[1].replace(te, ne), e[3] = (e[3] || e[4] || e[5] || "").replace(te, ne), "~=" === e[2] && (e[3] = " " + e[3] + " "), e.slice(0, 4) }, CHILD: function (e) { return e[1] = e[1].toLowerCase(), "nth" === e[1].slice(0, 3) ? (e[3] || se.error(e[0]), e[4] = +(e[4] ? e[5] + (e[6] || 1) : 2 * ("even" === e[3] || "odd" === e[3])), e[5] = +(e[7] + e[8] || "odd" === e[3])) : e[3] && se.error(e[0]), e }, PSEUDO: function (e) { var t, n = !e[6] && e[2]; return G.CHILD.test(e[0]) ? null : (e[3] ? e[2] = e[4] || e[5] || "" : n && X.test(n) && (t = h(n, !0)) && (t = n.indexOf(")", n.length - t) - n.length) && (e[0] = e[0].slice(0, t), e[2] = n.slice(0, t)), e.slice(0, 3)) } }, filter: { TAG: function (e) { var t = e.replace(te, ne).toLowerCase(); return "*" === e ? function () { return !0 } : function (e) { return e.nodeName && e.nodeName.toLowerCase() === t } }, CLASS: function (e) { var t = m[e + " "]; return t || (t = new RegExp("(^|" + M + ")" + e + "(" + M + "|$)")) && m(e, function (e) { return t.test("string" == typeof e.className && e.className || "undefined" != typeof e.getAttribute && e.getAttribute("class") || "") }) }, ATTR: function (n, r, i) { return function (e) { var t = se.attr(e, n); return null == t ? "!=" === r : !r || (t += "", "=" === r ? t === i : "!=" === r ? t !== i : "^=" === r ? i && 0 === t.indexOf(i) : "*=" === r ? i && -1 < t.indexOf(i) : "$=" === r ? i && t.slice(-i.length) === i : "~=" === r ? -1 < (" " + t.replace(B, " ") + " ").indexOf(i) : "|=" === r && (t === i || t.slice(0, i.length + 1) === i + "-")) } }, CHILD: function (h, e, t, g, v) { var y = "nth" !== h.slice(0, 3), m = "last" !== h.slice(-4), x = "of-type" === e; return 1 === g && 0 === v ? function (e) { return !!e.parentNode } : function (e, t, n) { var r, i, o, a, s, u, l = y !== m ? "nextSibling" : "previousSibling", c = e.parentNode, f = x && e.nodeName.toLowerCase(), p = !n && !x, d = !1; if (c) { if (y) { while (l) { a = e; while (a = a[l]) if (x ? a.nodeName.toLowerCase() === f : 1 === a.nodeType) return !1; u = l = "only" === h && !u && "nextSibling" } return !0 } if (u = [m ? c.firstChild : c.lastChild], m && p) { d = (s = (r = (i = (o = (a = c)[S] || (a[S] = {}))[a.uniqueID] || (o[a.uniqueID] = {}))[h] || [])[0] === k && r[1]) && r[2], a = s && c.childNodes[s]; while (a = ++s && a && a[l] || (d = s = 0) || u.pop()) if (1 === a.nodeType && ++d && a === e) { i[h] = [k, s, d]; break } } else if (p && (d = s = (r = (i = (o = (a = e)[S] || (a[S] = {}))[a.uniqueID] || (o[a.uniqueID] = {}))[h] || [])[0] === k && r[1]), !1 === d) while (a = ++s && a && a[l] || (d = s = 0) || u.pop()) if ((x ? a.nodeName.toLowerCase() === f : 1 === a.nodeType) && ++d && (p && ((i = (o = a[S] || (a[S] = {}))[a.uniqueID] || (o[a.uniqueID] = {}))[h] = [k, d]), a === e)) break; return (d -= v) === g || d % g == 0 && 0 <= d / g } } }, PSEUDO: function (e, o) { var t, a = b.pseudos[e] || b.setFilters[e.toLowerCase()] || se.error("unsupported pseudo: " + e); return a[S] ? a(o) : 1 < a.length ? (t = [e, e, "", o], b.setFilters.hasOwnProperty(e.toLowerCase()) ? le(function (e, t) { var n, r = a(e, o), i = r.length; while (i--) e[n = P(e, r[i])] = !(t[n] = r[i]) }) : function (e) { return a(e, 0, t) }) : a } }, pseudos: { not: le(function (e) { var r = [], i = [], s = f(e.replace($, "$1")); return s[S] ? le(function (e, t, n, r) { var i, o = s(e, null, r, []), a = e.length; while (a--) (i = o[a]) && (e[a] = !(t[a] = i)) }) : function (e, t, n) { return r[0] = e, s(r, null, n, i), r[0] = null, !i.pop() } }), has: le(function (t) { return function (e) { return 0 < se(t, e).length } }), contains: le(function (t) { return t = t.replace(te, ne), function (e) { return -1 < (e.textContent || o(e)).indexOf(t) } }), lang: le(function (n) { return V.test(n || "") || se.error("unsupported lang: " + n), n = n.replace(te, ne).toLowerCase(), function (e) { var t; do { if (t = E ? e.lang : e.getAttribute("xml:lang") || e.getAttribute("lang")) return (t = t.toLowerCase()) === n || 0 === t.indexOf(n + "-") } while ((e = e.parentNode) && 1 === e.nodeType); return !1 } }), target: function (e) { var t = n.location && n.location.hash; return t && t.slice(1) === e.id }, root: function (e) { return e === a }, focus: function (e) { return e === C.activeElement && (!C.hasFocus || C.hasFocus()) && !!(e.type || e.href || ~e.tabIndex) }, enabled: ge(!1), disabled: ge(!0), checked: function (e) { var t = e.nodeName.toLowerCase(); return "input" === t && !!e.checked || "option" === t && !!e.selected }, selected: function (e) { return e.parentNode && e.parentNode.selectedIndex, !0 === e.selected }, empty: function (e) { for (e = e.firstChild; e; e = e.nextSibling)if (e.nodeType < 6) return !1; return !0 }, parent: function (e) { return !b.pseudos.empty(e) }, header: function (e) { return J.test(e.nodeName) }, input: function (e) { return Q.test(e.nodeName) }, button: function (e) { var t = e.nodeName.toLowerCase(); return "input" === t && "button" === e.type || "button" === t }, text: function (e) { var t; return "input" === e.nodeName.toLowerCase() && "text" === e.type && (null == (t = e.getAttribute("type")) || "text" === t.toLowerCase()) }, first: ve(function () { return [0] }), last: ve(function (e, t) { return [t - 1] }), eq: ve(function (e, t, n) { return [n < 0 ? n + t : n] }), even: ve(function (e, t) { for (var n = 0; n < t; n += 2)e.push(n); return e }), odd: ve(function (e, t) { for (var n = 1; n < t; n += 2)e.push(n); return e }), lt: ve(function (e, t, n) { for (var r = n < 0 ? n + t : t < n ? t : n; 0 <= --r;)e.push(r); return e }), gt: ve(function (e, t, n) { for (var r = n < 0 ? n + t : n; ++r < t;)e.push(r); return e }) } }).pseudos.nth = b.pseudos.eq, { radio: !0, checkbox: !0, file: !0, password: !0, image: !0 }) b.pseudos[e] = de(e); for (e in { submit: !0, reset: !0 }) b.pseudos[e] = he(e); function me() { } function xe(e) { for (var t = 0, n = e.length, r = ""; t < n; t++)r += e[t].value; return r } function be(s, e, t) { var u = e.dir, l = e.next, c = l || u, f = t && "parentNode" === c, p = r++; return e.first ? function (e, t, n) { while (e = e[u]) if (1 === e.nodeType || f) return s(e, t, n); return !1 } : function (e, t, n) { var r, i, o, a = [k, p]; if (n) { while (e = e[u]) if ((1 === e.nodeType || f) && s(e, t, n)) return !0 } else while (e = e[u]) if (1 === e.nodeType || f) if (i = (o = e[S] || (e[S] = {}))[e.uniqueID] || (o[e.uniqueID] = {}), l && l === e.nodeName.toLowerCase()) e = e[u] || e; else { if ((r = i[c]) && r[0] === k && r[1] === p) return a[2] = r[2]; if ((i[c] = a)[2] = s(e, t, n)) return !0 } return !1 } } function we(i) { return 1 < i.length ? function (e, t, n) { var r = i.length; while (r--) if (!i[r](e, t, n)) return !1; return !0 } : i[0] } function Te(e, t, n, r, i) { for (var o, a = [], s = 0, u = e.length, l = null != t; s < u; s++)(o = e[s]) && (n && !n(o, r, i) || (a.push(o), l && t.push(s))); return a } function Ce(d, h, g, v, y, e) { return v && !v[S] && (v = Ce(v)), y && !y[S] && (y = Ce(y, e)), le(function (e, t, n, r) { var i, o, a, s = [], u = [], l = t.length, c = e || function (e, t, n) { for (var r = 0, i = t.length; r < i; r++)se(e, t[r], n); return n }(h || "*", n.nodeType ? [n] : n, []), f = !d || !e && h ? c : Te(c, s, d, n, r), p = g ? y || (e ? d : l || v) ? [] : t : f; if (g && g(f, p, n, r), v) { i = Te(p, u), v(i, [], n, r), o = i.length; while (o--) (a = i[o]) && (p[u[o]] = !(f[u[o]] = a)) } if (e) { if (y || d) { if (y) { i = [], o = p.length; while (o--) (a = p[o]) && i.push(f[o] = a); y(null, p = [], i, r) } o = p.length; while (o--) (a = p[o]) && -1 < (i = y ? P(e, a) : s[o]) && (e[i] = !(t[i] = a)) } } else p = Te(p === t ? p.splice(l, p.length) : p), y ? y(null, t, p, r) : H.apply(t, p) }) } function Ee(e) { for (var i, t, n, r = e.length, o = b.relative[e[0].type], a = o || b.relative[" "], s = o ? 1 : 0, u = be(function (e) { return e === i }, a, !0), l = be(function (e) { return -1 < P(i, e) }, a, !0), c = [function (e, t, n) { var r = !o && (n || t !== w) || ((i = t).nodeType ? u(e, t, n) : l(e, t, n)); return i = null, r }]; s < r; s++)if (t = b.relative[e[s].type]) c = [be(we(c), t)]; else { if ((t = b.filter[e[s].type].apply(null, e[s].matches))[S]) { for (n = ++s; n < r; n++)if (b.relative[e[n].type]) break; return Ce(1 < s && we(c), 1 < s && xe(e.slice(0, s - 1).concat({ value: " " === e[s - 2].type ? "*" : "" })).replace($, "$1"), t, s < n && Ee(e.slice(s, n)), n < r && Ee(e = e.slice(n)), n < r && xe(e)) } c.push(t) } return we(c) } return me.prototype = b.filters = b.pseudos, b.setFilters = new me, h = se.tokenize = function (e, t) { var n, r, i, o, a, s, u, l = x[e + " "]; if (l) return t ? 0 : l.slice(0); a = e, s = [], u = b.preFilter; while (a) { for (o in n && !(r = _.exec(a)) || (r && (a = a.slice(r[0].length) || a), s.push(i = [])), n = !1, (r = z.exec(a)) && (n = r.shift(), i.push({ value: n, type: r[0].replace($, " ") }), a = a.slice(n.length)), b.filter) !(r = G[o].exec(a)) || u[o] && !(r = u[o](r)) || (n = r.shift(), i.push({ value: n, type: o, matches: r }), a = a.slice(n.length)); if (!n) break } return t ? a.length : a ? se.error(e) : x(e, s).slice(0) }, f = se.compile = function (e, t) { var n, v, y, m, x, r, i = [], o = [], a = A[e + " "]; if (!a) { t || (t = h(e)), n = t.length; while (n--) (a = Ee(t[n]))[S] ? i.push(a) : o.push(a); (a = A(e, (v = o, m = 0 < (y = i).length, x = 0 < v.length, r = function (e, t, n, r, i) { var o, a, s, u = 0, l = "0", c = e && [], f = [], p = w, d = e || x && b.find.TAG("*", i), h = k += null == p ? 1 : Math.random() || .1, g = d.length; for (i && (w = t == C || t || i); l !== g && null != (o = d[l]); l++) { if (x && o) { a = 0, t || o.ownerDocument == C || (T(o), n = !E); while (s = v[a++]) if (s(o, t || C, n)) { r.push(o); break } i && (k = h) } m && ((o = !s && o) && u--, e && c.push(o)) } if (u += l, m && l !== u) { a = 0; while (s = y[a++]) s(c, f, t, n); if (e) { if (0 < u) while (l--) c[l] || f[l] || (f[l] = q.call(r)); f = Te(f) } H.apply(r, f), i && !e && 0 < f.length && 1 < u + y.length && se.uniqueSort(r) } return i && (k = h, w = p), c }, m ? le(r) : r))).selector = e } return a }, g = se.select = function (e, t, n, r) { var i, o, a, s, u, l = "function" == typeof e && e, c = !r && h(e = l.selector || e); if (n = n || [], 1 === c.length) { if (2 < (o = c[0] = c[0].slice(0)).length && "ID" === (a = o[0]).type && 9 === t.nodeType && E && b.relative[o[1].type]) { if (!(t = (b.find.ID(a.matches[0].replace(te, ne), t) || [])[0])) return n; l && (t = t.parentNode), e = e.slice(o.shift().value.length) } i = G.needsContext.test(e) ? 0 : o.length; while (i--) { if (a = o[i], b.relative[s = a.type]) break; if ((u = b.find[s]) && (r = u(a.matches[0].replace(te, ne), ee.test(o[0].type) && ye(t.parentNode) || t))) { if (o.splice(i, 1), !(e = r.length && xe(o))) return H.apply(n, r), n; break } } } return (l || f(e, c))(r, t, !E, n, !t || ee.test(e) && ye(t.parentNode) || t), n }, d.sortStable = S.split("").sort(D).join("") === S, d.detectDuplicates = !!l, T(), d.sortDetached = ce(function (e) { return 1 & e.compareDocumentPosition(C.createElement("fieldset")) }), ce(function (e) { return e.innerHTML = "<a href='#'></a>", "#" === e.firstChild.getAttribute("href") }) || fe("type|href|height|width", function (e, t, n) { if (!n) return e.getAttribute(t, "type" === t.toLowerCase() ? 1 : 2) }), d.attributes && ce(function (e) { return e.innerHTML = "<input/>", e.firstChild.setAttribute("value", ""), "" === e.firstChild.getAttribute("value") }) || fe("value", function (e, t, n) { if (!n && "input" === e.nodeName.toLowerCase()) return e.defaultValue }), ce(function (e) { return null == e.getAttribute("disabled") }) || fe(R, function (e, t, n) { var r; if (!n) return !0 === e[t] ? t.toLowerCase() : (r = e.getAttributeNode(t)) && r.specified ? r.value : null }), se }(C); S.find = d, S.expr = d.selectors, S.expr[":"] = S.expr.pseudos, S.uniqueSort = S.unique = d.uniqueSort, S.text = d.getText, S.isXMLDoc = d.isXML, S.contains = d.contains, S.escapeSelector = d.escape; var h = function (e, t, n) { var r = [], i = void 0 !== n; while ((e = e[t]) && 9 !== e.nodeType) if (1 === e.nodeType) { if (i && S(e).is(n)) break; r.push(e) } return r }, T = function (e, t) { for (var n = []; e; e = e.nextSibling)1 === e.nodeType && e !== t && n.push(e); return n }, k = S.expr.match.needsContext; function A(e, t) { return e.nodeName && e.nodeName.toLowerCase() === t.toLowerCase() } var N = /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i; function D(e, n, r) { return m(n) ? S.grep(e, function (e, t) { return !!n.call(e, t, e) !== r }) : n.nodeType ? S.grep(e, function (e) { return e === n !== r }) : "string" != typeof n ? S.grep(e, function (e) { return -1 < i.call(n, e) !== r }) : S.filter(n, e, r) } S.filter = function (e, t, n) { var r = t[0]; return n && (e = ":not(" + e + ")"), 1 === t.length && 1 === r.nodeType ? S.find.matchesSelector(r, e) ? [r] : [] : S.find.matches(e, S.grep(t, function (e) { return 1 === e.nodeType })) }, S.fn.extend({ find: function (e) { var t, n, r = this.length, i = this; if ("string" != typeof e) return this.pushStack(S(e).filter(function () { for (t = 0; t < r; t++)if (S.contains(i[t], this)) return !0 })); for (n = this.pushStack([]), t = 0; t < r; t++)S.find(e, i[t], n); return 1 < r ? S.uniqueSort(n) : n }, filter: function (e) { return this.pushStack(D(this, e || [], !1)) }, not: function (e) { return this.pushStack(D(this, e || [], !0)) }, is: function (e) { return !!D(this, "string" == typeof e && k.test(e) ? S(e) : e || [], !1).length } }); var j, q = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/; (S.fn.init = function (e, t, n) { var r, i; if (!e) return this; if (n = n || j, "string" == typeof e) { if (!(r = "<" === e[0] && ">" === e[e.length - 1] && 3 <= e.length ? [null, e, null] : q.exec(e)) || !r[1] && t) return !t || t.jquery ? (t || n).find(e) : this.constructor(t).find(e); if (r[1]) { if (t = t instanceof S ? t[0] : t, S.merge(this, S.parseHTML(r[1], t && t.nodeType ? t.ownerDocument || t : E, !0)), N.test(r[1]) && S.isPlainObject(t)) for (r in t) m(this[r]) ? this[r](t[r]) : this.attr(r, t[r]); return this } return (i = E.getElementById(r[2])) && (this[0] = i, this.length = 1), this } return e.nodeType ? (this[0] = e, this.length = 1, this) : m(e) ? void 0 !== n.ready ? n.ready(e) : e(S) : S.makeArray(e, this) }).prototype = S.fn, j = S(E); var L = /^(?:parents|prev(?:Until|All))/, H = { children: !0, contents: !0, next: !0, prev: !0 }; function O(e, t) { while ((e = e[t]) && 1 !== e.nodeType); return e } S.fn.extend({ has: function (e) { var t = S(e, this), n = t.length; return this.filter(function () { for (var e = 0; e < n; e++)if (S.contains(this, t[e])) return !0 }) }, closest: function (e, t) { var n, r = 0, i = this.length, o = [], a = "string" != typeof e && S(e); if (!k.test(e)) for (; r < i; r++)for (n = this[r]; n && n !== t; n = n.parentNode)if (n.nodeType < 11 && (a ? -1 < a.index(n) : 1 === n.nodeType && S.find.matchesSelector(n, e))) { o.push(n); break } return this.pushStack(1 < o.length ? S.uniqueSort(o) : o) }, index: function (e) { return e ? "string" == typeof e ? i.call(S(e), this[0]) : i.call(this, e.jquery ? e[0] : e) : this[0] && this[0].parentNode ? this.first().prevAll().length : -1 }, add: function (e, t) { return this.pushStack(S.uniqueSort(S.merge(this.get(), S(e, t)))) }, addBack: function (e) { return this.add(null == e ? this.prevObject : this.prevObject.filter(e)) } }), S.each({ parent: function (e) { var t = e.parentNode; return t && 11 !== t.nodeType ? t : null }, parents: function (e) { return h(e, "parentNode") }, parentsUntil: function (e, t, n) { return h(e, "parentNode", n) }, next: function (e) { return O(e, "nextSibling") }, prev: function (e) { return O(e, "previousSibling") }, nextAll: function (e) { return h(e, "nextSibling") }, prevAll: function (e) { return h(e, "previousSibling") }, nextUntil: function (e, t, n) { return h(e, "nextSibling", n) }, prevUntil: function (e, t, n) { return h(e, "previousSibling", n) }, siblings: function (e) { return T((e.parentNode || {}).firstChild, e) }, children: function (e) { return T(e.firstChild) }, contents: function (e) { return null != e.contentDocument && r(e.contentDocument) ? e.contentDocument : (A(e, "template") && (e = e.content || e), S.merge([], e.childNodes)) } }, function (r, i) { S.fn[r] = function (e, t) { var n = S.map(this, i, e); return "Until" !== r.slice(-5) && (t = e), t && "string" == typeof t && (n = S.filter(t, n)), 1 < this.length && (H[r] || S.uniqueSort(n), L.test(r) && n.reverse()), this.pushStack(n) } }); var P = /[^\x20\t\r\n\f]+/g; function R(e) { return e } function M(e) { throw e } function I(e, t, n, r) { var i; try { e && m(i = e.promise) ? i.call(e).done(t).fail(n) : e && m(i = e.then) ? i.call(e, t, n) : t.apply(void 0, [e].slice(r)) } catch (e) { n.apply(void 0, [e]) } } S.Callbacks = function (r) { var e, n; r = "string" == typeof r ? (e = r, n = {}, S.each(e.match(P) || [], function (e, t) { n[t] = !0 }), n) : S.extend({}, r); var i, t, o, a, s = [], u = [], l = -1, c = function () { for (a = a || r.once, o = i = !0; u.length; l = -1) { t = u.shift(); while (++l < s.length) !1 === s[l].apply(t[0], t[1]) && r.stopOnFalse && (l = s.length, t = !1) } r.memory || (t = !1), i = !1, a && (s = t ? [] : "") }, f = { add: function () { return s && (t && !i && (l = s.length - 1, u.push(t)), function n(e) { S.each(e, function (e, t) { m(t) ? r.unique && f.has(t) || s.push(t) : t && t.length && "string" !== w(t) && n(t) }) }(arguments), t && !i && c()), this }, remove: function () { return S.each(arguments, function (e, t) { var n; while (-1 < (n = S.inArray(t, s, n))) s.splice(n, 1), n <= l && l-- }), this }, has: function (e) { return e ? -1 < S.inArray(e, s) : 0 < s.length }, empty: function () { return s && (s = []), this }, disable: function () { return a = u = [], s = t = "", this }, disabled: function () { return !s }, lock: function () { return a = u = [], t || i || (s = t = ""), this }, locked: function () { return !!a }, fireWith: function (e, t) { return a || (t = [e, (t = t || []).slice ? t.slice() : t], u.push(t), i || c()), this }, fire: function () { return f.fireWith(this, arguments), this }, fired: function () { return !!o } }; return f }, S.extend({ Deferred: function (e) { var o = [["notify", "progress", S.Callbacks("memory"), S.Callbacks("memory"), 2], ["resolve", "done", S.Callbacks("once memory"), S.Callbacks("once memory"), 0, "resolved"], ["reject", "fail", S.Callbacks("once memory"), S.Callbacks("once memory"), 1, "rejected"]], i = "pending", a = { state: function () { return i }, always: function () { return s.done(arguments).fail(arguments), this }, "catch": function (e) { return a.then(null, e) }, pipe: function () { var i = arguments; return S.Deferred(function (r) { S.each(o, function (e, t) { var n = m(i[t[4]]) && i[t[4]]; s[t[1]](function () { var e = n && n.apply(this, arguments); e && m(e.promise) ? e.promise().progress(r.notify).done(r.resolve).fail(r.reject) : r[t[0] + "With"](this, n ? [e] : arguments) }) }), i = null }).promise() }, then: function (t, n, r) { var u = 0; function l(i, o, a, s) { return function () { var n = this, r = arguments, e = function () { var e, t; if (!(i < u)) { if ((e = a.apply(n, r)) === o.promise()) throw new TypeError("Thenable self-resolution"); t = e && ("object" == typeof e || "function" == typeof e) && e.then, m(t) ? s ? t.call(e, l(u, o, R, s), l(u, o, M, s)) : (u++, t.call(e, l(u, o, R, s), l(u, o, M, s), l(u, o, R, o.notifyWith))) : (a !== R && (n = void 0, r = [e]), (s || o.resolveWith)(n, r)) } }, t = s ? e : function () { try { e() } catch (e) { S.Deferred.exceptionHook && S.Deferred.exceptionHook(e, t.stackTrace), u <= i + 1 && (a !== M && (n = void 0, r = [e]), o.rejectWith(n, r)) } }; i ? t() : (S.Deferred.getStackHook && (t.stackTrace = S.Deferred.getStackHook()), C.setTimeout(t)) } } return S.Deferred(function (e) { o[0][3].add(l(0, e, m(r) ? r : R, e.notifyWith)), o[1][3].add(l(0, e, m(t) ? t : R)), o[2][3].add(l(0, e, m(n) ? n : M)) }).promise() }, promise: function (e) { return null != e ? S.extend(e, a) : a } }, s = {}; return S.each(o, function (e, t) { var n = t[2], r = t[5]; a[t[1]] = n.add, r && n.add(function () { i = r }, o[3 - e][2].disable, o[3 - e][3].disable, o[0][2].lock, o[0][3].lock), n.add(t[3].fire), s[t[0]] = function () { return s[t[0] + "With"](this === s ? void 0 : this, arguments), this }, s[t[0] + "With"] = n.fireWith }), a.promise(s), e && e.call(s, s), s }, when: function (e) { var n = arguments.length, t = n, r = Array(t), i = s.call(arguments), o = S.Deferred(), a = function (t) { return function (e) { r[t] = this, i[t] = 1 < arguments.length ? s.call(arguments) : e, --n || o.resolveWith(r, i) } }; if (n <= 1 && (I(e, o.done(a(t)).resolve, o.reject, !n), "pending" === o.state() || m(i[t] && i[t].then))) return o.then(); while (t--) I(i[t], a(t), o.reject); return o.promise() } }); var W = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/; S.Deferred.exceptionHook = function (e, t) { C.console && C.console.warn && e && W.test(e.name) && C.console.warn("jQuery.Deferred exception: " + e.message, e.stack, t) }, S.readyException = function (e) { C.setTimeout(function () { throw e }) }; var F = S.Deferred(); function B() { E.removeEventListener("DOMContentLoaded", B), C.removeEventListener("load", B), S.ready() } S.fn.ready = function (e) { return F.then(e)["catch"](function (e) { S.readyException(e) }), this }, S.extend({ isReady: !1, readyWait: 1, ready: function (e) { (!0 === e ? --S.readyWait : S.isReady) || (S.isReady = !0) !== e && 0 < --S.readyWait || F.resolveWith(E, [S]) } }), S.ready.then = F.then, "complete" === E.readyState || "loading" !== E.readyState && !E.documentElement.doScroll ? C.setTimeout(S.ready) : (E.addEventListener("DOMContentLoaded", B), C.addEventListener("load", B)); var $ = function (e, t, n, r, i, o, a) { var s = 0, u = e.length, l = null == n; if ("object" === w(n)) for (s in i = !0, n) $(e, t, s, n[s], !0, o, a); else if (void 0 !== r && (i = !0, m(r) || (a = !0), l && (a ? (t.call(e, r), t = null) : (l = t, t = function (e, t, n) { return l.call(S(e), n) })), t)) for (; s < u; s++)t(e[s], n, a ? r : r.call(e[s], s, t(e[s], n))); return i ? e : l ? t.call(e) : u ? t(e[0], n) : o }, _ = /^-ms-/, z = /-([a-z])/g; function U(e, t) { return t.toUpperCase() } function X(e) { return e.replace(_, "ms-").replace(z, U) } var V = function (e) { return 1 === e.nodeType || 9 === e.nodeType || !+e.nodeType }; function G() { this.expando = S.expando + G.uid++ } G.uid = 1, G.prototype = { cache: function (e) { var t = e[this.expando]; return t || (t = {}, V(e) && (e.nodeType ? e[this.expando] = t : Object.defineProperty(e, this.expando, { value: t, configurable: !0 }))), t }, set: function (e, t, n) { var r, i = this.cache(e); if ("string" == typeof t) i[X(t)] = n; else for (r in t) i[X(r)] = t[r]; return i }, get: function (e, t) { return void 0 === t ? this.cache(e) : e[this.expando] && e[this.expando][X(t)] }, access: function (e, t, n) { return void 0 === t || t && "string" == typeof t && void 0 === n ? this.get(e, t) : (this.set(e, t, n), void 0 !== n ? n : t) }, remove: function (e, t) { var n, r = e[this.expando]; if (void 0 !== r) { if (void 0 !== t) { n = (t = Array.isArray(t) ? t.map(X) : (t = X(t)) in r ? [t] : t.match(P) || []).length; while (n--) delete r[t[n]] } (void 0 === t || S.isEmptyObject(r)) && (e.nodeType ? e[this.expando] = void 0 : delete e[this.expando]) } }, hasData: function (e) { var t = e[this.expando]; return void 0 !== t && !S.isEmptyObject(t) } }; var Y = new G, Q = new G, J = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, K = /[A-Z]/g; function Z(e, t, n) { var r, i; if (void 0 === n && 1 === e.nodeType) if (r = "data-" + t.replace(K, "-$&").toLowerCase(), "string" == typeof (n = e.getAttribute(r))) { try { n = "true" === (i = n) || "false" !== i && ("null" === i ? null : i === +i + "" ? +i : J.test(i) ? JSON.parse(i) : i) } catch (e) { } Q.set(e, t, n) } else n = void 0; return n } S.extend({ hasData: function (e) { return Q.hasData(e) || Y.hasData(e) }, data: function (e, t, n) { return Q.access(e, t, n) }, removeData: function (e, t) { Q.remove(e, t) }, _data: function (e, t, n) { return Y.access(e, t, n) }, _removeData: function (e, t) { Y.remove(e, t) } }), S.fn.extend({ data: function (n, e) { var t, r, i, o = this[0], a = o && o.attributes; if (void 0 === n) { if (this.length && (i = Q.get(o), 1 === o.nodeType && !Y.get(o, "hasDataAttrs"))) { t = a.length; while (t--) a[t] && 0 === (r = a[t].name).indexOf("data-") && (r = X(r.slice(5)), Z(o, r, i[r])); Y.set(o, "hasDataAttrs", !0) } return i } return "object" == typeof n ? this.each(function () { Q.set(this, n) }) : $(this, function (e) { var t; if (o && void 0 === e) return void 0 !== (t = Q.get(o, n)) ? t : void 0 !== (t = Z(o, n)) ? t : void 0; this.each(function () { Q.set(this, n, e) }) }, null, e, 1 < arguments.length, null, !0) }, removeData: function (e) { return this.each(function () { Q.remove(this, e) }) } }), S.extend({ queue: function (e, t, n) { var r; if (e) return t = (t || "fx") + "queue", r = Y.get(e, t), n && (!r || Array.isArray(n) ? r = Y.access(e, t, S.makeArray(n)) : r.push(n)), r || [] }, dequeue: function (e, t) { t = t || "fx"; var n = S.queue(e, t), r = n.length, i = n.shift(), o = S._queueHooks(e, t); "inprogress" === i && (i = n.shift(), r--), i && ("fx" === t && n.unshift("inprogress"), delete o.stop, i.call(e, function () { S.dequeue(e, t) }, o)), !r && o && o.empty.fire() }, _queueHooks: function (e, t) { var n = t + "queueHooks"; return Y.get(e, n) || Y.access(e, n, { empty: S.Callbacks("once memory").add(function () { Y.remove(e, [t + "queue", n]) }) }) } }), S.fn.extend({ queue: function (t, n) { var e = 2; return "string" != typeof t && (n = t, t = "fx", e--), arguments.length < e ? S.queue(this[0], t) : void 0 === n ? this : this.each(function () { var e = S.queue(this, t, n); S._queueHooks(this, t), "fx" === t && "inprogress" !== e[0] && S.dequeue(this, t) }) }, dequeue: function (e) { return this.each(function () { S.dequeue(this, e) }) }, clearQueue: function (e) { return this.queue(e || "fx", []) }, promise: function (e, t) { var n, r = 1, i = S.Deferred(), o = this, a = this.length, s = function () { --r || i.resolveWith(o, [o]) }; "string" != typeof e && (t = e, e = void 0), e = e || "fx"; while (a--) (n = Y.get(o[a], e + "queueHooks")) && n.empty && (r++, n.empty.add(s)); return s(), i.promise(t) } }); var ee = /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source, te = new RegExp("^(?:([+-])=|)(" + ee + ")([a-z%]*)$", "i"), ne = ["Top", "Right", "Bottom", "Left"], re = E.documentElement, ie = function (e) { return S.contains(e.ownerDocument, e) }, oe = { composed: !0 }; re.getRootNode && (ie = function (e) { return S.contains(e.ownerDocument, e) || e.getRootNode(oe) === e.ownerDocument }); var ae = function (e, t) { return "none" === (e = t || e).style.display || "" === e.style.display && ie(e) && "none" === S.css(e, "display") }; function se(e, t, n, r) { var i, o, a = 20, s = r ? function () { return r.cur() } : function () { return S.css(e, t, "") }, u = s(), l = n && n[3] || (S.cssNumber[t] ? "" : "px"), c = e.nodeType && (S.cssNumber[t] || "px" !== l && +u) && te.exec(S.css(e, t)); if (c && c[3] !== l) { u /= 2, l = l || c[3], c = +u || 1; while (a--) S.style(e, t, c + l), (1 - o) * (1 - (o = s() / u || .5)) <= 0 && (a = 0), c /= o; c *= 2, S.style(e, t, c + l), n = n || [] } return n && (c = +c || +u || 0, i = n[1] ? c + (n[1] + 1) * n[2] : +n[2], r && (r.unit = l, r.start = c, r.end = i)), i } var ue = {}; function le(e, t) { for (var n, r, i, o, a, s, u, l = [], c = 0, f = e.length; c < f; c++)(r = e[c]).style && (n = r.style.display, t ? ("none" === n && (l[c] = Y.get(r, "display") || null, l[c] || (r.style.display = "")), "" === r.style.display && ae(r) && (l[c] = (u = a = o = void 0, a = (i = r).ownerDocument, s = i.nodeName, (u = ue[s]) || (o = a.body.appendChild(a.createElement(s)), u = S.css(o, "display"), o.parentNode.removeChild(o), "none" === u && (u = "block"), ue[s] = u)))) : "none" !== n && (l[c] = "none", Y.set(r, "display", n))); for (c = 0; c < f; c++)null != l[c] && (e[c].style.display = l[c]); return e } S.fn.extend({ show: function () { return le(this, !0) }, hide: function () { return le(this) }, toggle: function (e) { return "boolean" == typeof e ? e ? this.show() : this.hide() : this.each(function () { ae(this) ? S(this).show() : S(this).hide() }) } }); var ce, fe, pe = /^(?:checkbox|radio)$/i, de = /<([a-z][^\/\0>\x20\t\r\n\f]*)/i, he = /^$|^module$|\/(?:java|ecma)script/i; ce = E.createDocumentFragment().appendChild(E.createElement("div")), (fe = E.createElement("input")).setAttribute("type", "radio"), fe.setAttribute("checked", "checked"), fe.setAttribute("name", "t"), ce.appendChild(fe), y.checkClone = ce.cloneNode(!0).cloneNode(!0).lastChild.checked, ce.innerHTML = "<textarea>x</textarea>", y.noCloneChecked = !!ce.cloneNode(!0).lastChild.defaultValue, ce.innerHTML = "<option></option>", y.option = !!ce.lastChild; var ge = { thead: [1, "<table>", "</table>"], col: [2, "<table><colgroup>", "</colgroup></table>"], tr: [2, "<table><tbody>", "</tbody></table>"], td: [3, "<table><tbody><tr>", "</tr></tbody></table>"], _default: [0, "", ""] }; function ve(e, t) { var n; return n = "undefined" != typeof e.getElementsByTagName ? e.getElementsByTagName(t || "*") : "undefined" != typeof e.querySelectorAll ? e.querySelectorAll(t || "*") : [], void 0 === t || t && A(e, t) ? S.merge([e], n) : n } function ye(e, t) { for (var n = 0, r = e.length; n < r; n++)Y.set(e[n], "globalEval", !t || Y.get(t[n], "globalEval")) } ge.tbody = ge.tfoot = ge.colgroup = ge.caption = ge.thead, ge.th = ge.td, y.option || (ge.optgroup = ge.option = [1, "<select multiple='multiple'>", "</select>"]); var me = /<|&#?\w+;/; function xe(e, t, n, r, i) { for (var o, a, s, u, l, c, f = t.createDocumentFragment(), p = [], d = 0, h = e.length; d < h; d++)if ((o = e[d]) || 0 === o) if ("object" === w(o)) S.merge(p, o.nodeType ? [o] : o); else if (me.test(o)) { a = a || f.appendChild(t.createElement("div")), s = (de.exec(o) || ["", ""])[1].toLowerCase(), u = ge[s] || ge._default, a.innerHTML = u[1] + S.htmlPrefilter(o) + u[2], c = u[0]; while (c--) a = a.lastChild; S.merge(p, a.childNodes), (a = f.firstChild).textContent = "" } else p.push(t.createTextNode(o)); f.textContent = "", d = 0; while (o = p[d++]) if (r && -1 < S.inArray(o, r)) i && i.push(o); else if (l = ie(o), a = ve(f.appendChild(o), "script"), l && ye(a), n) { c = 0; while (o = a[c++]) he.test(o.type || "") && n.push(o) } return f } var be = /^key/, we = /^(?:mouse|pointer|contextmenu|drag|drop)|click/, Te = /^([^.]*)(?:\.(.+)|)/; function Ce() { return !0 } function Ee() { return !1 } function Se(e, t) { return e === function () { try { return E.activeElement } catch (e) { } }() == ("focus" === t) } function ke(e, t, n, r, i, o) { var a, s; if ("object" == typeof t) { for (s in "string" != typeof n && (r = r || n, n = void 0), t) ke(e, s, n, r, t[s], o); return e } if (null == r && null == i ? (i = n, r = n = void 0) : null == i && ("string" == typeof n ? (i = r, r = void 0) : (i = r, r = n, n = void 0)), !1 === i) i = Ee; else if (!i) return e; return 1 === o && (a = i, (i = function (e) { return S().off(e), a.apply(this, arguments) }).guid = a.guid || (a.guid = S.guid++)), e.each(function () { S.event.add(this, t, i, r, n) }) } function Ae(e, i, o) { o ? (Y.set(e, i, !1), S.event.add(e, i, { namespace: !1, handler: function (e) { var t, n, r = Y.get(this, i); if (1 & e.isTrigger && this[i]) { if (r.length) (S.event.special[i] || {}).delegateType && e.stopPropagation(); else if (r = s.call(arguments), Y.set(this, i, r), t = o(this, i), this[i](), r !== (n = Y.get(this, i)) || t ? Y.set(this, i, !1) : n = {}, r !== n) return e.stopImmediatePropagation(), e.preventDefault(), n.value } else r.length && (Y.set(this, i, { value: S.event.trigger(S.extend(r[0], S.Event.prototype), r.slice(1), this) }), e.stopImmediatePropagation()) } })) : void 0 === Y.get(e, i) && S.event.add(e, i, Ce) } S.event = { global: {}, add: function (t, e, n, r, i) { var o, a, s, u, l, c, f, p, d, h, g, v = Y.get(t); if (V(t)) { n.handler && (n = (o = n).handler, i = o.selector), i && S.find.matchesSelector(re, i), n.guid || (n.guid = S.guid++), (u = v.events) || (u = v.events = Object.create(null)), (a = v.handle) || (a = v.handle = function (e) { return "undefined" != typeof S && S.event.triggered !== e.type ? S.event.dispatch.apply(t, arguments) : void 0 }), l = (e = (e || "").match(P) || [""]).length; while (l--) d = g = (s = Te.exec(e[l]) || [])[1], h = (s[2] || "").split(".").sort(), d && (f = S.event.special[d] || {}, d = (i ? f.delegateType : f.bindType) || d, f = S.event.special[d] || {}, c = S.extend({ type: d, origType: g, data: r, handler: n, guid: n.guid, selector: i, needsContext: i && S.expr.match.needsContext.test(i), namespace: h.join(".") }, o), (p = u[d]) || ((p = u[d] = []).delegateCount = 0, f.setup && !1 !== f.setup.call(t, r, h, a) || t.addEventListener && t.addEventListener(d, a)), f.add && (f.add.call(t, c), c.handler.guid || (c.handler.guid = n.guid)), i ? p.splice(p.delegateCount++, 0, c) : p.push(c), S.event.global[d] = !0) } }, remove: function (e, t, n, r, i) { var o, a, s, u, l, c, f, p, d, h, g, v = Y.hasData(e) && Y.get(e); if (v && (u = v.events)) { l = (t = (t || "").match(P) || [""]).length; while (l--) if (d = g = (s = Te.exec(t[l]) || [])[1], h = (s[2] || "").split(".").sort(), d) { f = S.event.special[d] || {}, p = u[d = (r ? f.delegateType : f.bindType) || d] || [], s = s[2] && new RegExp("(^|\\.)" + h.join("\\.(?:.*\\.|)") + "(\\.|$)"), a = o = p.length; while (o--) c = p[o], !i && g !== c.origType || n && n.guid !== c.guid || s && !s.test(c.namespace) || r && r !== c.selector && ("**" !== r || !c.selector) || (p.splice(o, 1), c.selector && p.delegateCount--, f.remove && f.remove.call(e, c)); a && !p.length && (f.teardown && !1 !== f.teardown.call(e, h, v.handle) || S.removeEvent(e, d, v.handle), delete u[d]) } else for (d in u) S.event.remove(e, d + t[l], n, r, !0); S.isEmptyObject(u) && Y.remove(e, "handle events") } }, dispatch: function (e) { var t, n, r, i, o, a, s = new Array(arguments.length), u = S.event.fix(e), l = (Y.get(this, "events") || Object.create(null))[u.type] || [], c = S.event.special[u.type] || {}; for (s[0] = u, t = 1; t < arguments.length; t++)s[t] = arguments[t]; if (u.delegateTarget = this, !c.preDispatch || !1 !== c.preDispatch.call(this, u)) { a = S.event.handlers.call(this, u, l), t = 0; while ((i = a[t++]) && !u.isPropagationStopped()) { u.currentTarget = i.elem, n = 0; while ((o = i.handlers[n++]) && !u.isImmediatePropagationStopped()) u.rnamespace && !1 !== o.namespace && !u.rnamespace.test(o.namespace) || (u.handleObj = o, u.data = o.data, void 0 !== (r = ((S.event.special[o.origType] || {}).handle || o.handler).apply(i.elem, s)) && !1 === (u.result = r) && (u.preventDefault(), u.stopPropagation())) } return c.postDispatch && c.postDispatch.call(this, u), u.result } }, handlers: function (e, t) { var n, r, i, o, a, s = [], u = t.delegateCount, l = e.target; if (u && l.nodeType && !("click" === e.type && 1 <= e.button)) for (; l !== this; l = l.parentNode || this)if (1 === l.nodeType && ("click" !== e.type || !0 !== l.disabled)) { for (o = [], a = {}, n = 0; n < u; n++)void 0 === a[i = (r = t[n]).selector + " "] && (a[i] = r.needsContext ? -1 < S(i, this).index(l) : S.find(i, this, null, [l]).length), a[i] && o.push(r); o.length && s.push({ elem: l, handlers: o }) } return l = this, u < t.length && s.push({ elem: l, handlers: t.slice(u) }), s }, addProp: function (t, e) { Object.defineProperty(S.Event.prototype, t, { enumerable: !0, configurable: !0, get: m(e) ? function () { if (this.originalEvent) return e(this.originalEvent) } : function () { if (this.originalEvent) return this.originalEvent[t] }, set: function (e) { Object.defineProperty(this, t, { enumerable: !0, configurable: !0, writable: !0, value: e }) } }) }, fix: function (e) { return e[S.expando] ? e : new S.Event(e) }, special: { load: { noBubble: !0 }, click: { setup: function (e) { var t = this || e; return pe.test(t.type) && t.click && A(t, "input") && Ae(t, "click", Ce), !1 }, trigger: function (e) { var t = this || e; return pe.test(t.type) && t.click && A(t, "input") && Ae(t, "click"), !0 }, _default: function (e) { var t = e.target; return pe.test(t.type) && t.click && A(t, "input") && Y.get(t, "click") || A(t, "a") } }, beforeunload: { postDispatch: function (e) { void 0 !== e.result && e.originalEvent && (e.originalEvent.returnValue = e.result) } } } }, S.removeEvent = function (e, t, n) { e.removeEventListener && e.removeEventListener(t, n) }, S.Event = function (e, t) { if (!(this instanceof S.Event)) return new S.Event(e, t); e && e.type ? (this.originalEvent = e, this.type = e.type, this.isDefaultPrevented = e.defaultPrevented || void 0 === e.defaultPrevented && !1 === e.returnValue ? Ce : Ee, this.target = e.target && 3 === e.target.nodeType ? e.target.parentNode : e.target, this.currentTarget = e.currentTarget, this.relatedTarget = e.relatedTarget) : this.type = e, t && S.extend(this, t), this.timeStamp = e && e.timeStamp || Date.now(), this[S.expando] = !0 }, S.Event.prototype = { constructor: S.Event, isDefaultPrevented: Ee, isPropagationStopped: Ee, isImmediatePropagationStopped: Ee, isSimulated: !1, preventDefault: function () { var e = this.originalEvent; this.isDefaultPrevented = Ce, e && !this.isSimulated && e.preventDefault() }, stopPropagation: function () { var e = this.originalEvent; this.isPropagationStopped = Ce, e && !this.isSimulated && e.stopPropagation() }, stopImmediatePropagation: function () { var e = this.originalEvent; this.isImmediatePropagationStopped = Ce, e && !this.isSimulated && e.stopImmediatePropagation(), this.stopPropagation() } }, S.each({ altKey: !0, bubbles: !0, cancelable: !0, changedTouches: !0, ctrlKey: !0, detail: !0, eventPhase: !0, metaKey: !0, pageX: !0, pageY: !0, shiftKey: !0, view: !0, "char": !0, code: !0, charCode: !0, key: !0, keyCode: !0, button: !0, buttons: !0, clientX: !0, clientY: !0, offsetX: !0, offsetY: !0, pointerId: !0, pointerType: !0, screenX: !0, screenY: !0, targetTouches: !0, toElement: !0, touches: !0, which: function (e) { var t = e.button; return null == e.which && be.test(e.type) ? null != e.charCode ? e.charCode : e.keyCode : !e.which && void 0 !== t && we.test(e.type) ? 1 & t ? 1 : 2 & t ? 3 : 4 & t ? 2 : 0 : e.which } }, S.event.addProp), S.each({ focus: "focusin", blur: "focusout" }, function (e, t) { S.event.special[e] = { setup: function () { return Ae(this, e, Se), !1 }, trigger: function () { return Ae(this, e), !0 }, delegateType: t } }), S.each({ mouseenter: "mouseover", mouseleave: "mouseout", pointerenter: "pointerover", pointerleave: "pointerout" }, function (e, i) { S.event.special[e] = { delegateType: i, bindType: i, handle: function (e) { var t, n = e.relatedTarget, r = e.handleObj; return n && (n === this || S.contains(this, n)) || (e.type = r.origType, t = r.handler.apply(this, arguments), e.type = i), t } } }), S.fn.extend({ on: function (e, t, n, r) { return ke(this, e, t, n, r) }, one: function (e, t, n, r) { return ke(this, e, t, n, r, 1) }, off: function (e, t, n) { var r, i; if (e && e.preventDefault && e.handleObj) return r = e.handleObj, S(e.delegateTarget).off(r.namespace ? r.origType + "." + r.namespace : r.origType, r.selector, r.handler), this; if ("object" == typeof e) { for (i in e) this.off(i, t, e[i]); return this } return !1 !== t && "function" != typeof t || (n = t, t = void 0), !1 === n && (n = Ee), this.each(function () { S.event.remove(this, e, n, t) }) } }); var Ne = /<script|<style|<link/i, De = /checked\s*(?:[^=]|=\s*.checked.)/i, je = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g; function qe(e, t) { return A(e, "table") && A(11 !== t.nodeType ? t : t.firstChild, "tr") && S(e).children("tbody")[0] || e } function Le(e) { return e.type = (null !== e.getAttribute("type")) + "/" + e.type, e } function He(e) { return "true/" === (e.type || "").slice(0, 5) ? e.type = e.type.slice(5) : e.removeAttribute("type"), e } function Oe(e, t) { var n, r, i, o, a, s; if (1 === t.nodeType) { if (Y.hasData(e) && (s = Y.get(e).events)) for (i in Y.remove(t, "handle events"), s) for (n = 0, r = s[i].length; n < r; n++)S.event.add(t, i, s[i][n]); Q.hasData(e) && (o = Q.access(e), a = S.extend({}, o), Q.set(t, a)) } } function Pe(n, r, i, o) { r = g(r); var e, t, a, s, u, l, c = 0, f = n.length, p = f - 1, d = r[0], h = m(d); if (h || 1 < f && "string" == typeof d && !y.checkClone && De.test(d)) return n.each(function (e) { var t = n.eq(e); h && (r[0] = d.call(this, e, t.html())), Pe(t, r, i, o) }); if (f && (t = (e = xe(r, n[0].ownerDocument, !1, n, o)).firstChild, 1 === e.childNodes.length && (e = t), t || o)) { for (s = (a = S.map(ve(e, "script"), Le)).length; c < f; c++)u = e, c !== p && (u = S.clone(u, !0, !0), s && S.merge(a, ve(u, "script"))), i.call(n[c], u, c); if (s) for (l = a[a.length - 1].ownerDocument, S.map(a, He), c = 0; c < s; c++)u = a[c], he.test(u.type || "") && !Y.access(u, "globalEval") && S.contains(l, u) && (u.src && "module" !== (u.type || "").toLowerCase() ? S._evalUrl && !u.noModule && S._evalUrl(u.src, { nonce: u.nonce || u.getAttribute("nonce") }, l) : b(u.textContent.replace(je, ""), u, l)) } return n } function Re(e, t, n) { for (var r, i = t ? S.filter(t, e) : e, o = 0; null != (r = i[o]); o++)n || 1 !== r.nodeType || S.cleanData(ve(r)), r.parentNode && (n && ie(r) && ye(ve(r, "script")), r.parentNode.removeChild(r)); return e } S.extend({ htmlPrefilter: function (e) { return e }, clone: function (e, t, n) { var r, i, o, a, s, u, l, c = e.cloneNode(!0), f = ie(e); if (!(y.noCloneChecked || 1 !== e.nodeType && 11 !== e.nodeType || S.isXMLDoc(e))) for (a = ve(c), r = 0, i = (o = ve(e)).length; r < i; r++)s = o[r], u = a[r], void 0, "input" === (l = u.nodeName.toLowerCase()) && pe.test(s.type) ? u.checked = s.checked : "input" !== l && "textarea" !== l || (u.defaultValue = s.defaultValue); if (t) if (n) for (o = o || ve(e), a = a || ve(c), r = 0, i = o.length; r < i; r++)Oe(o[r], a[r]); else Oe(e, c); return 0 < (a = ve(c, "script")).length && ye(a, !f && ve(e, "script")), c }, cleanData: function (e) { for (var t, n, r, i = S.event.special, o = 0; void 0 !== (n = e[o]); o++)if (V(n)) { if (t = n[Y.expando]) { if (t.events) for (r in t.events) i[r] ? S.event.remove(n, r) : S.removeEvent(n, r, t.handle); n[Y.expando] = void 0 } n[Q.expando] && (n[Q.expando] = void 0) } } }), S.fn.extend({ detach: function (e) { return Re(this, e, !0) }, remove: function (e) { return Re(this, e) }, text: function (e) { return $(this, function (e) { return void 0 === e ? S.text(this) : this.empty().each(function () { 1 !== this.nodeType && 11 !== this.nodeType && 9 !== this.nodeType || (this.textContent = e) }) }, null, e, arguments.length) }, append: function () { return Pe(this, arguments, function (e) { 1 !== this.nodeType && 11 !== this.nodeType && 9 !== this.nodeType || qe(this, e).appendChild(e) }) }, prepend: function () { return Pe(this, arguments, function (e) { if (1 === this.nodeType || 11 === this.nodeType || 9 === this.nodeType) { var t = qe(this, e); t.insertBefore(e, t.firstChild) } }) }, before: function () { return Pe(this, arguments, function (e) { this.parentNode && this.parentNode.insertBefore(e, this) }) }, after: function () { return Pe(this, arguments, function (e) { this.parentNode && this.parentNode.insertBefore(e, this.nextSibling) }) }, empty: function () { for (var e, t = 0; null != (e = this[t]); t++)1 === e.nodeType && (S.cleanData(ve(e, !1)), e.textContent = ""); return this }, clone: function (e, t) { return e = null != e && e, t = null == t ? e : t, this.map(function () { return S.clone(this, e, t) }) }, html: function (e) { return $(this, function (e) { var t = this[0] || {}, n = 0, r = this.length; if (void 0 === e && 1 === t.nodeType) return t.innerHTML; if ("string" == typeof e && !Ne.test(e) && !ge[(de.exec(e) || ["", ""])[1].toLowerCase()]) { e = S.htmlPrefilter(e); try { for (; n < r; n++)1 === (t = this[n] || {}).nodeType && (S.cleanData(ve(t, !1)), t.innerHTML = e); t = 0 } catch (e) { } } t && this.empty().append(e) }, null, e, arguments.length) }, replaceWith: function () { var n = []; return Pe(this, arguments, function (e) { var t = this.parentNode; S.inArray(this, n) < 0 && (S.cleanData(ve(this)), t && t.replaceChild(e, this)) }, n) } }), S.each({ appendTo: "append", prependTo: "prepend", insertBefore: "before", insertAfter: "after", replaceAll: "replaceWith" }, function (e, a) { S.fn[e] = function (e) { for (var t, n = [], r = S(e), i = r.length - 1, o = 0; o <= i; o++)t = o === i ? this : this.clone(!0), S(r[o])[a](t), u.apply(n, t.get()); return this.pushStack(n) } }); var Me = new RegExp("^(" + ee + ")(?!px)[a-z%]+$", "i"), Ie = function (e) { var t = e.ownerDocument.defaultView; return t && t.opener || (t = C), t.getComputedStyle(e) }, We = function (e, t, n) { var r, i, o = {}; for (i in t) o[i] = e.style[i], e.style[i] = t[i]; for (i in r = n.call(e), t) e.style[i] = o[i]; return r }, Fe = new RegExp(ne.join("|"), "i"); function Be(e, t, n) { var r, i, o, a, s = e.style; return (n = n || Ie(e)) && ("" !== (a = n.getPropertyValue(t) || n[t]) || ie(e) || (a = S.style(e, t)), !y.pixelBoxStyles() && Me.test(a) && Fe.test(t) && (r = s.width, i = s.minWidth, o = s.maxWidth, s.minWidth = s.maxWidth = s.width = a, a = n.width, s.width = r, s.minWidth = i, s.maxWidth = o)), void 0 !== a ? a + "" : a } function $e(e, t) { return { get: function () { if (!e()) return (this.get = t).apply(this, arguments); delete this.get } } } !function () { function e() { if (l) { u.style.cssText = "position:absolute;left:-11111px;width:60px;margin-top:1px;padding:0;border:0", l.style.cssText = "position:relative;display:block;box-sizing:border-box;overflow:scroll;margin:auto;border:1px;padding:1px;width:60%;top:1%", re.appendChild(u).appendChild(l); var e = C.getComputedStyle(l); n = "1%" !== e.top, s = 12 === t(e.marginLeft), l.style.right = "60%", o = 36 === t(e.right), r = 36 === t(e.width), l.style.position = "absolute", i = 12 === t(l.offsetWidth / 3), re.removeChild(u), l = null } } function t(e) { return Math.round(parseFloat(e)) } var n, r, i, o, a, s, u = E.createElement("div"), l = E.createElement("div"); l.style && (l.style.backgroundClip = "content-box", l.cloneNode(!0).style.backgroundClip = "", y.clearCloneStyle = "content-box" === l.style.backgroundClip, S.extend(y, { boxSizingReliable: function () { return e(), r }, pixelBoxStyles: function () { return e(), o }, pixelPosition: function () { return e(), n }, reliableMarginLeft: function () { return e(), s }, scrollboxSize: function () { return e(), i }, reliableTrDimensions: function () { var e, t, n, r; return null == a && (e = E.createElement("table"), t = E.createElement("tr"), n = E.createElement("div"), e.style.cssText = "position:absolute;left:-11111px", t.style.height = "1px", n.style.height = "9px", re.appendChild(e).appendChild(t).appendChild(n), r = C.getComputedStyle(t), a = 3 < parseInt(r.height), re.removeChild(e)), a } })) }(); var _e = ["Webkit", "Moz", "ms"], ze = E.createElement("div").style, Ue = {}; function Xe(e) { var t = S.cssProps[e] || Ue[e]; return t || (e in ze ? e : Ue[e] = function (e) { var t = e[0].toUpperCase() + e.slice(1), n = _e.length; while (n--) if ((e = _e[n] + t) in ze) return e }(e) || e) } var Ve = /^(none|table(?!-c[ea]).+)/, Ge = /^--/, Ye = { position: "absolute", visibility: "hidden", display: "block" }, Qe = { letterSpacing: "0", fontWeight: "400" }; function Je(e, t, n) { var r = te.exec(t); return r ? Math.max(0, r[2] - (n || 0)) + (r[3] || "px") : t } function Ke(e, t, n, r, i, o) { var a = "width" === t ? 1 : 0, s = 0, u = 0; if (n === (r ? "border" : "content")) return 0; for (; a < 4; a += 2)"margin" === n && (u += S.css(e, n + ne[a], !0, i)), r ? ("content" === n && (u -= S.css(e, "padding" + ne[a], !0, i)), "margin" !== n && (u -= S.css(e, "border" + ne[a] + "Width", !0, i))) : (u += S.css(e, "padding" + ne[a], !0, i), "padding" !== n ? u += S.css(e, "border" + ne[a] + "Width", !0, i) : s += S.css(e, "border" + ne[a] + "Width", !0, i)); return !r && 0 <= o && (u += Math.max(0, Math.ceil(e["offset" + t[0].toUpperCase() + t.slice(1)] - o - u - s - .5)) || 0), u } function Ze(e, t, n) { var r = Ie(e), i = (!y.boxSizingReliable() || n) && "border-box" === S.css(e, "boxSizing", !1, r), o = i, a = Be(e, t, r), s = "offset" + t[0].toUpperCase() + t.slice(1); if (Me.test(a)) { if (!n) return a; a = "auto" } return (!y.boxSizingReliable() && i || !y.reliableTrDimensions() && A(e, "tr") || "auto" === a || !parseFloat(a) && "inline" === S.css(e, "display", !1, r)) && e.getClientRects().length && (i = "border-box" === S.css(e, "boxSizing", !1, r), (o = s in e) && (a = e[s])), (a = parseFloat(a) || 0) + Ke(e, t, n || (i ? "border" : "content"), o, r, a) + "px" } function et(e, t, n, r, i) { return new et.prototype.init(e, t, n, r, i) } S.extend({ cssHooks: { opacity: { get: function (e, t) { if (t) { var n = Be(e, "opacity"); return "" === n ? "1" : n } } } }, cssNumber: { animationIterationCount: !0, columnCount: !0, fillOpacity: !0, flexGrow: !0, flexShrink: !0, fontWeight: !0, gridArea: !0, gridColumn: !0, gridColumnEnd: !0, gridColumnStart: !0, gridRow: !0, gridRowEnd: !0, gridRowStart: !0, lineHeight: !0, opacity: !0, order: !0, orphans: !0, widows: !0, zIndex: !0, zoom: !0 }, cssProps: {}, style: function (e, t, n, r) { if (e && 3 !== e.nodeType && 8 !== e.nodeType && e.style) { var i, o, a, s = X(t), u = Ge.test(t), l = e.style; if (u || (t = Xe(s)), a = S.cssHooks[t] || S.cssHooks[s], void 0 === n) return a && "get" in a && void 0 !== (i = a.get(e, !1, r)) ? i : l[t]; "string" === (o = typeof n) && (i = te.exec(n)) && i[1] && (n = se(e, t, i), o = "number"), null != n && n == n && ("number" !== o || u || (n += i && i[3] || (S.cssNumber[s] ? "" : "px")), y.clearCloneStyle || "" !== n || 0 !== t.indexOf("background") || (l[t] = "inherit"), a && "set" in a && void 0 === (n = a.set(e, n, r)) || (u ? l.setProperty(t, n) : l[t] = n)) } }, css: function (e, t, n, r) { var i, o, a, s = X(t); return Ge.test(t) || (t = Xe(s)), (a = S.cssHooks[t] || S.cssHooks[s]) && "get" in a && (i = a.get(e, !0, n)), void 0 === i && (i = Be(e, t, r)), "normal" === i && t in Qe && (i = Qe[t]), "" === n || n ? (o = parseFloat(i), !0 === n || isFinite(o) ? o || 0 : i) : i } }), S.each(["height", "width"], function (e, u) { S.cssHooks[u] = { get: function (e, t, n) { if (t) return !Ve.test(S.css(e, "display")) || e.getClientRects().length && e.getBoundingClientRect().width ? Ze(e, u, n) : We(e, Ye, function () { return Ze(e, u, n) }) }, set: function (e, t, n) { var r, i = Ie(e), o = !y.scrollboxSize() && "absolute" === i.position, a = (o || n) && "border-box" === S.css(e, "boxSizing", !1, i), s = n ? Ke(e, u, n, a, i) : 0; return a && o && (s -= Math.ceil(e["offset" + u[0].toUpperCase() + u.slice(1)] - parseFloat(i[u]) - Ke(e, u, "border", !1, i) - .5)), s && (r = te.exec(t)) && "px" !== (r[3] || "px") && (e.style[u] = t, t = S.css(e, u)), Je(0, t, s) } } }), S.cssHooks.marginLeft = $e(y.reliableMarginLeft, function (e, t) { if (t) return (parseFloat(Be(e, "marginLeft")) || e.getBoundingClientRect().left - We(e, { marginLeft: 0 }, function () { return e.getBoundingClientRect().left })) + "px" }), S.each({ margin: "", padding: "", border: "Width" }, function (i, o) { S.cssHooks[i + o] = { expand: function (e) { for (var t = 0, n = {}, r = "string" == typeof e ? e.split(" ") : [e]; t < 4; t++)n[i + ne[t] + o] = r[t] || r[t - 2] || r[0]; return n } }, "margin" !== i && (S.cssHooks[i + o].set = Je) }), S.fn.extend({ css: function (e, t) { return $(this, function (e, t, n) { var r, i, o = {}, a = 0; if (Array.isArray(t)) { for (r = Ie(e), i = t.length; a < i; a++)o[t[a]] = S.css(e, t[a], !1, r); return o } return void 0 !== n ? S.style(e, t, n) : S.css(e, t) }, e, t, 1 < arguments.length) } }), ((S.Tween = et).prototype = { constructor: et, init: function (e, t, n, r, i, o) { this.elem = e, this.prop = n, this.easing = i || S.easing._default, this.options = t, this.start = this.now = this.cur(), this.end = r, this.unit = o || (S.cssNumber[n] ? "" : "px") }, cur: function () { var e = et.propHooks[this.prop]; return e && e.get ? e.get(this) : et.propHooks._default.get(this) }, run: function (e) { var t, n = et.propHooks[this.prop]; return this.options.duration ? this.pos = t = S.easing[this.easing](e, this.options.duration * e, 0, 1, this.options.duration) : this.pos = t = e, this.now = (this.end - this.start) * t + this.start, this.options.step && this.options.step.call(this.elem, this.now, this), n && n.set ? n.set(this) : et.propHooks._default.set(this), this } }).init.prototype = et.prototype, (et.propHooks = { _default: { get: function (e) { var t; return 1 !== e.elem.nodeType || null != e.elem[e.prop] && null == e.elem.style[e.prop] ? e.elem[e.prop] : (t = S.css(e.elem, e.prop, "")) && "auto" !== t ? t : 0 }, set: function (e) { S.fx.step[e.prop] ? S.fx.step[e.prop](e) : 1 !== e.elem.nodeType || !S.cssHooks[e.prop] && null == e.elem.style[Xe(e.prop)] ? e.elem[e.prop] = e.now : S.style(e.elem, e.prop, e.now + e.unit) } } }).scrollTop = et.propHooks.scrollLeft = { set: function (e) { e.elem.nodeType && e.elem.parentNode && (e.elem[e.prop] = e.now) } }, S.easing = { linear: function (e) { return e }, swing: function (e) { return .5 - Math.cos(e * Math.PI) / 2 }, _default: "swing" }, S.fx = et.prototype.init, S.fx.step = {}; var tt, nt, rt, it, ot = /^(?:toggle|show|hide)$/, at = /queueHooks$/; function st() { nt && (!1 === E.hidden && C.requestAnimationFrame ? C.requestAnimationFrame(st) : C.setTimeout(st, S.fx.interval), S.fx.tick()) } function ut() { return C.setTimeout(function () { tt = void 0 }), tt = Date.now() } function lt(e, t) { var n, r = 0, i = { height: e }; for (t = t ? 1 : 0; r < 4; r += 2 - t)i["margin" + (n = ne[r])] = i["padding" + n] = e; return t && (i.opacity = i.width = e), i } function ct(e, t, n) { for (var r, i = (ft.tweeners[t] || []).concat(ft.tweeners["*"]), o = 0, a = i.length; o < a; o++)if (r = i[o].call(n, t, e)) return r } function ft(o, e, t) { var n, a, r = 0, i = ft.prefilters.length, s = S.Deferred().always(function () { delete u.elem }), u = function () { if (a) return !1; for (var e = tt || ut(), t = Math.max(0, l.startTime + l.duration - e), n = 1 - (t / l.duration || 0), r = 0, i = l.tweens.length; r < i; r++)l.tweens[r].run(n); return s.notifyWith(o, [l, n, t]), n < 1 && i ? t : (i || s.notifyWith(o, [l, 1, 0]), s.resolveWith(o, [l]), !1) }, l = s.promise({ elem: o, props: S.extend({}, e), opts: S.extend(!0, { specialEasing: {}, easing: S.easing._default }, t), originalProperties: e, originalOptions: t, startTime: tt || ut(), duration: t.duration, tweens: [], createTween: function (e, t) { var n = S.Tween(o, l.opts, e, t, l.opts.specialEasing[e] || l.opts.easing); return l.tweens.push(n), n }, stop: function (e) { var t = 0, n = e ? l.tweens.length : 0; if (a) return this; for (a = !0; t < n; t++)l.tweens[t].run(1); return e ? (s.notifyWith(o, [l, 1, 0]), s.resolveWith(o, [l, e])) : s.rejectWith(o, [l, e]), this } }), c = l.props; for (!function (e, t) { var n, r, i, o, a; for (n in e) if (i = t[r = X(n)], o = e[n], Array.isArray(o) && (i = o[1], o = e[n] = o[0]), n !== r && (e[r] = o, delete e[n]), (a = S.cssHooks[r]) && "expand" in a) for (n in o = a.expand(o), delete e[r], o) n in e || (e[n] = o[n], t[n] = i); else t[r] = i }(c, l.opts.specialEasing); r < i; r++)if (n = ft.prefilters[r].call(l, o, c, l.opts)) return m(n.stop) && (S._queueHooks(l.elem, l.opts.queue).stop = n.stop.bind(n)), n; return S.map(c, ct, l), m(l.opts.start) && l.opts.start.call(o, l), l.progress(l.opts.progress).done(l.opts.done, l.opts.complete).fail(l.opts.fail).always(l.opts.always), S.fx.timer(S.extend(u, { elem: o, anim: l, queue: l.opts.queue })), l } S.Animation = S.extend(ft, { tweeners: { "*": [function (e, t) { var n = this.createTween(e, t); return se(n.elem, e, te.exec(t), n), n }] }, tweener: function (e, t) { m(e) ? (t = e, e = ["*"]) : e = e.match(P); for (var n, r = 0, i = e.length; r < i; r++)n = e[r], ft.tweeners[n] = ft.tweeners[n] || [], ft.tweeners[n].unshift(t) }, prefilters: [function (e, t, n) { var r, i, o, a, s, u, l, c, f = "width" in t || "height" in t, p = this, d = {}, h = e.style, g = e.nodeType && ae(e), v = Y.get(e, "fxshow"); for (r in n.queue || (null == (a = S._queueHooks(e, "fx")).unqueued && (a.unqueued = 0, s = a.empty.fire, a.empty.fire = function () { a.unqueued || s() }), a.unqueued++, p.always(function () { p.always(function () { a.unqueued--, S.queue(e, "fx").length || a.empty.fire() }) })), t) if (i = t[r], ot.test(i)) { if (delete t[r], o = o || "toggle" === i, i === (g ? "hide" : "show")) { if ("show" !== i || !v || void 0 === v[r]) continue; g = !0 } d[r] = v && v[r] || S.style(e, r) } if ((u = !S.isEmptyObject(t)) || !S.isEmptyObject(d)) for (r in f && 1 === e.nodeType && (n.overflow = [h.overflow, h.overflowX, h.overflowY], null == (l = v && v.display) && (l = Y.get(e, "display")), "none" === (c = S.css(e, "display")) && (l ? c = l : (le([e], !0), l = e.style.display || l, c = S.css(e, "display"), le([e]))), ("inline" === c || "inline-block" === c && null != l) && "none" === S.css(e, "float") && (u || (p.done(function () { h.display = l }), null == l && (c = h.display, l = "none" === c ? "" : c)), h.display = "inline-block")), n.overflow && (h.overflow = "hidden", p.always(function () { h.overflow = n.overflow[0], h.overflowX = n.overflow[1], h.overflowY = n.overflow[2] })), u = !1, d) u || (v ? "hidden" in v && (g = v.hidden) : v = Y.access(e, "fxshow", { display: l }), o && (v.hidden = !g), g && le([e], !0), p.done(function () { for (r in g || le([e]), Y.remove(e, "fxshow"), d) S.style(e, r, d[r]) })), u = ct(g ? v[r] : 0, r, p), r in v || (v[r] = u.start, g && (u.end = u.start, u.start = 0)) }], prefilter: function (e, t) { t ? ft.prefilters.unshift(e) : ft.prefilters.push(e) } }), S.speed = function (e, t, n) { var r = e && "object" == typeof e ? S.extend({}, e) : { complete: n || !n && t || m(e) && e, duration: e, easing: n && t || t && !m(t) && t }; return S.fx.off ? r.duration = 0 : "number" != typeof r.duration && (r.duration in S.fx.speeds ? r.duration = S.fx.speeds[r.duration] : r.duration = S.fx.speeds._default), null != r.queue && !0 !== r.queue || (r.queue = "fx"), r.old = r.complete, r.complete = function () { m(r.old) && r.old.call(this), r.queue && S.dequeue(this, r.queue) }, r }, S.fn.extend({ fadeTo: function (e, t, n, r) { return this.filter(ae).css("opacity", 0).show().end().animate({ opacity: t }, e, n, r) }, animate: function (t, e, n, r) { var i = S.isEmptyObject(t), o = S.speed(e, n, r), a = function () { var e = ft(this, S.extend({}, t), o); (i || Y.get(this, "finish")) && e.stop(!0) }; return a.finish = a, i || !1 === o.queue ? this.each(a) : this.queue(o.queue, a) }, stop: function (i, e, o) { var a = function (e) { var t = e.stop; delete e.stop, t(o) }; return "string" != typeof i && (o = e, e = i, i = void 0), e && this.queue(i || "fx", []), this.each(function () { var e = !0, t = null != i && i + "queueHooks", n = S.timers, r = Y.get(this); if (t) r[t] && r[t].stop && a(r[t]); else for (t in r) r[t] && r[t].stop && at.test(t) && a(r[t]); for (t = n.length; t--;)n[t].elem !== this || null != i && n[t].queue !== i || (n[t].anim.stop(o), e = !1, n.splice(t, 1)); !e && o || S.dequeue(this, i) }) }, finish: function (a) { return !1 !== a && (a = a || "fx"), this.each(function () { var e, t = Y.get(this), n = t[a + "queue"], r = t[a + "queueHooks"], i = S.timers, o = n ? n.length : 0; for (t.finish = !0, S.queue(this, a, []), r && r.stop && r.stop.call(this, !0), e = i.length; e--;)i[e].elem === this && i[e].queue === a && (i[e].anim.stop(!0), i.splice(e, 1)); for (e = 0; e < o; e++)n[e] && n[e].finish && n[e].finish.call(this); delete t.finish }) } }), S.each(["toggle", "show", "hide"], function (e, r) { var i = S.fn[r]; S.fn[r] = function (e, t, n) { return null == e || "boolean" == typeof e ? i.apply(this, arguments) : this.animate(lt(r, !0), e, t, n) } }), S.each({ slideDown: lt("show"), slideUp: lt("hide"), slideToggle: lt("toggle"), fadeIn: { opacity: "show" }, fadeOut: { opacity: "hide" }, fadeToggle: { opacity: "toggle" } }, function (e, r) { S.fn[e] = function (e, t, n) { return this.animate(r, e, t, n) } }), S.timers = [], S.fx.tick = function () { var e, t = 0, n = S.timers; for (tt = Date.now(); t < n.length; t++)(e = n[t])() || n[t] !== e || n.splice(t--, 1); n.length || S.fx.stop(), tt = void 0 }, S.fx.timer = function (e) { S.timers.push(e), S.fx.start() }, S.fx.interval = 13, S.fx.start = function () { nt || (nt = !0, st()) }, S.fx.stop = function () { nt = null }, S.fx.speeds = { slow: 600, fast: 200, _default: 400 }, S.fn.delay = function (r, e) { return r = S.fx && S.fx.speeds[r] || r, e = e || "fx", this.queue(e, function (e, t) { var n = C.setTimeout(e, r); t.stop = function () { C.clearTimeout(n) } }) }, rt = E.createElement("input"), it = E.createElement("select").appendChild(E.createElement("option")), rt.type = "checkbox", y.checkOn = "" !== rt.value, y.optSelected = it.selected, (rt = E.createElement("input")).value = "t", rt.type = "radio", y.radioValue = "t" === rt.value; var pt, dt = S.expr.attrHandle; S.fn.extend({ attr: function (e, t) { return $(this, S.attr, e, t, 1 < arguments.length) }, removeAttr: function (e) { return this.each(function () { S.removeAttr(this, e) }) } }), S.extend({ attr: function (e, t, n) { var r, i, o = e.nodeType; if (3 !== o && 8 !== o && 2 !== o) return "undefined" == typeof e.getAttribute ? S.prop(e, t, n) : (1 === o && S.isXMLDoc(e) || (i = S.attrHooks[t.toLowerCase()] || (S.expr.match.bool.test(t) ? pt : void 0)), void 0 !== n ? null === n ? void S.removeAttr(e, t) : i && "set" in i && void 0 !== (r = i.set(e, n, t)) ? r : (e.setAttribute(t, n + ""), n) : i && "get" in i && null !== (r = i.get(e, t)) ? r : null == (r = S.find.attr(e, t)) ? void 0 : r) }, attrHooks: { type: { set: function (e, t) { if (!y.radioValue && "radio" === t && A(e, "input")) { var n = e.value; return e.setAttribute("type", t), n && (e.value = n), t } } } }, removeAttr: function (e, t) { var n, r = 0, i = t && t.match(P); if (i && 1 === e.nodeType) while (n = i[r++]) e.removeAttribute(n) } }), pt = { set: function (e, t, n) { return !1 === t ? S.removeAttr(e, n) : e.setAttribute(n, n), n } }, S.each(S.expr.match.bool.source.match(/\w+/g), function (e, t) { var a = dt[t] || S.find.attr; dt[t] = function (e, t, n) { var r, i, o = t.toLowerCase(); return n || (i = dt[o], dt[o] = r, r = null != a(e, t, n) ? o : null, dt[o] = i), r } }); var ht = /^(?:input|select|textarea|button)$/i, gt = /^(?:a|area)$/i; function vt(e) { return (e.match(P) || []).join(" ") } function yt(e) { return e.getAttribute && e.getAttribute("class") || "" } function mt(e) { return Array.isArray(e) ? e : "string" == typeof e && e.match(P) || [] } S.fn.extend({ prop: function (e, t) { return $(this, S.prop, e, t, 1 < arguments.length) }, removeProp: function (e) { return this.each(function () { delete this[S.propFix[e] || e] }) } }), S.extend({ prop: function (e, t, n) { var r, i, o = e.nodeType; if (3 !== o && 8 !== o && 2 !== o) return 1 === o && S.isXMLDoc(e) || (t = S.propFix[t] || t, i = S.propHooks[t]), void 0 !== n ? i && "set" in i && void 0 !== (r = i.set(e, n, t)) ? r : e[t] = n : i && "get" in i && null !== (r = i.get(e, t)) ? r : e[t] }, propHooks: { tabIndex: { get: function (e) { var t = S.find.attr(e, "tabindex"); return t ? parseInt(t, 10) : ht.test(e.nodeName) || gt.test(e.nodeName) && e.href ? 0 : -1 } } }, propFix: { "for": "htmlFor", "class": "className" } }), y.optSelected || (S.propHooks.selected = { get: function (e) { var t = e.parentNode; return t && t.parentNode && t.parentNode.selectedIndex, null }, set: function (e) { var t = e.parentNode; t && (t.selectedIndex, t.parentNode && t.parentNode.selectedIndex) } }), S.each(["tabIndex", "readOnly", "maxLength", "cellSpacing", "cellPadding", "rowSpan", "colSpan", "useMap", "frameBorder", "contentEditable"], function () { S.propFix[this.toLowerCase()] = this }), S.fn.extend({ addClass: function (t) { var e, n, r, i, o, a, s, u = 0; if (m(t)) return this.each(function (e) { S(this).addClass(t.call(this, e, yt(this))) }); if ((e = mt(t)).length) while (n = this[u++]) if (i = yt(n), r = 1 === n.nodeType && " " + vt(i) + " ") { a = 0; while (o = e[a++]) r.indexOf(" " + o + " ") < 0 && (r += o + " "); i !== (s = vt(r)) && n.setAttribute("class", s) } return this }, removeClass: function (t) { var e, n, r, i, o, a, s, u = 0; if (m(t)) return this.each(function (e) { S(this).removeClass(t.call(this, e, yt(this))) }); if (!arguments.length) return this.attr("class", ""); if ((e = mt(t)).length) while (n = this[u++]) if (i = yt(n), r = 1 === n.nodeType && " " + vt(i) + " ") { a = 0; while (o = e[a++]) while (-1 < r.indexOf(" " + o + " ")) r = r.replace(" " + o + " ", " "); i !== (s = vt(r)) && n.setAttribute("class", s) } return this }, toggleClass: function (i, t) { var o = typeof i, a = "string" === o || Array.isArray(i); return "boolean" == typeof t && a ? t ? this.addClass(i) : this.removeClass(i) : m(i) ? this.each(function (e) { S(this).toggleClass(i.call(this, e, yt(this), t), t) }) : this.each(function () { var e, t, n, r; if (a) { t = 0, n = S(this), r = mt(i); while (e = r[t++]) n.hasClass(e) ? n.removeClass(e) : n.addClass(e) } else void 0 !== i && "boolean" !== o || ((e = yt(this)) && Y.set(this, "__className__", e), this.setAttribute && this.setAttribute("class", e || !1 === i ? "" : Y.get(this, "__className__") || "")) }) }, hasClass: function (e) { var t, n, r = 0; t = " " + e + " "; while (n = this[r++]) if (1 === n.nodeType && -1 < (" " + vt(yt(n)) + " ").indexOf(t)) return !0; return !1 } }); var xt = /\r/g; S.fn.extend({ val: function (n) { var r, e, i, t = this[0]; return arguments.length ? (i = m(n), this.each(function (e) { var t; 1 === this.nodeType && (null == (t = i ? n.call(this, e, S(this).val()) : n) ? t = "" : "number" == typeof t ? t += "" : Array.isArray(t) && (t = S.map(t, function (e) { return null == e ? "" : e + "" })), (r = S.valHooks[this.type] || S.valHooks[this.nodeName.toLowerCase()]) && "set" in r && void 0 !== r.set(this, t, "value") || (this.value = t)) })) : t ? (r = S.valHooks[t.type] || S.valHooks[t.nodeName.toLowerCase()]) && "get" in r && void 0 !== (e = r.get(t, "value")) ? e : "string" == typeof (e = t.value) ? e.replace(xt, "") : null == e ? "" : e : void 0 } }), S.extend({ valHooks: { option: { get: function (e) { var t = S.find.attr(e, "value"); return null != t ? t : vt(S.text(e)) } }, select: { get: function (e) { var t, n, r, i = e.options, o = e.selectedIndex, a = "select-one" === e.type, s = a ? null : [], u = a ? o + 1 : i.length; for (r = o < 0 ? u : a ? o : 0; r < u; r++)if (((n = i[r]).selected || r === o) && !n.disabled && (!n.parentNode.disabled || !A(n.parentNode, "optgroup"))) { if (t = S(n).val(), a) return t; s.push(t) } return s }, set: function (e, t) { var n, r, i = e.options, o = S.makeArray(t), a = i.length; while (a--) ((r = i[a]).selected = -1 < S.inArray(S.valHooks.option.get(r), o)) && (n = !0); return n || (e.selectedIndex = -1), o } } } }), S.each(["radio", "checkbox"], function () { S.valHooks[this] = { set: function (e, t) { if (Array.isArray(t)) return e.checked = -1 < S.inArray(S(e).val(), t) } }, y.checkOn || (S.valHooks[this].get = function (e) { return null === e.getAttribute("value") ? "on" : e.value }) }), y.focusin = "onfocusin" in C; var bt = /^(?:focusinfocus|focusoutblur)$/, wt = function (e) { e.stopPropagation() }; S.extend(S.event, { trigger: function (e, t, n, r) { var i, o, a, s, u, l, c, f, p = [n || E], d = v.call(e, "type") ? e.type : e, h = v.call(e, "namespace") ? e.namespace.split(".") : []; if (o = f = a = n = n || E, 3 !== n.nodeType && 8 !== n.nodeType && !bt.test(d + S.event.triggered) && (-1 < d.indexOf(".") && (d = (h = d.split(".")).shift(), h.sort()), u = d.indexOf(":") < 0 && "on" + d, (e = e[S.expando] ? e : new S.Event(d, "object" == typeof e && e)).isTrigger = r ? 2 : 3, e.namespace = h.join("."), e.rnamespace = e.namespace ? new RegExp("(^|\\.)" + h.join("\\.(?:.*\\.|)") + "(\\.|$)") : null, e.result = void 0, e.target || (e.target = n), t = null == t ? [e] : S.makeArray(t, [e]), c = S.event.special[d] || {}, r || !c.trigger || !1 !== c.trigger.apply(n, t))) { if (!r && !c.noBubble && !x(n)) { for (s = c.delegateType || d, bt.test(s + d) || (o = o.parentNode); o; o = o.parentNode)p.push(o), a = o; a === (n.ownerDocument || E) && p.push(a.defaultView || a.parentWindow || C) } i = 0; while ((o = p[i++]) && !e.isPropagationStopped()) f = o, e.type = 1 < i ? s : c.bindType || d, (l = (Y.get(o, "events") || Object.create(null))[e.type] && Y.get(o, "handle")) && l.apply(o, t), (l = u && o[u]) && l.apply && V(o) && (e.result = l.apply(o, t), !1 === e.result && e.preventDefault()); return e.type = d, r || e.isDefaultPrevented() || c._default && !1 !== c._default.apply(p.pop(), t) || !V(n) || u && m(n[d]) && !x(n) && ((a = n[u]) && (n[u] = null), S.event.triggered = d, e.isPropagationStopped() && f.addEventListener(d, wt), n[d](), e.isPropagationStopped() && f.removeEventListener(d, wt), S.event.triggered = void 0, a && (n[u] = a)), e.result } }, simulate: function (e, t, n) { var r = S.extend(new S.Event, n, { type: e, isSimulated: !0 }); S.event.trigger(r, null, t) } }), S.fn.extend({ trigger: function (e, t) { return this.each(function () { S.event.trigger(e, t, this) }) }, triggerHandler: function (e, t) { var n = this[0]; if (n) return S.event.trigger(e, t, n, !0) } }), y.focusin || S.each({ focus: "focusin", blur: "focusout" }, function (n, r) { var i = function (e) { S.event.simulate(r, e.target, S.event.fix(e)) }; S.event.special[r] = { setup: function () { var e = this.ownerDocument || this.document || this, t = Y.access(e, r); t || e.addEventListener(n, i, !0), Y.access(e, r, (t || 0) + 1) }, teardown: function () { var e = this.ownerDocument || this.document || this, t = Y.access(e, r) - 1; t ? Y.access(e, r, t) : (e.removeEventListener(n, i, !0), Y.remove(e, r)) } } }); var Tt = C.location, Ct = { guid: Date.now() }, Et = /\?/; S.parseXML = function (e) { var t; if (!e || "string" != typeof e) return null; try { t = (new C.DOMParser).parseFromString(e, "text/xml") } catch (e) { t = void 0 } return t && !t.getElementsByTagName("parsererror").length || S.error("Invalid XML: " + e), t }; var St = /\[\]$/, kt = /\r?\n/g, At = /^(?:submit|button|image|reset|file)$/i, Nt = /^(?:input|select|textarea|keygen)/i; function Dt(n, e, r, i) { var t; if (Array.isArray(e)) S.each(e, function (e, t) { r || St.test(n) ? i(n, t) : Dt(n + "[" + ("object" == typeof t && null != t ? e : "") + "]", t, r, i) }); else if (r || "object" !== w(e)) i(n, e); else for (t in e) Dt(n + "[" + t + "]", e[t], r, i) } S.param = function (e, t) { var n, r = [], i = function (e, t) { var n = m(t) ? t() : t; r[r.length] = encodeURIComponent(e) + "=" + encodeURIComponent(null == n ? "" : n) }; if (null == e) return ""; if (Array.isArray(e) || e.jquery && !S.isPlainObject(e)) S.each(e, function () { i(this.name, this.value) }); else for (n in e) Dt(n, e[n], t, i); return r.join("&") }, S.fn.extend({ serialize: function () { return S.param(this.serializeArray()) }, serializeArray: function () { return this.map(function () { var e = S.prop(this, "elements"); return e ? S.makeArray(e) : this }).filter(function () { var e = this.type; return this.name && !S(this).is(":disabled") && Nt.test(this.nodeName) && !At.test(e) && (this.checked || !pe.test(e)) }).map(function (e, t) { var n = S(this).val(); return null == n ? null : Array.isArray(n) ? S.map(n, function (e) { return { name: t.name, value: e.replace(kt, "\r\n") } }) : { name: t.name, value: n.replace(kt, "\r\n") } }).get() } }); var jt = /%20/g, qt = /#.*$/, Lt = /([?&])_=[^&]*/, Ht = /^(.*?):[ \t]*([^\r\n]*)$/gm, Ot = /^(?:GET|HEAD)$/, Pt = /^\/\//, Rt = {}, Mt = {}, It = "*/".concat("*"), Wt = E.createElement("a"); function Ft(o) { return function (e, t) { "string" != typeof e && (t = e, e = "*"); var n, r = 0, i = e.toLowerCase().match(P) || []; if (m(t)) while (n = i[r++]) "+" === n[0] ? (n = n.slice(1) || "*", (o[n] = o[n] || []).unshift(t)) : (o[n] = o[n] || []).push(t) } } function Bt(t, i, o, a) { var s = {}, u = t === Mt; function l(e) { var r; return s[e] = !0, S.each(t[e] || [], function (e, t) { var n = t(i, o, a); return "string" != typeof n || u || s[n] ? u ? !(r = n) : void 0 : (i.dataTypes.unshift(n), l(n), !1) }), r } return l(i.dataTypes[0]) || !s["*"] && l("*") } function $t(e, t) { var n, r, i = S.ajaxSettings.flatOptions || {}; for (n in t) void 0 !== t[n] && ((i[n] ? e : r || (r = {}))[n] = t[n]); return r && S.extend(!0, e, r), e } Wt.href = Tt.href, S.extend({ active: 0, lastModified: {}, etag: {}, ajaxSettings: { url: Tt.href, type: "GET", isLocal: /^(?:about|app|app-storage|.+-extension|file|res|widget):$/.test(Tt.protocol), global: !0, processData: !0, async: !0, contentType: "application/x-www-form-urlencoded; charset=UTF-8", accepts: { "*": It, text: "text/plain", html: "text/html", xml: "application/xml, text/xml", json: "application/json, text/javascript" }, contents: { xml: /\bxml\b/, html: /\bhtml/, json: /\bjson\b/ }, responseFields: { xml: "responseXML", text: "responseText", json: "responseJSON" }, converters: { "* text": String, "text html": !0, "text json": JSON.parse, "text xml": S.parseXML }, flatOptions: { url: !0, context: !0 } }, ajaxSetup: function (e, t) { return t ? $t($t(e, S.ajaxSettings), t) : $t(S.ajaxSettings, e) }, ajaxPrefilter: Ft(Rt), ajaxTransport: Ft(Mt), ajax: function (e, t) { "object" == typeof e && (t = e, e = void 0), t = t || {}; var c, f, p, n, d, r, h, g, i, o, v = S.ajaxSetup({}, t), y = v.context || v, m = v.context && (y.nodeType || y.jquery) ? S(y) : S.event, x = S.Deferred(), b = S.Callbacks("once memory"), w = v.statusCode || {}, a = {}, s = {}, u = "canceled", T = { readyState: 0, getResponseHeader: function (e) { var t; if (h) { if (!n) { n = {}; while (t = Ht.exec(p)) n[t[1].toLowerCase() + " "] = (n[t[1].toLowerCase() + " "] || []).concat(t[2]) } t = n[e.toLowerCase() + " "] } return null == t ? null : t.join(", ") }, getAllResponseHeaders: function () { return h ? p : null }, setRequestHeader: function (e, t) { return null == h && (e = s[e.toLowerCase()] = s[e.toLowerCase()] || e, a[e] = t), this }, overrideMimeType: function (e) { return null == h && (v.mimeType = e), this }, statusCode: function (e) { var t; if (e) if (h) T.always(e[T.status]); else for (t in e) w[t] = [w[t], e[t]]; return this }, abort: function (e) { var t = e || u; return c && c.abort(t), l(0, t), this } }; if (x.promise(T), v.url = ((e || v.url || Tt.href) + "").replace(Pt, Tt.protocol + "//"), v.type = t.method || t.type || v.method || v.type, v.dataTypes = (v.dataType || "*").toLowerCase().match(P) || [""], null == v.crossDomain) { r = E.createElement("a"); try { r.href = v.url, r.href = r.href, v.crossDomain = Wt.protocol + "//" + Wt.host != r.protocol + "//" + r.host } catch (e) { v.crossDomain = !0 } } if (v.data && v.processData && "string" != typeof v.data && (v.data = S.param(v.data, v.traditional)), Bt(Rt, v, t, T), h) return T; for (i in (g = S.event && v.global) && 0 == S.active++ && S.event.trigger("ajaxStart"), v.type = v.type.toUpperCase(), v.hasContent = !Ot.test(v.type), f = v.url.replace(qt, ""), v.hasContent ? v.data && v.processData && 0 === (v.contentType || "").indexOf("application/x-www-form-urlencoded") && (v.data = v.data.replace(jt, "+")) : (o = v.url.slice(f.length), v.data && (v.processData || "string" == typeof v.data) && (f += (Et.test(f) ? "&" : "?") + v.data, delete v.data), !1 === v.cache && (f = f.replace(Lt, "$1"), o = (Et.test(f) ? "&" : "?") + "_=" + Ct.guid++ + o), v.url = f + o), v.ifModified && (S.lastModified[f] && T.setRequestHeader("If-Modified-Since", S.lastModified[f]), S.etag[f] && T.setRequestHeader("If-None-Match", S.etag[f])), (v.data && v.hasContent && !1 !== v.contentType || t.contentType) && T.setRequestHeader("Content-Type", v.contentType), T.setRequestHeader("Accept", v.dataTypes[0] && v.accepts[v.dataTypes[0]] ? v.accepts[v.dataTypes[0]] + ("*" !== v.dataTypes[0] ? ", " + It + "; q=0.01" : "") : v.accepts["*"]), v.headers) T.setRequestHeader(i, v.headers[i]); if (v.beforeSend && (!1 === v.beforeSend.call(y, T, v) || h)) return T.abort(); if (u = "abort", b.add(v.complete), T.done(v.success), T.fail(v.error), c = Bt(Mt, v, t, T)) { if (T.readyState = 1, g && m.trigger("ajaxSend", [T, v]), h) return T; v.async && 0 < v.timeout && (d = C.setTimeout(function () { T.abort("timeout") }, v.timeout)); try { h = !1, c.send(a, l) } catch (e) { if (h) throw e; l(-1, e) } } else l(-1, "No Transport"); function l(e, t, n, r) { var i, o, a, s, u, l = t; h || (h = !0, d && C.clearTimeout(d), c = void 0, p = r || "", T.readyState = 0 < e ? 4 : 0, i = 200 <= e && e < 300 || 304 === e, n && (s = function (e, t, n) { var r, i, o, a, s = e.contents, u = e.dataTypes; while ("*" === u[0]) u.shift(), void 0 === r && (r = e.mimeType || t.getResponseHeader("Content-Type")); if (r) for (i in s) if (s[i] && s[i].test(r)) { u.unshift(i); break } if (u[0] in n) o = u[0]; else { for (i in n) { if (!u[0] || e.converters[i + " " + u[0]]) { o = i; break } a || (a = i) } o = o || a } if (o) return o !== u[0] && u.unshift(o), n[o] }(v, T, n)), !i && -1 < S.inArray("script", v.dataTypes) && (v.converters["text script"] = function () { }), s = function (e, t, n, r) { var i, o, a, s, u, l = {}, c = e.dataTypes.slice(); if (c[1]) for (a in e.converters) l[a.toLowerCase()] = e.converters[a]; o = c.shift(); while (o) if (e.responseFields[o] && (n[e.responseFields[o]] = t), !u && r && e.dataFilter && (t = e.dataFilter(t, e.dataType)), u = o, o = c.shift()) if ("*" === o) o = u; else if ("*" !== u && u !== o) { if (!(a = l[u + " " + o] || l["* " + o])) for (i in l) if ((s = i.split(" "))[1] === o && (a = l[u + " " + s[0]] || l["* " + s[0]])) { !0 === a ? a = l[i] : !0 !== l[i] && (o = s[0], c.unshift(s[1])); break } if (!0 !== a) if (a && e["throws"]) t = a(t); else try { t = a(t) } catch (e) { return { state: "parsererror", error: a ? e : "No conversion from " + u + " to " + o } } } return { state: "success", data: t } }(v, s, T, i), i ? (v.ifModified && ((u = T.getResponseHeader("Last-Modified")) && (S.lastModified[f] = u), (u = T.getResponseHeader("etag")) && (S.etag[f] = u)), 204 === e || "HEAD" === v.type ? l = "nocontent" : 304 === e ? l = "notmodified" : (l = s.state, o = s.data, i = !(a = s.error))) : (a = l, !e && l || (l = "error", e < 0 && (e = 0))), T.status = e, T.statusText = (t || l) + "", i ? x.resolveWith(y, [o, l, T]) : x.rejectWith(y, [T, l, a]), T.statusCode(w), w = void 0, g && m.trigger(i ? "ajaxSuccess" : "ajaxError", [T, v, i ? o : a]), b.fireWith(y, [T, l]), g && (m.trigger("ajaxComplete", [T, v]), --S.active || S.event.trigger("ajaxStop"))) } return T }, getJSON: function (e, t, n) { return S.get(e, t, n, "json") }, getScript: function (e, t) { return S.get(e, void 0, t, "script") } }), S.each(["get", "post"], function (e, i) { S[i] = function (e, t, n, r) { return m(t) && (r = r || n, n = t, t = void 0), S.ajax(S.extend({ url: e, type: i, dataType: r, data: t, success: n }, S.isPlainObject(e) && e)) } }), S.ajaxPrefilter(function (e) { var t; for (t in e.headers) "content-type" === t.toLowerCase() && (e.contentType = e.headers[t] || "") }), S._evalUrl = function (e, t, n) { return S.ajax({ url: e, type: "GET", dataType: "script", cache: !0, async: !1, global: !1, converters: { "text script": function () { } }, dataFilter: function (e) { S.globalEval(e, t, n) } }) }, S.fn.extend({ wrapAll: function (e) { var t; return this[0] && (m(e) && (e = e.call(this[0])), t = S(e, this[0].ownerDocument).eq(0).clone(!0), this[0].parentNode && t.insertBefore(this[0]), t.map(function () { var e = this; while (e.firstElementChild) e = e.firstElementChild; return e }).append(this)), this }, wrapInner: function (n) { return m(n) ? this.each(function (e) { S(this).wrapInner(n.call(this, e)) }) : this.each(function () { var e = S(this), t = e.contents(); t.length ? t.wrapAll(n) : e.append(n) }) }, wrap: function (t) { var n = m(t); return this.each(function (e) { S(this).wrapAll(n ? t.call(this, e) : t) }) }, unwrap: function (e) { return this.parent(e).not("body").each(function () { S(this).replaceWith(this.childNodes) }), this } }), S.expr.pseudos.hidden = function (e) { return !S.expr.pseudos.visible(e) }, S.expr.pseudos.visible = function (e) { return !!(e.offsetWidth || e.offsetHeight || e.getClientRects().length) }, S.ajaxSettings.xhr = function () { try { return new C.XMLHttpRequest } catch (e) { } }; var _t = { 0: 200, 1223: 204 }, zt = S.ajaxSettings.xhr(); y.cors = !!zt && "withCredentials" in zt, y.ajax = zt = !!zt, S.ajaxTransport(function (i) { var o, a; if (y.cors || zt && !i.crossDomain) return { send: function (e, t) { var n, r = i.xhr(); if (r.open(i.type, i.url, i.async, i.username, i.password), i.xhrFields) for (n in i.xhrFields) r[n] = i.xhrFields[n]; for (n in i.mimeType && r.overrideMimeType && r.overrideMimeType(i.mimeType), i.crossDomain || e["X-Requested-With"] || (e["X-Requested-With"] = "XMLHttpRequest"), e) r.setRequestHeader(n, e[n]); o = function (e) { return function () { o && (o = a = r.onload = r.onerror = r.onabort = r.ontimeout = r.onreadystatechange = null, "abort" === e ? r.abort() : "error" === e ? "number" != typeof r.status ? t(0, "error") : t(r.status, r.statusText) : t(_t[r.status] || r.status, r.statusText, "text" !== (r.responseType || "text") || "string" != typeof r.responseText ? { binary: r.response } : { text: r.responseText }, r.getAllResponseHeaders())) } }, r.onload = o(), a = r.onerror = r.ontimeout = o("error"), void 0 !== r.onabort ? r.onabort = a : r.onreadystatechange = function () { 4 === r.readyState && C.setTimeout(function () { o && a() }) }, o = o("abort"); try { r.send(i.hasContent && i.data || null) } catch (e) { if (o) throw e } }, abort: function () { o && o() } } }), S.ajaxPrefilter(function (e) { e.crossDomain && (e.contents.script = !1) }), S.ajaxSetup({ accepts: { script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" }, contents: { script: /\b(?:java|ecma)script\b/ }, converters: { "text script": function (e) { return S.globalEval(e), e } } }), S.ajaxPrefilter("script", function (e) { void 0 === e.cache && (e.cache = !1), e.crossDomain && (e.type = "GET") }), S.ajaxTransport("script", function (n) { var r, i; if (n.crossDomain || n.scriptAttrs) return { send: function (e, t) { r = S("<script>").attr(n.scriptAttrs || {}).prop({ charset: n.scriptCharset, src: n.url }).on("load error", i = function (e) { r.remove(), i = null, e && t("error" === e.type ? 404 : 200, e.type) }), E.head.appendChild(r[0]) }, abort: function () { i && i() } } }); var Ut, Xt = [], Vt = /(=)\?(?=&|$)|\?\?/; S.ajaxSetup({ jsonp: "callback", jsonpCallback: function () { var e = Xt.pop() || S.expando + "_" + Ct.guid++; return this[e] = !0, e } }), S.ajaxPrefilter("json jsonp", function (e, t, n) { var r, i, o, a = !1 !== e.jsonp && (Vt.test(e.url) ? "url" : "string" == typeof e.data && 0 === (e.contentType || "").indexOf("application/x-www-form-urlencoded") && Vt.test(e.data) && "data"); if (a || "jsonp" === e.dataTypes[0]) return r = e.jsonpCallback = m(e.jsonpCallback) ? e.jsonpCallback() : e.jsonpCallback, a ? e[a] = e[a].replace(Vt, "$1" + r) : !1 !== e.jsonp && (e.url += (Et.test(e.url) ? "&" : "?") + e.jsonp + "=" + r), e.converters["script json"] = function () { return o || S.error(r + " was not called"), o[0] }, e.dataTypes[0] = "json", i = C[r], C[r] = function () { o = arguments }, n.always(function () { void 0 === i ? S(C).removeProp(r) : C[r] = i, e[r] && (e.jsonpCallback = t.jsonpCallback, Xt.push(r)), o && m(i) && i(o[0]), o = i = void 0 }), "script" }), y.createHTMLDocument = ((Ut = E.implementation.createHTMLDocument("").body).innerHTML = "<form></form><form></form>", 2 === Ut.childNodes.length), S.parseHTML = function (e, t, n) { return "string" != typeof e ? [] : ("boolean" == typeof t && (n = t, t = !1), t || (y.createHTMLDocument ? ((r = (t = E.implementation.createHTMLDocument("")).createElement("base")).href = E.location.href, t.head.appendChild(r)) : t = E), o = !n && [], (i = N.exec(e)) ? [t.createElement(i[1])] : (i = xe([e], t, o), o && o.length && S(o).remove(), S.merge([], i.childNodes))); var r, i, o }, S.fn.load = function (e, t, n) { var r, i, o, a = this, s = e.indexOf(" "); return -1 < s && (r = vt(e.slice(s)), e = e.slice(0, s)), m(t) ? (n = t, t = void 0) : t && "object" == typeof t && (i = "POST"), 0 < a.length && S.ajax({ url: e, type: i || "GET", dataType: "html", data: t }).done(function (e) { o = arguments, a.html(r ? S("<div>").append(S.parseHTML(e)).find(r) : e) }).always(n && function (e, t) { a.each(function () { n.apply(this, o || [e.responseText, t, e]) }) }), this }, S.expr.pseudos.animated = function (t) { return S.grep(S.timers, function (e) { return t === e.elem }).length }, S.offset = { setOffset: function (e, t, n) { var r, i, o, a, s, u, l = S.css(e, "position"), c = S(e), f = {}; "static" === l && (e.style.position = "relative"), s = c.offset(), o = S.css(e, "top"), u = S.css(e, "left"), ("absolute" === l || "fixed" === l) && -1 < (o + u).indexOf("auto") ? (a = (r = c.position()).top, i = r.left) : (a = parseFloat(o) || 0, i = parseFloat(u) || 0), m(t) && (t = t.call(e, n, S.extend({}, s))), null != t.top && (f.top = t.top - s.top + a), null != t.left && (f.left = t.left - s.left + i), "using" in t ? t.using.call(e, f) : ("number" == typeof f.top && (f.top += "px"), "number" == typeof f.left && (f.left += "px"), c.css(f)) } }, S.fn.extend({ offset: function (t) { if (arguments.length) return void 0 === t ? this : this.each(function (e) { S.offset.setOffset(this, t, e) }); var e, n, r = this[0]; return r ? r.getClientRects().length ? (e = r.getBoundingClientRect(), n = r.ownerDocument.defaultView, { top: e.top + n.pageYOffset, left: e.left + n.pageXOffset }) : { top: 0, left: 0 } : void 0 }, position: function () { if (this[0]) { var e, t, n, r = this[0], i = { top: 0, left: 0 }; if ("fixed" === S.css(r, "position")) t = r.getBoundingClientRect(); else { t = this.offset(), n = r.ownerDocument, e = r.offsetParent || n.documentElement; while (e && (e === n.body || e === n.documentElement) && "static" === S.css(e, "position")) e = e.parentNode; e && e !== r && 1 === e.nodeType && ((i = S(e).offset()).top += S.css(e, "borderTopWidth", !0), i.left += S.css(e, "borderLeftWidth", !0)) } return { top: t.top - i.top - S.css(r, "marginTop", !0), left: t.left - i.left - S.css(r, "marginLeft", !0) } } }, offsetParent: function () { return this.map(function () { var e = this.offsetParent; while (e && "static" === S.css(e, "position")) e = e.offsetParent; return e || re }) } }), S.each({ scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function (t, i) { var o = "pageYOffset" === i; S.fn[t] = function (e) { return $(this, function (e, t, n) { var r; if (x(e) ? r = e : 9 === e.nodeType && (r = e.defaultView), void 0 === n) return r ? r[i] : e[t]; r ? r.scrollTo(o ? r.pageXOffset : n, o ? n : r.pageYOffset) : e[t] = n }, t, e, arguments.length) } }), S.each(["top", "left"], function (e, n) { S.cssHooks[n] = $e(y.pixelPosition, function (e, t) { if (t) return t = Be(e, n), Me.test(t) ? S(e).position()[n] + "px" : t }) }), S.each({ Height: "height", Width: "width" }, function (a, s) { S.each({ padding: "inner" + a, content: s, "": "outer" + a }, function (r, o) { S.fn[o] = function (e, t) { var n = arguments.length && (r || "boolean" != typeof e), i = r || (!0 === e || !0 === t ? "margin" : "border"); return $(this, function (e, t, n) { var r; return x(e) ? 0 === o.indexOf("outer") ? e["inner" + a] : e.document.documentElement["client" + a] : 9 === e.nodeType ? (r = e.documentElement, Math.max(e.body["scroll" + a], r["scroll" + a], e.body["offset" + a], r["offset" + a], r["client" + a])) : void 0 === n ? S.css(e, t, i) : S.style(e, t, n, i) }, s, n ? e : void 0, n) } }) }), S.each(["ajaxStart", "ajaxStop", "ajaxComplete", "ajaxError", "ajaxSuccess", "ajaxSend"], function (e, t) { S.fn[t] = function (e) { return this.on(t, e) } }), S.fn.extend({ bind: function (e, t, n) { return this.on(e, null, t, n) }, unbind: function (e, t) { return this.off(e, null, t) }, delegate: function (e, t, n, r) { return this.on(t, e, n, r) }, undelegate: function (e, t, n) { return 1 === arguments.length ? this.off(e, "**") : this.off(t, e || "**", n) }, hover: function (e, t) { return this.mouseenter(e).mouseleave(t || e) } }), S.each("blur focus focusin focusout resize scroll click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup contextmenu".split(" "), function (e, n) { S.fn[n] = function (e, t) { return 0 < arguments.length ? this.on(n, null, e, t) : this.trigger(n) } }); var Gt = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g; S.proxy = function (e, t) { var n, r, i; if ("string" == typeof t && (n = e[t], t = e, e = n), m(e)) return r = s.call(arguments, 2), (i = function () { return e.apply(t || this, r.concat(s.call(arguments))) }).guid = e.guid = e.guid || S.guid++, i }, S.holdReady = function (e) { e ? S.readyWait++ : S.ready(!0) }, S.isArray = Array.isArray, S.parseJSON = JSON.parse, S.nodeName = A, S.isFunction = m, S.isWindow = x, S.camelCase = X, S.type = w, S.now = Date.now, S.isNumeric = function (e) { var t = S.type(e); return ("number" === t || "string" === t) && !isNaN(e - parseFloat(e)) }, S.trim = function (e) { return null == e ? "" : (e + "").replace(Gt, "") }, "function" == typeof define && define.amd && define("jquery", [], function () { return S }); var Yt = C.jQuery, Qt = C.$; return S.noConflict = function (e) { return C.$ === S && (C.$ = Qt), e && C.jQuery === S && (C.jQuery = Yt), S }, "undefined" == typeof e && (C.jQuery = C.$ = S), S });
</script>
<script type="text/javascrip">
/*!
* Bootstrap v4.3.1 (https://getbootstrap.com/)
* Copyright 2011-2019 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
*/
!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],e):e((t=t||self).bootstrap={},t.jQuery)}(this,function(t,p){"use strict";function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}function s(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}function l(o){for(var t=1;t<arguments.length;t++){var r=null!=arguments[t]?arguments[t]:{},e=Object.keys(r);"function"==typeof Object.getOwnPropertySymbols&&(e=e.concat(Object.getOwnPropertySymbols(r).filter(function(t){return Object.getOwnPropertyDescriptor(r,t).enumerable}))),e.forEach(function(t){var e,n,i;e=o,i=r[n=t],n in e?Object.defineProperty(e,n,{value:i,enumerable:!0,configurable:!0,writable:!0}):e[n]=i})}return o}p=p&&p.hasOwnProperty("default")?p.default:p;var e="transitionend";function n(t){var e=this,n=!1;return p(this).one(m.TRANSITION_END,function(){n=!0}),setTimeout(function(){n||m.triggerTransitionEnd(e)},t),this}var m={TRANSITION_END:"bsTransitionEnd",getUID:function(t){for(;t+=~~(1e6*Math.random()),document.getElementById(t););return t},getSelectorFromElement:function(t){var e=t.getAttribute("data-target");if(!e||"#"===e){var n=t.getAttribute("href");e=n&&"#"!==n?n.trim():""}try{return document.querySelector(e)?e:null}catch(t){return null}},getTransitionDurationFromElement:function(t){if(!t)return 0;var e=p(t).css("transition-duration"),n=p(t).css("transition-delay"),i=parseFloat(e),o=parseFloat(n);return i||o?(e=e.split(",")[0],n=n.split(",")[0],1e3*(parseFloat(e)+parseFloat(n))):0},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(t){p(t).trigger(e)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]||t).nodeType},typeCheckConfig:function(t,e,n){for(var i in n)if(Object.prototype.hasOwnProperty.call(n,i)){var o=n[i],r=e[i],s=r&&m.isElement(r)?"element":(a=r,{}.toString.call(a).match(/\s([a-z]+)/i)[1].toLowerCase());if(!new RegExp(o).test(s))throw new Error(t.toUpperCase()+': Option "'+i+'" provided type "'+s+'" but expected type "'+o+'".')}var a},findShadowRoot:function(t){if(!document.documentElement.attachShadow)return null;if("function"!=typeof t.getRootNode)return t instanceof ShadowRoot?t:t.parentNode?m.findShadowRoot(t.parentNode):null;var e=t.getRootNode();return e instanceof ShadowRoot?e:null}};p.fn.emulateTransitionEnd=n,p.event.special[m.TRANSITION_END]={bindType:e,delegateType:e,handle:function(t){if(p(t.target).is(this))return t.handleObj.handler.apply(this,arguments)}};var o="alert",r="bs.alert",a="."+r,c=p.fn[o],h={CLOSE:"close"+a,CLOSED:"closed"+a,CLICK_DATA_API:"click"+a+".data-api"},u="alert",f="fade",d="show",g=function(){function i(t){this._element=t}var t=i.prototype;return t.close=function(t){var e=this._element;t&&(e=this._getRootElement(t)),this._triggerCloseEvent(e).isDefaultPrevented()||this._removeElement(e)},t.dispose=function(){p.removeData(this._element,r),this._element=null},t._getRootElement=function(t){var e=m.getSelectorFromElement(t),n=!1;return e&&(n=document.querySelector(e)),n||(n=p(t).closest("."+u)[0]),n},t._triggerCloseEvent=function(t){var e=p.Event(h.CLOSE);return p(t).trigger(e),e},t._removeElement=function(e){var n=this;if(p(e).removeClass(d),p(e).hasClass(f)){var t=m.getTransitionDurationFromElement(e);p(e).one(m.TRANSITION_END,function(t){return n._destroyElement(e,t)}).emulateTransitionEnd(t)}else this._destroyElement(e)},t._destroyElement=function(t){p(t).detach().trigger(h.CLOSED).remove()},i._jQueryInterface=function(n){return this.each(function(){var t=p(this),e=t.data(r);e||(e=new i(this),t.data(r,e)),"close"===n&&e[n](this)})},i._handleDismiss=function(e){return function(t){t&&t.preventDefault(),e.close(this)}},s(i,null,[{key:"VERSION",get:function(){return"4.3.1"}}]),i}();p(document).on(h.CLICK_DATA_API,'[data-dismiss="alert"]',g._handleDismiss(new g)),p.fn[o]=g._jQueryInterface,p.fn[o].Constructor=g,p.fn[o].noConflict=function(){return p.fn[o]=c,g._jQueryInterface};var _="button",v="bs.button",y="."+v,E=".data-api",b=p.fn[_],w="active",C="btn",T="focus",S='[data-toggle^="button"]',D='[data-toggle="buttons"]',I='input:not([type="hidden"])',A=".active",O=".btn",N={CLICK_DATA_API:"click"+y+E,FOCUS_BLUR_DATA_API:"focus"+y+E+" blur"+y+E},k=function(){function n(t){this._element=t}var t=n.prototype;return t.toggle=function(){var t=!0,e=!0,n=p(this._element).closest(D)[0];if(n){var i=this._element.querySelector(I);if(i){if("radio"===i.type)if(i.checked&&this._element.classList.contains(w))t=!1;else{var o=n.querySelector(A);o&&p(o).removeClass(w)}if(t){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!this._element.classList.contains(w),p(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!this._element.classList.contains(w)),t&&p(this._element).toggleClass(w)},t.dispose=function(){p.removeData(this._element,v),this._element=null},n._jQueryInterface=function(e){return this.each(function(){var t=p(this).data(v);t||(t=new n(this),p(this).data(v,t)),"toggle"===e&&t[e]()})},s(n,null,[{key:"VERSION",get:function(){return"4.3.1"}}]),n}();p(document).on(N.CLICK_DATA_API,S,function(t){t.preventDefault();var e=t.target;p(e).hasClass(C)||(e=p(e).closest(O)),k._jQueryInterface.call(p(e),"toggle")}).on(N.FOCUS_BLUR_DATA_API,S,function(t){var e=p(t.target).closest(O)[0];p(e).toggleClass(T,/^focus(in)?$/.test(t.type))}),p.fn[_]=k._jQueryInterface,p.fn[_].Constructor=k,p.fn[_].noConflict=function(){return p.fn[_]=b,k._jQueryInterface};var L="carousel",x="bs.carousel",P="."+x,H=".data-api",j=p.fn[L],R={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0,touch:!0},F={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean",touch:"boolean"},M="next",W="prev",U="left",B="right",q={SLIDE:"slide"+P,SLID:"slid"+P,KEYDOWN:"keydown"+P,MOUSEENTER:"mouseenter"+P,MOUSELEAVE:"mouseleave"+P,TOUCHSTART:"touchstart"+P,TOUCHMOVE:"touchmove"+P,TOUCHEND:"touchend"+P,POINTERDOWN:"pointerdown"+P,POINTERUP:"pointerup"+P,DRAG_START:"dragstart"+P,LOAD_DATA_API:"load"+P+H,CLICK_DATA_API:"click"+P+H},K="carousel",Q="active",V="slide",Y="carousel-item-right",z="carousel-item-left",X="carousel-item-next",G="carousel-item-prev",$="pointer-event",J=".active",Z=".active.carousel-item",tt=".carousel-item",et=".carousel-item img",nt=".carousel-item-next, .carousel-item-prev",it=".carousel-indicators",ot="[data-slide], [data-slide-to]",rt='[data-ride="carousel"]',st={TOUCH:"touch",PEN:"pen"},at=function(){function r(t,e){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this.touchStartX=0,this.touchDeltaX=0,this._config=this._getConfig(e),this._element=t,this._indicatorsElement=this._element.querySelector(it),this._touchSupported="ontouchstart"in document.documentElement||0<navigator.maxTouchPoints,this._pointerEvent=Boolean(window.PointerEvent||window.MSPointerEvent),this._addEventListeners()}var t=r.prototype;return t.next=function(){this._isSliding||this._slide(M)},t.nextWhenVisible=function(){!document.hidden&&p(this._element).is(":visible")&&"hidden"!==p(this._element).css("visibility")&&this.next()},t.prev=function(){this._isSliding||this._slide(W)},t.pause=function(t){t||(this._isPaused=!0),this._element.querySelector(nt)&&(m.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},t.cycle=function(t){t||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},t.to=function(t){var e=this;this._activeElement=this._element.querySelector(Z);var n=this._getItemIndex(this._activeElement);if(!(t>this._items.length-1||t<0))if(this._isSliding)p(this._element).one(q.SLID,function(){return e.to(t)});else{if(n===t)return this.pause(),void this.cycle();var i=n<t?M:W;this._slide(i,this._items[t])}},t.dispose=function(){p(this._element).off(P),p.removeData(this._element,x),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},t._getConfig=function(t){return t=l({},R,t),m.typeCheckConfig(L,t,F),t},t._handleSwipe=function(){var t=Math.abs(this.touchDeltaX);if(!(t<=40)){var e=t/this.touchDeltaX;0<e&&this.prev(),e<0&&this.next()}},t._addEventListeners=function(){var e=this;this._config.keyboard&&p(this._element).on(q.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&p(this._element).on(q.MOUSEENTER,function(t){return e.pause(t)}).on(q.MOUSELEAVE,function(t){return e.cycle(t)}),this._config.touch&&this._addTouchEventListeners()},t._addTouchEventListeners=function(){var n=this;if(this._touchSupported){var e=function(t){n._pointerEvent&&st[t.originalEvent.pointerType.toUpperCase()]?n.touchStartX=t.originalEvent.clientX:n._pointerEvent||(n.touchStartX=t.originalEvent.touches[0].clientX)},i=function(t){n._pointerEvent&&st[t.originalEvent.pointerType.toUpperCase()]&&(n.touchDeltaX=t.originalEvent.clientX-n.touchStartX),n._handleSwipe(),"hover"===n._config.pause&&(n.pause(),n.touchTimeout&&clearTimeout(n.touchTimeout),n.touchTimeout=setTimeout(function(t){return n.cycle(t)},500+n._config.interval))};p(this._element.querySelectorAll(et)).on(q.DRAG_START,function(t){return t.preventDefault()}),this._pointerEvent?(p(this._element).on(q.POINTERDOWN,function(t){return e(t)}),p(this._element).on(q.POINTERUP,function(t){return i(t)}),this._element.classList.add($)):(p(this._element).on(q.TOUCHSTART,function(t){return e(t)}),p(this._element).on(q.TOUCHMOVE,function(t){var e;(e=t).originalEvent.touches&&1<e.originalEvent.touches.length?n.touchDeltaX=0:n.touchDeltaX=e.originalEvent.touches[0].clientX-n.touchStartX}),p(this._element).on(q.TOUCHEND,function(t){return i(t)}))}},t._keydown=function(t){if(!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},t._getItemIndex=function(t){return this._items=t&&t.parentNode?[].slice.call(t.parentNode.querySelectorAll(tt)):[],this._items.indexOf(t)},t._getItemByDirection=function(t,e){var n=t===M,i=t===W,o=this._getItemIndex(e),r=this._items.length-1;if((i&&0===o||n&&o===r)&&!this._config.wrap)return e;var s=(o+(t===W?-1:1))%this._items.length;return-1===s?this._items[this._items.length-1]:this._items[s]},t._triggerSlideEvent=function(t,e){var n=this._getItemIndex(t),i=this._getItemIndex(this._element.querySelector(Z)),o=p.Event(q.SLIDE,{relatedTarget:t,direction:e,from:i,to:n});return p(this._element).trigger(o),o},t._setActiveIndicatorElement=function(t){if(this._indicatorsElement){var e=[].slice.call(this._indicatorsElement.querySelectorAll(J));p(e).removeClass(Q);var n=this._indicatorsElement.children[this._getItemIndex(t)];n&&p(n).addClass(Q)}},t._slide=function(t,e){var n,i,o,r=this,s=this._element.querySelector(Z),a=this._getItemIndex(s),l=e||s&&this._getItemByDirection(t,s),c=this._getItemIndex(l),h=Boolean(this._interval);if(o=t===M?(n=z,i=X,U):(n=Y,i=G,B),l&&p(l).hasClass(Q))this._isSliding=!1;else if(!this._triggerSlideEvent(l,o).isDefaultPrevented()&&s&&l){this._isSliding=!0,h&&this.pause(),this._setActiveIndicatorElement(l);var u=p.Event(q.SLID,{relatedTarget:l,direction:o,from:a,to:c});if(p(this._element).hasClass(V)){p(l).addClass(i),m.reflow(l),p(s).addClass(n),p(l).addClass(n);var f=parseInt(l.getAttribute("data-interval"),10);this._config.interval=f?(this._config.defaultInterval=this._config.defaultInterval||this._config.interval,f):this._config.defaultInterval||this._config.interval;var d=m.getTransitionDurationFromElement(s);p(s).one(m.TRANSITION_END,function(){p(l).removeClass(n+" "+i).addClass(Q),p(s).removeClass(Q+" "+i+" "+n),r._isSliding=!1,setTimeout(function(){return p(r._element).trigger(u)},0)}).emulateTransitionEnd(d)}else p(s).removeClass(Q),p(l).addClass(Q),this._isSliding=!1,p(this._element).trigger(u);h&&this.cycle()}},r._jQueryInterface=function(i){return this.each(function(){var t=p(this).data(x),e=l({},R,p(this).data());"object"==typeof i&&(e=l({},e,i));var n="string"==typeof i?i:e.slide;if(t||(t=new r(this,e),p(this).data(x,t)),"number"==typeof i)t.to(i);else if("string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}else e.interval&&e.ride&&(t.pause(),t.cycle())})},r._dataApiClickHandler=function(t){var e=m.getSelectorFromElement(this);if(e){var n=p(e)[0];if(n&&p(n).hasClass(K)){var i=l({},p(n).data(),p(this).data()),o=this.getAttribute("data-slide-to");o&&(i.interval=!1),r._jQueryInterface.call(p(n),i),o&&p(n).data(x).to(o),t.preventDefault()}}},s(r,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"Default",get:function(){return R}}]),r}();p(document).on(q.CLICK_DATA_API,ot,at._dataApiClickHandler),p(window).on(q.LOAD_DATA_API,function(){for(var t=[].slice.call(document.querySelectorAll(rt)),e=0,n=t.length;e<n;e++){var i=p(t[e]);at._jQueryInterface.call(i,i.data())}}),p.fn[L]=at._jQueryInterface,p.fn[L].Constructor=at,p.fn[L].noConflict=function(){return p.fn[L]=j,at._jQueryInterface};var lt="collapse",ct="bs.collapse",ht="."+ct,ut=p.fn[lt],ft={toggle:!0,parent:""},dt={toggle:"boolean",parent:"(string|element)"},pt={SHOW:"show"+ht,SHOWN:"shown"+ht,HIDE:"hide"+ht,HIDDEN:"hidden"+ht,CLICK_DATA_API:"click"+ht+".data-api"},mt="show",gt="collapse",_t="collapsing",vt="collapsed",yt="width",Et="height",bt=".show, .collapsing",wt='[data-toggle="collapse"]',Ct=function(){function a(e,t){this._isTransitioning=!1,this._element=e,this._config=this._getConfig(t),this._triggerArray=[].slice.call(document.querySelectorAll('[data-toggle="collapse"][href="#'+e.id+'"],[data-toggle="collapse"][data-target="#'+e.id+'"]'));for(var n=[].slice.call(document.querySelectorAll(wt)),i=0,o=n.length;i<o;i++){var r=n[i],s=m.getSelectorFromElement(r),a=[].slice.call(document.querySelectorAll(s)).filter(function(t){return t===e});null!==s&&0<a.length&&(this._selector=s,this._triggerArray.push(r))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var t=a.prototype;return t.toggle=function(){p(this._element).hasClass(mt)?this.hide():this.show()},t.show=function(){var t,e,n=this;if(!this._isTransitioning&&!p(this._element).hasClass(mt)&&(this._parent&&0===(t=[].slice.call(this._parent.querySelectorAll(bt)).filter(function(t){return"string"==typeof n._config.parent?t.getAttribute("data-parent")===n._config.parent:t.classList.contains(gt)})).length&&(t=null),!(t&&(e=p(t).not(this._selector).data(ct))&&e._isTransitioning))){var i=p.Event(pt.SHOW);if(p(this._element).trigger(i),!i.isDefaultPrevented()){t&&(a._jQueryInterface.call(p(t).not(this._selector),"hide"),e||p(t).data(ct,null));var o=this._getDimension();p(this._element).removeClass(gt).addClass(_t),this._element.style[o]=0,this._triggerArray.length&&p(this._triggerArray).removeClass(vt).attr("aria-expanded",!0),this.setTransitioning(!0);var r="scroll"+(o[0].toUpperCase()+o.slice(1)),s=m.getTransitionDurationFromElement(this._element);p(this._element).one(m.TRANSITION_END,function(){p(n._element).removeClass(_t).addClass(gt).addClass(mt),n._element.style[o]="",n.setTransitioning(!1),p(n._element).trigger(pt.SHOWN)}).emulateTransitionEnd(s),this._element.style[o]=this._element[r]+"px"}}},t.hide=function(){var t=this;if(!this._isTransitioning&&p(this._element).hasClass(mt)){var e=p.Event(pt.HIDE);if(p(this._element).trigger(e),!e.isDefaultPrevented()){var n=this._getDimension();this._element.style[n]=this._element.getBoundingClientRect()[n]+"px",m.reflow(this._element),p(this._element).addClass(_t).removeClass(gt).removeClass(mt);var i=this._triggerArray.length;if(0<i)for(var o=0;o<i;o++){var r=this._triggerArray[o],s=m.getSelectorFromElement(r);if(null!==s)p([].slice.call(document.querySelectorAll(s))).hasClass(mt)||p(r).addClass(vt).attr("aria-expanded",!1)}this.setTransitioning(!0);this._element.style[n]="";var a=m.getTransitionDurationFromElement(this._element);p(this._element).one(m.TRANSITION_END,function(){t.setTransitioning(!1),p(t._element).removeClass(_t).addClass(gt).trigger(pt.HIDDEN)}).emulateTransitionEnd(a)}}},t.setTransitioning=function(t){this._isTransitioning=t},t.dispose=function(){p.removeData(this._element,ct),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},t._getConfig=function(t){return(t=l({},ft,t)).toggle=Boolean(t.toggle),m.typeCheckConfig(lt,t,dt),t},t._getDimension=function(){return p(this._element).hasClass(yt)?yt:Et},t._getParent=function(){var t,n=this;m.isElement(this._config.parent)?(t=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(t=this._config.parent[0])):t=document.querySelector(this._config.parent);var e='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]',i=[].slice.call(t.querySelectorAll(e));return p(i).each(function(t,e){n._addAriaAndCollapsedClass(a._getTargetFromElement(e),[e])}),t},t._addAriaAndCollapsedClass=function(t,e){var n=p(t).hasClass(mt);e.length&&p(e).toggleClass(vt,!n).attr("aria-expanded",n)},a._getTargetFromElement=function(t){var e=m.getSelectorFromElement(t);return e?document.querySelector(e):null},a._jQueryInterface=function(i){return this.each(function(){var t=p(this),e=t.data(ct),n=l({},ft,t.data(),"object"==typeof i&&i?i:{});if(!e&&n.toggle&&/show|hide/.test(i)&&(n.toggle=!1),e||(e=new a(this,n),t.data(ct,e)),"string"==typeof i){if("undefined"==typeof e[i])throw new TypeError('No method named "'+i+'"');e[i]()}})},s(a,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"Default",get:function(){return ft}}]),a}();p(document).on(pt.CLICK_DATA_API,wt,function(t){"A"===t.currentTarget.tagName&&t.preventDefault();var n=p(this),e=m.getSelectorFromElement(this),i=[].slice.call(document.querySelectorAll(e));p(i).each(function(){var t=p(this),e=t.data(ct)?"toggle":n.data();Ct._jQueryInterface.call(t,e)})}),p.fn[lt]=Ct._jQueryInterface,p.fn[lt].Constructor=Ct,p.fn[lt].noConflict=function(){return p.fn[lt]=ut,Ct._jQueryInterface};for(var Tt="undefined"!=typeof window&&"undefined"!=typeof document,St=["Edge","Trident","Firefox"],Dt=0,It=0;It<St.length;It+=1)if(Tt&&0<=navigator.userAgent.indexOf(St[It])){Dt=1;break}var At=Tt&&window.Promise?function(t){var e=!1;return function(){e||(e=!0,window.Promise.resolve().then(function(){e=!1,t()}))}}:function(t){var e=!1;return function(){e||(e=!0,setTimeout(function(){e=!1,t()},Dt))}};function Ot(t){return t&&"[object Function]"==={}.toString.call(t)}function Nt(t,e){if(1!==t.nodeType)return[];var n=t.ownerDocument.defaultView.getComputedStyle(t,null);return e?n[e]:n}function kt(t){return"HTML"===t.nodeName?t:t.parentNode||t.host}function Lt(t){if(!t)return document.body;switch(t.nodeName){case"HTML":case"BODY":return t.ownerDocument.body;case"#document":return t.body}var e=Nt(t),n=e.overflow,i=e.overflowX,o=e.overflowY;return/(auto|scroll|overlay)/.test(n+o+i)?t:Lt(kt(t))}var xt=Tt&&!(!window.MSInputMethodContext||!document.documentMode),Pt=Tt&&/MSIE 10/.test(navigator.userAgent);function Ht(t){return 11===t?xt:10===t?Pt:xt||Pt}function jt(t){if(!t)return document.documentElement;for(var e=Ht(10)?document.body:null,n=t.offsetParent||null;n===e&&t.nextElementSibling;)n=(t=t.nextElementSibling).offsetParent;var i=n&&n.nodeName;return i&&"BODY"!==i&&"HTML"!==i?-1!==["TH","TD","TABLE"].indexOf(n.nodeName)&&"static"===Nt(n,"position")?jt(n):n:t?t.ownerDocument.documentElement:document.documentElement}function Rt(t){return null!==t.parentNode?Rt(t.parentNode):t}function Ft(t,e){if(!(t&&t.nodeType&&e&&e.nodeType))return document.documentElement;var n=t.compareDocumentPosition(e)&Node.DOCUMENT_POSITION_FOLLOWING,i=n?t:e,o=n?e:t,r=document.createRange();r.setStart(i,0),r.setEnd(o,0);var s,a,l=r.commonAncestorContainer;if(t!==l&&e!==l||i.contains(o))return"BODY"===(a=(s=l).nodeName)||"HTML"!==a&&jt(s.firstElementChild)!==s?jt(l):l;var c=Rt(t);return c.host?Ft(c.host,e):Ft(t,Rt(e).host)}function Mt(t){var e="top"===(1<arguments.length&&void 0!==arguments[1]?arguments[1]:"top")?"scrollTop":"scrollLeft",n=t.nodeName;if("BODY"!==n&&"HTML"!==n)return t[e];var i=t.ownerDocument.documentElement;return(t.ownerDocument.scrollingElement||i)[e]}function Wt(t,e){var n="x"===e?"Left":"Top",i="Left"===n?"Right":"Bottom";return parseFloat(t["border"+n+"Width"],10)+parseFloat(t["border"+i+"Width"],10)}function Ut(t,e,n,i){return Math.max(e["offset"+t],e["scroll"+t],n["client"+t],n["offset"+t],n["scroll"+t],Ht(10)?parseInt(n["offset"+t])+parseInt(i["margin"+("Height"===t?"Top":"Left")])+parseInt(i["margin"+("Height"===t?"Bottom":"Right")]):0)}function Bt(t){var e=t.body,n=t.documentElement,i=Ht(10)&&getComputedStyle(n);return{height:Ut("Height",e,n,i),width:Ut("Width",e,n,i)}}var qt=function(){function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}return function(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}}(),Kt=function(t,e,n){return e in t?Object.defineProperty(t,e,{value:n,enumerable:!0,configurable:!0,writable:!0}):t[e]=n,t},Qt=Object.assign||function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t};function Vt(t){return Qt({},t,{right:t.left+t.width,bottom:t.top+t.height})}function Yt(t){var e={};try{if(Ht(10)){e=t.getBoundingClientRect();var n=Mt(t,"top"),i=Mt(t,"left");e.top+=n,e.left+=i,e.bottom+=n,e.right+=i}else e=t.getBoundingClientRect()}catch(t){}var o={left:e.left,top:e.top,width:e.right-e.left,height:e.bottom-e.top},r="HTML"===t.nodeName?Bt(t.ownerDocument):{},s=r.width||t.clientWidth||o.right-o.left,a=r.height||t.clientHeight||o.bottom-o.top,l=t.offsetWidth-s,c=t.offsetHeight-a;if(l||c){var h=Nt(t);l-=Wt(h,"x"),c-=Wt(h,"y"),o.width-=l,o.height-=c}return Vt(o)}function zt(t,e){var n=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=Ht(10),o="HTML"===e.nodeName,r=Yt(t),s=Yt(e),a=Lt(t),l=Nt(e),c=parseFloat(l.borderTopWidth,10),h=parseFloat(l.borderLeftWidth,10);n&&o&&(s.top=Math.max(s.top,0),s.left=Math.max(s.left,0));var u=Vt({top:r.top-s.top-c,left:r.left-s.left-h,width:r.width,height:r.height});if(u.marginTop=0,u.marginLeft=0,!i&&o){var f=parseFloat(l.marginTop,10),d=parseFloat(l.marginLeft,10);u.top-=c-f,u.bottom-=c-f,u.left-=h-d,u.right-=h-d,u.marginTop=f,u.marginLeft=d}return(i&&!n?e.contains(a):e===a&&"BODY"!==a.nodeName)&&(u=function(t,e){var n=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=Mt(e,"top"),o=Mt(e,"left"),r=n?-1:1;return t.top+=i*r,t.bottom+=i*r,t.left+=o*r,t.right+=o*r,t}(u,e)),u}function Xt(t){if(!t||!t.parentElement||Ht())return document.documentElement;for(var e=t.parentElement;e&&"none"===Nt(e,"transform");)e=e.parentElement;return e||document.documentElement}function Gt(t,e,n,i){var o=4<arguments.length&&void 0!==arguments[4]&&arguments[4],r={top:0,left:0},s=o?Xt(t):Ft(t,e);if("viewport"===i)r=function(t){var e=1<arguments.length&&void 0!==arguments[1]&&arguments[1],n=t.ownerDocument.documentElement,i=zt(t,n),o=Math.max(n.clientWidth,window.innerWidth||0),r=Math.max(n.clientHeight,window.innerHeight||0),s=e?0:Mt(n),a=e?0:Mt(n,"left");return Vt({top:s-i.top+i.marginTop,left:a-i.left+i.marginLeft,width:o,height:r})}(s,o);else{var a=void 0;"scrollParent"===i?"BODY"===(a=Lt(kt(e))).nodeName&&(a=t.ownerDocument.documentElement):a="window"===i?t.ownerDocument.documentElement:i;var l=zt(a,s,o);if("HTML"!==a.nodeName||function t(e){var n=e.nodeName;if("BODY"===n||"HTML"===n)return!1;if("fixed"===Nt(e,"position"))return!0;var i=kt(e);return!!i&&t(i)}(s))r=l;else{var c=Bt(t.ownerDocument),h=c.height,u=c.width;r.top+=l.top-l.marginTop,r.bottom=h+l.top,r.left+=l.left-l.marginLeft,r.right=u+l.left}}var f="number"==typeof(n=n||0);return r.left+=f?n:n.left||0,r.top+=f?n:n.top||0,r.right-=f?n:n.right||0,r.bottom-=f?n:n.bottom||0,r}function $t(t,e,i,n,o){var r=5<arguments.length&&void 0!==arguments[5]?arguments[5]:0;if(-1===t.indexOf("auto"))return t;var s=Gt(i,n,r,o),a={top:{width:s.width,height:e.top-s.top},right:{width:s.right-e.right,height:s.height},bottom:{width:s.width,height:s.bottom-e.bottom},left:{width:e.left-s.left,height:s.height}},l=Object.keys(a).map(function(t){return Qt({key:t},a[t],{area:(e=a[t],e.width*e.height)});var e}).sort(function(t,e){return e.area-t.area}),c=l.filter(function(t){var e=t.width,n=t.height;return e>=i.clientWidth&&n>=i.clientHeight}),h=0<c.length?c[0].key:l[0].key,u=t.split("-")[1];return h+(u?"-"+u:"")}function Jt(t,e,n){var i=3<arguments.length&&void 0!==arguments[3]?arguments[3]:null;return zt(n,i?Xt(e):Ft(e,n),i)}function Zt(t){var e=t.ownerDocument.defaultView.getComputedStyle(t),n=parseFloat(e.marginTop||0)+parseFloat(e.marginBottom||0),i=parseFloat(e.marginLeft||0)+parseFloat(e.marginRight||0);return{width:t.offsetWidth+i,height:t.offsetHeight+n}}function te(t){var e={left:"right",right:"left",bottom:"top",top:"bottom"};return t.replace(/left|right|bottom|top/g,function(t){return e[t]})}function ee(t,e,n){n=n.split("-")[0];var i=Zt(t),o={width:i.width,height:i.height},r=-1!==["right","left"].indexOf(n),s=r?"top":"left",a=r?"left":"top",l=r?"height":"width",c=r?"width":"height";return o[s]=e[s]+e[l]/2-i[l]/2,o[a]=n===a?e[a]-i[c]:e[te(a)],o}function ne(t,e){return Array.prototype.find?t.find(e):t.filter(e)[0]}function ie(t,n,e){return(void 0===e?t:t.slice(0,function(t,e,n){if(Array.prototype.findIndex)return t.findIndex(function(t){return t[e]===n});var i=ne(t,function(t){return t[e]===n});return t.indexOf(i)}(t,"name",e))).forEach(function(t){t.function&&console.warn("`modifier.function` is deprecated, use `modifier.fn`!");var e=t.function||t.fn;t.enabled&&Ot(e)&&(n.offsets.popper=Vt(n.offsets.popper),n.offsets.reference=Vt(n.offsets.reference),n=e(n,t))}),n}function oe(t,n){return t.some(function(t){var e=t.name;return t.enabled&&e===n})}function re(t){for(var e=[!1,"ms","Webkit","Moz","O"],n=t.charAt(0).toUpperCase()+t.slice(1),i=0;i<e.length;i++){var o=e[i],r=o?""+o+n:t;if("undefined"!=typeof document.body.style[r])return r}return null}function se(t){var e=t.ownerDocument;return e?e.defaultView:window}function ae(t,e,n,i){n.updateBound=i,se(t).addEventListener("resize",n.updateBound,{passive:!0});var o=Lt(t);return function t(e,n,i,o){var r="BODY"===e.nodeName,s=r?e.ownerDocument.defaultView:e;s.addEventListener(n,i,{passive:!0}),r||t(Lt(s.parentNode),n,i,o),o.push(s)}(o,"scroll",n.updateBound,n.scrollParents),n.scrollElement=o,n.eventsEnabled=!0,n}function le(){var t,e;this.state.eventsEnabled&&(cancelAnimationFrame(this.scheduleUpdate),this.state=(t=this.reference,e=this.state,se(t).removeEventListener("resize",e.updateBound),e.scrollParents.forEach(function(t){t.removeEventListener("scroll",e.updateBound)}),e.updateBound=null,e.scrollParents=[],e.scrollElement=null,e.eventsEnabled=!1,e))}function ce(t){return""!==t&&!isNaN(parseFloat(t))&&isFinite(t)}function he(n,i){Object.keys(i).forEach(function(t){var e="";-1!==["width","height","top","right","bottom","left"].indexOf(t)&&ce(i[t])&&(e="px"),n.style[t]=i[t]+e})}var ue=Tt&&/Firefox/i.test(navigator.userAgent);function fe(t,e,n){var i=ne(t,function(t){return t.name===e}),o=!!i&&t.some(function(t){return t.name===n&&t.enabled&&t.order<i.order});if(!o){var r="`"+e+"`",s="`"+n+"`";console.warn(s+" modifier is required by "+r+" modifier in order to work, be sure to include it before "+r+"!")}return o}var de=["auto-start","auto","auto-end","top-start","top","top-end","right-start","right","right-end","bottom-end","bottom","bottom-start","left-end","left","left-start"],pe=de.slice(3);function me(t){var e=1<arguments.length&&void 0!==arguments[1]&&arguments[1],n=pe.indexOf(t),i=pe.slice(n+1).concat(pe.slice(0,n));return e?i.reverse():i}var ge="flip",_e="clockwise",ve="counterclockwise";function ye(t,o,r,e){var s=[0,0],a=-1!==["right","left"].indexOf(e),n=t.split(/(\+|\-)/).map(function(t){return t.trim()}),i=n.indexOf(ne(n,function(t){return-1!==t.search(/,|\s/)}));n[i]&&-1===n[i].indexOf(",")&&console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");var l=/\s*,\s*|\s+/,c=-1!==i?[n.slice(0,i).concat([n[i].split(l)[0]]),[n[i].split(l)[1]].concat(n.slice(i+1))]:[n];return(c=c.map(function(t,e){var n=(1===e?!a:a)?"height":"width",i=!1;return t.reduce(function(t,e){return""===t[t.length-1]&&-1!==["+","-"].indexOf(e)?(t[t.length-1]=e,i=!0,t):i?(t[t.length-1]+=e,i=!1,t):t.concat(e)},[]).map(function(t){return function(t,e,n,i){var o=t.match(/((?:\-|\+)?\d*\.?\d*)(.*)/),r=+o[1],s=o[2];if(!r)return t;if(0!==s.indexOf("%"))return"vh"!==s&&"vw"!==s?r:("vh"===s?Math.max(document.documentElement.clientHeight,window.innerHeight||0):Math.max(document.documentElement.clientWidth,window.innerWidth||0))/100*r;var a=void 0;switch(s){case"%p":a=n;break;case"%":case"%r":default:a=i}return Vt(a)[e]/100*r}(t,n,o,r)})})).forEach(function(n,i){n.forEach(function(t,e){ce(t)&&(s[i]+=t*("-"===n[e-1]?-1:1))})}),s}var Ee={placement:"bottom",positionFixed:!1,eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(t){var e=t.placement,n=e.split("-")[0],i=e.split("-")[1];if(i){var o=t.offsets,r=o.reference,s=o.popper,a=-1!==["bottom","top"].indexOf(n),l=a?"left":"top",c=a?"width":"height",h={start:Kt({},l,r[l]),end:Kt({},l,r[l]+r[c]-s[c])};t.offsets.popper=Qt({},s,h[i])}return t}},offset:{order:200,enabled:!0,fn:function(t,e){var n=e.offset,i=t.placement,o=t.offsets,r=o.popper,s=o.reference,a=i.split("-")[0],l=void 0;return l=ce(+n)?[+n,0]:ye(n,r,s,a),"left"===a?(r.top+=l[0],r.left-=l[1]):"right"===a?(r.top+=l[0],r.left+=l[1]):"top"===a?(r.left+=l[0],r.top-=l[1]):"bottom"===a&&(r.left+=l[0],r.top+=l[1]),t.popper=r,t},offset:0},preventOverflow:{order:300,enabled:!0,fn:function(t,i){var e=i.boundariesElement||jt(t.instance.popper);t.instance.reference===e&&(e=jt(e));var n=re("transform"),o=t.instance.popper.style,r=o.top,s=o.left,a=o[n];o.top="",o.left="",o[n]="";var l=Gt(t.instance.popper,t.instance.reference,i.padding,e,t.positionFixed);o.top=r,o.left=s,o[n]=a,i.boundaries=l;var c=i.priority,h=t.offsets.popper,u={primary:function(t){var e=h[t];return h[t]<l[t]&&!i.escapeWithReference&&(e=Math.max(h[t],l[t])),Kt({},t,e)},secondary:function(t){var e="right"===t?"left":"top",n=h[e];return h[t]>l[t]&&!i.escapeWithReference&&(n=Math.min(h[e],l[t]-("right"===t?h.width:h.height))),Kt({},e,n)}};return c.forEach(function(t){var e=-1!==["left","top"].indexOf(t)?"primary":"secondary";h=Qt({},h,u[e](t))}),t.offsets.popper=h,t},priority:["left","right","top","bottom"],padding:5,boundariesElement:"scrollParent"},keepTogether:{order:400,enabled:!0,fn:function(t){var e=t.offsets,n=e.popper,i=e.reference,o=t.placement.split("-")[0],r=Math.floor,s=-1!==["top","bottom"].indexOf(o),a=s?"right":"bottom",l=s?"left":"top",c=s?"width":"height";return n[a]<r(i[l])&&(t.offsets.popper[l]=r(i[l])-n[c]),n[l]>r(i[a])&&(t.offsets.popper[l]=r(i[a])),t}},arrow:{order:500,enabled:!0,fn:function(t,e){var n;if(!fe(t.instance.modifiers,"arrow","keepTogether"))return t;var i=e.element;if("string"==typeof i){if(!(i=t.instance.popper.querySelector(i)))return t}else if(!t.instance.popper.contains(i))return console.warn("WARNING: `arrow.element` must be child of its popper element!"),t;var o=t.placement.split("-")[0],r=t.offsets,s=r.popper,a=r.reference,l=-1!==["left","right"].indexOf(o),c=l?"height":"width",h=l?"Top":"Left",u=h.toLowerCase(),f=l?"left":"top",d=l?"bottom":"right",p=Zt(i)[c];a[d]-p<s[u]&&(t.offsets.popper[u]-=s[u]-(a[d]-p)),a[u]+p>s[d]&&(t.offsets.popper[u]+=a[u]+p-s[d]),t.offsets.popper=Vt(t.offsets.popper);var m=a[u]+a[c]/2-p/2,g=Nt(t.instance.popper),_=parseFloat(g["margin"+h],10),v=parseFloat(g["border"+h+"Width"],10),y=m-t.offsets.popper[u]-_-v;return y=Math.max(Math.min(s[c]-p,y),0),t.arrowElement=i,t.offsets.arrow=(Kt(n={},u,Math.round(y)),Kt(n,f,""),n),t},element:"[x-arrow]"},flip:{order:600,enabled:!0,fn:function(p,m){if(oe(p.instance.modifiers,"inner"))return p;if(p.flipped&&p.placement===p.originalPlacement)return p;var g=Gt(p.instance.popper,p.instance.reference,m.padding,m.boundariesElement,p.positionFixed),_=p.placement.split("-")[0],v=te(_),y=p.placement.split("-")[1]||"",E=[];switch(m.behavior){case ge:E=[_,v];break;case _e:E=me(_);break;case ve:E=me(_,!0);break;default:E=m.behavior}return E.forEach(function(t,e){if(_!==t||E.length===e+1)return p;_=p.placement.split("-")[0],v=te(_);var n,i=p.offsets.popper,o=p.offsets.reference,r=Math.floor,s="left"===_&&r(i.right)>r(o.left)||"right"===_&&r(i.left)<r(o.right)||"top"===_&&r(i.bottom)>r(o.top)||"bottom"===_&&r(i.top)<r(o.bottom),a=r(i.left)<r(g.left),l=r(i.right)>r(g.right),c=r(i.top)<r(g.top),h=r(i.bottom)>r(g.bottom),u="left"===_&&a||"right"===_&&l||"top"===_&&c||"bottom"===_&&h,f=-1!==["top","bottom"].indexOf(_),d=!!m.flipVariations&&(f&&"start"===y&&a||f&&"end"===y&&l||!f&&"start"===y&&c||!f&&"end"===y&&h);(s||u||d)&&(p.flipped=!0,(s||u)&&(_=E[e+1]),d&&(y="end"===(n=y)?"start":"start"===n?"end":n),p.placement=_+(y?"-"+y:""),p.offsets.popper=Qt({},p.offsets.popper,ee(p.instance.popper,p.offsets.reference,p.placement)),p=ie(p.instance.modifiers,p,"flip"))}),p},behavior:"flip",padding:5,boundariesElement:"viewport"},inner:{order:700,enabled:!1,fn:function(t){var e=t.placement,n=e.split("-")[0],i=t.offsets,o=i.popper,r=i.reference,s=-1!==["left","right"].indexOf(n),a=-1===["top","left"].indexOf(n);return o[s?"left":"top"]=r[n]-(a?o[s?"width":"height"]:0),t.placement=te(e),t.offsets.popper=Vt(o),t}},hide:{order:800,enabled:!0,fn:function(t){if(!fe(t.instance.modifiers,"hide","preventOverflow"))return t;var e=t.offsets.reference,n=ne(t.instance.modifiers,function(t){return"preventOverflow"===t.name}).boundaries;if(e.bottom<n.top||e.left>n.right||e.top>n.bottom||e.right<n.left){if(!0===t.hide)return t;t.hide=!0,t.attributes["x-out-of-boundaries"]=""}else{if(!1===t.hide)return t;t.hide=!1,t.attributes["x-out-of-boundaries"]=!1}return t}},computeStyle:{order:850,enabled:!0,fn:function(t,e){var n=e.x,i=e.y,o=t.offsets.popper,r=ne(t.instance.modifiers,function(t){return"applyStyle"===t.name}).gpuAcceleration;void 0!==r&&console.warn("WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!");var s,a,l,c,h,u,f,d,p,m,g,_,v,y,E=void 0!==r?r:e.gpuAcceleration,b=jt(t.instance.popper),w=Yt(b),C={position:o.position},T=(s=t,a=window.devicePixelRatio<2||!ue,l=s.offsets,c=l.popper,h=l.reference,u=Math.round,f=Math.floor,d=function(t){return t},p=u(h.width),m=u(c.width),g=-1!==["left","right"].indexOf(s.placement),_=-1!==s.placement.indexOf("-"),y=a?u:d,{left:(v=a?g||_||p%2==m%2?u:f:d)(p%2==1&&m%2==1&&!_&&a?c.left-1:c.left),top:y(c.top),bottom:y(c.bottom),right:v(c.right)}),S="bottom"===n?"top":"bottom",D="right"===i?"left":"right",I=re("transform"),A=void 0,O=void 0;if(O="bottom"===S?"HTML"===b.nodeName?-b.clientHeight+T.bottom:-w.height+T.bottom:T.top,A="right"===D?"HTML"===b.nodeName?-b.clientWidth+T.right:-w.width+T.right:T.left,E&&I)C[I]="translate3d("+A+"px, "+O+"px, 0)",C[S]=0,C[D]=0,C.willChange="transform";else{var N="bottom"===S?-1:1,k="right"===D?-1:1;C[S]=O*N,C[D]=A*k,C.willChange=S+", "+D}var L={"x-placement":t.placement};return t.attributes=Qt({},L,t.attributes),t.styles=Qt({},C,t.styles),t.arrowStyles=Qt({},t.offsets.arrow,t.arrowStyles),t},gpuAcceleration:!0,x:"bottom",y:"right"},applyStyle:{order:900,enabled:!0,fn:function(t){var e,n;return he(t.instance.popper,t.styles),e=t.instance.popper,n=t.attributes,Object.keys(n).forEach(function(t){!1!==n[t]?e.setAttribute(t,n[t]):e.removeAttribute(t)}),t.arrowElement&&Object.keys(t.arrowStyles).length&&he(t.arrowElement,t.arrowStyles),t},onLoad:function(t,e,n,i,o){var r=Jt(o,e,t,n.positionFixed),s=$t(n.placement,r,e,t,n.modifiers.flip.boundariesElement,n.modifiers.flip.padding);return e.setAttribute("x-placement",s),he(e,{position:n.positionFixed?"fixed":"absolute"}),n},gpuAcceleration:void 0}}},be=function(){function r(t,e){var n=this,i=2<arguments.length&&void 0!==arguments[2]?arguments[2]:{};!function(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}(this,r),this.scheduleUpdate=function(){return requestAnimationFrame(n.update)},this.update=At(this.update.bind(this)),this.options=Qt({},r.Defaults,i),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=t&&t.jquery?t[0]:t,this.popper=e&&e.jquery?e[0]:e,this.options.modifiers={},Object.keys(Qt({},r.Defaults.modifiers,i.modifiers)).forEach(function(t){n.options.modifiers[t]=Qt({},r.Defaults.modifiers[t]||{},i.modifiers?i.modifiers[t]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(t){return Qt({name:t},n.options.modifiers[t])}).sort(function(t,e){return t.order-e.order}),this.modifiers.forEach(function(t){t.enabled&&Ot(t.onLoad)&&t.onLoad(n.reference,n.popper,n.options,t,n.state)}),this.update();var o=this.options.eventsEnabled;o&&this.enableEventListeners(),this.state.eventsEnabled=o}return qt(r,[{key:"update",value:function(){return function(){if(!this.state.isDestroyed){var t={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};t.offsets.reference=Jt(this.state,this.popper,this.reference,this.options.positionFixed),t.placement=$t(this.options.placement,t.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),t.originalPlacement=t.placement,t.positionFixed=this.options.positionFixed,t.offsets.popper=ee(this.popper,t.offsets.reference,t.placement),t.offsets.popper.position=this.options.positionFixed?"fixed":"absolute",t=ie(this.modifiers,t),this.state.isCreated?this.options.onUpdate(t):(this.state.isCreated=!0,this.options.onCreate(t))}}.call(this)}},{key:"destroy",value:function(){return function(){return this.state.isDestroyed=!0,oe(this.modifiers,"applyStyle")&&(this.popper.removeAttribute("x-placement"),this.popper.style.position="",this.popper.style.top="",this.popper.style.left="",this.popper.style.right="",this.popper.style.bottom="",this.popper.style.willChange="",this.popper.style[re("transform")]=""),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}.call(this)}},{key:"enableEventListeners",value:function(){return function(){this.state.eventsEnabled||(this.state=ae(this.reference,this.options,this.state,this.scheduleUpdate))}.call(this)}},{key:"disableEventListeners",value:function(){return le.call(this)}}]),r}();be.Utils=("undefined"!=typeof window?window:global).PopperUtils,be.placements=de,be.Defaults=Ee;var we="dropdown",Ce="bs.dropdown",Te="."+Ce,Se=".data-api",De=p.fn[we],Ie=new RegExp("38|40|27"),Ae={HIDE:"hide"+Te,HIDDEN:"hidden"+Te,SHOW:"show"+Te,SHOWN:"shown"+Te,CLICK:"click"+Te,CLICK_DATA_API:"click"+Te+Se,KEYDOWN_DATA_API:"keydown"+Te+Se,KEYUP_DATA_API:"keyup"+Te+Se},Oe="disabled",Ne="show",ke="dropup",Le="dropright",xe="dropleft",Pe="dropdown-menu-right",He="position-static",je='[data-toggle="dropdown"]',Re=".dropdown form",Fe=".dropdown-menu",Me=".navbar-nav",We=".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",Ue="top-start",Be="top-end",qe="bottom-start",Ke="bottom-end",Qe="right-start",Ve="left-start",Ye={offset:0,flip:!0,boundary:"scrollParent",reference:"toggle",display:"dynamic"},ze={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)",reference:"(string|element)",display:"string"},Xe=function(){function c(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var t=c.prototype;return t.toggle=function(){if(!this._element.disabled&&!p(this._element).hasClass(Oe)){var t=c._getParentFromElement(this._element),e=p(this._menu).hasClass(Ne);if(c._clearMenus(),!e){var n={relatedTarget:this._element},i=p.Event(Ae.SHOW,n);if(p(t).trigger(i),!i.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof be)throw new TypeError("Bootstrap's dropdowns require Popper.js (https://popper.js.org/)");var o=this._element;"parent"===this._config.reference?o=t:m.isElement(this._config.reference)&&(o=this._config.reference,"undefined"!=typeof this._config.reference.jquery&&(o=this._config.reference[0])),"scrollParent"!==this._config.boundary&&p(t).addClass(He),this._popper=new be(o,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===p(t).closest(Me).length&&p(document.body).children().on("mouseover",null,p.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),p(this._menu).toggleClass(Ne),p(t).toggleClass(Ne).trigger(p.Event(Ae.SHOWN,n))}}}},t.show=function(){if(!(this._element.disabled||p(this._element).hasClass(Oe)||p(this._menu).hasClass(Ne))){var t={relatedTarget:this._element},e=p.Event(Ae.SHOW,t),n=c._getParentFromElement(this._element);p(n).trigger(e),e.isDefaultPrevented()||(p(this._menu).toggleClass(Ne),p(n).toggleClass(Ne).trigger(p.Event(Ae.SHOWN,t)))}},t.hide=function(){if(!this._element.disabled&&!p(this._element).hasClass(Oe)&&p(this._menu).hasClass(Ne)){var t={relatedTarget:this._element},e=p.Event(Ae.HIDE,t),n=c._getParentFromElement(this._element);p(n).trigger(e),e.isDefaultPrevented()||(p(this._menu).toggleClass(Ne),p(n).toggleClass(Ne).trigger(p.Event(Ae.HIDDEN,t)))}},t.dispose=function(){p.removeData(this._element,Ce),p(this._element).off(Te),this._element=null,(this._menu=null)!==this._popper&&(this._popper.destroy(),this._popper=null)},t.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},t._addEventListeners=function(){var e=this;p(this._element).on(Ae.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},t._getConfig=function(t){return t=l({},this.constructor.Default,p(this._element).data(),t),m.typeCheckConfig(we,t,this.constructor.DefaultType),t},t._getMenuElement=function(){if(!this._menu){var t=c._getParentFromElement(this._element);t&&(this._menu=t.querySelector(Fe))}return this._menu},t._getPlacement=function(){var t=p(this._element.parentNode),e=qe;return t.hasClass(ke)?(e=Ue,p(this._menu).hasClass(Pe)&&(e=Be)):t.hasClass(Le)?e=Qe:t.hasClass(xe)?e=Ve:p(this._menu).hasClass(Pe)&&(e=Ke),e},t._detectNavbar=function(){return 0<p(this._element).closest(".navbar").length},t._getOffset=function(){var e=this,t={};return"function"==typeof this._config.offset?t.fn=function(t){return t.offsets=l({},t.offsets,e._config.offset(t.offsets,e._element)||{}),t}:t.offset=this._config.offset,t},t._getPopperConfig=function(){var t={placement:this._getPlacement(),modifiers:{offset:this._getOffset(),flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}};return"static"===this._config.display&&(t.modifiers.applyStyle={enabled:!1}),t},c._jQueryInterface=function(e){return this.each(function(){var t=p(this).data(Ce);if(t||(t=new c(this,"object"==typeof e?e:null),p(this).data(Ce,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},c._clearMenus=function(t){if(!t||3!==t.which&&("keyup"!==t.type||9===t.which))for(var e=[].slice.call(document.querySelectorAll(je)),n=0,i=e.length;n<i;n++){var o=c._getParentFromElement(e[n]),r=p(e[n]).data(Ce),s={relatedTarget:e[n]};if(t&&"click"===t.type&&(s.clickEvent=t),r){var a=r._menu;if(p(o).hasClass(Ne)&&!(t&&("click"===t.type&&/input|textarea/i.test(t.target.tagName)||"keyup"===t.type&&9===t.which)&&p.contains(o,t.target))){var l=p.Event(Ae.HIDE,s);p(o).trigger(l),l.isDefaultPrevented()||("ontouchstart"in document.documentElement&&p(document.body).children().off("mouseover",null,p.noop),e[n].setAttribute("aria-expanded","false"),p(a).removeClass(Ne),p(o).removeClass(Ne).trigger(p.Event(Ae.HIDDEN,s)))}}}},c._getParentFromElement=function(t){var e,n=m.getSelectorFromElement(t);return n&&(e=document.querySelector(n)),e||t.parentNode},c._dataApiKeydownHandler=function(t){if((/input|textarea/i.test(t.target.tagName)?!(32===t.which||27!==t.which&&(40!==t.which&&38!==t.which||p(t.target).closest(Fe).length)):Ie.test(t.which))&&(t.preventDefault(),t.stopPropagation(),!this.disabled&&!p(this).hasClass(Oe))){var e=c._getParentFromElement(this),n=p(e).hasClass(Ne);if(n&&(!n||27!==t.which&&32!==t.which)){var i=[].slice.call(e.querySelectorAll(We));if(0!==i.length){var o=i.indexOf(t.target);38===t.which&&0<o&&o--,40===t.which&&o<i.length-1&&o++,o<0&&(o=0),i[o].focus()}}else{if(27===t.which){var r=e.querySelector(je);p(r).trigger("focus")}p(this).trigger("click")}}},s(c,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"Default",get:function(){return Ye}},{key:"DefaultType",get:function(){return ze}}]),c}();p(document).on(Ae.KEYDOWN_DATA_API,je,Xe._dataApiKeydownHandler).on(Ae.KEYDOWN_DATA_API,Fe,Xe._dataApiKeydownHandler).on(Ae.CLICK_DATA_API+" "+Ae.KEYUP_DATA_API,Xe._clearMenus).on(Ae.CLICK_DATA_API,je,function(t){t.preventDefault(),t.stopPropagation(),Xe._jQueryInterface.call(p(this),"toggle")}).on(Ae.CLICK_DATA_API,Re,function(t){t.stopPropagation()}),p.fn[we]=Xe._jQueryInterface,p.fn[we].Constructor=Xe,p.fn[we].noConflict=function(){return p.fn[we]=De,Xe._jQueryInterface};var Ge="modal",$e="bs.modal",Je="."+$e,Ze=p.fn[Ge],tn={backdrop:!0,keyboard:!0,focus:!0,show:!0},en={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},nn={HIDE:"hide"+Je,HIDDEN:"hidden"+Je,SHOW:"show"+Je,SHOWN:"shown"+Je,FOCUSIN:"focusin"+Je,RESIZE:"resize"+Je,CLICK_DISMISS:"click.dismiss"+Je,KEYDOWN_DISMISS:"keydown.dismiss"+Je,MOUSEUP_DISMISS:"mouseup.dismiss"+Je,MOUSEDOWN_DISMISS:"mousedown.dismiss"+Je,CLICK_DATA_API:"click"+Je+".data-api"},on="modal-dialog-scrollable",rn="modal-scrollbar-measure",sn="modal-backdrop",an="modal-open",ln="fade",cn="show",hn=".modal-dialog",un=".modal-body",fn='[data-toggle="modal"]',dn='[data-dismiss="modal"]',pn=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",mn=".sticky-top",gn=function(){function o(t,e){this._config=this._getConfig(e),this._element=t,this._dialog=t.querySelector(hn),this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._isTransitioning=!1,this._scrollbarWidth=0}var t=o.prototype;return t.toggle=function(t){return this._isShown?this.hide():this.show(t)},t.show=function(t){var e=this;if(!this._isShown&&!this._isTransitioning){p(this._element).hasClass(ln)&&(this._isTransitioning=!0);var n=p.Event(nn.SHOW,{relatedTarget:t});p(this._element).trigger(n),this._isShown||n.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),this._setEscapeEvent(),this._setResizeEvent(),p(this._element).on(nn.CLICK_DISMISS,dn,function(t){return e.hide(t)}),p(this._dialog).on(nn.MOUSEDOWN_DISMISS,function(){p(e._element).one(nn.MOUSEUP_DISMISS,function(t){p(t.target).is(e._element)&&(e._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return e._showElement(t)}))}},t.hide=function(t){var e=this;if(t&&t.preventDefault(),this._isShown&&!this._isTransitioning){var n=p.Event(nn.HIDE);if(p(this._element).trigger(n),this._isShown&&!n.isDefaultPrevented()){this._isShown=!1;var i=p(this._element).hasClass(ln);if(i&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),p(document).off(nn.FOCUSIN),p(this._element).removeClass(cn),p(this._element).off(nn.CLICK_DISMISS),p(this._dialog).off(nn.MOUSEDOWN_DISMISS),i){var o=m.getTransitionDurationFromElement(this._element);p(this._element).one(m.TRANSITION_END,function(t){return e._hideModal(t)}).emulateTransitionEnd(o)}else this._hideModal()}}},t.dispose=function(){[window,this._element,this._dialog].forEach(function(t){return p(t).off(Je)}),p(document).off(nn.FOCUSIN),p.removeData(this._element,$e),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._isTransitioning=null,this._scrollbarWidth=null},t.handleUpdate=function(){this._adjustDialog()},t._getConfig=function(t){return t=l({},tn,t),m.typeCheckConfig(Ge,t,en),t},t._showElement=function(t){var e=this,n=p(this._element).hasClass(ln);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),p(this._dialog).hasClass(on)?this._dialog.querySelector(un).scrollTop=0:this._element.scrollTop=0,n&&m.reflow(this._element),p(this._element).addClass(cn),this._config.focus&&this._enforceFocus();var i=p.Event(nn.SHOWN,{relatedTarget:t}),o=function(){e._config.focus&&e._element.focus(),e._isTransitioning=!1,p(e._element).trigger(i)};if(n){var r=m.getTransitionDurationFromElement(this._dialog);p(this._dialog).one(m.TRANSITION_END,o).emulateTransitionEnd(r)}else o()},t._enforceFocus=function(){var e=this;p(document).off(nn.FOCUSIN).on(nn.FOCUSIN,function(t){document!==t.target&&e._element!==t.target&&0===p(e._element).has(t.target).length&&e._element.focus()})},t._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?p(this._element).on(nn.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown||p(this._element).off(nn.KEYDOWN_DISMISS)},t._setResizeEvent=function(){var e=this;this._isShown?p(window).on(nn.RESIZE,function(t){return e.handleUpdate(t)}):p(window).off(nn.RESIZE)},t._hideModal=function(){var t=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._isTransitioning=!1,this._showBackdrop(function(){p(document.body).removeClass(an),t._resetAdjustments(),t._resetScrollbar(),p(t._element).trigger(nn.HIDDEN)})},t._removeBackdrop=function(){this._backdrop&&(p(this._backdrop).remove(),this._backdrop=null)},t._showBackdrop=function(t){var e=this,n=p(this._element).hasClass(ln)?ln:"";if(this._isShown&&this._config.backdrop){if(this._backdrop=document.createElement("div"),this._backdrop.className=sn,n&&this._backdrop.classList.add(n),p(this._backdrop).appendTo(document.body),p(this._element).on(nn.CLICK_DISMISS,function(t){e._ignoreBackdropClick?e._ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"===e._config.backdrop?e._element.focus():e.hide())}),n&&m.reflow(this._backdrop),p(this._backdrop).addClass(cn),!t)return;if(!n)return void t();var i=m.getTransitionDurationFromElement(this._backdrop);p(this._backdrop).one(m.TRANSITION_END,t).emulateTransitionEnd(i)}else if(!this._isShown&&this._backdrop){p(this._backdrop).removeClass(cn);var o=function(){e._removeBackdrop(),t&&t()};if(p(this._element).hasClass(ln)){var r=m.getTransitionDurationFromElement(this._backdrop);p(this._backdrop).one(m.TRANSITION_END,o).emulateTransitionEnd(r)}else o()}else t&&t()},t._adjustDialog=function(){var t=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},t._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},t._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},t._setScrollbar=function(){var o=this;if(this._isBodyOverflowing){var t=[].slice.call(document.querySelectorAll(pn)),e=[].slice.call(document.querySelectorAll(mn));p(t).each(function(t,e){var n=e.style.paddingRight,i=p(e).css("padding-right");p(e).data("padding-right",n).css("padding-right",parseFloat(i)+o._scrollbarWidth+"px")}),p(e).each(function(t,e){var n=e.style.marginRight,i=p(e).css("margin-right");p(e).data("margin-right",n).css("margin-right",parseFloat(i)-o._scrollbarWidth+"px")});var n=document.body.style.paddingRight,i=p(document.body).css("padding-right");p(document.body).data("padding-right",n).css("padding-right",parseFloat(i)+this._scrollbarWidth+"px")}p(document.body).addClass(an)},t._resetScrollbar=function(){var t=[].slice.call(document.querySelectorAll(pn));p(t).each(function(t,e){var n=p(e).data("padding-right");p(e).removeData("padding-right"),e.style.paddingRight=n||""});var e=[].slice.call(document.querySelectorAll(""+mn));p(e).each(function(t,e){var n=p(e).data("margin-right");"undefined"!=typeof n&&p(e).css("margin-right",n).removeData("margin-right")});var n=p(document.body).data("padding-right");p(document.body).removeData("padding-right"),document.body.style.paddingRight=n||""},t._getScrollbarWidth=function(){var t=document.createElement("div");t.className=rn,document.body.appendChild(t);var e=t.getBoundingClientRect().width-t.clientWidth;return document.body.removeChild(t),e},o._jQueryInterface=function(n,i){return this.each(function(){var t=p(this).data($e),e=l({},tn,p(this).data(),"object"==typeof n&&n?n:{});if(t||(t=new o(this,e),p(this).data($e,t)),"string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n](i)}else e.show&&t.show(i)})},s(o,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"Default",get:function(){return tn}}]),o}();p(document).on(nn.CLICK_DATA_API,fn,function(t){var e,n=this,i=m.getSelectorFromElement(this);i&&(e=document.querySelector(i));var o=p(e).data($e)?"toggle":l({},p(e).data(),p(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||t.preventDefault();var r=p(e).one(nn.SHOW,function(t){t.isDefaultPrevented()||r.one(nn.HIDDEN,function(){p(n).is(":visible")&&n.focus()})});gn._jQueryInterface.call(p(e),o,this)}),p.fn[Ge]=gn._jQueryInterface,p.fn[Ge].Constructor=gn,p.fn[Ge].noConflict=function(){return p.fn[Ge]=Ze,gn._jQueryInterface};var _n=["background","cite","href","itemtype","longdesc","poster","src","xlink:href"],vn={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],div:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},yn=/^(?:(?:https?|mailto|ftp|tel|file):|[^&:/?#]*(?:[/?#]|$))/gi,En=/^data:(?:image\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\/(?:mpeg|mp4|ogg|webm)|audio\/(?:mp3|oga|ogg|opus));base64,[a-z0-9+/]+=*$/i;function bn(t,s,e){if(0===t.length)return t;if(e&&"function"==typeof e)return e(t);for(var n=(new window.DOMParser).parseFromString(t,"text/html"),a=Object.keys(s),l=[].slice.call(n.body.querySelectorAll("*")),i=function(t,e){var n=l[t],i=n.nodeName.toLowerCase();if(-1===a.indexOf(n.nodeName.toLowerCase()))return n.parentNode.removeChild(n),"continue";var o=[].slice.call(n.attributes),r=[].concat(s["*"]||[],s[i]||[]);o.forEach(function(t){(function(t,e){var n=t.nodeName.toLowerCase();if(-1!==e.indexOf(n))return-1===_n.indexOf(n)||Boolean(t.nodeValue.match(yn)||t.nodeValue.match(En));for(var i=e.filter(function(t){return t instanceof RegExp}),o=0,r=i.length;o<r;o++)if(n.match(i[o]))return!0;return!1})(t,r)||n.removeAttribute(t.nodeName)})},o=0,r=l.length;o<r;o++)i(o);return n.body.innerHTML}var wn="tooltip",Cn="bs.tooltip",Tn="."+Cn,Sn=p.fn[wn],Dn="bs-tooltip",In=new RegExp("(^|\\s)"+Dn+"\\S+","g"),An=["sanitize","whiteList","sanitizeFn"],On={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string|function)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)",sanitize:"boolean",sanitizeFn:"(null|function)",whiteList:"object"},Nn={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"},kn={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,selector:!1,placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent",sanitize:!0,sanitizeFn:null,whiteList:vn},Ln="show",xn="out",Pn={HIDE:"hide"+Tn,HIDDEN:"hidden"+Tn,SHOW:"show"+Tn,SHOWN:"shown"+Tn,INSERTED:"inserted"+Tn,CLICK:"click"+Tn,FOCUSIN:"focusin"+Tn,FOCUSOUT:"focusout"+Tn,MOUSEENTER:"mouseenter"+Tn,MOUSELEAVE:"mouseleave"+Tn},Hn="fade",jn="show",Rn=".tooltip-inner",Fn=".arrow",Mn="hover",Wn="focus",Un="click",Bn="manual",qn=function(){function i(t,e){if("undefined"==typeof be)throw new TypeError("Bootstrap's tooltips require Popper.js (https://popper.js.org/)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var t=i.prototype;return t.enable=function(){this._isEnabled=!0},t.disable=function(){this._isEnabled=!1},t.toggleEnabled=function(){this._isEnabled=!this._isEnabled},t.toggle=function(t){if(this._isEnabled)if(t){var e=this.constructor.DATA_KEY,n=p(t.currentTarget).data(e);n||(n=new this.constructor(t.currentTarget,this._getDelegateConfig()),p(t.currentTarget).data(e,n)),n._activeTrigger.click=!n._activeTrigger.click,n._isWithActiveTrigger()?n._enter(null,n):n._leave(null,n)}else{if(p(this.getTipElement()).hasClass(jn))return void this._leave(null,this);this._enter(null,this)}},t.dispose=function(){clearTimeout(this._timeout),p.removeData(this.element,this.constructor.DATA_KEY),p(this.element).off(this.constructor.EVENT_KEY),p(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&p(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,(this._activeTrigger=null)!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},t.show=function(){var e=this;if("none"===p(this.element).css("display"))throw new Error("Please use show on visible elements");var t=p.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){p(this.element).trigger(t);var n=m.findShadowRoot(this.element),i=p.contains(null!==n?n:this.element.ownerDocument.documentElement,this.element);if(t.isDefaultPrevented()||!i)return;var o=this.getTipElement(),r=m.getUID(this.constructor.NAME);o.setAttribute("id",r),this.element.setAttribute("aria-describedby",r),this.setContent(),this.config.animation&&p(o).addClass(Hn);var s="function"==typeof this.config.placement?this.config.placement.call(this,o,this.element):this.config.placement,a=this._getAttachment(s);this.addAttachmentClass(a);var l=this._getContainer();p(o).data(this.constructor.DATA_KEY,this),p.contains(this.element.ownerDocument.documentElement,this.tip)||p(o).appendTo(l),p(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new be(this.element,o,{placement:a,modifiers:{offset:this._getOffset(),flip:{behavior:this.config.fallbackPlacement},arrow:{element:Fn},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){return e._handlePopperPlacementChange(t)}}),p(o).addClass(jn),"ontouchstart"in document.documentElement&&p(document.body).children().on("mouseover",null,p.noop);var c=function(){e.config.animation&&e._fixTransition();var t=e._hoverState;e._hoverState=null,p(e.element).trigger(e.constructor.Event.SHOWN),t===xn&&e._leave(null,e)};if(p(this.tip).hasClass(Hn)){var h=m.getTransitionDurationFromElement(this.tip);p(this.tip).one(m.TRANSITION_END,c).emulateTransitionEnd(h)}else c()}},t.hide=function(t){var e=this,n=this.getTipElement(),i=p.Event(this.constructor.Event.HIDE),o=function(){e._hoverState!==Ln&&n.parentNode&&n.parentNode.removeChild(n),e._cleanTipClass(),e.element.removeAttribute("aria-describedby"),p(e.element).trigger(e.constructor.Event.HIDDEN),null!==e._popper&&e._popper.destroy(),t&&t()};if(p(this.element).trigger(i),!i.isDefaultPrevented()){if(p(n).removeClass(jn),"ontouchstart"in document.documentElement&&p(document.body).children().off("mouseover",null,p.noop),this._activeTrigger[Un]=!1,this._activeTrigger[Wn]=!1,this._activeTrigger[Mn]=!1,p(this.tip).hasClass(Hn)){var r=m.getTransitionDurationFromElement(n);p(n).one(m.TRANSITION_END,o).emulateTransitionEnd(r)}else o();this._hoverState=""}},t.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},t.isWithContent=function(){return Boolean(this.getTitle())},t.addAttachmentClass=function(t){p(this.getTipElement()).addClass(Dn+"-"+t)},t.getTipElement=function(){return this.tip=this.tip||p(this.config.template)[0],this.tip},t.setContent=function(){var t=this.getTipElement();this.setElementContent(p(t.querySelectorAll(Rn)),this.getTitle()),p(t).removeClass(Hn+" "+jn)},t.setElementContent=function(t,e){"object"!=typeof e||!e.nodeType&&!e.jquery?this.config.html?(this.config.sanitize&&(e=bn(e,this.config.whiteList,this.config.sanitizeFn)),t.html(e)):t.text(e):this.config.html?p(e).parent().is(t)||t.empty().append(e):t.text(p(e).text())},t.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},t._getOffset=function(){var e=this,t={};return"function"==typeof this.config.offset?t.fn=function(t){return t.offsets=l({},t.offsets,e.config.offset(t.offsets,e.element)||{}),t}:t.offset=this.config.offset,t},t._getContainer=function(){return!1===this.config.container?document.body:m.isElement(this.config.container)?p(this.config.container):p(document).find(this.config.container)},t._getAttachment=function(t){return Nn[t.toUpperCase()]},t._setListeners=function(){var i=this;this.config.trigger.split(" ").forEach(function(t){if("click"===t)p(i.element).on(i.constructor.Event.CLICK,i.config.selector,function(t){return i.toggle(t)});else if(t!==Bn){var e=t===Mn?i.constructor.Event.MOUSEENTER:i.constructor.Event.FOCUSIN,n=t===Mn?i.constructor.Event.MOUSELEAVE:i.constructor.Event.FOCUSOUT;p(i.element).on(e,i.config.selector,function(t){return i._enter(t)}).on(n,i.config.selector,function(t){return i._leave(t)})}}),p(this.element).closest(".modal").on("hide.bs.modal",function(){i.element&&i.hide()}),this.config.selector?this.config=l({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},t._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},t._enter=function(t,e){var n=this.constructor.DATA_KEY;(e=e||p(t.currentTarget).data(n))||(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),p(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusin"===t.type?Wn:Mn]=!0),p(e.getTipElement()).hasClass(jn)||e._hoverState===Ln?e._hoverState=Ln:(clearTimeout(e._timeout),e._hoverState=Ln,e.config.delay&&e.config.delay.show?e._timeout=setTimeout(function(){e._hoverState===Ln&&e.show()},e.config.delay.show):e.show())},t._leave=function(t,e){var n=this.constructor.DATA_KEY;(e=e||p(t.currentTarget).data(n))||(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),p(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusout"===t.type?Wn:Mn]=!1),e._isWithActiveTrigger()||(clearTimeout(e._timeout),e._hoverState=xn,e.config.delay&&e.config.delay.hide?e._timeout=setTimeout(function(){e._hoverState===xn&&e.hide()},e.config.delay.hide):e.hide())},t._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},t._getConfig=function(t){var e=p(this.element).data();return Object.keys(e).forEach(function(t){-1!==An.indexOf(t)&&delete e[t]}),"number"==typeof(t=l({},this.constructor.Default,e,"object"==typeof t&&t?t:{})).delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),m.typeCheckConfig(wn,t,this.constructor.DefaultType),t.sanitize&&(t.template=bn(t.template,t.whiteList,t.sanitizeFn)),t},t._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},t._cleanTipClass=function(){var t=p(this.getTipElement()),e=t.attr("class").match(In);null!==e&&e.length&&t.removeClass(e.join(""))},t._handlePopperPlacementChange=function(t){var e=t.instance;this.tip=e.popper,this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},t._fixTransition=function(){var t=this.getTipElement(),e=this.config.animation;null===t.getAttribute("x-placement")&&(p(t).removeClass(Hn),this.config.animation=!1,this.hide(),this.show(),this.config.animation=e)},i._jQueryInterface=function(n){return this.each(function(){var t=p(this).data(Cn),e="object"==typeof n&&n;if((t||!/dispose|hide/.test(n))&&(t||(t=new i(this,e),p(this).data(Cn,t)),"string"==typeof n)){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"Default",get:function(){return kn}},{key:"NAME",get:function(){return wn}},{key:"DATA_KEY",get:function(){return Cn}},{key:"Event",get:function(){return Pn}},{key:"EVENT_KEY",get:function(){return Tn}},{key:"DefaultType",get:function(){return On}}]),i}();p.fn[wn]=qn._jQueryInterface,p.fn[wn].Constructor=qn,p.fn[wn].noConflict=function(){return p.fn[wn]=Sn,qn._jQueryInterface};var Kn="popover",Qn="bs.popover",Vn="."+Qn,Yn=p.fn[Kn],zn="bs-popover",Xn=new RegExp("(^|\\s)"+zn+"\\S+","g"),Gn=l({},qn.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),$n=l({},qn.DefaultType,{content:"(string|element|function)"}),Jn="fade",Zn="show",ti=".popover-header",ei=".popover-body",ni={HIDE:"hide"+Vn,HIDDEN:"hidden"+Vn,SHOW:"show"+Vn,SHOWN:"shown"+Vn,INSERTED:"inserted"+Vn,CLICK:"click"+Vn,FOCUSIN:"focusin"+Vn,FOCUSOUT:"focusout"+Vn,MOUSEENTER:"mouseenter"+Vn,MOUSELEAVE:"mouseleave"+Vn},ii=function(t){var e,n;function i(){return t.apply(this,arguments)||this}n=t,(e=i).prototype=Object.create(n.prototype),(e.prototype.constructor=e).__proto__=n;var o=i.prototype;return o.isWithContent=function(){return this.getTitle()||this._getContent()},o.addAttachmentClass=function(t){p(this.getTipElement()).addClass(zn+"-"+t)},o.getTipElement=function(){return this.tip=this.tip||p(this.config.template)[0],this.tip},o.setContent=function(){var t=p(this.getTipElement());this.setElementContent(t.find(ti),this.getTitle());var e=this._getContent();"function"==typeof e&&(e=e.call(this.element)),this.setElementContent(t.find(ei),e),t.removeClass(Jn+" "+Zn)},o._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},o._cleanTipClass=function(){var t=p(this.getTipElement()),e=t.attr("class").match(Xn);null!==e&&0<e.length&&t.removeClass(e.join(""))},i._jQueryInterface=function(n){return this.each(function(){var t=p(this).data(Qn),e="object"==typeof n?n:null;if((t||!/dispose|hide/.test(n))&&(t||(t=new i(this,e),p(this).data(Qn,t)),"string"==typeof n)){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"Default",get:function(){return Gn}},{key:"NAME",get:function(){return Kn}},{key:"DATA_KEY",get:function(){return Qn}},{key:"Event",get:function(){return ni}},{key:"EVENT_KEY",get:function(){return Vn}},{key:"DefaultType",get:function(){return $n}}]),i}(qn);p.fn[Kn]=ii._jQueryInterface,p.fn[Kn].Constructor=ii,p.fn[Kn].noConflict=function(){return p.fn[Kn]=Yn,ii._jQueryInterface};var oi="scrollspy",ri="bs.scrollspy",si="."+ri,ai=p.fn[oi],li={offset:10,method:"auto",target:""},ci={offset:"number",method:"string",target:"(string|element)"},hi={ACTIVATE:"activate"+si,SCROLL:"scroll"+si,LOAD_DATA_API:"load"+si+".data-api"},ui="dropdown-item",fi="active",di='[data-spy="scroll"]',pi=".nav, .list-group",mi=".nav-link",gi=".nav-item",_i=".list-group-item",vi=".dropdown",yi=".dropdown-item",Ei=".dropdown-toggle",bi="offset",wi="position",Ci=function(){function n(t,e){var n=this;this._element=t,this._scrollElement="BODY"===t.tagName?window:t,this._config=this._getConfig(e),this._selector=this._config.target+" "+mi+","+this._config.target+" "+_i+","+this._config.target+" "+yi,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,p(this._scrollElement).on(hi.SCROLL,function(t){return n._process(t)}),this.refresh(),this._process()}var t=n.prototype;return t.refresh=function(){var e=this,t=this._scrollElement===this._scrollElement.window?bi:wi,o="auto"===this._config.method?t:this._config.method,r=o===wi?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),[].slice.call(document.querySelectorAll(this._selector)).map(function(t){var e,n=m.getSelectorFromElement(t);if(n&&(e=document.querySelector(n)),e){var i=e.getBoundingClientRect();if(i.width||i.height)return[p(e)[o]().top+r,n]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},t.dispose=function(){p.removeData(this._element,ri),p(this._scrollElement).off(si),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},t._getConfig=function(t){if("string"!=typeof(t=l({},li,"object"==typeof t&&t?t:{})).target){var e=p(t.target).attr("id");e||(e=m.getUID(oi),p(t.target).attr("id",e)),t.target="#"+e}return m.typeCheckConfig(oi,t,ci),t},t._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},t._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},t._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},t._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),n<=t){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t<this._offsets[0]&&0<this._offsets[0])return this._activeTarget=null,void this._clear();for(var o=this._offsets.length;o--;){this._activeTarget!==this._targets[o]&&t>=this._offsets[o]&&("undefined"==typeof this._offsets[o+1]||t<this._offsets[o+1])&&this._activate(this._targets[o])}}},t._activate=function(e){this._activeTarget=e,this._clear();var t=this._selector.split(",").map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'}),n=p([].slice.call(document.querySelectorAll(t.join(","))));n.hasClass(ui)?(n.closest(vi).find(Ei).addClass(fi),n.addClass(fi)):(n.addClass(fi),n.parents(pi).prev(mi+", "+_i).addClass(fi),n.parents(pi).prev(gi).children(mi).addClass(fi)),p(this._scrollElement).trigger(hi.ACTIVATE,{relatedTarget:e})},t._clear=function(){[].slice.call(document.querySelectorAll(this._selector)).filter(function(t){return t.classList.contains(fi)}).forEach(function(t){return t.classList.remove(fi)})},n._jQueryInterface=function(e){return this.each(function(){var t=p(this).data(ri);if(t||(t=new n(this,"object"==typeof e&&e),p(this).data(ri,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},s(n,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"Default",get:function(){return li}}]),n}();p(window).on(hi.LOAD_DATA_API,function(){for(var t=[].slice.call(document.querySelectorAll(di)),e=t.length;e--;){var n=p(t[e]);Ci._jQueryInterface.call(n,n.data())}}),p.fn[oi]=Ci._jQueryInterface,p.fn[oi].Constructor=Ci,p.fn[oi].noConflict=function(){return p.fn[oi]=ai,Ci._jQueryInterface};var Ti="bs.tab",Si="."+Ti,Di=p.fn.tab,Ii={HIDE:"hide"+Si,HIDDEN:"hidden"+Si,SHOW:"show"+Si,SHOWN:"shown"+Si,CLICK_DATA_API:"click"+Si+".data-api"},Ai="dropdown-menu",Oi="active",Ni="disabled",ki="fade",Li="show",xi=".dropdown",Pi=".nav, .list-group",Hi=".active",ji="> li > .active",Ri='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',Fi=".dropdown-toggle",Mi="> .dropdown-menu .active",Wi=function(){function i(t){this._element=t}var t=i.prototype;return t.show=function(){var n=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&p(this._element).hasClass(Oi)||p(this._element).hasClass(Ni))){var t,i,e=p(this._element).closest(Pi)[0],o=m.getSelectorFromElement(this._element);if(e){var r="UL"===e.nodeName||"OL"===e.nodeName?ji:Hi;i=(i=p.makeArray(p(e).find(r)))[i.length-1]}var s=p.Event(Ii.HIDE,{relatedTarget:this._element}),a=p.Event(Ii.SHOW,{relatedTarget:i});if(i&&p(i).trigger(s),p(this._element).trigger(a),!a.isDefaultPrevented()&&!s.isDefaultPrevented()){o&&(t=document.querySelector(o)),this._activate(this._element,e);var l=function(){var t=p.Event(Ii.HIDDEN,{relatedTarget:n._element}),e=p.Event(Ii.SHOWN,{relatedTarget:i});p(i).trigger(t),p(n._element).trigger(e)};t?this._activate(t,t.parentNode,l):l()}}},t.dispose=function(){p.removeData(this._element,Ti),this._element=null},t._activate=function(t,e,n){var i=this,o=(!e||"UL"!==e.nodeName&&"OL"!==e.nodeName?p(e).children(Hi):p(e).find(ji))[0],r=n&&o&&p(o).hasClass(ki),s=function(){return i._transitionComplete(t,o,n)};if(o&&r){var a=m.getTransitionDurationFromElement(o);p(o).removeClass(Li).one(m.TRANSITION_END,s).emulateTransitionEnd(a)}else s()},t._transitionComplete=function(t,e,n){if(e){p(e).removeClass(Oi);var i=p(e.parentNode).find(Mi)[0];i&&p(i).removeClass(Oi),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!1)}if(p(t).addClass(Oi),"tab"===t.getAttribute("role")&&t.setAttribute("aria-selected",!0),m.reflow(t),t.classList.contains(ki)&&t.classList.add(Li),t.parentNode&&p(t.parentNode).hasClass(Ai)){var o=p(t).closest(xi)[0];if(o){var r=[].slice.call(o.querySelectorAll(Fi));p(r).addClass(Oi)}t.setAttribute("aria-expanded",!0)}n&&n()},i._jQueryInterface=function(n){return this.each(function(){var t=p(this),e=t.data(Ti);if(e||(e=new i(this),t.data(Ti,e)),"string"==typeof n){if("undefined"==typeof e[n])throw new TypeError('No method named "'+n+'"');e[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.3.1"}}]),i}();p(document).on(Ii.CLICK_DATA_API,Ri,function(t){t.preventDefault(),Wi._jQueryInterface.call(p(this),"show")}),p.fn.tab=Wi._jQueryInterface,p.fn.tab.Constructor=Wi,p.fn.tab.noConflict=function(){return p.fn.tab=Di,Wi._jQueryInterface};var Ui="toast",Bi="bs.toast",qi="."+Bi,Ki=p.fn[Ui],Qi={CLICK_DISMISS:"click.dismiss"+qi,HIDE:"hide"+qi,HIDDEN:"hidden"+qi,SHOW:"show"+qi,SHOWN:"shown"+qi},Vi="fade",Yi="hide",zi="show",Xi="showing",Gi={animation:"boolean",autohide:"boolean",delay:"number"},$i={animation:!0,autohide:!0,delay:500},Ji='[data-dismiss="toast"]',Zi=function(){function i(t,e){this._element=t,this._config=this._getConfig(e),this._timeout=null,this._setListeners()}var t=i.prototype;return t.show=function(){var t=this;p(this._element).trigger(Qi.SHOW),this._config.animation&&this._element.classList.add(Vi);var e=function(){t._element.classList.remove(Xi),t._element.classList.add(zi),p(t._element).trigger(Qi.SHOWN),t._config.autohide&&t.hide()};if(this._element.classList.remove(Yi),this._element.classList.add(Xi),this._config.animation){var n=m.getTransitionDurationFromElement(this._element);p(this._element).one(m.TRANSITION_END,e).emulateTransitionEnd(n)}else e()},t.hide=function(t){var e=this;this._element.classList.contains(zi)&&(p(this._element).trigger(Qi.HIDE),t?this._close():this._timeout=setTimeout(function(){e._close()},this._config.delay))},t.dispose=function(){clearTimeout(this._timeout),this._timeout=null,this._element.classList.contains(zi)&&this._element.classList.remove(zi),p(this._element).off(Qi.CLICK_DISMISS),p.removeData(this._element,Bi),this._element=null,this._config=null},t._getConfig=function(t){return t=l({},$i,p(this._element).data(),"object"==typeof t&&t?t:{}),m.typeCheckConfig(Ui,t,this.constructor.DefaultType),t},t._setListeners=function(){var t=this;p(this._element).on(Qi.CLICK_DISMISS,Ji,function(){return t.hide(!0)})},t._close=function(){var t=this,e=function(){t._element.classList.add(Yi),p(t._element).trigger(Qi.HIDDEN)};if(this._element.classList.remove(zi),this._config.animation){var n=m.getTransitionDurationFromElement(this._element);p(this._element).one(m.TRANSITION_END,e).emulateTransitionEnd(n)}else e()},i._jQueryInterface=function(n){return this.each(function(){var t=p(this),e=t.data(Bi);if(e||(e=new i(this,"object"==typeof n&&n),t.data(Bi,e)),"string"==typeof n){if("undefined"==typeof e[n])throw new TypeError('No method named "'+n+'"');e[n](this)}})},s(i,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"DefaultType",get:function(){return Gi}},{key:"Default",get:function(){return $i}}]),i}();p.fn[Ui]=Zi._jQueryInterface,p.fn[Ui].Constructor=Zi,p.fn[Ui].noConflict=function(){return p.fn[Ui]=Ki,Zi._jQueryInterface},function(){if("undefined"==typeof p)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var t=p.fn.jquery.split(" ")[0].split(".");if(t[0]<2&&t[1]<9||1===t[0]&&9===t[1]&&t[2]<1||4<=t[0])throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(),t.Util=m,t.Alert=g,t.Button=k,t.Carousel=at,t.Collapse=Ct,t.Dropdown=Xe,t.Modal=gn,t.Popover=ii,t.Scrollspy=Ci,t.Tab=Wi,t.Toast=Zi,t.Tooltip=qn,Object.defineProperty(t,"__esModule",{value:!0})});
//# sourceMappingURL=bootstrap.bundle.min.js.map
</script>
<script type="text/javascript">
// set tested on
var now = new Date();
var dt = new Date(now.getFullYear(), now.getMonth(), now.getDate(), now.getHours() - 2, now.getMinutes());
var dtstr = dt.toLocaleDateString("de-AT") + " " + dt.toLocaleTimeString("de-AT").substr(0, 5);
document.getElementById("testedOn").innerHTML = dtstr;
var dtValid = new Date(now.getFullYear(), now.getMonth(), now.getDate() + 1, now.getHours() - 2, now.getMinutes());
var dtValidStr = dtValid.toLocaleDateString("de-AT") + " " + dtValid.toLocaleTimeString("de-AT").substr(0, 5);
document.getElementById("validUntil").innerHTML = dtValidStr;
</script>
</body>
</html>